| Patents for C07D 295 - Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms (34,005) |
|---|
| 04/13/2011 | CN102010371A Proline ionic liquid and preparation method and application thereof |
| 04/13/2011 | CN102010298A Indene derivatives as pharmaceutical agents |
| 04/12/2011 | US7923446 Biaryl sulfonamides and methods for using same |
| 04/12/2011 | CA2471099C .alpha.-(n-sulphonamido)acetamide derivatives as .beta.-amyloid inhibitors |
| 04/12/2011 | CA2458035C Quaternary ammonium salts of omega-aminoalkylamides of r-2-aryl-propionic acids and pharmaceutical compositions containing them |
| 04/12/2011 | CA2387107C Derivatives of dicarboxylic acid having pharmaceutical properties |
| 04/07/2011 | WO2011040509A1 2,3-dihydro-1h-indene-2-ylurea derivative and pharmaceutical application of same |
| 04/07/2011 | WO2011040462A1 Base-generating agent, photosensitive resin composition, material for pattern-forming comprising said photosensitive resin composition, pattern-forming method using said photosensitive resin composition, and article |
| 04/07/2011 | WO2011000945A9 Aminoalkamides for use in the treatment of inflammatory, degenerative or demyelinating diseases of the cns |
| 04/07/2011 | US20110082154 Sigma ligands for neuronal regeneration and functional recovery |
| 04/07/2011 | US20110082134 1,2,3-Trisubstituted aryl and heteroaryl derivatives as modulators of metabolism and the prophylaxis and treatment of disorders related thereto such as diabetes and hyperglycemia |
| 04/07/2011 | US20110082109 Novel acyl guanidine derivatives |
| 04/07/2011 | US20110082064 Amine reaction compounds comprising one or more active ingredient |
| 04/07/2011 | CA2774040A1 2, 3-dihydro-1h-inden-2-yl urea derivatives and medical uses thereof |
| 04/06/2011 | EP1780197B9 5-substituted-2-phenylamino benzamides as mek inhibitors |
| 04/06/2011 | EP1558259B1 Urea derivatives as IL-8 receptor antagonists |
| 04/06/2011 | CN1946680B 非核苷逆转录酶抑制剂 Non-nucleoside reverse transcriptase inhibitors |
| 04/06/2011 | CN1812980B Derivatives of piperidinyl- and piperazinyl-alkyl carbamates, preparation methods thereof and application of same in therapeutics |
| 04/06/2011 | CN1730476B Aromatic amine ketone compounds, its synthesis method, pharmaceutical composition containing same and uses |
| 04/06/2011 | CN102007108A Inhibitors of the chemokine receptor cxcr3 |
| 04/06/2011 | CN102002021A Novel method for synthesizing repaglinide |
| 04/06/2011 | CN102002020A Method for refining piperazine |
| 04/06/2011 | CN102002019A Method for removing ethylene glycol monomethyl ether impurity in coarse product of morpholine device |
| 04/06/2011 | CN102001916A 作为药物活性剂的茚衍生物 Indene derivatives as pharmaceutically active agent |
| 04/06/2011 | CN102000602A Cyclamine catalyst |
| 04/06/2011 | CN101575321B Production method of trimetazidine and its hydrochloride |
| 04/05/2011 | US7919626 Pyrazole compounds and uses thereof |
| 04/05/2011 | US7919529 δ-amino-γ-hydroxy-ω-aryl-alkanoic acid amides |
| 03/31/2011 | US20110077251 Novel 17 beta lupane derivatives |
| 03/31/2011 | US20110077247 Class of histone deacetylase inhibitors |
| 03/30/2011 | EP2301939A1 Enzyme inhibitors |
| 03/30/2011 | EP2301534A1 Amino-methyl substituted tetracycline compounds |
| 03/30/2011 | EP2300426A1 Compounds comprising a cyclobutoxy group |
| 03/30/2011 | EP2300412A1 Prostaglandin produgs as hypotensive agents |
| 03/30/2011 | EP2300370A2 Synthesis and use of mse-framework type molecular sieves |
