| Patents for C07D 277 - Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings (33,621) |
|---|
| 06/18/2008 | EP1283830B1 Para-amine substituted phenylamide glucokinase activators |
| 06/18/2008 | EP0885210B2 Tricylic compounds having binding affinity for melatonin receptors, their production and use |
| 06/18/2008 | CN101203499A Alkyl sulfonamide derivatives |
| 06/18/2008 | CN101200416A Method for preparing anti-diabetic nateglinide ketone intermediates |
| 06/17/2008 | US7388098 Dynamic resolution of isomers and resolved isomers |
| 06/17/2008 | US7388097 controlling microorganisms; microbiocides; fungicides |
| 06/17/2008 | US7387751 Method of preparing organomagnesium compounds |
| 06/17/2008 | CA2369947C Hydroxamic acid derivative |
| 06/12/2008 | WO2008068470A1 Antibacterial polycyclic urea compounds |
| 06/12/2008 | WO2008067773A1 New crystal types of febuxostat and their preparation methods |
| 06/12/2008 | WO2008015517A3 Ep2 agonists |
| 06/12/2008 | WO2007089548A3 Compounds and methods for modulating protein trafficking |
| 06/12/2008 | US20080139811 Reacting an amino, hydroxy substituted amide with a heterocyclic substituted carboxylic acid to produce (2S,3S,5S)-2-(2,6-Dimethylphenoxyacetyl) amino-3-hydroxy-5-[2S-1-imidazolidin-2-onyl)-3-methyl-butanoyl] amino-1,6-diphenylhexane; inhibitors of HIV infection |
| 06/12/2008 | US20080139786 Exposing azo, azide and sulfenate agents to visible or infrared light; use in medical procedures to cause necrosis or apoptosis of tissue |
| 06/12/2008 | US20080139599 e.g. 4-[6-(5-methyl-2-phenyloxazol-4-ylmethoxy)-1-oxoindan-5-yl]benzoic acid; antidiabetic and antilipemic agent, obesity; atherosclerosis; coupling benzene derivatives folowed by hydration and alkylation |
| 06/12/2008 | US20080139565 Anthranilic Acid Derivatives and Their Use in Treatment of Diseases of Lipid Metabolism, in Particular Dyslipidaemia |
| 06/12/2008 | US20080139562 e.g. {-[3-Cyclopentyl-2-(4-methane sulfonyl-phenyl)-propionylamino]-5-methyl-thiazol-4-yl}-acetic acid ethyl ester; antidiabetic and hypoglycemic agent; non-insulin dependent diabetis, obesity, impaired glucose tolerance, eating disorder, dyslipidemia, hyperlipidemia, hypertension |
| 06/12/2008 | US20080139547 N-Hydroxyalkynylbenzamide (or hydroxamate) derivatives; anticarcinogenic and antiproliferative agents |
| 06/12/2008 | US20080139505 Potentiators Of Glutamate Receptors |
| 06/12/2008 | CA2670870A1 Antibacterial polycyclic urea compounds |
| 06/11/2008 | EP1928871A2 Bicyclic derivatives as modulators of voltage gated ion channels |
| 06/11/2008 | EP1928848A2 Sphingosine kinase inhibitors and methods of their use |
| 06/10/2008 | US7385095 Indene derivatives and organic light emitting diode using the same |
| 06/10/2008 | US7385093 Method for producing halogenated 2-(3-butenylsulphanyl)-1,3-thiazoles |
| 06/10/2008 | US7385063 Method for preparing imidazole derivatives |
| 06/10/2008 | US7384970 Inhibitors of cathepsin S |
| 06/10/2008 | US7384968 Thiazole-amine compounds for the treatment of neurodegenerative disorders |
| 06/10/2008 | US7384967 Aryl carbonyl derivatives as therapeutic agents |
