| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 01/20/1988 | EP0253271A1 Fluorescence polarization method for monitoring fetal lung maturity |
| 01/20/1988 | EP0253179A2 A-acylamino aminoalkyl phophonate angiotensin converting enzyme inhibitors |
| 01/20/1988 | EP0253005A1 Epoxy phosphate compounds and process for the preparation thereof |
| 01/20/1988 | EP0252928A1 Phosphinylalkanoyl imino acids |
| 01/20/1988 | CN87103510A 5-sulfur substituted pyridine monocarboxylic herbicides |
| 01/19/1988 | US4720589 Bis-phosphineoxide compounds |
| 01/19/1988 | US4720565 Process for preparing O-alkyl S-(alpha-branched alkyl) alkylphosphonothioate |
| 01/19/1988 | US4720561 Preparation of metal alkyls |
| 01/19/1988 | US4720560 Hybrid organometallic compounds, particularly for metal organic chemical vapor deposition |
| 01/19/1988 | US4720488 2-phenylimino-1,3-thiazolidin-3-organophosphorus compounds having pesticidal activity |
| 01/19/1988 | US4720352 Process for the preparation of vanadium-containing mixed metal soap solutions |
| 01/19/1988 | CA1231720A1 Additives for lubricants |
| 01/19/1988 | CA1231513A1 Process for the preparation of phosphonitrile chloride oligomer |
| 01/14/1988 | WO1988000199A1 New thiophosphate ester; also polyurethane foam or prepolymer, containing tris- and bis- (2,4,6-tribromophenoxy) (thio) phosphate |
| 01/14/1988 | WO1988000197A1 Benzopyran and benzothiopyran derivatives and compositions containing them |
| 01/14/1988 | WO1988000183A1 S-trifluorobutenyl derivatives and pesticidal uses |
| 01/14/1988 | WO1988000061A1 BONE-SEEKING COMPLEXES OF TECHNETIUM-99m |
| 01/14/1988 | DE3722043A1 Solutions of oxazaphosphorines with an improved stability, and process for their preparation |
| 01/14/1988 | DE3721305A1 6-trifluormethyl-1h-benzotriazol-1-yl-diphenylphosphat und seine verwendung zur herstellung von cephalosporinderivaten 6-trifluoromethyl-1H-benzotriazol-1-yl-diphenyl phosphate and its use for the manufacture of cephalosporin derivatives |
| 01/13/1988 | EP0252885A1 Bicyclic thiaaza compounds |
| 01/13/1988 | EP0252880A2 Hydroxyphosphono carboxylic acids |
| 01/13/1988 | EP0252824A1 Surface-active compositions based on phosphoric esters, method of preparing them, and their use in the production of active materials |
| 01/13/1988 | EP0252683A2 Process and reagents for DNA sequence analysis |
| 01/13/1988 | EP0252505A1 1-Hydroxy-3-(N-methyl-N-propyl amino)propane-1,1-diphosphonic acid, process for its preparation and medicines containing this compound |
| 01/13/1988 | EP0252504A1 Diphosphonic-acid derivatives, process for their preparation and medicines containing these compounds |
| 01/13/1988 | EP0252405A2 3-methoxy-4-hydroxyphenylglycol fluorescence polarization immunoassay |
| 01/13/1988 | EP0252244A1 Process for preparing vinyldiphosphonic acid and its salts |
| 01/13/1988 | CN87104606A S-trifluoro bulenyl derivatives and its usage of insecticide |
| 01/13/1988 | CN87100286A Dihydropyridine-5-phosphonic acid cyclic propylene ester |
| 01/12/1988 | US4719297 Acylphosphine compounds and their use as photoinitiators |
| 01/12/1988 | US4719203 Diphosphonic acid derivatives, processes for the preparation thereof and pharmaceutical compositions containing them |
| 01/12/1988 | US4719097 Phosphates of resorufin derivatives and compositions thereof for the determination of the activity of phosphatases |
| 01/12/1988 | US4719050 Diphosponylated oxonitriles, processes and uses therefor, and compositions containing them |
| 01/12/1988 | US4719031 Polymeric alkylene diphosphonate anhydrides, their production and use |
| 01/12/1988 | CA1231349A1 Process for the racemization of optically active aminoacids |
| 01/12/1988 | CA1231344A1 4h-thiopyran-1,1-dioxide and electrophotographic layers and elements comprising same |
| 01/07/1988 | EP0252055A1 Substituted pyridine herbicides |
| 01/07/1988 | EP0251941A1 Process for preparing paranitrophenol |
| 01/07/1988 | EP0251786A2 Alkynylamino-nucleotides |
| 01/07/1988 | EP0251657A2 Therapeutic compositions with galactitol as carrier |
| 01/07/1988 | EP0251472A2 Pesticidal unsaturated lipid amides |
| 01/07/1988 | EP0251324A2 Process for the preparation of antibiotics |
| 01/07/1988 | EP0251249A2 Alkyl-hydroxyalkyl phosphoric-acid ester |
| 01/07/1988 | EP0251246A1 Process for converting organohydroxyl compounds to halides |
| 01/07/1988 | EP0251229A1 Polymerizable beta-glycerophospholipid and method for production thereof |
| 01/07/1988 | EP0251164A2 New chiral phosphinopyrrolidine compounds and their use for asymetric synthesis of optically active compounds |
