| Patents for C07D 271 - Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms (7,144) |
|---|
| 05/05/2011 | US20110105485 Alpha-(N-Sulfonamido)Acetamide Derivatives as Beta-Amyloid Inhibitors |
| 05/05/2011 | US20110105432 Aminocarboxylic acid derivative and medicinal use thereof |
| 05/04/2011 | EP2315756A2 1,2,5-oxadiazoles as inhibitors of indoleamine 2,3-dioxygenase |
| 05/04/2011 | CN101638394B 6-nitro anti-caking agent and use method thereof |
| 04/27/2011 | EP2313380A1 Oxadiazole derivatives for treating diabetes |
| 04/27/2011 | EP1841426B1 Tertiary carbinamines having substituted heterocycles, which are active as inhibitors of beta-secretase, for the treatment of alzheimer's disease |
| 04/26/2011 | CA2477657C Cathepsin cysteine protease inhibitors |
| 04/21/2011 | WO2011046954A1 Hematopoietic growth factor mimetic small molecule compounds and their uses |
| 04/21/2011 | US20110092554 1,3,5 tri-subtituted benzenes for treatment of alzheimer's disease and other disorders |
| 04/20/2011 | EP2310378A2 Oxadiazole-2-oxides as antischistosomal agents |
| 04/19/2011 | CA2384417C Novel dicarboxylic acid derivatives with pharmaceutical properties |
| 04/14/2011 | WO2011044307A1 Phenyloxadiazole derivatives as pgds inhibitors |
| 04/14/2011 | WO2011043480A1 Homocysteine synthase inhibitor |
| 04/14/2011 | WO2011043479A1 Therapeutic agent for cerebral infarction |
| 04/14/2011 | US20110086893 Oxa- and thiadiazoles and their use as metalloproteinase inhibitors |
| 04/14/2011 | CA2776242A1 Phenyloxadiazole derivatives as pgds inhibitors |
| 04/13/2011 | EP2307381A2 New drugs for inhibiting aggregation of proteins involved in diseases linked to protein aggregation and/or neurodegenerative diseases |
| 04/13/2011 | EP2307023A1 Novel piperazine derivatives as inhibitors of stearoyl-coa desaturase |
| 04/13/2011 | EP2307013A1 Pain-relieving compositions of furoxan no donors and uses thereof |
| 04/13/2011 | CN101519385B Small molecule compound being capable of promoting proliferation of stem cells and function thereof |
| 04/12/2011 | US7923462 Catechol derivative, pharmaceutical composition containing the same, use of the catechol derivative, and use of the pharmaceutical composition |
| 04/12/2011 | CA2471099C .alpha.-(n-sulphonamido)acetamide derivatives as .beta.-amyloid inhibitors |
| 04/12/2011 | CA2387107C Derivatives of dicarboxylic acid having pharmaceutical properties |
| 04/06/2011 | EP2305640A2 Substituted diphenyl-ethers, -amines, -sulfides and -methanes for the treatment of respiratory diseases |
| 04/06/2011 | EP2305636A1 Selective androgen receptor modulators and methods of use thereof |
| 04/06/2011 | EP1836149B1 Phenylbenzoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic uses thereof |
| 04/06/2011 | CN102007107A Novel aminomethyl benzene derivatives |
| 04/06/2011 | CN102007103A Substituted sulfonic acid amide compounds |
| 04/06/2011 | CN102002014A Preparation method of substituted 1,3,4-diazole-2-(3H)-ketone |
| 04/06/2011 | CN101068796B Compounds, compositions and thin films |
| 04/05/2011 | US7919496 5-[4-(2-Trifluoromethylbenzoyl)piperazin-1-yl]-[1,3,4]thiadiazole-2-carboxylic acid ethyl ester; metabolic disorders type II diabetes, impaired glucose tolerance, insulin resistance, obesity, fatty liver, non-alcoholic steatohepatitis, dyslipidemia and metabolic syndrome; cardiovascular disorders |
