| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 07/17/1984 | US4460507 Process for the preparation of thienamycin |
| 07/17/1984 | US4460408 Process for preparation of chalcogenide alloys by coreduction of esters |
| 07/11/1984 | EP0113190A1 Alpha-hydroxy-beta-haloethylphosphinic acids and their salts, and their production and use |
| 07/11/1984 | EP0113101A1 6-(1-Hydroxyethyl)-2-SR8-1-methyl-1-carbadethiapen-2-em-3-carboxylic acid esters |
| 07/11/1984 | EP0113019A1 Process for the continuous preparation of 2-carboxyethyl-alkyl phosphinic acid esters |
| 07/11/1984 | EP0112872A1 New glycerine derivatives for the synthesis of phospholipids |
| 07/11/1984 | EP0112871A1 Derivatives of n,n-bis(2-chloroethyl)-phosphoric acid amide. |
| 07/10/1984 | US4459406 Layered compounds of mixed oxides and Lewis bases |
| 07/10/1984 | US4459294 Miticides, nematocides |
| 07/10/1984 | US4459241 Antideposit agents |
| 07/10/1984 | CA1170668A1 Process for the preparation of vinylphosphonic acid dichloride and 2-chloroethanephosphonic acid dichloride |
| 07/10/1984 | CA1170666A1 Trialkylsulfonium salts of n-phosphonomethylglycine and their use as plant growth regulators and herbicides |
| 07/04/1984 | EP0112803A2 N-phenylsulfonyl-N'-pyrimidinyl and triazinyl ureas containing phosporus |
| 07/04/1984 | EP0112801A1 Magnesium complexes of oligomeric phosphonic-acid esters, process for their preparation and their use as stabilizers in bleaching baths containing alcaline peroxide |
| 07/04/1984 | EP0112743A1 Derivatives of tricyclophosphazenes, process for their preparation and their use as medicines |
| 07/04/1984 | EP0112584A2 7H-dibenzo(a,c)cyclohepten-5-ones(7), process for their preparation and medicaments for the treatment of psychic disorders and stomac and intestine ulcers |
| 07/04/1984 | EP0112580A1 Process for preparing phosphonomethylated amino acids |
| 07/04/1984 | EP0112497A1 Process for the preparation of alkanephosphonous acid esters |
| 07/03/1984 | US4458086 Process for the preparation of 2-(thienyl-2)-and 2-(thienyl-3)-ethylamines |
| 07/03/1984 | US4458045 Flameproofed organic materials |
| 07/03/1984 | US4458035 Polyurethane foam having a flame retardant oligomeric phosphate ester |
| 07/03/1984 | US4457923 Insecticides, miticides, nematocides |
| 07/03/1984 | US4457922 Pesticidal bisphenol phosphates |
| 07/03/1984 | US4457873 Via n-carboxymethyl-s-methylene bisdithiocarbamate |
| 07/03/1984 | CA1170265A1 Organophosphorus derivatives |
| 06/27/1984 | EP0112322A1 Enamine derivatives of phosphonic acid esters |
| 06/27/1984 | EP0112321A1 Enamine derivatives of phosphonic acid esters |
| 06/27/1984 | EP0112283A1 Heterocyclyl-thio compounds, process for their preparation, pharmaceutical compositions containing them and their use |
| 06/27/1984 | EP0111997A2 Vinyl carboxylic acid derivatives, their production and use |
| 06/27/1984 | EP0111950A2 Process for the preparation of bisphosphine dioxides |
| 06/26/1984 | US4456768 Chemical synthesis |
| 06/26/1984 | US4456619 Amides of 2-alkynoic acids and use for inhibiting accumulation of cholesterol ester in arterial walls |
| 06/26/1984 | US4456599 Benzothiazolesulfonamide derivatives for the topical treatment of elevated intraocular pressure |
| 06/26/1984 | US4456567 3,9-Dichloro-2,4,8,10-tetraoxa-3,9-diphosphaspiro [5,5] undecane-9-oxide and process for preparing same |
