| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 05/05/1988 | DE3737152A1 Novel 2-phenyl-4,5,6,7-tetrahydroisoindole-1,3(2H)-diones |
| 05/04/1988 | EP0266272A1 Process for the recovery of acid organo-phosphorous compounds and/or organo-phosphorous ions from an aqueous solution, and its use in treating aqueous effluents |
| 05/04/1988 | EP0266168A2 Compositions and methods for the synthesis of oligonucleotides having 5'-phosphorylated termini |
| 05/04/1988 | EP0265824A2 Amphoteric and zwitterionic tensioactive phosphates |
| 05/04/1988 | CN87104306A Catalyst composition and olefin/co copolymerization process |
| 05/03/1988 | US4742178 Rhodium complex catalyst |
| 05/03/1988 | US4742088 Phosphorus-containing nitrogen compounds as flame retardants and synthetic resins containing them |
| 05/03/1988 | US4742060 Heterocyclic compounds |
| 05/03/1988 | US4742052 Antibacterial β-lactam compounds |
| 05/03/1988 | US4741857 Method of purifying neutral organophosphorus extractants |
| 05/03/1988 | US4741767 2H-Imidazo(1',2':1,2)pyrrolo(3,4-B)pyridine compounds, and their use as herbicidal agents |
| 05/03/1988 | CA1236014A1 Polysaccharide haemoglobin complexes |
| 05/03/1988 | CA1235891A1 Process for preparation of chalcogenide alloys by coreduction of esters |
| 04/28/1988 | DE3636001A1 Process for the preparation of tertiary phosphine oxides |
| 04/27/1988 | EP0265412A2 2-Amino-4-Phosphonyl-butanoate derivates and preparation of 2-amino-4-phosphinyl butanoic acids |
| 04/27/1988 | EP0265196A2 The stabilization of dye images produced in photographic materials |
| 04/27/1988 | EP0265050A1 Mitomycin derivatives |
| 04/27/1988 | EP0264901A1 Acylation products of bis(2-imidazolin-2-ylhydrazones) of 9,10-anthracenedicarboxaldehyde |
| 04/26/1988 | US4740609 Phosphoric esters and process for preparing same |
| 04/26/1988 | US4740608 (Phosphonomethyl)trifluoromethyl sulfonates |
| 04/26/1988 | US4740507 Carbapenem compounds and use |
| 04/26/1988 | US4740505 Pyridazinyloxy (or thio) phenyl phosphates |
| 04/26/1988 | US4740332 Process for preparing phosphonous acids |
| 04/26/1988 | US4740235 3-fluoropyridyl-2-oxy-phenoxy derivatives having herbicidal activity |
| 04/26/1988 | CA1235704A1 Bis(aminoalkyl)piperazine derivatives and their use as metal ion control agents and cement set retarding agents |
| 04/20/1988 | EP0264038A1 Cytostatics containing glycidyl groups |
| 04/20/1988 | CN86105481A Preparation of surface active agent from phosphatide of rape oil |
| 04/19/1988 | US4739095 Derivatives of N,N-(2-chloro-ethyl)-phosphoric acid amide |
| 04/19/1988 | US4739093 Novel phosphorus compounds for protecting cultivated plants from the phytotoxic action of herbicides |
| 04/19/1988 | US4739092 Converting monophosphate into a monophosphoric ester salt with a basic compound; extracting with aliphatic and cycloaliphatic solvents |
| 04/19/1988 | US4739091 Neucarbyl-substituted phosphorates |
| 04/19/1988 | US4739090 Reacting phosphorous trichloride, pentaerythritol, and alkyl phenol in presence of catalyst |
| 04/19/1988 | US4739088 Reacting amides with alcoholic metal salts; removing alcohol; reacting with organosilanes |
| 04/19/1988 | US4739086 Reacting vanadium oxytrihalide with alkali metal alkoxide |
| 04/19/1988 | US4739079 Analgesics, antidiarrhea, antiemetic agents |
| 04/19/1988 | US4739073 Intermediates in the synthesis of indole analogs of mevalonolactone and derivatives thereof |
| 04/19/1988 | US4739057 Using an arylphosphorushalide |
| 04/19/1988 | US4739049 Phosphorylation of cyclic amides |
| 04/19/1988 | US4739000 Antioxidant aromatic tetraphosphites |
| 04/19/1988 | US4738803 Enzyme inhibitors |
| 04/19/1988 | US4738711 Diphenyl ether carboxylic acids and salts and esters thereof useful as herbicides |
| 04/19/1988 | US4738708 N-sulphonyl-N-[N'phosphonomethylglycyl]amine and derivatives as herbicides |
| 04/19/1988 | CA1235414A1 7-acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
| 04/13/1988 | EP0263502A2 Oligopeptide antibiotics |
| 04/12/1988 | US4737593 Bisacylphosphine oxides, the preparation and use thereof |
| 04/12/1988 | US4737588 Transition metal complex catalyzed reactions |
| 04/12/1988 | US4737490 S-(3-buten-1-yl) trithiophosphonate insecticides |
| 04/12/1988 | US4737317 Vapor phase reaction of benzene with phosphorus trichloride using aluminum/aluminum chloride catalyst; low temperature |
| 04/12/1988 | US4737295 With phosphatides |
