| Patents for C07D 471 - Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups (64,559) |
|---|
| 03/12/2009 | WO2009033084A1 Pyrazolo-pyridines as tyrosine kinase inhibitors |
| 03/12/2009 | WO2009032754A2 Heterocyclodiazepine cannabinoid receptor modulators for treatment of disease |
| 03/12/2009 | WO2009032703A1 2- (het) arylamino-6-aminopyridine derivatives and fused forms thereof as anaplastic lymphoma kinase inhibitors |
| 03/12/2009 | WO2009032125A1 2,3-substituted azaindole derivatives for treating viral infections |
| 03/12/2009 | WO2009030952A2 Phenylcarboxamide derivatives as inhibitors and effectors of the hedgehog pathway |
| 03/12/2009 | WO2009030831A2 Novel photochromic materials |
| 03/12/2009 | WO2009030725A2 Azaindoles as inhibitors of soluble adenylate cyclase |
| 03/12/2009 | WO2009030715A1 Arylsulfonylaminomethylphosphonic acid derivatives, the preparation thereof and the use thereof as pharmaceutical compositions |
| 03/12/2009 | WO2009030106A1 7-(4-oximino-3-amino-1-piperidyl)quinolinecarboxylic acid derivatives and their preparation methods |
| 03/12/2009 | WO2009006319A3 Ammosamides as anticancer agents |
| 03/12/2009 | WO2008145524A3 4,4-disubstituted piperidine derivatives |
| 03/12/2009 | WO2008014219A8 Thiozolidinedione derivatives as p13 kinase inhibitors |
| 03/12/2009 | WO2006122806A3 1,3-dihydro-imidazo [4,5-c] quinolin-2-ones as lipid kinase inhibitors |
| 03/12/2009 | US20090069564 Methods and Compositions for Selectin Inhibition |
| 03/12/2009 | US20090069432 Compounds, compositions and methods for the treatment of amyloid diseases and synucleinopathies such as alzheimer's disease, type 2 diabetes, and parkinson's disease |
| 03/12/2009 | US20090069368 Fgf-receptor agonist dimeric compounds |
| 03/12/2009 | US20090069347 2-phenoxy pyrimidinone analogues |
| 03/12/2009 | US20090069340 Pyrazolone Compounds As Metabotropic Glutamate Receptor Agonists For The Treatment Of Neurological And Psychiatric Disorders |
| 03/12/2009 | US20090069333 Fungicides |
| 03/12/2009 | US20090069319 Imidazopyridine analogs and their use as agonists of the wnt-beta-catenin cellular messaging system |
| 03/12/2009 | US20090069318 Novel Compounds |
| 03/12/2009 | US20090069316 Novel quinoline derivatives |
| 03/12/2009 | US20090069314 Hydroxyalkyl Substituted Imidazoquinoline Compounds and Methods |
| 03/12/2009 | US20090069299 Pyrazolo[3,4-c]Quinolines, Pyrazolo[3,4-c]Naphthyridines, Analogs Thereof, and Methods |
| 03/12/2009 | US20090069282 Alkyne compounds with mch antagonistic activity and medicaments comprising these compounds |
| 03/12/2009 | US20090068577 Naphthalenetetracarboxylic acid diimide derivative and electrophotographic photoconductor having the same |
| 03/12/2009 | CA2698753A1 Pyrazolo-pyridines as tyrosine kinase inhibitors |
| 03/12/2009 | CA2698486A1 Arylsulfonylaminomethylphosphonic acid derivatives, the preparation thereof and the use thereof as pharmaceutical compositions |
| 03/12/2009 | CA2697500A1 2,3-substituted azaindole derivatives for treating viral infections |
| 03/11/2009 | EP2033962A1 Tetracyclic indolopyridines as EG5 inhibitors |
| 03/11/2009 | EP2033961A1 Naphthalenetetracarboxylic acid diimide derivative and electrophotographic photoconductor having the same |
| 03/11/2009 | EP2033952A1 Nitrogen-containing Heteroaryl compounds having HIV Integrase Inhibitory Activity |
| 03/11/2009 | EP2033644A1 Spiroindene and spiroindane compounds |
| 03/11/2009 | EP2032577A1 Long wavelength shifted benzotriazole uv-absorbers and their use |
| 03/11/2009 | EP2032575A1 Novel 1,4-diaza-bicyclo[3.2.2]nonyl oxadiazolyl derivatives and their medical use |
| 03/11/2009 | EP2032574A1 Novel 1,4-diaza-bicyclo[3.2.2]nonyl oxadiazolyl derivatives and their medical use |
| 03/11/2009 | EP2032573A1 Substituted arylpyrazolopyridines and salts thereof, pharmaceutical compositions comprising same, methods of preparing same and uses of same |
