| Patents for C07D 209 - Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom (45,780) |
|---|
| 05/11/2006 | DE102004053192A1 2-Alkoxy-6-alkyl-phenyl substituierte spirocyclische Tetramsäure-Derivate 2-alkoxy-6-alkyl-phenyl substituted spirocyclic tetramic acid derivatives |
| 05/11/2006 | DE102004053191A1 2,6-Diethyl-4-methyl-phenyl substituierte Tetramsäure-Derivate 2,6-diethyl-4-methyl-phenyl substituted tetramic acid derivatives |
| 05/11/2006 | CA2586910A1 2-substituted indoles, their precursors and novel processes for the preparation thereof |
| 05/11/2006 | CA2585334A1 Indole derivatives useful as progesterone receptor modulators |
| 05/11/2006 | CA2584979A1 Indole and benzimidazole derivatives |
| 05/10/2006 | EP1655303A2 Hydroxylamine esters as polimerization initiators |
| 05/10/2006 | EP1655285A1 Method for preparation of a crystalline form of carvedilol (form II) |
| 05/10/2006 | EP1654327A1 Cyanin-type compounds having an alkynyl linker arm |
| 05/10/2006 | EP1654228A1 Tetrahydrocarbazole derivatives and their pharmaceutical use |
| 05/10/2006 | EP1654227A1 Bicyclic indoline sulfonamide derivatives |
| 05/10/2006 | EP1654224A1 Substituted benzoylureido-o-benzoylamides, method for the production thereof and use of the same |
| 05/10/2006 | EP1654218A2 Matrix metalloproteinase inhibitors |
| 05/10/2006 | EP1654217A1 2- adamantyl derivatives as p2x7 receptor antagonists. |
| 05/10/2006 | EP1653947A1 (4-hydroxyphenyl)-1h-indole-3-carbaldehyde oxime derivatives as estrogenic agents |
| 05/10/2006 | EP1653946A2 Geometrically restricted 3-cyclopentylidene-1,3-dihydroindol-2-ones as potent protein kinase inhibitors |
| 05/10/2006 | EP1282630B1 Process for Reducing the Molecular Weight of Polypropylene Using Hydroxylamine Esters |
| 05/10/2006 | EP1212296B9 Phosphate mimics and methods of treatment using phosphatase inhibitors |
| 05/10/2006 | CN1769284A Substituted 1H-indole-2-ketone compound and its preparation method and uses |
| 05/10/2006 | CN1769269A End-blocked triarylamine and carbazoles material, handling method and uses |
| 05/10/2006 | CN1255408C Method for synthesizing 3 (or8)-(1-methoxyethyl)-8-(or3)-(1-hydroxyethyl)-deuteroporphyrin IX |
| 05/10/2006 | CN1255403C Beta-carboline derivatives useful as inhibitors of phosphodiesterase |
| 05/10/2006 | CN1255381C Indigo derivative and its preparing process and application |
| 05/09/2006 | US7041835 (−)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane, compositions thereof, and uses as a dopamine-reuptake inhibitor |
| 05/09/2006 | US7041834 alkylamination of N-methylcarbazol-5-one at the 6-position in the presence of formaldehyde, a secondary amine, and a desiccant; deamination and coupling of 2-methylimidazole at the 1-position; reaction time less than three hours |
| 05/09/2006 | US7041828 Phenyl-substituted imidazopyridines |
| 05/09/2006 | US7041827 Phenyl-substituted imidazopyridines |
| 05/09/2006 | US7041697 for the treatment of depression, anxiety, panic disorder, post-traumatic stress disorder, premenstrual disorder, attention deficit disorder, obsessive compulsive disorder, obesity, eating disorders, cocaine and alcohol addiction, sexual dysfunction |
| 05/09/2006 | US7041684 4-[2-Hydroxy-3-([4-(5-carbamoyl-2-pyridyloxy)phenyl]-2-methylpropylamino)propoxy]carbazole and salts;treating obesity; antidiabetic agent for non-insulin dependent diabetes (Type II); |
| 05/09/2006 | US7041663 2-phenyl-1-[4-(2-aminoethoxy)-benzyl]-indoles as estrogenic agents |