| 06/10/2008 | US7384966 Anticancer, antiproliferative, antitumor agents; particularly active against breast cancer cell; compounds can be use in Positron Emission Tomography imaging; 2-(3,4-Dimethoxyphenyl)benzothiazole N-oxide |
| 06/10/2008 | US7384965 Fused heterocyclic derivatives as PPAR modulators |
| 06/10/2008 | US7384964 Synthesis of epothilones, intermediates thereto, analogues and uses thereof |
| 06/10/2008 | US7384928 7-side chain is substituted with aminothiazole and 3-position with a cyclic-type quarternary ammoniummethyl group; antibacterial activities against cephem-resistant Pseudomonas aeruginosa which produce beta -lactamase; antibiotic resistance; pharmacokinetics; high water solubility; injection |
| 06/10/2008 | US7384758 Bioluminescent protease assay with modified aminoluciferin or derivatives thereof |
| 06/10/2008 | US7384625 Containing thiazolium compounds. |
| 06/10/2008 | US7384580 higher reactivity with an electrophile; lithium chloride complexes; using organometallic R1(MgX).LiY, a fast exchange reaction occurs leading to Grignard reagents in high yields under mild conditions; ether solvent; phenyl-(4-cyanophenyl)methanol from benzaldehyde, 4-bromobenzonitrile and i-PrMgCl.LiCl |
| 06/10/2008 | CA2129046C Opioid diarylmethylpiperazines and piperidines |
| 06/05/2008 | WO2008066145A1 Thiazole derivative and use thereof as vap-1 inhibitor |
| 06/05/2008 | US20080132709 5-benzoyl-4-amino-2-(p-methoxyphenyl)aminothiazole; solid phase synthesis on aminomethylpolystyrene beads with 1-[N-(arylthiocarbamoyl) amidino]-3,5-dimethylpyrazole to produce N (N-arylthiocarbamoyl)-N-guanidinomethyl polystyrene, reacting an a-haloketone, cyclizing, dearylation; microtubule inhibitor |
| 06/05/2008 | US20080132553 Preventing and reversing the formation of advance glycosylation endproducts |
| 06/05/2008 | US20080132543 Therapeutic and Delivery Methods of Prostaglandin Ep4, Agonists |
| 06/05/2008 | US20080132519 nuclear receptor activity modulators; 4-(ethylamino)-3-{[(2Z,5Z)-5-{[methyl(phenyl)amino]methylidene}-4-oxo-3-(phenylmethyl)-1,3-thiazolidin-2-ylidene]amino}benzonitrile; diseases or disorders affected by abnormal cholesterol, triglyceride, or bile acid levels |
| 06/05/2008 | US20080132494 Thiazole and oxazole-substituted arylamides as P2X3 and P2X2/3 antagonists |
| 06/05/2008 | US20080132459 Inhibitors of Histone Deacetylase |
| 06/04/2008 | EP1926826A2 Class iia histone deacetylase (hdac) substrate |
| 06/04/2008 | EP1926729A1 Benzothiazole cyclobutyl amine derivatives and their use as histamine-3 receptors ligands |
| 06/04/2008 | EP1926721A2 Thiophene and thiazole substituted trifluoroethanone derivatives as histone deacetylase (hdac) inhibitors |
| 06/04/2008 | EP1926719A2 2-aniline-4-aryl substituted thiazole derivatives |
| 06/04/2008 | EP1926718A1 Pesticide thiazolyloxy substituted phenylamidine derivatives |
| 06/04/2008 | EP1926486A1 Novel polymorphs of (s)-2,6-diamino-4,5,6,7-tetrahydrobenzothiazole monotartrate and methods of producing and using the same |
| 06/04/2008 | EP1343775B1 Piperazine derivatives |
| 06/04/2008 | EP1204643B1 Fungicidal heterocyclic aromatic amides and their compositions, methods of use and preparation |