| 03/11/2009 | EP2032572A1 Substituted aminopyrazolopyridines and salts thereof, their preparations and pharmaceutical compositions comprising them |
| 03/11/2009 | EP2032571A1 3 -amino-imidazo[1, 2-a]pyridine derivatives as sglt inhibitors |
| 03/11/2009 | EP2032535A1 Spirocyclic nitriles as protease inhibitors |
| 03/11/2009 | EP2032141A1 Inhibitors of janus kinases |
| 03/11/2009 | EP1919475B1 Tetrahydro- beta-carbolin-sulfonamide derivatives as 5-ht6 ligands |
| 03/11/2009 | EP1620440B1 Synthesis of substituted heterocyclic compounds |
| 03/11/2009 | EP1572689B1 Tetracyclic immunomodulatory compounds |
| 03/11/2009 | EP1485364B1 Aminocarbonyl-derivatives as novel inhibitors of histone deacetylase |
| 03/11/2009 | EP1317445B1 Chemokine receptor binding heterocyclic compounds |
| 03/11/2009 | CN101384604A Ethanol or 1,2-ethanediol cyclohexyl antibiotic derivatives |
| 03/11/2009 | CN101384593A 3-deazapurine derivatives as tlr7 modulators |
| 03/11/2009 | CN101384592A Anti-viral compounds |
| 03/11/2009 | CN101384591A Anti-viral compounds |
| 03/11/2009 | CN101384590A Oxazoloisoquinoline derivatives as thrombin receptor antagonists |
| 03/11/2009 | CN101384586A Pi-3 kinase inhibitors and methods of their use |
| 03/11/2009 | CN101384583A Azacyclyl-substituted aryldihydroisoquinolinones, process for their preparation and their use as medicaments |
| 03/11/2009 | CN101384555A Novel aminoalcohol-substituted aryldihydroisoquinolinones, process for their preparation and their use as medicaments |
| 03/11/2009 | CN101381368A Ethylenediamine schiff base type sweat fingerprint fluorescent reagent, synthesis and use thereof |
| 03/11/2009 | CN101381365A Dual action antibiotics |
| 03/11/2009 | CN100467468C Triaza-spiropiperidine derivatives for use as GLYT-1 inhibitors in the treatment of neurological and neuropsychiatric disorders |
| 03/11/2009 | CN100467467C 2,4-dioxopyrimidine-based mesoionic pigments |
| 03/11/2009 | CN100467447C Thioamide compound or its salt and cytokine production inhibitor containing the same |
| 03/10/2009 | US7501512 Chemical compounds |
| 03/10/2009 | US7501509 A tetrapyrollic photosensitizer compound having at least one pendant CH2CH2CON(CH2CON(CH2COOH)2)2 or N(CH2COOH)2 group, being a chlorin, bacteriochlorin, porphyrin, pyropheophorbide, purpurinimide, or bacteriopurpurinimide |
| 03/10/2009 | US7501446 3-(Pyrid-3-yl)-5-(thiophen-2-yl)-pyrazoles; prenyl-protein transferase inhibitors |
| 03/10/2009 | US7501444 3-Pyrid-3-yl- pyrazoles in which pyrazole ring is additionally substituted with a halogenated phenyl group; prenyl-protein transferase inhibitors |
| 03/10/2009 | US7501438 1-(3-naphthalen-1-yl-imidazo[1,5-a]pyridin-1-yl)-butan-1-one; chronic pain, an inflammatory disorder, rheumatoid arthritis, multiple sclerosis, osteoporosis and osteoarthritis; cannabinoid receptor ligands |
| 03/10/2009 | US7501437 2-[(2-Isopropylsulfanyl-3-oxo-spiro[3.5]non-1-en-1-yl)amino]-3-[4-([2,7]naphthyridin-1-ylamino)phenyl]propanoic acid; compounds can inhibit the binding of integrins to their ligands and are of use in the prophylaxis and treatment of immuno or inflammatory disorders |
| 03/10/2009 | US7501436 To treat irritable bowel syndrome; side effect reduction, improved pharmacodynamics and safety, more potent and selective; 2-imidazomethyl- pyrido(4,3-b)indol-1-one or -carbazol-1-one derivatives containing an ester group |
| 03/10/2009 | US7501435 Inhibitors of checkpoint kinases |
| 03/10/2009 | US7501431 Physiologically active substances PF1270A, B and C substances |
| 03/10/2009 | US7501427 Such as N6-(4,5-dihydrooxazol-2-yl)-N4-[3-methyl-4-(6-methylpyridin-3-yloxy)-phenyl]-quinazoline-4,6-diamine; for treatment of hyperproliferative disorders such as cancer |
| 03/10/2009 | US7501425 e.g. 1-Methyl-7-[4-(pyrazol-1-yl)phenylamino]pyrimido[4,5-d]pyrimidin-2(1H)-one; anticarcinogenic agents; restenosis, angiogenesis and atherosclerosis |