| 05/09/2006 | US7041354 Optical data carrier comprising a cyanine dye as light-absorbent compound in the information layer |
| 05/09/2006 | US7041235 Fluorescent diketopyrrolopyrrole analogues |
| 05/04/2006 | WO2006047119A1 Arylcarbaz as hosts in phosphorescent organic light emitting devices |
| 05/04/2006 | WO2006047032A2 Indole compounds useful as serotonin selective agents |
| 05/04/2006 | WO2006047017A1 Novel tetracyclic heteroatom containing derivatives useful as sex steroid hormone receptor modulators |
| 05/04/2006 | WO2006046916A1 Novel sulphonamide derivatives as glucocorticoid receptor modulators for the treatment of inflammatory diseases |
| 05/04/2006 | WO2006046540A1 Process for producing n-vinylcarbazole compound |
| 05/04/2006 | WO2006046499A1 Indoline compound and process for producing the same |
| 05/04/2006 | WO2006046131A1 Tetralin histamine-3 receptor antagonists |
| 05/04/2006 | WO2006045478A1 New indole or benzimidazole derivatives |
| 05/04/2006 | WO2006023231A3 Fluorescent metal ion indicators with large stokes shift |
| 05/04/2006 | WO2006017639A3 Crystalline polymorph of pipindoxifene hydrochloride monohydrate |
| 05/04/2006 | WO2006013227A8 Methylamine risks and treatment with n-derivatives of hyperactivity, depression and alcoholism |
| 05/04/2006 | WO2006012227A3 Amido compounds and their use as pharmaceuticals |
| 05/04/2006 | WO2005109987A3 3-(((4-phenyl)-piperazine-1-yl)-alkyl)-3-alkyl-1, 3-dihydro-2h-indol-2-one derivatives and related compounds for the treatment of central nervous system disorders |
| 05/04/2006 | WO2005061475A3 Ornithine derivatives as prostaglandin e2 agonists or antagonists |
| 05/04/2006 | US20060094771 Carvedilol pharmasolve solvate |
| 05/04/2006 | US20060094718 O-substituted hydroxyaryl derivatives |
| 05/04/2006 | US20060094717 Indole, azaindole and related heterocyclic ureido and thioureido piperazine derivatives |
| 05/04/2006 | US20060094711 2-phenyl-1-[4-(2-aminoethoxy)-benzyl]-indoles as estrogenic agents |
| 05/04/2006 | CA2585030A1 New indole or benzimidazole derivatives |
| 05/04/2006 | CA2584413A1 Novel sulphonamide derivatives as glucocorticoid receptor modulators for the treatment of inflammatory diseases |
| 05/04/2006 | CA2583660A1 Indoline compound and process for producing the same |
| 05/04/2006 | CA2582079A1 Indole compounds useful as serotonin selective agents |
| 05/04/2006 | CA2581223A1 Novel tetracyclic heteroatom containing derivatives useful as sex steroid hormone receptor modulators |
| 05/03/2006 | EP1652892A1 Cyanine compounds, optical recording materials and optical recording media |
| 05/03/2006 | EP1651637A1 3-amino chroman and 2-amino tetralin derivatives |
| 05/03/2006 | EP1651626A1 Urea derivatives and their use as tyrosinkinase inhibitors |
| 05/03/2006 | EP1651602A2 Aryl heteroaromatic products, compositions comprising the same and use thereof |
| 05/03/2006 | EP1651601A1 Stable modifications of tegaserod hydrogen maleate |
| 05/03/2006 | EP1651595A2 Ubiquitin ligase inhibitors |
| 05/03/2006 | EP1651200A1 Polyhydroxy phenols and their use in bindng p-selectin |
| 05/03/2006 | EP1543011B1 Thienopyrrolyl and furanopyrrolyl compounds and their use as histamine h4 receptor ligands |
| 05/03/2006 | EP1528923B1 N-((3-oxo-2,3-dihydro-1h-isoindol-1-yl)acetyl)guanidine derivatives as nhe1-inhibitors for the treatment of infarction and angina pectoris |
| 05/03/2006 | EP1444224B1 3-substituted oxindole beta-3 agonists |
| 05/03/2006 | EP1353904B9 1-aryl-or 1-alkylsulfonylbenzazole derivatives as 5-hydroxytryptamine-6 ligands |