| 03/31/2011 | WO2011035874A1 N-(1,2,5-oxadiazol-3-yl) benzamides and the use thereof as herbicides |
| 03/31/2011 | US20110077409 Process for the preparation of certain substituted sulfilimines |
| 03/31/2011 | US20110077251 Novel 17 beta lupane derivatives |
| 03/31/2011 | CA2775104A1 N-(1,2,5-oxadiazol-3-yl)benzamides and the use thereof as herbicides |
| 03/30/2011 | EP2301934A1 Nitrocatechol derivatives as COMT inhibitors |
| 03/30/2011 | EP2300442A2 Compounds and methods for modulating g protein-coupled receptors |
| 03/29/2011 | US7915402 Antioxidant inflammation modulators: oleanolic acid derivatives with saturation in the C-ring |
| 03/29/2011 | US7915298 Compounds and methods for leukotriene biosynthesis inhibition |
| 03/24/2011 | US20110071178 Methods and Compounds for Modulating Cannabinoid Activity |
| 03/24/2011 | US20110071126 Inhibitors of beta-secretase |
| 03/23/2011 | EP2297140A1 Novel 1,2,4 oxadiazole compounds and methods of use thereof |
| 03/22/2011 | US7910613 2-acylaminothiazole derivatives |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/16/2011 | EP2295417A1 Novel intermediates useful for preparing alpha-(n-sulfonamido)acetamide compound |
| 03/16/2011 | EP2205575B1 A novel alpha-(n-sulfonamido)acetamide compound as an inhibitor of beta amyloid peptide production |
| 03/16/2011 | EP1417186B1 Heterocyclic aryl sulphonamides |
| 03/16/2011 | CN101550111B Preparation method of 2,5-bichlorphenyl-1,3,4-furodiazole |
| 03/15/2011 | US7906724 N-type conjugated materials based on 2-vinyl-4,5-dicyanoimidazoles and their use in organic photovoltaics |
| 03/15/2011 | US7906652 Heterocycle-substituted 3-alkyl azetidine derivatives |
| 03/10/2011 | WO2011028651A1 Inhibitors of human 15-lipoxygenase-1 |
| 03/10/2011 | WO2011027888A1 Diamide-phenyl derivative and pharmaceutically acceptable salt thereof |
| 03/10/2011 | US20110060019 Heteroaryl-ureas and their use as glucokinase activators |
| 03/09/2011 | EP2291080A1 Novel modulators of sphingosine phosphate receptors |
| 03/08/2011 | US7902235 Compounds for nonsense suppression, and methods for their use |
| 03/02/2011 | EP2289510A1 Heterocyclic derivatives for the treatment of diseases mediated by stearoyl-coa desaturase enzymes |
| 03/02/2011 | EP2004601B1 Novel dipeptidyl peptidase iv inhibitors and processes for their preparation and pharmaceutical compositions containing them |
| 03/02/2011 | EP1901731B1 Niacin receptor agonists, compositions containing such compounds and methods of treatment |
| 02/24/2011 | US20110046147 17beta-hydroxysteroid dehydrogenase type 1 inhibitors for the treatment of hormone-related diseases |
| 02/24/2011 | US20110042660 Organic luminescent medium and organic el device |
| 02/23/2011 | EP2285789A1 Novel substituted pyrazoles, 1,2,4-oxadiazoles, and 1,3,4-oxadiazoles |
| 02/17/2011 | US20110040100 Crystalline forms of 3-[5-(2-fluorophenyl)-[1,2,4]oxadiazol-3-yl]-benzoic acid |
| 02/17/2011 | US20110040094 1,3,4-trisubstituted benzenes |
| 02/17/2011 | US20110039874 Monoacylglycerol lipase inhibitors for modulation of cannabinoid activity |
| 02/16/2011 | EP2284149A1 Selective androgen receptor modulators and methods of use thereof |