| 01/07/1988 | EP0251082A2 Substituted acrylic acid esters and fungicides containing these compounds |
| 01/07/1988 | EP0250446A1 Process for the preservation of organic products. |
| 01/05/1988 | US4717775 Transition metal complex catalyzed reactions |
| 01/05/1988 | US4717512 Preparation of acylated glycerophosphocholines and glycerophosphoethanolamines |
| 01/05/1988 | US4717492 Phenolic-containing Mannich base reaction products and lubricant compositions containing same |
| 01/05/1988 | US4717491 Reaction products of dialkyl and trialkyl phosphites with elemental sulfur, organic compositions containing same, and their use in lubricant compositions |
| 01/05/1988 | CA1231103A1 Process for the preparation of phosphinothricin |
| 01/05/1988 | CA1231101A1 Organophosphorus compound, process for its preparation and insecticidal, miticidal or nematicidal composition containing it |
| 01/05/1988 | CA1231100A1 0-(5-trifluoromethylpyrid-2-yl) phosphoric acid esters |
| 01/05/1988 | CA1231096A1 Photopolymerizable organic compositions and diaryliodonium salts used therein |
| 12/29/1987 | US4716250 Complexed with rhodium |
| 12/29/1987 | US4716242 Salts of oxazaphosphorine derivatives |
| 12/29/1987 | US4716232 Intermediates for antibiotics |
| 12/29/1987 | US4716230 Certain bis(di-2 or 4-pyridyl-phosphino) alkanes #10 having anti-tumor properties |
| 12/29/1987 | US4716222 Substrates for hydrolases |
| 12/29/1987 | US4716156 Insecticides, miticides |
| 12/29/1987 | US4716155 Phosphorus containing compounds and hypotensive use thereof |
| 12/29/1987 | US4715994 Phosphinic acid derivatives |
| 12/29/1987 | US4715889 Herbicides |
| 12/29/1987 | US4715882 Pre- and postemergence |
| 12/29/1987 | CA1230885A1 Process for preparing organic chlorophosphanes |
| 12/29/1987 | CA1230877A1 Quinoline derivatives and their use for controlling undesirable plant growth |
| 12/23/1987 | EP0250367A2 Stabilizers for organic polymers |
| 12/22/1987 | US4714771 Process for preparing halogenated trialkyl phosphate esters |
| 12/22/1987 | US4714724 Dibromoneopentyl phosphate melamine salt flame retardant |
| 12/22/1987 | US4714571 Preferential solvent extraction |
| 12/22/1987 | US4714491 Diphenyl ether herbicides |
| 12/17/1987 | WO1987007638A2 Phosphorous- and sulfur-containing lubricant and functional fluid compositions |
| 12/17/1987 | WO1987007609A1 1,1,2-triaryl-1-butene derivatives |
| 12/17/1987 | WO1987007602A2 N-(5-substituted methylene) phenyl herbicides |
| 12/17/1987 | WO1987007600A2 Chelate ligands for low pressure hydroformylation catalyst and process employing same |
| 12/17/1987 | WO1987007599A2 Anti-inflammatory compositions |
| 12/16/1987 | EP0249445A2 Substituted aminoalkanoylaminoalkyl phosphonate angiotensin converting enzyme inhibitors |
| 12/16/1987 | EP0248972A2 Ammoniummonofluorophosphates, process for their preparation and their use |
| 12/16/1987 | EP0248858A1 Novel phospho-compounds and medicaments containing these. |
| 12/16/1987 | CN87103168A Substituted pyrimidines |
| 12/15/1987 | US4713465 Flavanone intermediates for halogenohydroxyflavones |
| 12/15/1987 | US4713313 Quaternary group compounds of pyridine or pyrimidine as silver halide solvents for diffusion transfer |
| 12/09/1987 | EP0248491A2 Method for preparing diesters of phosphonic acids |
| 12/09/1987 | EP0248062A1 Medicaments. |
| 12/09/1987 | EP0248047A1 Medicament with anti-tumoral action containing hexadecylphosphocholine. |
| 12/09/1987 | EP0112871B1 Derivatives of n,n-bis(2-chloroethyl)-phosphoric acid amide |
| 12/08/1987 | US4711884 Hypotensive agents; angiotensin enzyme inhibiting activity |
| 12/08/1987 | US4711880 For calcium and phosphate metabolism disorders |
| 12/08/1987 | CA1230194A1 Immobilized epoxy advancement initiators |
| 12/03/1987 | WO1987005781A3 Synergistic plant growth regulator compositions |
| 12/02/1987 | EP0247595A2 New azaphospholones and use thereof |
| 12/01/1987 | US4710587 Process for removing triorganophosphine from an organic liquid |
| 12/01/1987 | US4710580 Antiallergens; antiinflammatory agents |
| 12/01/1987 | US4710579 2-(acetoacetyloxy)-3-(octadecyloxy)propyl-3-trimethylammoniopropyl phosphate or a pharmaceutically acceptable salt thereof |
| 12/01/1987 | US4710576 Complexes |
| 12/01/1987 | US4710523 Discoloration, wear resistant surface coating, finishes, and printing ink |
| 12/01/1987 | US4710494 Bisthiophosphates and their use for controlling pests |
| 12/01/1987 | US4710488 Synthetic blood; low oxygen affinity |