| 05/03/2006 | EP1208091B1 Benzophenones as inhibitors of reverse transcriptase |
| 05/03/2006 | EP1074542B1 Sulfonamide-containing indole compounds |
| 05/03/2006 | CN1768036A Indolone-acetamide derivatives, processes for preparing them and their uses |
| 05/03/2006 | CN1768026A 2-aryl-acetic acids, their derivatives and pharmaceutical compositions containing them |
| 05/03/2006 | CN1768019A method for synthesis of (2s)-indoline-2-carboxylic acid and use in the synthesis of perindopril |
| 05/03/2006 | CN1767823A Asthma and allergic inflammation modulators |
| 05/03/2006 | CN1765896A Novel preparation method of ramosetron hydrochloride |
| 05/03/2006 | CN1254476C Dihydroimidazo[5,1-a]-beta-carboline derivatives, method for preparing same and use thereof as medicine |
| 05/03/2006 | CN1254465C Calcilytic compounds |
| 05/02/2006 | US7038077 2-Amino-bicyclo[3.1.0]hexane-2,6-dicarboxylic acid derivatives; nervous system, psychological, and psychiatric disorders |
| 05/02/2006 | US7038041 Selective nuclear receptor-targeted systems for delivery of cytotoxins to cancer cells for targeted photodynamic therapy |
| 05/02/2006 | US7037940 Taxol enhancer compounds |
| 05/02/2006 | US7037935 4-Pyrrolidino-phenyl-benzyl ether derivatives |
| 05/02/2006 | US7037932 such as (lepido%3S)-3-(1-Benzothien-7-yloxy)-N-methyl-3-phenyl-1-propanamine oxalate; for treatment of pain |
| 05/02/2006 | CA2206005C Aniline derivatives possessing an inhibitory effect of nitric oxide synthase |
| 05/02/2006 | CA2061836C Nmda antagonists |
| 04/27/2006 | WO2006045120A2 Purification of tegaserod maleate |
| 04/27/2006 | WO2006044707A1 Chemical compounds |
| 04/27/2006 | WO2006044415A2 Carboxylic acid peri - substituted bicyclics for occlusive artery disease |
| 04/27/2006 | WO2006044405A1 Aryl sulfonamide peri-substituted bicyclics for occlusive artery disease |
| 04/27/2006 | WO2006044232A1 Ophthalmic compositions for treating ocular hypertension |
| 04/27/2006 | WO2006044000A1 Sulfonamide pert-substituted bicyclics for occlusive artery disease |
| 04/27/2006 | WO2006043839A1 Nitrobenzindoles and their use in cancer therapy |
| 04/27/2006 | WO2006043647A1 Carbazole derivative, and light emitting element and light emitting device using the carbazole derivative |
| 04/27/2006 | WO2005118564A3 Methods for the synthesis of milnacipran and congeners thereof |
| 04/27/2006 | WO2005110985A3 Indole, benzofuran and benzothiophene derivatives as selective androgen receptor modulators (sarms) |
| 04/27/2006 | US20060089401 Kinase inhibitors |
| 04/27/2006 | US20060089400 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolylcis/trans-isomerases |
| 04/27/2006 | US20060089345 Indole derivatives, method for preparating same and pharmaceutical compositions containing same |
| 04/27/2006 | US20060089336 4-Dedimethylamino tetracycline compounds |
| 04/27/2006 | US20060088728 Arylcarbazoles as hosts in PHOLEDs |
| 04/27/2006 | DE3930473B4 Färbemittel für keratinische Fasern, die Prekursoren von Oxidationsfarbstoffen und Indol-Kuppler enthalten, sowie Verfahren zu deren Herstellung und Färbeverfahren unter Verwendung dieser Mittel Dyes for keratinous fibers containing oxidation dye precursors and indole couplers, and to methods for their preparation and dyeing processes using these agents |
| 04/27/2006 | CA2584702A1 Nitrobenzindoles and their use in cancer therapy |
| 04/27/2006 | CA2583828A1 Carboxylic acid peri-substituted bicyclics for occlusive artery disease |
| 04/27/2006 | CA2583710A1 Aryl sulfonamide peri-substituted bicyclics for occlusive artery disease |