| 02/16/2011 | EP2283001A2 Sulfone compounds which modulate the cb2 receptor |
| 02/16/2011 | EP1379498B1 Sulphones which modulate the action of gamma secretase |
| 02/15/2011 | CA2496842C Heterocyclic aromatic compounds useful as growth hormone secretagogues |
| 02/10/2011 | WO2011016470A1 Sulfone derivative |
| 02/10/2011 | WO2011016469A1 Amide derivative |
| 02/10/2011 | US20110034450 Oxo-heterocyclic substituted carboxylic acid derivatives and the use thereof |
| 02/10/2011 | CA2770405A1 Sulfone derivative |
| 02/10/2011 | CA2770404A1 Amide derivative |
| 02/08/2011 | US7884103 such as N-(4-Chloro-phenyl)-2-methyl-2-phenylmethanesulfonylamino-3-(4-[1,2,4]triazol-1-yl-phenoxy)-propionamide, used for controlling or preventing the infestation of plants by phytopathogenic microorganisms, especially fungi |
| 02/03/2011 | US20110028463 Amide compounds |
| 02/03/2011 | US20110028449 Novel aminomethyl benzene derivatives |
| 02/03/2011 | US20110024691 Aromatic and aromatic/heteroaromatic molecular structures with controllable electron conducting properties |
| 02/02/2011 | EP2280282A1 Methods of detecting Lp-PLA2 activity |
| 02/02/2011 | EP2279173A1 New arylsulphonylglycine derivatives, the preparation thereof and their use as medicaments |
| 02/02/2011 | EP2278879A2 Compounds, compositions and methods comprising oxadiazole derivatives |
| 02/02/2011 | CN101965339A Novel catechol derivative, pharmaceutical composition containing the same, use of the catechol derivative, and use of the pharmaceutical composition |
| 02/01/2011 | US7880020 Carbamic acid compounds comprising an amide linkage as HDAC inhibitors |
| 02/01/2011 | US7879995 organic electroluminescent device has, between a pair of electrodes, at least one organic layer including a light-emitting layer, in which the organic layer contains a specific tetraphenylene compound |
| 02/01/2011 | CA2315717C Inhibition of raf kinase using substituted heterocyclic ureas |
| 01/27/2011 | US20110021448 Inhibitors for the Soluble Epoxide Hydrolase |
| 01/26/2011 | CN101959881A 5-O-substituted 3-N-phenyl-1,3,4-oxadiazolones for medical use |
| 01/26/2011 | CN101955470A Potentiators of glutamate receptors |
| 01/25/2011 | US7875637 Benzimidazole derivative and use as a II receptor antagonist |
| 01/25/2011 | CA2404125C Sulphonamido-substituted bridged bicycloalkyl derivatives |
| 01/19/2011 | EP1581509B1 1-(amino)indanes as edg receptor agonists |
| 01/19/2011 | CN101952263A Romp-polymerizable electron transport materials based on a bis-oxadiazole moiety |
| 01/18/2011 | US7872139 Heteroaryl-ureas and their use as glucokinase activators |
| 01/18/2011 | US7872032 1, 3, 4-oxadiazol-2-ones as PPAR delta modulators and their use thereof |
| 01/18/2011 | CA2321881C Non-imidazole alkylamines as histamine h3-receptor ligands and their therapeutic applications |
| 01/13/2011 | WO2010012442A8 Insecticidal benzenedicarboxamide derivative |
| 01/12/2011 | CN101945863A Oxadiazole derivatives active on sphingosine-1-phosphate (s1p) |
| 01/12/2011 | CN101945859A Bis-(sulfonylamino) derivatives in therapy |
| 01/12/2011 | CN101945848A Tetrasubstituted benzenes |
| 01/11/2011 | US7868204 Inhibitors of histone deacetylase |
| 01/11/2011 | US7868031 Propionamide compounds as antiinflammatory agents |