| Patents for C07D 471 - Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups (64,559) |
|---|
| 07/02/2009 | US20090170847 Imidazopyridine Derivatives Inhibiting Protein Kinase Activity, Method for the Preparation Thereof and Pharmaceutical Composition Containing Same |
| 07/02/2009 | US20090170846 Inhibitors of the hiv integrase enzyme |
| 07/02/2009 | US20090170836 New inhibitors of histone deacetylase |
| 07/02/2009 | US20090170834 Fused Pyrimidones and Thiopyrimidones, and Uses Thereof |
| 07/02/2009 | US20090170812 Transcription factor modulating compounds and methods of use thereof |
| 07/02/2009 | US20090169567 Basic group-containing compound and use thereof |
| 07/02/2009 | US20090169479 Compounds Comprising Short Aminoalcohol Chains and Metal Complexes for Medical Imgaing |
| 07/02/2009 | US20090166614 Fluorinated rylenetetracarboxylic acid derivatives and use thereof |
| 07/02/2009 | US20090165848 Quinacridine Derivatives and Organic Electronic Devices Using the Same |
| 07/02/2009 | DE102007063051A1 New perylene bisimide compounds useful as pigments for glue-, aquarel- and water- colors, for mass coloring of polymers, preferably e.g. polyvinyl chloride, polyacrylic acid and/or their copolymers and in display elements of sign boards |
| 07/02/2009 | CA2710335A1 Substituted imidazopyridine derivatives as melanocortin-4 receptor antagonists |
| 07/02/2009 | CA2710109A1 Dipeptidyl peptidase-iv inhibiting compounds, methods of preparing the same, and pharmaceutical compositions containing the same as active agent |
| 07/02/2009 | CA2710016A1 Translocator protein ligands |
| 07/02/2009 | CA2709650A1 4-amino-pyrimidine derivatives |
| 07/02/2009 | CA2709536A1 Indazolyl, benzimidazolyl, benzotriazolyl substituted indolinone derivatives as kinase inhibitors useful in the treatment of cancer |
| 07/02/2009 | CA2709514A1 Bicyclic derivatives for use in the treatment of androgen receptor associated conditions |
| 07/02/2009 | CA2709348A1 Heterocyclic antiviral compounds |
| 07/02/2009 | CA2708314A1 Process for the preparation of pyrido [2,1-a] isoquinoline derivatives |
| 07/02/2009 | CA2708312A1 Spiroindolinone derivatives as anticancer agents |
| 07/01/2009 | EP2074998A2 Use of cyclic bioisosteres of purine system derivatives for the treatment of diseases caused by disorders of nitrergic and dopaminergic systems |
| 07/01/2009 | EP2074125A1 Phenylacetamides useful as protein kinase inhibitors |
| 07/01/2009 | EP2074124A1 3- (benzo [d][1,3]dioxol-5-ylmethyl) -4- (thio) oxo-2- (thio) oxo-azolidin-5-ylidene derivatives as antibacterial agents |
| 07/01/2009 | EP2074123A1 Novel anxiolytic compounds |
| 07/01/2009 | EP2074122A1 Pyrido (2, 3-d) pyrimidin0ne compounds and their use as pi3 inhibitors |
| 07/01/2009 | EP2074121A1 Chymase inhibitors |
| 07/01/2009 | EP2074115A1 N3-heteroaryl substituted triazoles and n5-heteroaryl substituted triazoles useful as axl inhibitors |
| 07/01/2009 | EP2074075A1 Condensed ring aromatic compound for organic light-emitting device and organic light-emitting device having the same |
| 07/01/2009 | EP2073807A1 Pharmaceutical combinations |
| 07/01/2009 | EP1747221B1 Fused ring nk1 antagonists |
| 07/01/2009 | EP1686999B1 Pyrazole derivatives as inhibitors of receptor tyrosine kinases |
| 07/01/2009 | EP1576159B1 The gene cluster involved in safracin biosynthesis and its uses for genetic engineering |
| 07/01/2009 | EP1226127B1 Substituted phenyl sulfamoyl carboxamides |
| 07/01/2009 | CN101472924A KV1.5 potassium channel inhibitors |
| 07/01/2009 | CN101472923A Novel compound having affinity to amyloid |
| 07/01/2009 | CN101468988A Piperazine derivative, preparation thereof and use thereof in medicine |
| 07/01/2009 | CN100506821C Tetrahydropyridoethers |
| 07/01/2009 | CN100506815C Piperidinyl targeting compounds that selectively bind integrins |
| 07/01/2009 | CN100506801C Inhibitors of glycogen synthase kinase 3 |
| 06/30/2009 | US7553966 Glucocorticoid mimetics, methods of making them, pharmaceutical compositions, and uses thereof |
