| Patents for C07D 207 - Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom (40,304) |
|---|
| 03/23/2011 | EP2298311A1 w-Carboxy aryl substituted diphenyl ureas as p38 kinase inhibitors |
| 03/23/2011 | EP2298300A1 Compositions for inhibition of anglogenesis comprising thalidomide and aspirin |
| 03/23/2011 | EP2297098A1 Pyrrolidine derivatives as nk2 receptor antagonists |
| 03/23/2011 | EP2297097A2 Compounds and compositions useful for the treatment of malaria |
| 03/23/2011 | EP2297096A2 Aryl ketone as mri |
| 03/23/2011 | EP2297091A1 Insecticidal compounds |
| 03/23/2011 | EP2212281B1 Arylsulfonamides with analgesic activity |
| 03/23/2011 | EP1478623B1 Novel coupling agents, the active intermediates and the conjugates thereof and the use of said conjugates in diagnostic methods |
| 03/23/2011 | CN1942436B Lysine based compounds |
| 03/23/2011 | CN101987831A Process for preparing of n-methyl pyrrolidone |
| 03/23/2011 | CN101195096B Chiral latex catalyst, production method and application thereof |
| 03/23/2011 | CN101155779B Production method of n-vinyl-2-pyrrolidone |
| 03/22/2011 | US7910774 Alternative synthesis of renin inhibitors and intermediates thereof |
| 03/22/2011 | US7910770 3-Isopropoxy-7-methoxy-N-(1H-1,2,3,4-tetrazol-5-yl)-1-benzo[b]thiophene-2-carboxamide; autoimmune diseases such as rheumatoid arthritis, immune thrombocytopenia purpura, systemic lupus erythematosus and Crohn's disease |
| 03/22/2011 | US7910745 Organic compound and method for producing radioactive halogen-labeled organic compound using the same |
| 03/22/2011 | US7910617 Method for suppressing the number of peripheral blood lymphocytes using an amino alcohol compound |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | US7910590 Cyclic amine bace-1 inhibitors having a heterocyclic substituent |
| 03/22/2011 | US7910106 Combinations of SAP depleting agents and anti-SAP antibodies |
| 03/22/2011 | US7910059 For the determination of an analyte or analytes such as proteins, peptides, nucleic acids, carbohydrates, lipids, steroids and small molecules by mass analysis |
| 03/22/2011 | CA2498091C Sulfonylamino-acetic acid derivatives |
| 03/22/2011 | CA2488001C 1,5-distributed pyrrolid-2-one derivatives for use as ep4 receptor agonists in the treatment of eye diseases such as glaucoma |
| 03/22/2011 | CA2418970C Preparation of n-protected-3-pyrrolidine-lactam substituted phosphonium salts |
| 03/22/2011 | CA2333965C Method of enhancing lysosomal .alpha.-galactosidase a |
| 03/17/2011 | WO2011030981A1 Method for preparing [18f]fallypride with low base concentration |
| 03/17/2011 | WO2011030728A1 Nmp distilling apparatus |
| 03/17/2011 | WO2011029762A1 Process for preparing alpha-carboxamide derivatives |
| 03/17/2011 | WO2010066846A3 Method for the isolation of atorvastatin |
| 03/17/2011 | US20110065932 Process for the preparation of Levetiracetam |
| 03/17/2011 | US20110065931 Atorvastatin calcium propylene glycol solvates |
| 03/17/2011 | US20110065040 Photoresist composition |
| 03/17/2011 | CA2774067A1 Distillation apparatus for nmp |
| 03/16/2011 | EP2295407A1 Hydrazine-based and carbonyl-based bifunctional crosslinking reagents |
| 03/16/2011 | EP2295406A1 Heterocyclic compound |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP1425268B2 Organic sulfates as ionic liquids |
| 03/16/2011 | CN101985435A Novel eutectic ionic liquid and preparation method thereof |
| 03/15/2011 | US7906551 3-substituted-1,5-diarly-2-alkyl-pyrroles highly selective and orally effective COX-2 inhibitors |
| 03/15/2011 | US7906550 Viricide against hepatitis virus; pyrrole derivatives as, for example, 3-acetyl-4,5-dimethyl-2-pyrrole carboxylic acid |
| 03/15/2011 | US7906235 Pentacyclic anion salts or tetrazapentalene derivatives and their uses as ionic conducting materials |
| 03/15/2011 | CA2550596C 3-cycloalkylaminopyrrolidine derivatives as modulators of chemokine receptors |
| 03/15/2011 | CA2450820C Processes for preparing calcium salt forms of statins |
| 03/10/2011 | WO2011027888A1 Diamide-phenyl derivative and pharmaceutically acceptable salt thereof |
| 03/10/2011 | WO2011027081A2 Novel derivatives of 5,6,7,8-tetrahydroindolizine inhibiting hsp90, compositions containing same, and use thereof |
| 03/10/2011 | WO2011008666A3 3-phenoxymethylpyrrolidine compounds |
| 03/10/2011 | WO2010132508A3 Compositions and methods for biological sample storage |
| 03/10/2011 | US20110059937 Il-8 receptor antagonists |
| 03/09/2011 | EP2292630A1 O2-substituted 1- (2-carboxylato)pyrrolidin-1-yl diazen-1-ium-1,2-diolates |
| 03/09/2011 | EP2292600A1 Crystaline forms VI and VII of atorvastatin calcium |
| 03/09/2011 | EP2292596A2 CETP activity inhibitor |
