Patents for C07D 217 - Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems (11,865) |
---|
02/09/1982 | CA1117945A1 Dipyrido ¬4,3-b| ¬3,4-f| indoles, process for obtaining them, therapeutical use and pharmaceutical compositions |
02/02/1982 | US4313950 Antireproductive tricyclic ortho-fused nitrogen containing compounds |
01/21/1982 | WO1982000144A1 A short total synthesis of dihydrothebainone,dihydrocodeinone,and nordihydrocodeinone |
01/13/1982 | EP0043729A1 New dopaminergic isoquinolines |
01/13/1982 | EP0043706A2 A short total synthesis of dihydrothebainone, dihydrocodeinone, and nordihydrocodeinone |
01/05/1982 | CA1115706A1 Process for preparing 1-(3,4,5-trimethoxybenzyl)-5,7- dihydroxy-1,2,3,4-tetrahydroisoquinoline and salt thereof |
12/30/1981 | EP0042593A1 Aryloxy-propanol amines, process for their preparation and medicines containing these compounds |
12/30/1981 | EP0042592A1 N-heteroarylalkylene diamines, process for their preparation and their use |
12/29/1981 | US4308399 Diabetic angiopathy |
12/08/1981 | US4304771 Antihypertensive amides |
12/08/1981 | CA1113937A1 Substituted piperidinylpropanols |
12/02/1981 | EP0040990A1 Antiallergic imidodisulfamides, their preparation and pharmaceutical compositions containing them |
12/02/1981 | EP0040956A1 8-Substituted 4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinolines |
12/01/1981 | CA1113472A1 Bis-(2,4-dinitrophenyl)-methyl-pyridinium compounds and the preparation thereof |
12/01/1981 | CA1113455A1 7-acylamido-3-(2-carboxyalkyl-2,3-dihydro-3-triazolo ¬4,3-b| pyridazin-3-on-6-ylthiomethyl)-3-cephem- 4-carboxylic acids |
12/01/1981 | CA1113356A1 Process and diagnostic device for the determination of ammonia and of substrates which react with the formation of ammonia |
11/24/1981 | US4302458 Antiallergens |
11/24/1981 | CA1113096A1 Neuromuscular blocking agents |
11/18/1981 | EP0039804A1 Cyclic amides |
11/17/1981 | US4301290 Organic compounds |
11/17/1981 | US4301284 N-(3-tertbutyl-chlorophenyl-2-methyl-1-propyl)-2,6-dimethyl morpholines |
11/17/1981 | CA1112642A1 Isoquinoline derivatives, process for preparing same and compositions thereof |
10/21/1981 | EP0038177A1 Antiallergic imidodisulfamides, pharmaceutical compositions containing them and process for their preparation |
10/21/1981 | EP0037934A2 Substituted alpha-aminocarbonyl-1-benzyl-3,4-dihydroisoquinolines, processes for their preparation and their use |
10/13/1981 | US4294969 Process for producing 2-bromo-3,5-disubstituted pyridines |
10/13/1981 | US4294832 Hypotensive agents, angiotensin inhibitors |
09/29/1981 | US4292320 Smooth muscle relaxants |
09/29/1981 | CA1109876A1 Demethylation of (-)-1-(p-methoxybenzyl)-2-methyl-1,2, 3,4,5,6,7,8-octahydroisoquinoline |
09/15/1981 | US4289882 Morphine analog analgesics |
09/09/1981 | EP0035244A2 Cycloalka(4,5)pyrrolo(2,3-g)isoquinolines, processes and intermediates for their preparation, and medicines containing them |
09/08/1981 | CA1108613A1 Pyrimido ¬2,1-a| isoquinoline derivatives |
09/01/1981 | US4287197 Also useful as analgesics, antipyretics and antiinflammatory agents |
08/18/1981 | CA1107282A1 Process for the production of morpholine and piperidine derivatives and the products thereof |
08/11/1981 | US4283539 Isoquinoline acetic acids |
08/11/1981 | CA1106846A1 Aminoalkoxyphenyl-derivatives |
08/04/1981 | US4282239 Sulfonyl ureas and pharmaceutical preparations thereof |
08/04/1981 | US4282223 Antidepressants |
08/04/1981 | US4282222 3-Piperidino or apiperazino-1-phenyl or 1-substituted phenyl isoquinoline and antidepressant compositions thereof |
07/28/1981 | CA1105932A1 Process for the production of morpholine and piperidine derivatives and the products thereof |
07/21/1981 | US4279914 Thrombocyte aggregation inhibiting composition and methods |
07/21/1981 | US4279913 Antiarrythmia, hypotensive |
07/08/1981 | EP0031741A1 Substituted imino-acids, process for their preparation and their use as enzyme inhibitors |
07/07/1981 | US4277608 Method of preparing 4a-arylhexahydro-1H-2-pyrindines and 4a-aryloctahydroisoquinolines |
07/01/1981 | EP0031058A1 Sulfonyl ureas, processes for their preparation and pharmaceutical compositions containing these compounds |
06/30/1981 | CA1104132A1 Process for the preparation of therapeutically useful 3,4,5-trimethoxy-benzene derivatives |
06/24/1981 | EP0030861A2 Isoquinoline acetic acids and pharmaceutical compositions thereof |
06/23/1981 | US4275066 Antireproductive tricyclic ortho-fused nitrogen containing compounds |
06/10/1981 | EP0030198A1 Isoquinoline derivatives, their preparation and pharmaceutical compositions containing them |
06/10/1981 | EP0029982A1 Benzenesulfonyl ureas, processes for their preparation, pharmaceutical compositions based on these compounds and their use |