| 03/30/2011 | EP1742927B1 Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof |
| 03/30/2011 | EP1601643B1 Arylcycloalkyl derivatives with branched side chains as ppar receptor modulators, method for their production and their use as medicaments |
| 03/30/2011 | CN1976710B Compounds and compositions as cathepsin S inhibitors |
| 03/30/2011 | CN101998950A 3-(4-fluorophenyl)-3-hydroxy-2-amino-propionic acid amides and related compounds having analgesic activity |
| 03/30/2011 | CN101995769A Photoresist composition |
| 03/30/2011 | CN101993418A (Methyl) acrylamido carboxylate ionic liquid and preparation method thereof |
| 03/30/2011 | CN101992114A Catalyst for preparing N-formyl morpholine |
| 03/29/2011 | US7915421 Method for preparing phenyl acetic acid derivatives |
| 03/29/2011 | US7915420 Aryl piperidine amides |
| 03/29/2011 | US7915413 Compounds |
| 03/29/2011 | US7915293 Carbocyclic and heterocyclic sulfonamide derivatives, e.g., N-(2-bromo-5-(trifluoromethoxy)phenyl)-3,5-dichloro-4-(2-chloro-4-nitrophenoxy)benzenesulfonamide and 4-(2-(trifluoromethyl)phenoxy)-1-(3-trifluoromethyl)phenylsulfonyl)piperidine; treating proliferative diseases |
| 03/29/2011 | US7915291 Hepatitis C virus inhibitors |
| 03/29/2011 | US7915249 serotonin 5-HT2A, 5-HT2C and dopamin D2 receptors antagonist, and norepinephrine reuptake inhibitor; antidepressant, anxiolytic agent; psychosis, schizophrenia, bipolar and sexual disorders, obesity |
| 03/29/2011 | CA2489276C Tricyclic steroid hormone nuclear receptor modulators |
| 03/29/2011 | CA2390164C Substituted 4h-chromene and analogs as activators of caspases and inducers of apoptosis and the use thereof |
| 03/29/2011 | CA2383779C N-(indolecarbonyl)piperazine derivatives |
| 03/24/2011 | WO2011034934A1 Abt-263 crystalline forms and solvates for use in treating bcl-2 protein related diseases |
| 03/24/2011 | WO2011034078A1 Glycine compound |
| 03/24/2011 | WO2011033010A1 4-alkoxy-n- (2-hydroxycarbamoyl-2-piperidinyl-ethyl) -benzamide compounds as selective tace-inhibitors for the treatment of inflammatory diseases |
| 03/24/2011 | WO2011033009A1 N- [2-hydroxycarbamoyl-2- (piperazinyl) ethyl] benzamide compounds, their preparation and their use as tace inhibitors |
| 03/24/2011 | US20110071125 Substituted phenylamino-benzene derivatives useful for treating hyper-proliferative disorders and diseases associated with mitogen extracellular kinase activity |
| 03/24/2011 | US20110071066 Use of metal hydrazide complex compounds as oxidation catalysts |
| 03/24/2011 | US20110070179 Cationic alcohols and uses thereof |
| 03/24/2011 | CA2773895A1 Cationic alcohols and uses thereof |
| 03/24/2011 | CA2772689A1 Glycine compound |
| 03/24/2011 | CA2771984A1 Abt-263 crystalline forms and solvates for use in treating bcl-2 protein related diseases |
| 03/24/2011 | CA2771679A1 4-alkoxy-n- (2-hydroxycarbamoyl-2-piperidinyl-ethyl) -benzamide compounds as selective tace-inhibitors for the treatment of inflammatory diseases |
| 03/24/2011 | CA2771168A1 N-[2-hydroxycarbamoyl-2-(piperazinyl)ethyl]benzamide compounds, their preparation and their use as tace inhibitors |
| 03/23/2011 | EP2298742A1 Phenoxy acetic acids as PPAR delta activators |
| 03/23/2011 | EP2298729A1 Method of producing optically active amino acid derivative |
| 03/23/2011 | EP2298311A1 w-Carboxy aryl substituted diphenyl ureas as p38 kinase inhibitors |
| 03/23/2011 | EP2297131A2 Di-substituted phenyl compounds as phosphodiesterase 10 inhibitors |