| 04/12/1988 | CA1235142A1 Process for the preparation of bifunctional tertiary aromatic phosphine sulfides |
| 04/12/1988 | CA1235134A1 Benzo-1,4-quinones |
| 04/12/1988 | CA1235079A1 Process for the preparation of nucleoside alkyl-, aralkyl- and aryl-phosphonites and -phosphonates |
| 04/07/1988 | WO1987007600A3 Chelate ligands for low pressure hydroformylation catalyst and process employing same |
| 04/07/1988 | WO1987005897A3 Use of malonic acid derivative compounds for increasing crop yield |
| 04/06/1988 | EP0262394A2 Process for preparing vinylphosphonic acid dichloride |
| 04/06/1988 | EP0262227A1 Process for the preparation of myoinositol derivatives |
| 04/06/1988 | EP0262209A1 Synergistic plant growth regulator compositions. |
| 04/06/1988 | CN87105777A Heterocyclic compounds |
| 04/05/1988 | US4736065 Pesticides |
| 04/05/1988 | US4736053 Phosphoric ester derivatives and insecticidal and miticidal compositions containing said derivatives |
| 04/05/1988 | US4736052 Purification of diaryl alkylphosphonate reaction mixture |
| 04/05/1988 | US4736051 Process for the preparation of an alkali metal salt of a diester phosphoric acid |
| 04/05/1988 | US4736050 By siomerization of oxygen substituted phosphorochlorodithionate |
| 04/05/1988 | US4735936 Pharmaceutical composition containing inositol triphosphate |
| 04/05/1988 | US4735902 Stabilized composition containing inositoltriphosphate |
| 04/05/1988 | US4735748 Using thionyl chloride and phosphonic acid dialkyl ester and a phosphonium catalyst |
| 04/05/1988 | US4735649 Hydroxyalkyl esters of n-phosphonomethylclycine |
| 04/05/1988 | CA1234839A1 Process for the preparation of tertiary phosphine oxides |
| 04/05/1988 | CA1234834A1 Phospholipids |
| 04/05/1988 | CA1234823A1 Oximinophosphoric acid derivatives, their preparation and their use for controlling pests |
| 03/31/1988 | DE3633243A1 Phosphonate complexes |
| 03/30/1988 | EP0262009A1 Process for preparing phosphinous acid derivatives and intermediate products used therefor |
| 03/30/1988 | EP0261802A2 Perfluoro hexamethyltetramine and synthetic phospholipids, useful in synthetic blood |
| 03/30/1988 | EP0261283A1 Amino-derivatized phosphite and phosphate linking agents, phosphoramidite precursors and useful conjugates thereof |
| 03/30/1988 | EP0261226A1 Use of malonic acid derivative compounds for increasing crop yield |
| 03/30/1988 | CN85103541B Method of synthesis of yi-liu-liu |
| 03/29/1988 | US4734517 N-phosphonomethylaminomethylboronic acid derivatives |
| 03/29/1988 | US4734514 Hydrocarbon-substituted analogs of phosphine and arsine, particularly for metal organic chemical vapor deposition |
| 03/29/1988 | US4734505 1-(alkylated)-2-(acylated)diazolidinones |
| 03/29/1988 | US4734504 Intermediates for bicyclic pyrazolidinone bactericides |
| 03/29/1988 | US4734404 Insecticides, miticides |
| 03/29/1988 | US4734283 Method of making a food composition containing inosotoltriphosphate and the composition |
| 03/29/1988 | US4734225 D-mannite derivatives as starting products for the synthesis of phospholipids |
| 03/29/1988 | US4734120 Pre- and postemergence herbicides |
| 03/29/1988 | US4734119 Novel phosphorus compounds for protecting cultivated plants from the phytotoxic action of herbicides |
| 03/29/1988 | CA1234568A1 Bicyclic pyrazolidine, pyridazine and diazepine derivatives |
| 03/24/1988 | WO1988002004A1 Amino-derivatized phosphite and phosphate linking agents, phosphoramidite precursors, and useful conjugates |
| 03/24/1988 | WO1988000611A3 Lubricant and fuel additives derived from o,o-dialkyldithiophosphoric acid and a norbornyl reactant |
| 03/24/1988 | WO1987007602A3 N-(5-substituted methylene) phenyl herbicides |
| 03/24/1988 | WO1987004430A3 Fused benzazepines |
| 03/23/1988 | EP0260939A2 Molecules with antibody combining sites that exhibit catalytic properties |
| 03/23/1988 | EP0260605A2 Dihydropyridine-5-phosphonic acid cyclic ester |
| 03/23/1988 | EP0260380A2 Liquid polyvinyl chloride resin stabilizer systems based on complexes of organic triphosphites with zinc chloride |
| 03/22/1988 | US4733000 Oligopeptides for hypotensives |
| 03/22/1988 | US4732998 Bisphosphonic acids and esters |
| 03/22/1988 | US4732997 Dibenzoxaphosphorin compounds |
| 03/22/1988 | US4732977 Bactericides |
| 03/22/1988 | US4732912 Phenol derivatives |
| 03/16/1988 | EP0259836A2 Process for obtaining phosphatidyl choline from a phosphatide mixture |
| 03/16/1988 | EP0259803A2 Nadimido-substituted cyclophosphazenes and thermosets thereof |