| 03/09/2011 | EP2291368A1 Substituted gamma lactams as therapeutic agents |
| 03/09/2011 | EP1499297B1 Pharmaceutical formulation comprising atorvastatin calcium |
| 03/09/2011 | CN1582274B Inhibitors of factor Xa and other serine proteases involved in the coagulation cascade |
| 03/09/2011 | CN101326163B Prolinamide derivatives as sodium channel modulators |
| 03/08/2011 | US7902383 Production method of heterocyclic mercapto compound |
| 03/08/2011 | US7902380 Process for the preparation of (S)-alpha-ethyl-2-oxo-1-pyrrolidineacetamide and (R)-alpha-ethyl-2-oxo-pyrrolidineacetamide |
| 03/08/2011 | US7902366 NK1 antagonists |
| 03/08/2011 | US7902191 Histamine H3 receptor antagonists, preparation and therapeutic uses |
| 03/08/2011 | US7902181 Compounds 010 |
| 03/08/2011 | CA2487532C Pyrrolidine derivatives as oxytocin antagonists |
| 03/08/2011 | CA2460313C Bisphenylsulfanyl and sulphonate compounds and use thereof for elevating hdl cholesterol levels |
| 03/08/2011 | CA2415396C 1,3-disubstituted and 1,3,3-trisubstituted pyrrolidines as histamine-3 receptor ligands and their therapeutic applications |
| 03/03/2011 | WO2011023864A1 Pseudodipeptides as mmp inhibitors |
| 03/03/2011 | WO2011023677A1 Tetra-substituted heteroaryl compounds and their use as mdm2 and/or mdm4 modulators |
| 03/03/2011 | WO2011023667A1 Carbocyclic glyt1 receptor antagonists |
| 03/03/2011 | WO2011006080A3 Flavoring compositions for savory applications |
| 03/03/2011 | US20110054190 Catalyst and reaction process |
| 03/03/2011 | US20110054180 Magnetic Nanoparticle-Supported Glutathione as a Sustainable Organocatalyst |
| 03/03/2011 | US20110054175 System for fluorinating organic compounds |
| 03/03/2011 | US20110053974 Carboxylic acid compound |
| 03/03/2011 | US20110053943 CARBAMATE AND UREA INHIBITORS OF 11ß-HYDROXYSTEROID DEHYDROGENASE 1 |
| 03/03/2011 | US20110053904 Carbocyclic glyt1 receptor antagonists |
| 03/03/2011 | US20110053848 Prodrug comprising a drug linker conjugate |
| 03/03/2011 | US20110053819 Composition |
| 03/03/2011 | US20110052589 Compositions and methods for detecting and treating diseases and conditions related to chemokine receptors |
| 03/03/2011 | CA2772386A1 Tetracycline compounds |
| 03/03/2011 | CA2771936A1 Tetra-substituted heteroaryl compounds and their use as mdm2 and/or mdm4 modulators |
| 03/03/2011 | CA2770475A1 Novel pyrrolidine derived beta 3 adrenergic receptor agonists |
| 03/03/2011 | CA2767901A1 Carbocyclic glyt1 receptor antagonists |
| 03/02/2011 | EP2289888A2 Epoxycarboxylic acid amides, azides and amino alcohols and processes for preparation of alpha-keto amides by using them |
| 03/02/2011 | EP2289887A2 Epoxycarboxylic acid amides, azides and amino alcohols and processes for preparation of alpha-keto amides by using them |
| 03/02/2011 | EP2289871A1 7-substituted tetracycline compounds |
| 03/02/2011 | EP2289868A1 Carboxylic acid compound |
| 03/02/2011 | EP2182800B1 Fungicidal n-cycloalkyl-benzyl-thiocarboxamides or n-cycloalkyl-benzyl-n' -substituted-amidine derivatives |
| 03/02/2011 | EP2004601B1 Novel dipeptidyl peptidase iv inhibitors and processes for their preparation and pharmaceutical compositions containing them |
| 03/02/2011 | EP1417975B1 Remedies for diseases with bone mass loss having ep4 agonist as the active ingredient |
| 03/02/2011 | CN1939916B Compound for treating AIDS |
| 03/02/2011 | CN101983187A Method of producing (s)-3-(1-cyano-1,1-diphenylmethyl)-pyrrolidine |
| 03/01/2011 | US7897803 Cis-alkoxy-substituted spirocyclic 1H-pyrrolidine-2,4-dione derivatives serving as pesticides |
| 03/01/2011 | US7897784 Process for preparing five-membered heterocyclyl tetracycline compounds and methods of use thereof |
| 03/01/2011 | US7897776 Sulfonamide containing compounds for treatment of inflammatory disorders |
| 03/01/2011 | US7897647 Useful in extending the in vivo circulating life of biologically active materials; bicine linker allows for the manipulation of the hydrolysis rate of the prodrug, thereby releasing the native entities at various rates in vivo as well as in vitro |
| 03/01/2011 | US7897623 ω-carboxyl aryl substituted diphenyl ureas as p38 kinase inhibitors |
| 03/01/2011 | US7897594 Preventive/remedy for retinal nerve diseases containing alkyl ether derivatives or salts thereof |
| 03/01/2011 | CA2530001C Polymer |
| 02/24/2011 | WO2011000490A3 Synthesis of ionic liquids |
| 02/24/2011 | WO2010129057A8 Tetracycline compounds |
| 02/24/2011 | US20110046411 Process for the preparation of intermediates useful in the synthesis of statin derivatives |
| 02/24/2011 | US20110046397 New processes |
| 02/24/2011 | US20110046199 Small molecule inhibitors of hiv proteases |