| 03/10/2009 | US7501420 1-benzoyl-3-(R)-methyl-4-[(7-(4-fluorophenyl)-6-azaindol-3-yl)-oxoacetyl]piperazine; antiviral agents, especially for the treatment of HIV and AIDS, either used alone or in combination with other antivirals, antiinfectives, immunomodulators or HIV entry inhibitors |
| 03/10/2009 | US7501418 e.g. 3-[4-(2-Methyl-3-phenyl-allyl)-piperazin-1-ylmethyl]-3a,4-dihydro-3H-2,5-dioxa-1,7-diaza-dicyclopenta[a,g]naphthalene; serotonine (5-HT) reuptake inhibitor, alpha 2-adrenoceptor antagonist; antidepressant, anxiolytic agent; Parkinson's disease, eating disorders, psychosis, obesity |
| 03/10/2009 | US7501417 Aminocarbonyl-derivatives as novel inhibitors of histone deacetylase |
| 03/10/2009 | US7501412 e.g. 4-(1-(2-hydroxyethyl)piperidin-4-yl)-2H-isoquinolin-1-one; poly(ADP-ribose)polymerase inhibitor; nicotinamide nucleotide (NAD) substrate; acute cerebral infarction |
| 03/10/2009 | US7501407 Amide substituted pyrimidine compound; antiarthritic agents; antiischemic agents; antidiabetic agents; inflammatory bowel disease; antiproliferative agents; antiallergens |
| 03/10/2009 | US7501389 Prmitting its use in medium such as an aqueous medium that is devoid of peroxygen bleach or a peroxy-based or -generating bleach system; Dimethyl 2,4-di-(2-pyridyl) -3-methyl-7-(pyridin-2-ylmethyl)-3,7-diaza-bicyclo[3.3.1]nonan-9-one-1,5-dicarboxylate (N2py3o-C1) and the iron complex; laundering |
| 03/05/2009 | WO2009029625A1 4- [heterocyclyl-methyl] -8-fluoro-quinolin-2-ones useful as nitric oxide synthase inhibitors |
| 03/05/2009 | WO2009029609A1 Imidazopyridine analogs and their use as agonists of the wnt-beta-catenin cellular messaging system |
| 03/05/2009 | WO2009029592A1 Heterobicyclic-substituted quinolones useful as nitric oxide synthase inhibitors |
| 03/05/2009 | WO2009028629A1 Heterocyclic compound and use thereof |
| 03/05/2009 | WO2009028588A1 Polycyclic compound |
| 03/05/2009 | WO2009027952A1 Benzoterrylene derivatives |
| 03/05/2009 | WO2009027820A2 Substituted-quinoxaline-type-piperidine compounds and the uses thereof |
| 03/05/2009 | WO2009027732A1 5-6-bicyclic heteroaromatic compounds with antibacterial activity |
| 03/05/2009 | WO2009027730A1 Quinolin-4-one and 4-oxodihydrocinnoline derivatives as inhibitors of poly(adp-ribose)polymerase (parp) |
| 03/05/2009 | WO2009027475A1 Phenylisoquinoline and phenylquinazoline derivatives for the treatment of bone diseases |
| 03/05/2009 | WO2009027283A1 Triazolopyridine compounds and their use as ask inhibitors |
| 03/05/2009 | WO2009027276A1 Process for the preparation of pyrido [2, 1-a] isoquinoline derivatives and polymorphic froms thereof |
| 03/05/2009 | WO2009027077A2 5-arylalkylidene-2-arylalkyl-thiazol-4-one derivatives as inhibitors of 5-lipoxygenase and uses thereof |
| 03/05/2009 | WO2008140641A3 Pure paliperidone and processes for preparing thereof |
| 03/05/2009 | WO2008127274A3 Heterocyclic inhibitors of bacterial peptidyl trna hydrolase and uses thereof |
| 03/05/2009 | WO2008118328A3 Process and intermediates for the synthesis of 8-[{1-(3,5-bis-(trifluoromethyl)phenyl)-ethoxy}-methyl]-8-phenyl-1,7-diaza-spiro[4.5]decan-2-one compounds |
| 03/05/2009 | WO2008070447A3 Anti-viral compounds |
| 03/05/2009 | WO2005121138A3 Heterotricyclic compounds for use as hcv inhibitors |
| 03/05/2009 | US20090062547 Cyclic-fused beta-lactones and their synthesis |
| 03/05/2009 | US20090062545 Trisazo Compound, Ink Composition, Recording Method, and Colored Article |
| 03/05/2009 | US20090062530 Substituted arylalkanoic acid derivatives and use thereof |
| 03/05/2009 | US20090062328 Oxime and Hydroxylamine Substituted Imidazo[4,5-c] Ring Compounds and Methods |
| 03/05/2009 | US20090062327 Inhibitors of AKT Activity |
| 03/05/2009 | US20090062323 Deuterium-enriched irinotecan |