| Patents for C07D 211 - Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings (37,939) |
|---|
| 03/23/2011 | EP1578353B1 4-hydroxypiperidine derivatives useful as antimycobacterial agents |
| 03/23/2011 | EP1140836B1 Amide compounds |
| 03/23/2011 | CN101990532A Method for making methylpentamethylene diamine and methylpiperidine |
| 03/23/2011 | CN101987833A Novel nilvaldipine crystal types and preparation method thereof |
| 03/23/2011 | CN101195602B 1-deoxidization nojiri toxin derivant, production method and uses thereof |
| 03/22/2011 | US7910774 Alternative synthesis of renin inhibitors and intermediates thereof |
| 03/22/2011 | US7910743 Compounds, compositions and methods |
| 03/22/2011 | US7910741 Nitrogen-containing heterocyclic derivatives and drugs containing the same as the active ingredient |
| 03/22/2011 | US7910652 Polyamide molding materials with an improved flowability, the production thereof and its use |
| 03/22/2011 | US7910608 Biphenyl compounds useful as muscarinic receptor antagonists |
| 03/22/2011 | US7910607 Nitroxide free radical synergized antineoplastic agents |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | US7910078 using an aminoalcohol derived from 4-amino-2-butanol, which have a higher CO2 absorption capacity; global warming; e.g. 4-(diethylamino)-2-butanol or 4-(piperidino)-2-butanol |
| 03/22/2011 | CA2433675C Pharmaceutically active piperidine derivatives |
| 03/22/2011 | CA2433603C Kappa opioid receptor ligands |
| 03/22/2011 | CA2432572C Oxybenzamides derivatives as factor xa inhibitors |
| 03/22/2011 | CA2333965C Method of enhancing lysosomal .alpha.-galactosidase a |
| 03/17/2011 | WO2011030591A1 Zinc cluster |
| 03/17/2011 | WO2011029896A1 Methods of preparation of muscarinic acetylcholine receptor antagonists |
| 03/17/2011 | WO2011029808A1 Hsl inhibitors useful in the treatment of diabetes |
| 03/17/2011 | WO2009084030A3 Improved process for the preparation of (1-benzyl-4-(5,6,- dimethoxyind anone-2-yl)methylpiperidine) hydrochloride-form iii |
| 03/17/2011 | US20110065923 Process for production of carebastine |
| 03/17/2011 | US20110065915 Catalysts for metathesis reactions including enantioselective olefin metathesis, and related methods |
| 03/17/2011 | US20110065743 Kappa opioid receptor ligands |
| 03/17/2011 | US20110065717 Sulfoximine derivatives as factor xa inhibitors |
| 03/17/2011 | US20110065707 New hsl inhibitors useful in the treatment of diabetes |
| 03/17/2011 | CA2772588A1 Zinc cluster |
| 03/17/2011 | CA2771452A1 Hsl inhibitors useful in the treatment of diabetes |
| 03/16/2011 | EP2295419A2 Substituted tetracycline compounds |
| 03/16/2011 | EP2295404A2 Substituted tetracycline compounds |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP2294051A1 Alpha-substituted n-sulfonyl gylcine amides antagonists of ccr10, compositions containing the same and methods for using them |
| 03/16/2011 | EP1448535B1 Benzamide and heteroarylamide as p2x7 receptor antagonists |
| 03/16/2011 | CN101985433A Preparation method for alvimopan |
| 03/16/2011 | CN101585804B Synthetic method of a fexofenadine hydrochloride |
| 03/16/2011 | CN101367759B Synthesis of high-purity amlodipine besylate |
| 03/16/2011 | CN101260075B Aralkylpiperidine derivative and application thereof in preparing analgesic and sedative medicament |
| 03/15/2011 | US7906675 Compounds for the treatment of metabolic disorders |
| 03/15/2011 | US7906655 5,5'-(1,2-ethynediyl)bis(2-((2S)-1-((2R)-2-phenylpropanoyl)-2-pyrrolidinyl)-1H-benzimidazole); inhibit the function of the NS5A protein encoded by Hepatitis C virus (HCV); useful in establishing or determining the binding site of other antiviral compounds |
| 03/15/2011 | US7906556 Methods of treating amyloidosis using cyclopropyl derivative aspartyl protease inhibitors |
| 03/15/2011 | US7906532 Indazole derivatives |
| 03/15/2011 | US7906496 Carboxylic acid derivatives |
| 03/15/2011 | CA2397681C Partially saturated calcium channel blockers |
| 03/10/2011 | WO2011028927A1 Selective sphingosine-1-phosphate receptor antagonists |
| 03/10/2011 | WO2011028860A2 Compounds and compositions for treating cancer |
| 03/10/2011 | WO2011028775A1 Methods of treating orthomyxoviral infections |
| 03/10/2011 | WO2011027888A1 Diamide-phenyl derivative and pharmaceutically acceptable salt thereof |
| 03/10/2011 | WO2011027321A1 Dihalide germanium(ii) precursors for germanium-containing film depositions |
| 03/10/2011 | WO2011027081A2 Novel derivatives of 5,6,7,8-tetrahydroindolizine inhibiting hsp90, compositions containing same, and use thereof |
| 03/10/2011 | WO2011026959A1 Novel ethane diamine hepcidin antagonists |