06/03/1981 | EP0029488A1 Amino acid derivatives, process for their preparation and their use in treating hypertension |
06/02/1981 | CA1102316A1 N su2 xx-arylsulfonyl-l-argininamides and the pharmaceutically acceptable salts thereof |
05/26/1981 | US4270000 Process for preparing 3-phenoxy morphinans |
05/20/1981 | EP0028959A1 5,8,13,13a-Tetrahydro-6H-dibenzo(a,g)quinolizine derivatives, process for their preparation and pharmaceutical compositions containing them |
05/13/1981 | EP0028279A1 Phthalide-isoquinoline derivatives, their preparation and their use in medicaments |
05/12/1981 | CA1100971A1 6,7-dimethoxy-1,2,3,4-tetrahydro-1-isoquinoline- acetamide derivatives and a process for the preparation thereof and pharmaceutical compositions containing same |
05/12/1981 | CA1100966A1 Process for the preparation of sulphoalkyl quaternary salts |
05/05/1981 | US4266060 Dipyrido [4,3-b] [3,4-f] indoles and process for obtaining them |
04/28/1981 | US4264619 Antiinflammatory agents |
04/14/1981 | US4261998 Tetrahydro-isoquinoline derivatives |
04/14/1981 | US4261993 Analgesic, antiinflammatory, antipyretic |
04/14/1981 | US4261992 Isoquinoline derivatives |
04/07/1981 | US4260763 Antispasmodics, tranquilizers |
04/07/1981 | US4260762 Octahydro-1H-pyrrolo[2,3-g]isoquinolines |
04/07/1981 | US4260761 Intermediates for the preparation of octahydro-1H-benzo[4,5]furo[3,2,-e]-isoquinoline analgesic and narcotic antagonistic compounds |
04/07/1981 | US4260611 Isoquinoline derivatives |
03/25/1981 | EP0025598A1 The use of 2-phenyltetralin derivatives, or heterocyclic analogues, in medicine and pharmaceutical compositions containing them |
03/24/1981 | US4258192 N2 -Arylsulfonyl-L-argininamides and the pharmaceutically acceptable salts thereof |
03/24/1981 | US4258049 Inhibiting phenylethanolamine N-methyltransferase with thiadiazolo and oxadiazolotetrahydroisoquinolines |
03/24/1981 | CA1098035A1 Anti-tussive and anti-thrombotic compositions containing tetrahydroxyaporphine or l-glaucine |
03/17/1981 | US4256761 Antihypertensive amides |
03/17/1981 | US4256751 Tetrahydroisoquinoline derivatives |
02/24/1981 | US4252804 Tranquilizers, anticonvulsants, muscle relaxants |
02/17/1981 | US4251660 Cyclization of n-benzyl-n-hydroxyethylamines |
02/17/1981 | US4251444 Thiazepino-[4,3-b]-isoquinoline-1,5-dione derivatives and precursors |
02/11/1981 | EP0023761A1 Tetrahydroisoquinoline derivatives, process for preparing them and compositions containing them |
02/11/1981 | EP0023575A1 Benzene sulfonyl semicarbazides, their preparation and use, pharmaceutical formulations containing them and their preparation |
02/11/1981 | EP0023569A1 Derivatives of carboxylic acids, their preparation and medicaments containing them |
02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
01/27/1981 | US4247697 Analgesics |
01/13/1981 | US4245096 Useful as ph indicators of for the detection of ammonia |
01/06/1981 | CA1093079A1 4-phenyl-8-amino-tetrahydroisoquinolines, pharmaceutical compositions containing same, process for preparing such compositions and their use as antidepressive medicaments |
01/06/1981 | CA1093074A1 Substituted oximino anti-ulcer compounds and compositions |
12/30/1980 | US4242348 Analgesics; antiiflammatory agents |
12/30/1980 | US4242346 Bis-2N-alkylene tetrahydroisoquinoline compounds |
12/23/1980 | USRE30456 2-Substituted phenyl-s-triazolo[5,1-a] isoquinoline compounds |
12/23/1980 | US4241209 Toxic to nervous systems; chemical warfare |
12/23/1980 | US4241058 Heterocyclics useful as fungicides and fungicidal compositions thereof |
12/23/1980 | CA1092105A1 Pyrrolo(2,1-b) (3)benzazepines |
12/16/1980 | USRE30452 Analgesics, narcotic antagonists |
12/16/1980 | CA1091675A2 2-cycloalkylmethyl-9,10-dihydroxy-1-(p- methoxybenzyl)perhydroisoquinoline compounds |
12/16/1980 | CA1091674A1 Isoquinolein derivatives, preparation process and composition thereof |
12/09/1980 | CA1091232A1 Imidazo-isoquinoline-diones |
11/25/1980 | US4236009 Method of preparing 4A-arylhexahydro-1H-2-pyrindines and 4A-aryloctahydroisoquinolines |
11/25/1980 | US4235906 Bis-isoquinolinium compounds, compositions and methods of use |
11/12/1980 | EP0018549A2 Tetrahydroisoquinoline compounds, process for preparing them and pharmaceutical compositions containing them |
11/04/1980 | US4232160 Isoquinoline propionamides exhibiting analgesic properties |
11/04/1980 | CA1088935A1 Levo-rotary 3-phenoxy morphinan derivatives |
10/29/1980 | EP0018104A2 Tetrahydroisoquinolines, their production and the compounds and pharmaceutical compositions containing them for use in the prevention or treatment of hypertension |
10/28/1980 | US4230711 N-haloalkylthio derivatives |
10/14/1980 | US4228170 7- and/or 8-Sulfur substituted 1,2,3,4-tetrahydroisoquinoline compounds |