| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 04/03/1984 | US4440936 Rhodium-phosphine chiral hydrogenation catalysis of acetophenone, atropic acid, and alpha-acylamidoacrylic acids and esters thereof |
| 04/03/1984 | US4440696 From a phenol and phosphorus trihalide, amine or amide catalyst |
| 04/03/1984 | US4440695 From n,n-bis(phosphonomethyl)glycine |
| 04/03/1984 | US4440685 Muscle relaxants, sedatives, anticonvulsants |
| 04/03/1984 | US4440646 Hydroxy or haloalkanephosphonates |
| 04/03/1984 | US4440634 Organic salt compositions in extraction processes |
| 04/03/1984 | CA1164644A1 Layered compounds of mixed oxides and lewis bases |
| 04/03/1984 | CA1164642A1 Intercalated layered mixed oxides |
| 03/28/1984 | EP0104157A1 Rubber compositions containing a vulcanization system alterative |
| 03/28/1984 | EP0103877A1 Phosphate derivatives, process for preparation thereof and pharmaceutical compositions of the same |
| 03/28/1984 | EP0103867A1 Phosphorus-containing peptide derivative |
| 03/27/1984 | US4439564 5-Membered cyclic phosphonates and compositions thereof |
| 03/27/1984 | US4439536 Hydrocarbon cracking catalyst |
| 03/27/1984 | US4439431 O,O-Diethyl O-((4-tertiarybutylsulfonyl)m-tolyl)phosphorothioate and its insecticidal use |
| 03/27/1984 | US4439430 O,O-Diethyl O-[(p-tertiarybutylthio)phenyl]phosphorothioates and its insecticidal use |
| 03/27/1984 | US4439428 Herbicide |
| 03/27/1984 | US4439373 From an amino acid, forming a co2 protecting group |
| 03/27/1984 | US4439365 Novel hydroxy substituted prostanoic acids, esters, congeners, intermediates and process |
| 03/27/1984 | CA1164478A1 Process for the separation of oils and/or phosphatidylethanolamine from alcohol soluble phosphatidylcholine products containing the same |
| 03/27/1984 | CA1164477A1 Process for the separation of acylated phospholipids from phosphatidylcholine products containing the same |
| 03/27/1984 | CA1164476A1 Process for the separation of oil and/or phosphatidylethanolamine from alcohol soluble phosphatidylcholine products containing the same |
| 03/21/1984 | EP0103055A1 N-phosphonomethylglycine derivatives and herbicidal compositions containing them |
| 03/20/1984 | US4438081 Using sulfur oxide, and sulfur oxide chloride |
| 03/20/1984 | US4438048 Process for the manufacture of mixed phosphoric acid ester compositions |
| 03/20/1984 | US4438013 Of metals in aqueous brines or acids |
| 03/20/1984 | US4438006 Corrosion resistance oil additive |
| 03/20/1984 | US4437874 Tri-mixed alkylsulfonium salts of N-phosphonomethylgylcine and their use as plant growth regulators and herbicides |
| 03/20/1984 | CA1164005A1 Phosphorus substituted 4-methyloxetan-2-ones, processes for their preparation and their use |
| 03/15/1984 | WO1984000966A1 Process for the production of derivatives of hydroxy-methylene diphosphonic acid |
| 03/14/1984 | EP0102754A1 Process for reclamation of high purity selenium, tellurium, and arsenic from scrap alloys |
| 03/14/1984 | EP0102694A1 Method for preparation of N-phosphonomethylglycine |
| 03/13/1984 | US4436899 Reaction of organic phosphonate or phosphate with tetravalent metal compound |
| 03/13/1984 | US4436811 Development accelerators |
| 03/13/1984 | US4436736 Insecticides, miticides |
| 03/13/1984 | US4436673 Fluid bed process for preparing phenylphosphonous dichloride |
| 03/13/1984 | US4436661 3-Substituted bicyclic azetidinone derivatives |
| 03/13/1984 | US4436640 Glycolate dithiophosphoric acids, metal salts thereof and oil compositions containing the salts |
| 03/13/1984 | CA1163643A1 Furyl substituted polyenes |
| 03/07/1984 | EP0102239A1 Azetidinone derivatives, a process for their preparation and their use as intermediates in the preparation of carbapenem antibiotics |
| 03/07/1984 | EP0102062A2 1,3-Dithianes, their production and use |
| 03/07/1984 | EP0101991A1 2-Alkene-phosphonates and process for their production |
| 03/07/1984 | EP0101973A1 4-Trifluoromethylphenyl(thio)phosphoric-acid amides, process for their preparation and their use as pesticides |
| 03/06/1984 | US4435533 4-Hydroxy-5-(substituted phosphinyl)ethyleneureas |
| 03/06/1984 | US4435403 Tranquilizers |
| 03/06/1984 | US4435338 Lubricant additives |
| 03/06/1984 | US4435204 N-Organo-phosphonomethylglycine-N-oxides and the use thereof to increase the sucrose content of sugarcane |
| 03/06/1984 | US4435186 Gasohol fuel additives |
| 03/06/1984 | CA1163274A1 Mono(2-ammonium-2-hydroxymethyl-1,3-propanediol) (2r-cis)-(3-methyloxiranyl) phosphonate, its preparation and pharmaceutical compositions containing it |
| 03/06/1984 | CA1163200A1 Phosphono-hydroxy-acetic acid and its salts, their production and their medicinal use |
| 03/01/1984 | WO1984000754A1 Aryl substituted 7-oxabicycloheptane compounds |
