| Patents for C07D 249 - Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms (17,749) |
|---|
| 06/05/2008 | CA2670313A1 Polymorphic forms of deferasirox (icl670a) |
| 06/04/2008 | EP1927591A1 Polymorphic Forms of Deferasirox (ICL670) |
| 06/04/2008 | EP1204643B1 Fungicidal heterocyclic aromatic amides and their compositions, methods of use and preparation |
| 06/04/2008 | EP1193250B1 Phenyl sulfamate derivatives |
| 06/04/2008 | CN101193869A Glucocortioid mimetics, methods of making them, pharmaceutical compositions, and uses thereof |
| 06/04/2008 | CN101190901A Method for synthesizing 2-(2'-hydroxyl-4'-benzoyloxyphenyl)-2H-benzotriazole and derivative thereof |
| 06/04/2008 | CN101190900A Method for preparing omega-(1H-1,2,4-triazol-1-yl)-arylethanone |
| 06/03/2008 | US7381828 Forming a salt such as a tartrate or mandelate of 6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]-dioxol-4-yl]oxy}-1-ethanol, chemical intermediates |
| 06/03/2008 | US7381762 Ultraviolet light (UV) absorbing compounds and compositions containing UV absorbing compounds |
| 06/03/2008 | CA2256015C Crystal modification of 1-(2,6-difluorobenzyl)-1h-1,2,3-triazole-4-carboxamide and its use as antiepileptic |
| 06/03/2008 | CA2203237C Aminotetrazole derivatives useful as nitric oxide synthase inhibitors |
| 05/29/2008 | WO2008063912A1 Substituted pyrazole and triazole compounds as ksp inhibitors |
| 05/29/2008 | WO2008062235A1 Therapeutic g-quadruplex ligands |
| 05/29/2008 | US20080125587 Synthesis of triazole compounds that modulate HSP90 activity |
| 05/29/2008 | US20080125470 N-(3-chloro-4-fluorophenyl)-N'-hydroxy-5-(2-(methylamino)-1,3-thiazol-4-yl)isoxazole-3-carboximidamide; cancer, viral infections, depression, a neurodegenerative disorder, trauma, age-related cataracts, organ transplant rejection, or an autoimmune disease |
| 05/29/2008 | US20080125433 Method of treating hair loss using thyromimetic compounds |
| 05/29/2008 | US20080125409 N-tert-butyl-5-(5-methanesulfonylamino-2-pyridyl)-1-(6-methoxy-3-pyridyl)-1H-1,2,4-triazole-3-carboxamide; prophylactic and/or therapeutic agent for ischemic diseases; platelet aggregation suppressant |
| 05/29/2008 | CA2668661A1 Substituted pyrazole and triazole compounds as ksp inhibitors |
| 05/28/2008 | CN101188936A Derivatives of a 1-phenyltriazole as antiparasitic agents |
| 05/28/2008 | CN100390156C Novel antibacterial compounds, process for their preparation and pharmaceutical compositions containing them |
| 05/27/2008 | US7378529 Heteroaryl, heterocyclic and aryl compounds which inhibit leukocyte adhesion mediated by VLA-4 |
| 05/27/2008 | US7378446 1-((4,14-(Dioxo),5-(1-hydroxy,1,2-dicarboxyethyl)),3-azaoctadec-6-enyl-),4-(phenoxy)benzene derivatives and salts ; extremely potent replication inhibitory activity against the hepatitis C virus (HCV); chronic hepatitis, cirrhosis and liver cancer; mild cytotoxicity in vitro; prophylaxis; prodrugs |
| 05/27/2008 | US7378432 3-(4-(3-guanidinophenyl)-1,2,3-triazol-1-yl)benzyl phosphoric acid hydrochloride; obesity, non-insulin dependent diabetes mellitus, insulin-dependent condition, affective disorder, neurodegenerative diseases, psychotic disease; compounds having hydrophobic moiety to a terminus of a peptide GSK-3 |
| 05/22/2008 | WO2008060931A2 Method for preparing fluorinated benzotriazole compounds |
| 05/22/2008 | WO2008001195A3 Novel processes for the preparation of dpp iv inhibitors |
| 05/22/2008 | US20080119658 Histone deacetylase inhibitors |
| 05/22/2008 | US20080119648 Histone deacetylase inhibitors |
| 05/21/2008 | EP1922310A2 Triazole derivatives useful as axl inhibitors |
| 05/21/2008 | EP1362027B1 Acylated 6,7,8,9-tetrahydro-5h-benzocycloheptenyl amines and their use as pharmaceutical |
| 05/20/2008 | US7375234 Copper-catalysed ligation of azides and acetylenes |
| 05/20/2008 | US7375221 Method for azidoaminotriazole, nitrosoguanazine, and related compounds |
| 05/15/2008 | WO2008057775A2 Heterocyclic amide compounds useful as kinase inhibitors |
| 05/15/2008 | WO2008055933A1 1,2,3-triazole derivatives as sigma receptor inhibitors |
| 05/15/2008 | WO2008055932A1 1,2,4-triazole derivatives as sigma receptor inhibitors |