| 03/23/2011 | EP2297122A1 New process for the preparation of levocetirizine and intermediates thereof |
| 03/23/2011 | EP2297118A1 N- (1, 1, 1, 3, 3, 3-hexafluoro-2-hydroxypropan-2-yl) benzyl-n' -arylcarbonylpiperaz ine derivatives |
| 03/23/2011 | EP2297111A2 Method for the production of halogen-substituted 2-(aminomethylidene)-3- oxobutyric acid esters |
| 03/23/2011 | EP2297097A2 Compounds and compositions useful for the treatment of malaria |
| 03/23/2011 | EP2297089A1 Benzocycloheptane and benzoxepine derivatives |
| 03/23/2011 | EP1838665B1 Mutilin derivatives and their use as pharmaceutical |
| 03/23/2011 | EP1140836B1 Amide compounds |
| 03/23/2011 | CN101987824A Preparation method of high-purity conductive salt for super capacitor |
| 03/22/2011 | US7910734 Crystal and salt of 1-cyclopropylmethyl-4-[2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
| 03/22/2011 | US7910730 Process for the preparation of delmopinol and derivatives thereof |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | US7910078 using an aminoalcohol derived from 4-amino-2-butanol, which have a higher CO2 absorption capacity; global warming; e.g. 4-(diethylamino)-2-butanol or 4-(piperidino)-2-butanol |
| 03/22/2011 | US7910059 For the determination of an analyte or analytes such as proteins, peptides, nucleic acids, carbohydrates, lipids, steroids and small molecules by mass analysis |
| 03/22/2011 | CA2614979C Piretanide polymorph, process for its preparation and its use |
| 03/22/2011 | CA2432572C Oxybenzamides derivatives as factor xa inhibitors |
| 03/22/2011 | CA2407592C Small technetium-99m and rhenium labeled agents and methods for imaging tumors |
| 03/17/2011 | WO2011030645A1 Photopolymerizable composition, color filter, method for producing same, solid-state image pickup element, liquid crystal display device, lithographic printing original plate, and novel compound |
| 03/17/2011 | WO2010028776A8 Piperazine derivatives for binding and imaging amyloid plaques and their use |
| 03/17/2011 | US20110065760 Compounds for the inhibition of rotamases and use thereof |
| 03/17/2011 | US20110065622 Novel nitrile and amidoxime compounds and methods of preparation for semiconductor processing |
| 03/16/2011 | EP2295438A1 Process for producing hydroxyalkyltriethylenediamine compound, and catalyst composition for the production of polyurethane resin using the hydroxyalkyltriethylenediamine compound |
| 03/16/2011 | EP2295419A2 Substituted tetracycline compounds |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP2295399A2 Liquid electrolytes for electrical storage devices |
| 03/16/2011 | EP2295052A1 Use of ritonavir for improving the pharmacokinetics of drugs metabolized by cytochrome P450 |
| 03/16/2011 | EP2294051A1 Alpha-substituted n-sulfonyl gylcine amides antagonists of ccr10, compositions containing the same and methods for using them |
| 03/16/2011 | EP1448535B1 Benzamide and heteroarylamide as p2x7 receptor antagonists |
| 03/16/2011 | CN101985438A Substituted phenyl piperazinyl aralkylone derivatives and application thereof to preparation of analgesics |
| 03/15/2011 | US7906549 Aminocarboxylic acid derivative and medicinal use thereof |
| 03/15/2011 | US7906537 Substituted p-diaminobenzene derivatives |
| 03/15/2011 | US7906513 Prevent reproduction; breaking life cycle;viricides |
| 03/15/2011 | US7906501 Pyrrole derivatives with angiotensin II antagonist activity |
| 03/15/2011 | CA2471814C Hydroxamic acid derivative and mmp inhibitor containing the same as active ingredient |