| 02/29/1984 | EP0101597A2 Process for the preparation of astaxanthine and intermediates in the astaxanthine synthesis |
| 02/28/1984 | US4434302 Process and catalyst for performing hydroformylation reactions |
| 02/28/1984 | US4434291 Ashless salt of dithiophosphoric acid |
| 02/28/1984 | US4434162 Phosphonic acid ester, pharmaceutical compositions containing the same and method of using the same |
| 02/28/1984 | US4434109 Stabilizers against heat, oxygen and light |
| 02/28/1984 | US4434108 Herbicidally active 2-nitro-5-(2'-chloro-4'-trifluoromethylphenoxy)phenylphosphinic acid derivatives |
| 02/28/1984 | US4434101 Inhibitors of SRS-synthesis |
| 02/28/1984 | US4434076 Quaternary ammonium-smectite complexes |
| 02/28/1984 | US4434075 Anionically modified organophilic clays and their preparation |
| 02/28/1984 | US4433975 Heterocyclic quaternary ammonium phosphates |
| 02/28/1984 | CA1162939A1 Phosphonomethylglycylhydroxamic acid and novel herbicidally active salts thereof, processes for their production and their use in herbicidal compositions |
| 02/22/1984 | EP0101238A2 Process for preparation of chalcogenide alloys by coreduction of esters |
| 02/22/1984 | EP0101199A1 Beta-lactam compounds |
| 02/22/1984 | EP0100966A1 Carbamic-acid esters, their preparation and their use in pest control |
| 02/22/1984 | EP0100902A2 Process for winning phosphatide ethanolic fractions highly enriched with phosphatidyl choline |
| 02/22/1984 | EP0100839A1 Catalytic hydrogenation of acetylenic phosphonium salts |
| 02/21/1984 | US4433149 Esters of ureido-phenyl (or pyridyl) phosphinic acids |
| 02/21/1984 | US4433148 Heterocyclic substituted triazol-3-ol compounds |
| 02/21/1984 | US4433087 Alkylated 2,2'-biphenylene phosphonates and stabilized compositions |
| 02/21/1984 | US4432994 Pesticide compounds, compositions and methods |
| 02/21/1984 | US4432972 Phosphonamidate compounds |
| 02/21/1984 | US4432971 Hypotensive agents and angiotensin inhibition |
| 02/21/1984 | US4432963 Water soluble stannous, ferrous, chromous, titanous and technetium methanehydroxydiphosphonate |
| 02/21/1984 | US4432904 Promoters for hydroformylation catalysts |
| 02/21/1984 | US4432886 Cationic fluorescent whitening agents |
| 02/21/1984 | CA1162570A1 Alkylphosphonites, processes for producing them, and the use of alkylphosphonites as fungicides |
| 02/21/1984 | CA1162556A1 Process for the preparation of nickel ylides containing ylide ligands with a sulfonated group v component |
| 02/21/1984 | CA1162555A1 Process for the preparation of nickel ylides containing directly sulfonated ylide ligands |
| 02/21/1984 | CA1162548A1 Derivatives of 2-nitro-4- or -5-pyridyloxyphenylphos- phonic acid, the preparation thereof, the use thereof |
| 02/21/1984 | CA1162542A1 Catalytic asymmetric hydrogenation |
| 02/15/1984 | EP0100718A1 Anti-inflammatory products derived from methylenediphosphonic acid, and process for their preparation |
| 02/15/1984 | EP0100528A2 Derivatives of (di)-thiophosphoric and (di)-thiophosphonic acids, process for their preparation, compositions containing them and their use in plant protection |
| 02/15/1984 | EP0100499A2 Phospholipid derivatives, processes for preparation thereof and pharmaceutical composition of the same |
| 02/15/1984 | EP0100476A2 Phosphoric-acid esters, process for their preparation and their use as pesticides |
| 02/14/1984 | US4431805 Pyrido[2,3-d]-pyrimidines |
| 02/14/1984 | US4431596 2-Hydroxy-2-phosphinyl ethanals and 1,2-dihydroxy-1,2 bisphosphinyl ethanes |
| 02/14/1984 | US4431594 Reacting the glycine depivative with an onium salt in water containing a tertiary amine and phase transfer agent |
| 02/14/1984 | US4431588 Penacillins |
| 02/14/1984 | US4431587 Beta-lactam antibacterial agents |
| 02/14/1984 | US4431438 Herbicides |
| 02/13/1984 | EP0090861A4 Cationic compounds useful for making radiodiagnostic agents. |
| 02/07/1984 | US4430453 Polyurethane foams suitable for high frequency welding and process for producing the same |
| 02/07/1984 | US4430452 Stabilizer-containing reactive components for PU-foams, new stabilizers and a process for producing these stabilizers |
| 02/07/1984 | US4430425 Hydroquinone derivatives |
| 02/07/1984 | CA1161861A1 Phosphorus-containing cyanohydrine derivatives and process for the preparation thereof |
| 02/02/1984 | WO1984000368A1 Derivatives of n,n-bis(2-chloroethyl)-phosphoric acid amide |
| 02/02/1984 | WO1984000367A1 New glycerine derivatives for the synthesis of phospholipides |
| 02/02/1984 | WO1984000362A2 New d-mannite derivatives as starting products for the synthesis of phospholipids |
| 02/01/1984 | EP0099785A2 Amino and substituted amino phosphinylalkanoyl compounds |
| 02/01/1984 | EP0099630A1 N'-(methoxy)methylthio)phosphinyl-N,N-dimethyl carbamimidothioic acid, ethyl ester |