| 05/15/2008 | US20080114177 Method for preparing fluorinated benzotriazole compounds |
| 05/15/2008 | US20080114037 Histone deacetylase inhibitors |
| 05/15/2008 | US20080113864 (-)-Enantiomer of the 2-[2-(1-chloro-cyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-2,4-dihydro-[1,2,4]-triazole-3-thione |
| 05/15/2008 | US20080113172 Partially fluorinated compositions and surface active agents |
| 05/15/2008 | CA2668996A1 1,2,3-triazole derivatives as sigma receptor inhibitors |
| 05/15/2008 | CA2668994A1 1,2,4-triazole derivatives as sigma receptor inhibitors |
| 05/14/2008 | EP1921073A1 1,2,4-Triazole derivatives as sigma receptor inhibitors |
| 05/14/2008 | EP1921072A1 1,2,3-Triazole derivatives as cannabinoid-receptor modulators |
| 05/14/2008 | EP1921071A1 1,2,3- triazole derivatives as sigma receptor inhibitors |
| 05/14/2008 | EP1919881A1 1, 2, 3 -triazoles inhibitors of tubulin polymerization for the treatment of poliferative disorders |
| 05/14/2008 | CN101180280A 1,2,4-triazole-5-one compounds as heterocyclic reverse transcriptase inhibitors |
| 05/14/2008 | CN100387580C Tricyclic triazolobenzazepine, derivatives, process for producing the same, and antiallergic |
| 05/13/2008 | US7371871 imidazole derivatives; Alzheimer's Disease, Down syndrome and Huntington's Disease; hypotensive agents, sleeping and eating disorders, anxiolytic agents, antidepressants, antiepileptic agents, drug abuse withdrawl |
| 05/08/2008 | US20080108630 Substituted triazoles as modulators of ppar and methods of their preparation |
| 05/08/2008 | US20080108625 Substituted Triazole Derivatives as Oxytocin Antagonists |
| 05/07/2008 | EP1917323A1 Novel materials for organic electroluminescent devices |
| 05/07/2008 | CN101172983A Substituted phenylacetic acids |
| 05/06/2008 | US7368479 Alpha-sulfonylamino-acetonitriles |
| 05/06/2008 | US7368464 Alkylating 4-amino-1,2,4-triazole with a stearically hindered methyl oxirane; chemical intermediates, fungicidal compositions for cereal diseases |
| 05/06/2008 | CA2390649C 5-aryl-1h-1,2,4-triazole compounds as inhibitors of cyclooxygenase-2 and pharmaceutical compositions containing them |
| 05/06/2008 | CA2377803C Phenyl sulfamate derivatives |
| 05/06/2008 | CA2244979C Proton conductor in liquid form |
| 05/01/2008 | US20080103150 and geranylgeranyltransferase inhibitor; 3-chloromethyl-4-cyanobenzyl-5 methyl triazole; antitumor agents; prevent membrane attachment of protein p21ras and block aberrant growth of ras-transformed tumors; capable to inhibit prenylation of Ras proteins, both at enzymatic and cellular level |
| 04/30/2008 | CN101171239A 场致发光器件 Electroluminescent device |
| 04/29/2008 | US7365196 Sulphonamido-substituted bridged bicycloalkyl derivatives |
| 04/29/2008 | US7365085 2-(3-{3-[[2-chloro-3-(trifluoromethyl)benzyl](2,2-dephenylethyl)amino]propoxy}phenyl)-ethanol; agonists of the nuclear receptors, LXR alpha and LXR beta used to increase ABCA1, ABCG1, and apolipoprotein E expression and inhibiting cholesterol absorption |
| 04/29/2008 | US7365074 Pyridazine, pyrimidine and pyrazine ethyne compounds |
| 04/29/2008 | US7365068 Hepatitis C virus infections; -(3-cyclopropyl-4-(pentyloxy)phenyl)-3-nicotinoylthiourea;methyl 2-oxo-2-(5-((3-(4-(pentyloxy)-3-(trifluoromethyl)phenyl)thioureido)carbonyl)pyridin-2-ylamino)acetate |
| 04/29/2008 | CA2343204C Arylsulfonanilide ureas |
| 04/29/2008 | CA2297732C Heterocyclic vinylethers against neurological disorders |
| 04/29/2008 | CA2254833C Pharmaceutical for treatment of neurological and neuropsychiatric disorders |
| 04/24/2008 | WO2008047104A1 Process for the preparation of pure anastrozole |
| 04/24/2008 | WO2007132005A3 Hybrid compounds based on polyol(s) and at least one other molecular entity, polymer or otherwise, especially of the polyorganosiloxane type, method for the preparation thereof, and applications of the same |
| 04/24/2008 | US20080096946 Tetramethylation of 3,5-di(cyanomethyl)toluene, oxidation of the 1-methyl group to form an aldehyde, conversion to a Boc-protected hydrazone, reduction to a Boc-protected hydrazine, salt formation, conversion to anastrozole; industrial scale, high yield and purity; anticarcinogenic agent; breast cancer |