| 06/04/2008 | EP1193250B1 Phenyl sulfamate derivatives |
| 06/04/2008 | CN101193880A Exo- and diastereo- selective syntheses of himbacine analogs |
| 06/04/2008 | CN101193876A Process for preparing ligands of PPARdelta and the intermediate compounds for preparing the same |
| 06/04/2008 | CN101193863A 5(Z)-5-(6-quinoxalinylmethylidene)-2-[(2,6-dichlorophenyl)amino]-1,3-thiazol-4(5H)-one |
| 06/04/2008 | CN101193635A Multicyclic compounds and methods of their use |
| 06/04/2008 | CN100391949C SW diaryl ethylene compounds and preparation and application thereof |
| 06/04/2008 | CN100391947C Biphenylcarboxamide compound |
| 06/03/2008 | US7381749 Sulfonamides as inhibitors of histone deacetylase for the treatment of disease |
| 06/03/2008 | US7381736 N-(4-{2-[[3-Bromo-4-(difluoro-phosphono-methyl)-benzyl]-(3 ,4-dichloro-phenyl)-amino]-thiazol-4-yl}-phenyl)-oxalamic acid; antidiabetic, hypotensive agent; ischemia, kidney failure, atherosclerosis, metabolic syndrome, insulin resistance, leptin resistance, obesity, neurodegenerative diseases |
| 06/03/2008 | US7381734 Serine protease inhibitors |
| 06/03/2008 | CA2335560C New 2-aminothiazol-fused 2-aminoindans and 2-aminotetralins and their use |
| 06/03/2008 | CA2203237C Aminotetrazole derivatives useful as nitric oxide synthase inhibitors |
| 05/29/2008 | WO2008063781A2 Chemical compounds as cannabinoid receptor ligands |
| 05/29/2008 | WO2008062892A1 Heterocyclic compounds and heterocyclic polymers |
| 05/29/2008 | WO2008062276A2 Acetylene derivatives as stearoyl coa desaturase inhibitors |
| 05/29/2008 | WO2008061795A2 N- (methyl) -1h- pyrazol- 3 -amine, n- (methyl) -pyridin-2-amine and n- (methyl) -thiaz0l-2-amine derivatives for the treatment of diseases associated with amyloid or amyloid-like proteins, like e.g. alzheimer's |
| 05/29/2008 | US20080125596 Coupling 4-(5-isopropyl-2-methyl-1,3-thiazol-4-yl)-phenol, produced starting from anisole, with 4-(5-halo-pentoxy)-benzonitrile, and reacting the obtained compound with hydroxylamine hydrochloride to form N-hydroxy-4-{5-[4-(5-isopropyl-2-methyl-1,3-thiazol-4-yl)phenoxy]pentoxy}benzamidine (DW-1350) |
| 05/29/2008 | US20080125470 N-(3-chloro-4-fluorophenyl)-N'-hydroxy-5-(2-(methylamino)-1,3-thiazol-4-yl)isoxazole-3-carboximidamide; cancer, viral infections, depression, a neurodegenerative disorder, trauma, age-related cataracts, organ transplant rejection, or an autoimmune disease |
| 05/29/2008 | US20080125467 (4-methylthiazol-2-yl)methyl 9-hydroxy-8-isobutyl-14-isopropyl-11,18-dimethyl-2,6,12,15-tetraoxo-3,7,13,16-tetraazanonadecan-5-ylcarbamate; Alzheimer's disease |
| 05/29/2008 | US20080125433 Method of treating hair loss using thyromimetic compounds |
| 05/29/2008 | US20080125424 Derivatives of urea and related diamines, methods for their manufacture, and uses therefor |
| 05/29/2008 | US20080125419 Benzothiazole derivatives with activity as adenosine receptor ligands |
| 05/29/2008 | CA2670418A1 N-(methyl)-1h-pyrazol-3-amine, n-(methyl)-pyridin-2-amine and n-(methyl)-thiazol-2-amine derivatives for the treatment of diseases associated with amyloid or amyloid-like proteins, like e.g. alzheimers's |