| 06/26/1984 | US4456566 Process for preparing amides of methylphosphonates |
| 06/26/1984 | US4456554 Ammonium compounds |
| 06/26/1984 | US4456540 Process of sulfurizing triglyceride and an olefin |
| 06/26/1984 | US4456539 Triazole-dithiophosphate reaction product and lubricant compositions containing same |
| 06/26/1984 | US4456538 Process for preparing molybdenum-containing compositions useful for improved fuel economy of internal combustion engines |
| 06/26/1984 | US4456465 Herbicides |
| 06/26/1984 | US4456464 Phenoxy- and pyridyloxy-phenoxyalkyl phosphinates and related sulfur compounds for weed control |
| 06/26/1984 | CA1169880A1 Method of oxidizing tertiary-alkyl phosphines |
| 06/26/1984 | CA1169871A1 Process for the preparation of new heterocyclic compounds |
| 06/20/1984 | EP0111452A1 Use of pyrroles as biocides for the protection of materials |
| 06/20/1984 | EP0111124A1 Polyene compounds, their preparation and pharmaceutical preparations containing them |
| 06/20/1984 | EP0111090A1 Indole derivatives, process for their preparation and their uses in further processing |
| 06/19/1984 | USRE31609 Method of preparing a controlled-release pharmaceutical preparation, and resulting composition |
| 06/19/1984 | US4455441 Attractant termiticidal compounds, compositions and methods of use therefor |
| 06/19/1984 | US4455421 Antifertility, antiulcer agents; tetrazole derivatives |
| 06/19/1984 | US4455291 Accelerators for forming cationic technetium complexes useful as radiodiagnostic agents |
| 06/19/1984 | US4455163 Herbicidal compositions and herbicidal processes |
| 06/19/1984 | CA1169439A1 Process to produce novel fluorocarbon vinyl ethers and resulting polymers |
| 06/19/1984 | CA1169436A1 Fluorocarbon ethers having substituted halogen site(s) and process to prepare |
| 06/19/1984 | CA1169433A1 Method for preparing an antihypertensive agent comprising 1-0-alkyl-2-acetoyl-sn-glycero-3- phosphocholine |
| 06/19/1984 | CA1169432A1 Process for the preparation of malathion |
| 06/19/1984 | CA1169239A1 Use of asymmetrical phosphate esters as corrosion inhibitors |
| 06/13/1984 | EP0110826A1 6-Hydroxy lower alkyl penem compounds, process for their preparation, pharmaceutical compositions containing them and their use |
| 06/13/1984 | EP0110820A1 Amino-substituted dibenzodioxaphosphepines and dioxaphosphocines |
| 06/13/1984 | EP0110814A2 Beta-carbolines, process for their preparation and pharmaceutical compositions containing them |
| 06/13/1984 | EP0110813A2 Process for producing beta-carboline derivatives |
| 06/13/1984 | EP0110396A2 Iron-tetraphenylporphine complex having phosphocholine group and oxygen adsorbing and desorbing agent |
| 06/13/1984 | EP0110305A1 Process for preparing aromatic phosphorus-chlorine compounds |
| 06/13/1984 | EP0110293A2 Sterically hindered phenyl bis(naphthyl)phosphites and compositions thereof |
| 06/12/1984 | US4454353 Trihydrocarbyl silyl substituted alkyl diaryl phosphine transition metal complexes and their use as homogeneous hydroformylation-aldolization catalysts |
| 06/12/1984 | US4454349 Perfluoroalkylether substituted phenyl phosphines |
| 06/12/1984 | US4454126 Phosphoramide derivatives and medicines containing the same |
| 06/12/1984 | US4454073 N-[Carboxyl(carbamoyl)carbonyl)-aminomethyl phosphonic acids |
| 06/12/1984 | US4454070 Transition metal-complex compounds and method for making the same |