| 04/24/2008 | US20080096929 enzyme myeloperoxidase inhibitor; 5-Phenoxymethyl-4-(dihydrofuran-2-one-3-yl)-2,4-dihydro-[1,2,4]triazole-3-thione; treatment or prophylaxis of neuroinflammatory disorders including multiple sclerosis, Alzheimer's disease, Parkinson's disease and stroke, COPD, asthma, inflammatory bowel disease |
| 04/24/2008 | US20080096903 inhibitors of disease-related target, Heat Shock Protein 90 (HSP90); antiproliferative; 2-chloro-5'-sulfamoyladenosine analogs; derivatives of adenine and other purines; Sulfamic Acid 2-[6-amino-2-fluoro-8-(6-iodo-benzo[1,3]dioxol-5-ylmethyl)-purin-9-yl]-ethyl ester |
| 04/24/2008 | US20080096901 Aminotriazole compounds useful as inhibitors of protein kinases |
| 04/24/2008 | US20080096892 C-Kit Modulators And Methods Of Use |
| 04/23/2008 | EP1914225A1 Salt molten at room temperature and display device |
| 04/23/2008 | EP0974587B1 1-substituted 4-carbamoyl-1,2,4-triazol-5-one derivatives and herbicide |
| 04/23/2008 | CN101166724A Sulfonylamino(thio)carbonyl compounds in the form of herbicides or plant growth regulators |
| 04/23/2008 | CN101165048A Method for preparing polyisocyanic acid ester |
| 04/22/2008 | US7361769 Metabolic disorders, eating disorders such as hyperphagia, and diabetes |
| 04/22/2008 | US7361687 Antagonists of the B2 receptor of bradykinin; analgesics; hyperalgesia and major algesia; cancer; nontoxic; industrial scale; 5-[[(2,4-dichloro-3-methylphenyl)sulphonyl]methylamino]-N-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]methyl]-N-methyl-pentanamide |
| 04/22/2008 | US7361677 Polycyclic sulphamate compounds suitable for use as inhibitors of aromatase and/or sulphatase |
| 04/22/2008 | US7361672 Pyrazoles, triazoles, or tetrazoles substituted with an aryl- or heteroarylcarbonylamino group and an aminocarbonylmethyl group: 5-chloro-thiophene-2-carboxylic acid (1-{[2-fluoro-4-(2-oxo-2H-pyridin-1-yl)-phenylcarbamoyl]-methyl}-1H-[1,2,4]triazol-3-yl)-amide; improved selectivity towards thrombin |
| 04/22/2008 | US7361449 Specific dye compound, optical information recording medium comprising specific dye, and information recording method using this optical information recording medium |
| 04/17/2008 | WO2008044767A1 Aromatic amine derivative and use thereof |
| 04/17/2008 | WO2008043492A1 Method for producing alkaline (meth)acrylamides |
| 04/17/2008 | US20080090887 Triazole compounds that modulate HSP90 activity |
| 04/17/2008 | US20080090829 5-{2-[2-(4-Tert-Butyl- phenyl)-oxazol-4-yl]-ethylsulfamoyl}-2-methyl-benzoic acid methyl ester; used as peroxisome proliferator activator receptor agonist, to increase high density lipoproteins and lower LDL-cholesterol and triglycerides; treatment of atherosclerosis, cardiovascular, metabolic disorders |
| 04/17/2008 | US20080090803 Fatty alcohol drug conjugates |
| 04/17/2008 | US20080090796 Useful in the treatment of neurological and psychiatric disorders associated with glutamatergic neurotransmission dysfunction and diseases; schizophrenia; 2,4-dichloro-N-{[4-(cyclopropylmethyl)-1-[(1-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]methyl}benzamide |
| 04/17/2008 | CA2666171A1 Method for producing basic (meth)acrylamides |
| 04/16/2008 | EP1910497A2 Compositions and methods for coupling a plurality of compounds to a scaffold |
| 04/16/2008 | EP1910317A1 1-amino linked compounds |
| 04/16/2008 | EP1910316A1 Substituted triazole derivatives and their use as neurokinin 3 receptor antagonists |
| 04/16/2008 | EP1909846A2 Triazole-containing releasable linkers, conjugates thereof, and methods of preparation |
| 04/16/2008 | CN101163662A Phenylacetylene derivatives having mglur5 receptor affinity |
| 04/15/2008 | CA2211981C Production of enantiomerically enriched ortho-substituted .alpha.,.alpha.-diaromatic methanols |
| 04/10/2008 | US20080085894 Alpha-(n-sulfonamido)acetamide derivatives as beta-amyloid inhibitors |
| 04/09/2008 | EP1908764A1 Azolo triazines and pyrimidines |
| 04/09/2008 | EP1907347A2 Compounds with activity at retinoic acid receptors |
| 04/09/2008 | CN101160291A 新颖的hsp90抑制剂 Novel hsp90 inhibitor |
| 04/09/2008 | CN101160282A Acetylene derivatives |
| 04/03/2008 | WO2008039023A1 Heteroaryl-pyrazole derivatives as cannabinoid cb1 receptor antagonists |