| 06/30/2009 | US7553848 Vanilloid receptor ligands and their use in treatments |
| 06/30/2009 | US7553847 Treating obsessive-compulsive disorder, acute stress disorder, post traumatic stress disorder, social anxiety disorder, somatization disorder; 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxo-hexyl)-1-isoindolinone |
| 06/30/2009 | US7553845 1-Methoxy-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-6-yl]carboxamide; angiogenesis inhibitors; antitumor, -carcinogenic, and metastasis agent; rheumatic diseases; antiarthritic agents; atherosclerosis; retenosis; leukemia; cardiotonic agents; imflammatory bowel disease; obesity; antidiabetic agents |
| 06/30/2009 | US7553841 Amino cyclobutylamide modulators of chemokine receptor activity |
| 06/30/2009 | US7553837 Phenylazole compounds production process and antioxidants |
| 06/25/2009 | WO2009078423A1 Fused tricyclic compound having aldose reductase inhibitory activity |
| 06/25/2009 | WO2009078253A1 Trisazo compound, ink composition, recording method and colored body |
| 06/25/2009 | WO2009077989A1 5-aminocyclylmethyl-oxazolidin-2-one derivatives |
| 06/25/2009 | WO2009077766A1 Pyrido[2,3-b]pyrazine-8-substituted compounds and their use |
| 06/25/2009 | WO2009077551A1 Process for preparing risperidone |
| 06/25/2009 | WO2009077334A1 Novel imidazo[1,2-a]pyridine and imidazo[1,2-b]pyridazine derivatives |
| 06/25/2009 | WO2009060297A3 An improved process for the preparation of paliperidone and its intermediates |
| 06/25/2009 | WO2008046084A3 Spiroheterocyclic compounds and their uses as therapeutic agents |
| 06/25/2009 | US20090163718 PROCESS FOR THE PREPARATION OF PYRIDO[2,1-a] ISOQUINOLINE DERIVATIVES |
| 06/25/2009 | US20090163716 Spirocyclic cyclohexane compounds |
| 06/25/2009 | US20090163555 Isolated optically active stereoisomers are useful for enhancing an immuneresponse, for treating autoimmune diseases and asantitumor agents, bacteriacides, fungicides or viricides; one pot synthesis of1-(3-a3S,5R-1-(3-amino-5-carboxy-2-oxopyrrolidin-3-ylmethyl)pyridinium bromide hydrobromide |
| 06/25/2009 | US20090163539 Enantiomer of tenatoprazole and the use thereof in therapy |
| 06/25/2009 | US20090163535 Substituted Heteroarylalkanoic Acids |
| 06/25/2009 | US20090163534 Indolizine Derivatives |
| 06/25/2009 | US20090163533 1-Substituted Pyrazolo (3,4-C) Ring Compounds as Modulators of Cytokine Biosynthesis for the Treatment of Viral Infections and Neoplastic Diseases |
| 06/25/2009 | US20090163522 Derivatives of Pyrido[2,3-d]pyrimidine, the Preparation Thereof, and the Therapeutic Application of the Same |
| 06/25/2009 | US20090163512 Spiroindolinone Derivatives |
| 06/25/2009 | US20090163511 Carboxamide, Sulfonamide and Amine Compounds and Methods for Using The Same |
| 06/25/2009 | US20090163488 Fused heterocycle derivatives and use thereof |
| 06/25/2009 | US20090162432 Stable laquinimod preparations |
| 06/25/2009 | US20090162289 A tetrapyrollic photosensitizer compound with one pendant CH2CH2CON(CH2CON(CH2COOH)2)2 or N(CH2COOH)2 group, being a chlorin, bacteriochlorin, porphyrin, pyropheophorbide, purpurinimide, or bacteriopurpurinimide; water soluble photosensitizing and imaging compounds; hyperproliferative tissue |
| 06/25/2009 | DE102007061764A1 Anellierte Cyanopyridine und ihre Verwendung Fused cyanopyridines and their use |
| 06/25/2009 | DE102007061763A1 Substituierte azabicyclische Verbindungen und ihre Verwendung Substituted azabicyclic compounds and their use |
| 06/25/2009 | DE102007061307A1 New naphthalenetetracarboxylic imide compounds useful e.g. as pigments for glue-, aquarelle- and water- colors, for the mass-pigmentation of polymers, and in optical memory devices, preferably compact disc or digital versatile disc |
| 06/25/2009 | CA2709257A1 Pyrido[2,3-b]pyrazine-8-substituted compounds and their use |
| 06/25/2009 | CA2708361A1 Novel imidazo[1,2-a]pyridine and imidazo[1,2-b]pyridazine derivatives |
| 06/25/2009 | CA2706837A1 5-aminocyclylmethyl-oxazolidin-2-one derivatives |