| 03/10/2011 | WO2011026241A1 Substituted heterocyclic derivatives for the treatment of pain and epilepsy |
| 03/10/2011 | US20110060145 Process for production of compound having antagonistic activity on npyy5 receptor, and useful crystal |
| 03/10/2011 | US20110060144 Method for manufacturing magnesium amides |
| 03/10/2011 | US20110059981 New Pyridine Analogues V |
| 03/10/2011 | US20110059971 Derivatives of 4-aminopiperidine and their use as a medicament |
| 03/10/2011 | US20110059937 Il-8 receptor antagonists |
| 03/10/2011 | US20110059931 Biphenyl compounds useful as muscarinic receptor antagonists |
| 03/10/2011 | US20110059922 Mitochondria targeted cationic anti-oxidant compounds for prevention, therapy or treatment of hyper-proliferative disease, neoplasias and cancers |
| 03/10/2011 | CA2772875A1 Methods of treating orthomyxoviral infections |
| 03/10/2011 | CA2772807A1 Methods of treating poxviral infections |
| 03/10/2011 | CA2772614A1 Compounds and compositions for treating cancer |
| 03/10/2011 | CA2771592A1 Substituted heterocyclic derivatives for the treatment of pain and epilepsy |
| 03/09/2011 | EP2292596A2 CETP activity inhibitor |
| 03/09/2011 | EP2292590A2 Prodrugs of 9-aminomethyl tetracycline compounds |
| 03/09/2011 | EP2292256A2 High mannose proteins and methods of making high mannose proteins |
| 03/09/2011 | EP2032534B1 4-[(3-fluorophenoxy)phenylmethyl]piperidine methanesulfonate: uses, process of synthesis and pharmaceutical compositions |
| 03/09/2011 | CN1582274B Inhibitors of factor Xa and other serine proteases involved in the coagulation cascade |
| 03/08/2011 | US7902368 Cationic substituted 2,2,6,6-tetraalkylpiperidinyl alkoxyamines |
| 03/08/2011 | US7902366 NK1 antagonists |
| 03/08/2011 | US7902233 Compounds useful as pesticides |
| 03/08/2011 | US7902223 Phenyl derivatives as factor XA inhibitors |
| 03/08/2011 | US7902191 Histamine H3 receptor antagonists, preparation and therapeutic uses |
| 03/08/2011 | US7902181 Compounds 010 |
| 03/08/2011 | CA2468691C 4-piperidinyl alkylamine derivatives as muscarinic receptor antagonists |
| 03/03/2011 | WO2011025790A1 Macrocyclic hopo chelators |
| 03/03/2011 | WO2011023954A2 Polymorphic forms of manidipine |
| 03/03/2011 | WO2011023667A1 Carbocyclic glyt1 receptor antagonists |
| 03/03/2011 | WO2010128528A9 Piperidine derivatives useful for treatment of diebetes |
| 03/03/2011 | US20110054178 Process for the manufacture of [phenylsulfanylphenyl]piperidines |
| 03/03/2011 | US20110053987 Pyridinium and thiazolium conjugates including polyethylene glycols and methods of using the same |
| 03/03/2011 | US20110053985 Novel piperidine-4-carboxylic acid phenyl-alkyl-amide derivatives and their use as monoamine neurotransmitter re-uptake inhibitors |
| 03/03/2011 | US20110053984 Novel 4-benzhydryloxy-tetraalkyl-piperidine derivatives and their use as monoamine neurotransmitter re-uptake inhibitors |
| 03/03/2011 | US20110053975 Chemical molecules that inhibit the slicing mechanism for treating diseases resulting from splicing anomalies |
| 03/03/2011 | US20110053943 CARBAMATE AND UREA INHIBITORS OF 11ß-HYDROXYSTEROID DEHYDROGENASE 1 |
| 03/03/2011 | US20110053938 Compounds and Compositions For Treating Cancer |
| 03/03/2011 | US20110053904 Carbocyclic glyt1 receptor antagonists |
| 03/03/2011 | US20110053901 Acetyl mimic compounds for the inhibition of isoprenyl-s-cysteinyl methyltransferase |
| 03/03/2011 | US20110052589 Compositions and methods for detecting and treating diseases and conditions related to chemokine receptors |
| 03/03/2011 | CA2772499A1 Polymorphic forms of manidipine |
| 03/03/2011 | CA2772386A1 Tetracycline compounds |
| 03/03/2011 | CA2767901A1 Carbocyclic glyt1 receptor antagonists |
| 03/02/2011 | EP2289879A1 Synthesis of a crytalline form of n-(4-fluorobenzyl)-n-(1-methylpiperidin-4-yl)-n'-(4-(2-methylpropyloxy)phenylmethyl)carbamide tartrate salt |
| 03/02/2011 | EP2289878A1 Fexofenadine polymorphs and process for the preparation thereof |
| 03/02/2011 | EP2288594A1 Imidazolidine derivatives |
| 03/02/2011 | CN1939916B Compound for treating AIDS |
| 03/01/2011 | US7897778 Benzamide compounds |
| 03/01/2011 | US7897777 resolving a racemic mixture of racemic threo-methylphenidate hydrochloride with a less than stoichiometric amount of tertiary amine base to obtain a methylphenidate-chiral acid salt, basifying salt to obtain methylphenidate free base, and converting free base into d-threo-methylphenidate hydrochloride |
| 03/01/2011 | US7897622 Viral polymerase inhibitors |
| 03/01/2011 | CA2468529C 4-(2-furoyl) aminopiperidines, intermediates in synthesizing the same, process for producing the same and medicinal use of the same |
| 02/24/2011 | WO2010129057A8 Tetracycline compounds |