| Patents for C07D 239 - Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings (42,619) |
|---|
| 03/24/2011 | US20110071167 Method of treatment of age-related macular degeneration (amd) |
| 03/24/2011 | US20110071158 New compounds |
| 03/24/2011 | US20110071148 Compounds as the estrogen related receptors modulators and the uses thereof |
| 03/24/2011 | US20110071144 Quinazoline derivatives and pharmaceutical compositions containing them |
| 03/24/2011 | US20110071134 2-(amino-substituted)-4-aryl pyrimidines and related compounds useful for treating inflammatory diseases |
| 03/24/2011 | US20110071126 Inhibitors of beta-secretase |
| 03/24/2011 | US20110070193 Anti-Infective Agents and Uses Thereof |
| 03/24/2011 | US20110068328 Halogen-containing perylenetetracarboxylic acid derivatives and the use thereof |
| 03/24/2011 | CA2774515A1 Substituted phenylamine carboxamide analogs as mglur5 negative allosteric modulators and methods of making and using the same |
| 03/24/2011 | CA2773985A1 Protein kinase conjugates and inhibitors |
| 03/24/2011 | CA2772689A1 Glycine compound |
| 03/23/2011 | EP2299785A1 Iridium compounds |
| 03/23/2011 | EP2298779A1 Sulfonamide derivatives as glycokinase activators useful in the treatment of type 2 diabetes |
| 03/23/2011 | EP2298761A1 HIV inhibiting pyrimidines derivatives |
| 03/23/2011 | EP2298746A1 4-amino- quinazoline and quinoline derivatives having an inhibitory effect on signal transduction mediated by tyrosine kinases |
| 03/23/2011 | EP2298745A1 Preparation method of rosuvastatin calcium and its intermediates |
| 03/23/2011 | EP2298305A1 4-(N-Phenylamino)-quinazolines/quinolines as inhibitors of tyrosine kinases |
| 03/23/2011 | EP2297117A1 Bicyclic heterocycle derivatives and use thereof as gpr119 modulators |
| 03/23/2011 | EP2297116A1 Substituted quinazolines |
| 03/23/2011 | EP2297088A2 New compounds with activity that protects against the action of toxins and viruses in intracellular action mode |
| 03/23/2011 | EP1926715B1 Pesticide pyrimidinyloxy substituted phenylamidine derivatives |
| 03/23/2011 | EP1330444B1 Nitrogenous heterocyclic compounds and process for making them |
| 03/23/2011 | EP1278748B1 Inhibitors of human phosphatidyl-inositol 3-kinase delta |
| 03/23/2011 | EP0744435B2 Water-absorbent resin, process for production thereof, and water-absorbent resin composition |
| 03/23/2011 | CN1988802B A use of sulfonanilides as agricultural and horticultural fungicide |
| 03/23/2011 | CN101987834A Novel erlotinib hydrochloride of crystalline form, preparation method and pharmaceutical application thereof |
| 03/22/2011 | US7910733 Image-forming material |
| 03/22/2011 | US7910731 Bicyclic heterocyclic compounds, pharmaceutical compositions containing these compounds, their use and process for preparing them |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | US7910597 platelet lowering agent anagrelide especially 3-and 5-substituted analogues, with reduced potential for cardiovascular side-effects; imidazo[2,1-b]quinazolin-2-one derivatives; by inhibiting megakaryocytopoeisis; antiproliferative agents |
| 03/22/2011 | US7910593 Water-soluble prodrugs |
| 03/22/2011 | US7910592 CETP inhibitors |
| 03/22/2011 | US7910586 Drug screening; administering secretase inhibitor; Alzheimer's disease |
| 03/22/2011 | US7910585 Pyrimidine derivatives |
| 03/22/2011 | CA2497440C Pyrazolopyrimidines as cyclin-dependent kinase inhibitors |
| 03/22/2011 | CA2492342C Novel bio-active pyrimidine derivatives |
| 03/22/2011 | CA2471538C Pyrrolopyrimidines |
| 03/22/2011 | CA2432572C Oxybenzamides derivatives as factor xa inhibitors |
| 03/17/2011 | WO2011030139A1 4- (pyrimidin-2-yl) -piperazine and 4- (pyrimidin-2-yl) -piperidine derivatives as gpr119 modulators |
| 03/17/2011 | WO2011029807A1 Ortho substituted pyrimidine compounds as jak inhibitors |
| 03/17/2011 | WO2010028776A8 Piperazine derivatives for binding and imaging amyloid plaques and their use |
| 03/17/2011 | WO2010025863A3 4-alkyl-substituted diaminopyrimidines |
| 03/17/2011 | US20110065920 Process for preparing pentanoic diacid derivatives |
| 03/17/2011 | US20110065918 New phenylalanine derivatives |
| 03/17/2011 | US20110065735 Substituted quinazolines |
| 03/17/2011 | US20110065710 Insecticidal N-(Heteroarylalkyl)Alkanediamine Derivatives |
| 03/17/2011 | US20110065681 Amide compounds, compositions and uses thereof |
| 03/17/2011 | US20110065671 Bicyclic heterocycle derivatives and use thereof as gpr119 modulators |
| 03/17/2011 | CA2771675A1 Ortho substituted pyrimidine compounds as jak inhibitors |
| 03/16/2011 | EP2295415A1 Quinazoline derivatives |
| 03/16/2011 | EP2295414A1 Novel uracil compound having inhibitory activity on human deoxyuridine triphosphatase or salt thereof |
| 03/16/2011 | EP2295408A1 Matrix metalloproteinase inhibitors |