| 06/24/2009 | EP2072517A1 Asymmetric phenanthrolins, method for their manufacture and doped organic semiconductor material containing them |
| 06/24/2009 | EP2072516A1 Substituted imidazopyridine derivates as Melancortin-4 receptor antagonists |
| 06/24/2009 | EP1954698B1 Spirocyclic compounds as hdac inhibitors |
| 06/24/2009 | EP1948654B1 5-amino-4-hydroxy-7- (imidazo [1,2-a] pyridin-6- ylmethyl)-8-methyl-nonamide derivatives and related compounds as renin inhibitors for the treatment of hypertension |
| 06/24/2009 | EP1863812A4 Dipeptidyl peptidase-iv inhibiting compounds, methods of preparing the same, and pharmaceutical compositions containing the same as an active agent |
| 06/24/2009 | CN101466711A Novel compound having affinity for amyloid |
| 06/24/2009 | CN101463032A 4,5- dihydro-[1,2,4]- triazole [4,3-a] quinoline derivatives used as positive inotropic medicament |
| 06/24/2009 | CN101461804A (+)-1-(3,4-dichlorrophenyl)-3-azabicyclo[3.1.0]hexane, compositions and uses thereof |
| 06/24/2009 | CN100503608C Deazapurines and uses thereof |
| 06/24/2009 | CN100503607C Yageine derivative compounds and their uses |
| 06/24/2009 | CN100503599C Carbonylamino-derivatives as novel inhibitors of histone deacetylase |
| 06/24/2009 | CN100503580C Irreversible inhibitor of tyrosine kinase |
| 06/24/2009 | CN100503574C Substituted ideno[1,2-c]isoquinoline derivatives and methods of use thereof |
| 06/23/2009 | US7550594 Excellent as an electron transporting layer as well as a light emitting layer; can be prepared by using a vacuum evaporation process, casting process or the like; devices having a large area can be prepared easily at a relatively low cost |
| 06/23/2009 | US7550590 Such as 2-[2-(3-Amino-piperidin-1-yl)4-oxo-4H-quinazolin-3-ylmethyl]-benzonitrile; type 2 diabetes mellitus, diabetic dislipidemia, impaired glucose tolerance |
| 06/23/2009 | US7550589 6-(2-alkyl-phenyl)-pyrido[2,3-D]pyrimidines useful as protein kinase inhibitors |
| 06/23/2009 | US7550499 Urea antagonists of P2Y1 receptor useful in the treatment of thrombotic conditions |
| 06/23/2009 | US7550492 Cholecystokinin (CCK2) receptor modulators; e.g. 2-(Benzo[1,2,5]thiadiazole-4sulfonylamino)-4-fluoro-N-[1-(4-fluoro-phenyl)-ethyl]-N-methyl-benzamide; pancreatic adenocarcinoma, pain, eating disorders, gastro-esophageal reflux disease, ulcers, anxiety |
| 06/23/2009 | US7550489 N-[3-(4-chlorophenyl)-2-(3-cyanophenyl)-1-methylpropyl]-2-(5-trifluoromethyl-2-pyridyloxy)-2-methylpropanamide and phentermine, metformin, or bupropion; obesity; antipsychotic agents; synergistic; cannabinoid receptor antagonists |
| 06/23/2009 | US7550480 1,8-naphthyridin-2(1H)-ones; treating CSBP/p38 kinase mediated diseases; cytokine suppressive anti-inflammatory drugs |
| 06/23/2009 | US7550479 Modified Pictet-Spengler reaction and products prepared therefrom |
| 06/23/2009 | US7550477 Anticancer agents; initiasting mitosis which causes tumor cell death |
| 06/23/2009 | US7550476 Condensed polycyclic compounds |
| 06/23/2009 | US7550475 Use of phosphodiesterase 4 inhibitors such as 6,7-dimethoxy-1-[2-(1,3-dioxocyclohexan-2-yl)pyridin-4-yl]-2,3-bis(hydroxymethyl)naphthalene to treat asthma, chronic obstructive pulmonary disease, atopic dermatitis, allergic rhinitis, psoriasis, rheumatoid arthritis, septic shock, ulcerative colitis |
| 06/23/2009 | US7550473 Pyrimidine derivatives useful as inhibitors of PKC-theta |
| 06/23/2009 | US7550469 Heterocyclic amide derivatives and their use as dopamine D3 receptor ligands |
| 06/23/2009 | US7550464 Use of phosphodiesterase 4 inhibitors such as 8,9-dimethoxy-6-phenyl-1,3,4,6,11,11a-hexahydro-2H -pyrazino[1,2-b]isoquinoline for treating asthma, chronic obstructive pulmonary disease, atopic dermatitis, allergic rhinitis, psoriasis, rheumatoid arthritis, septic shock, ulcerative colitis |
| 06/23/2009 | US7550458 Tricycloundecane compounds useful as modulators of nuclear hormone receptor function |
| 06/23/2009 | US7550450 Prostate cancer treatment |