| 05/29/2008 | CA2669069A1 Process for the preparation of 2-imino-thiazolidin-4-one derivatives |
| 05/28/2008 | EP1924570A1 Azole and thiazole derivatives and their use |
| 05/28/2008 | EP1846381B1 HETEROARYLACETAMIDES AS FACTOR Xa INHIBITORS |
| 05/28/2008 | EP1633355B1 Benzothiazole derivatives and use thereof in the treatment of diseases related to the adenosine a2a receptor |
| 05/28/2008 | CN101189218A Benzothiazol-2-on derivatives as lipase and phospholipase inhibitors |
| 05/28/2008 | CN101189217A Process for producing an aminomethyl thiazole compound |
| 05/28/2008 | CN101189216A Desferrithiocin polyether analogues |
| 05/28/2008 | CN100390158C Novel theterocyclic analogs of diphenylethylene compounds |
| 05/28/2008 | CN100390135C Novel derivatives of dicarboxylic acid having pharmaceutical properties |
| 05/27/2008 | US7378530 Anti-cancer and anti-microbial 5-membered heterocyclic compounds |
| 05/27/2008 | US7378433 N-[4-(heteroarylmethyl)phenyl]-heteroarylamines |
| 05/27/2008 | US7378412 Pharmaceutical compounds |
| 05/27/2008 | US7378409 Substituted cycloalkylamine derivatives as modulators of chemokine receptor activity |
| 05/27/2008 | US7378161 Organometallic complexes and organic electroluminescence device using the same |
| 05/22/2008 | WO2008059335A1 Diaryl, dipyridinyl and aryl-pyridinyl derivatives and uses thereof |
| 05/22/2008 | WO2008021926A3 Modulators of glucocorticoid receptor, and/or ap-1, and/or nf-kb activity and use thereof |
| 05/22/2008 | WO2007104557A3 Novel heterocyclic nf-kb inhibitors |
| 05/22/2008 | US20080119655 preparing biotin through intermediiate such as Di(imidazolidinylmethyl)disulfide compound; transformation of thiazole ring to imadazole ring with methyl mercaptan appendage |
| 05/22/2008 | US20080119526 Ep2 receptor agonists |
| 05/22/2008 | US20080119520 Disorders related to memory and cognition processes, neurological processes, cardiovascular function, and body weight; benzoxazole, benzimidazole, and indole compounds substituted with pyrrole, azepane, piperidine or azetidine e.g. 4-{2-[2-(2-methyl-pyrrolidin-1-yl)-ethyl]-benzooxazol-5-yl}-benzonitrile |
| 05/22/2008 | US20080119464 N-(4-piperidin-1-yl-phenyl)-2-[5-(thiaxolidine-3-carbonyl)-pyrrolidin-3-ylidene]-acetamide;antidiabetic agents; hyperglycemia, syndrome X, hyperinsulinemia, obesity, atherosclerosis |
| 05/22/2008 | US20080119456 [2-benzhydryl-4-(4-chlorophenyl)-thiazol-5-yl]-acetic acid; Chemoattractant Receptor-homologous molecule expressed on T Helper cells type 2 ligand; antiallergen and antiinflammatory agent; asthma, rhinitis, allergic airway syndrome, allergic rhinobronchitis; Alzheimer's disease, rheumatoid arthritis |
| 05/22/2008 | US20080119455 {2-[3-(4-Methyl-2-[2-methypropoxy]phenyl)-ureido]-thiazol-4-yl}-acetic acid ethyl ester; glucokinase inhibitor; antidiabetic, hypoglycemic agent; activators of glucokinase |
| 05/22/2008 | US20080119454 Aryl carbonyl derivatives as therapeutic agents |
| 05/21/2008 | EP1922312A1 Thiazole compounds and their use as pgd2 antagonists |
| 05/21/2008 | EP1562921B1 Process for preparing 2,6-diamino-4,5,6,7-tetrahydro-benzothiazole |