| 06/12/1984 | US4454064 Process for preparing pentaerythritol phosphate |
| 06/12/1984 | US4454063 Postemergence herbicides |
| 06/12/1984 | US4453965 N-Isopropylcarbanilylmethyl dithiophosphates as pre-emergent herbicides |
| 06/12/1984 | CA1169091A1 Process for the manufacture of 1-aminoalkane-1,1- diphosphonic acids |
| 06/12/1984 | CA1169087A1 Antimony mercaptocarboxylic acid ester stabilizers for polyvinyl chloride resin compositions and process |
| 06/12/1984 | CA1169082A1 Process for the synthesis of tertiary phosphine oxides, and new tertiary phosphine oxides |
| 06/12/1984 | CA1169073A1 Phosphinylalkanoyl substituted prolines |
| 06/12/1984 | CA1169045A1 Process of sulfurizing lard oil and an olefin and resultant product |
| 06/07/1984 | WO1984002131A1 Analogs of mevalolactone and derivatives thereof, processes for their production, pharmaceutical compositions containing them and their use as pharmaceuticals |
| 06/07/1984 | WO1984000362A3 New d-mannite derivatives as starting products for the synthesis of phospholipids |
| 06/05/1984 | US4452849 Phosphonic acid salts, their preparation and their use for fireproofing organic fibre material |
| 06/05/1984 | US4452792 Acridine substituted phosphorus compounds and their insecticidal use |
| 06/05/1984 | US4452791 Aminoalkyl and related substituted phosphinic acid angiotensin converting enzyme inhibitors |
| 06/05/1984 | US4452790 Phosphonyl hydroxyacyl amino acid derivatives as antihypertensives |
| 06/05/1984 | US4452743 Process for the separation of oils and/or phosphatidylethanolamine from alcohol soluble phosphatidylcholine products containing the same |
| 06/05/1984 | US4452724 Alkyl vanadate color improvement |
| 06/05/1984 | US4452716 Mixed trialkylphosphine oxides as functional fluids |
| 06/05/1984 | CA1168604A1 Glycerol-3-phosphoric acid halogenoalkyl esters and processes for their preparation and further conversion |
| 05/30/1984 | EP0109909A1 Derivatives of 2,2-dimethyl-3-(2-fluoro-3-oxo-3-(1,1-dimethylethoxy)-1-propenyl)cyclopropanecarboxylic acid |
| 05/30/1984 | EP0109600A1 3-Chloro-3-phenylprop-2-enyl-thiophosphoric-acid ester, process for its preparation and its use as a pesticide |
| 05/29/1984 | US4451673 Trihydrocarbyl silyl substituted alkyl diaryl phosphine transition metal complexes and their use as homogeneous isomerization hydroformylation catalysts |
| 05/29/1984 | US4451653 Heterocyclic substituted triazolyl phosphorous compounds |
| 05/29/1984 | US4451652 Substituted theophylline salts |
| 05/29/1984 | US4451450 Technetium-99 complexes |
| 05/29/1984 | US4451410 Process for preparing condensed polyalkoxyphosphazene |
| 05/29/1984 | US4451284 Derivatives of 2-nitro-4- or -5-pyridyloxyphenylphosphonic acid, the preparation thereof, the use thereof as herbicides and/or plant growth regulators |
| 05/29/1984 | CA1168254A1 Process for producing dialkyl phosphorochloridothionates |
| 05/29/1984 | CA1168245A1 Carboxyalkanoyl and hydroxycarbamoylalkanoyl derivatives of substituted prolines |
| 05/29/1984 | CA1168240A1 Pyrimidine-2-sulphides and their s-oxides for use in medicine |
| 05/23/1984 | EP0109362A1 Hetereocyclic compounds, process for their preparation, pharmaceutical compositions containing them and their use |
| 05/23/1984 | EP0109354A1 Biocidally active mixture |
| 05/23/1984 | EP0109314A1 Aluminum N-phosphonomethylglycine and its use as a herbicide |