| 03/16/2011 | EP2295404A2 Substituted tetracycline compounds |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP2294056A1 Bosentan salts |
| 03/16/2011 | EP2294055A1 Salts comprising a pyrimidinecarboxylic acid derivative for cosmetic use |
| 03/16/2011 | EP2205562B1 1,1,1-trifluoro-2-hydroxy-3-phenylpropane derivatives |
| 03/16/2011 | EP2046758B1 Substituted sulphoximines as tie2 inhibitors and salts thereof, pharmaceutical compositions comprising same, methods of preparing same and uses of same |
| 03/16/2011 | EP1940827B1 Carbamate compounds which inhibit leukocyte adhesion mediated by vla-4 |
| 03/16/2011 | CN101985443A Ethylenedicysteine (EC)-drug conjugates, compositions and methods for tissue specific disease imaging |
| 03/16/2011 | CN101985437A Naphtha uracil peptide nucleic acid (PNA) monomer, intermediate thereof as well as preparation methods and applications thereof |
| 03/16/2011 | CN101343253B 2-amido-4, 5-diaryl miazines compound, preparation and pharmaceutical use thereof |
| 03/16/2011 | CN101003512B Method for preparing methylamino uracil |
| 03/15/2011 | US7906655 5,5'-(1,2-ethynediyl)bis(2-((2S)-1-((2R)-2-phenylpropanoyl)-2-pyrrolidinyl)-1H-benzimidazole); inhibit the function of the NS5A protein encoded by Hepatitis C virus (HCV); useful in establishing or determining the binding site of other antiviral compounds |
| 03/15/2011 | US7906653 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/15/2011 | US7906650 Caspase inhibitors and uses thereof |
| 03/15/2011 | US7906644 2,4-pyrimidinediamine compounds and their uses |
| 03/15/2011 | US7906629 Protease inhibitor conjugates and antibodies useful in immunoassay |
| 03/15/2011 | US7906537 Substituted p-diaminobenzene derivatives |
| 03/15/2011 | US7906523 retrovirus inhibor; anticarcinogenic, antidiabetic agent, immunosuppressant, autoimmune diseases; 2-{6-[3(R)-Amino-piperidin-1-yl]-3-methyl-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-ylmethyl}-4-fluoro-benzonitrile; type 2 diabetes mellitus, impaired glucose tolerance, obesity, multiple sclerosis |
| 03/15/2011 | US7906522 2-aminoquinazoline derivatives |
| 03/15/2011 | US7906521 Quinazoline potassium channel inhibitors |
| 03/15/2011 | US7906511 Cyclic compound having pyrimidinylalkylthio group |
| 03/15/2011 | US7906235 Pentacyclic anion salts or tetrazapentalene derivatives and their uses as ionic conducting materials |
| 03/15/2011 | CA2591053C Pyrimidinone compounds and preparation and use thereof |
| 03/15/2011 | CA2502769C 3-phenyl substituted pyridoindolone, preparation and therapeutic use thereof |
| 03/15/2011 | CA2473910C Pyrimidine derivatives as rho-kinase inhibitors |
| 03/15/2011 | CA2450820C Processes for preparing calcium salt forms of statins |
| 03/15/2011 | CA2432000C Pyrimidineamines as angiogenesis modulators |
| 03/15/2011 | CA2431160C Anilinopyrimidine derivatives as ikk inhibitors and compositions and methods related thereto |
| 03/15/2011 | CA2426440C Quinazoline derivatives as kinase inhibitors |
| 03/15/2011 | CA2397366C Methanocarba cycloalkyl nucleoside analogues |
| 03/10/2011 | WO2011028741A1 Quinazolines as potassium ion channel inhibitors |
| 03/10/2011 | WO2011027888A1 Diamide-phenyl derivative and pharmaceutically acceptable salt thereof |
| 03/10/2011 | WO2011026959A1 Novel ethane diamine hepcidin antagonists |
| 03/10/2011 | WO2011026835A1 Novel pyrimidine and triazine hepcidine antagonists |
| 03/10/2011 | WO2011026781A1 Novel multifunctional peptidase inhibitors, especially for medical use |
| 03/10/2011 | WO2011004402A3 Improved process for the preparation of ambrisentan and novel intermediates thereof |
| 03/10/2011 | WO2010132508A3 Compositions and methods for biological sample storage |
| 03/10/2011 | WO2010035284A3 An improved process for the preparation of rosuvastatin calcium |
| 03/10/2011 | US20110060141 Regioselective preparation of substituted pyrimidines |
| 03/10/2011 | US20110059990 Substituted Phenyl(oxy/thio)alkanol Derivatives |
| 03/10/2011 | CA2772975A1 Novel multifunctional peptidase inhibitors, especially for medical use |
| 03/10/2011 | CA2772642A1 Quinazolines as potassium ion channel inhibitors |
| 03/10/2011 | CA2772075A1 Novel compositions and processes for preparing 5-amino or substituted amino 1,2,3-triazoles and triazole orotate formulations |
| 03/09/2011 | EP2292630A1 O2-substituted 1- (2-carboxylato)pyrrolidin-1-yl diazen-1-ium-1,2-diolates |
| 03/09/2011 | EP2292614A1 Substituted pyrimidines as aurora kinase inhibitors |
| 03/09/2011 | EP2292608A1 Intermediates for the preparation of substituted Aminosalicylic acid amides with fungicidal activity |
| 03/09/2011 | EP2292589A1 Novel multifunctional peptidase inhibitors, especially for medical use |
| 03/09/2011 | EP2292586A2 Photoelectric conversion material, film containing the material, photoelectric conversion device, production method thereof, photosensor, imaging device and their use methods |