| Patents for C08L 23 - Compositions of homopolymers or copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond; Compositions of derivatives of such polymers (79,117) |
|---|
| 09/02/2004 | US20040171759 Polymer composition containing at least one middle molecular weight reactive polyisobutene |
| 09/02/2004 | US20040171758 Thermoplastic elastomers and process for making same |
| 09/02/2004 | US20040171753 Polymeric blends that adhere to polycarbonates and polycarbonate alloys |
| 09/02/2004 | US20040171752 Polymer blend |
| 09/02/2004 | US20040171750 Thermoplastic elastomer composition |
| 09/02/2004 | US20040171729 Blend containing peroxy compound and metal oxide; melt processability |
| 09/02/2004 | US20040171723 Phosphorus compounds as stabilizers |
| 09/02/2004 | US20040171720 Moldings, films, fibers, or foams comprising mixtures of polyacetals, polyamines, hindered amine light stabilizers and adjuvants, having chemical and heat resistance |
| 09/02/2004 | US20040171708 Polyolefin resin expanded particle and in-mold foamed article prepared therefrom |
| 09/02/2004 | US20040170854 For packaging, i.e., packaging of consumer goods (compact discs, video cassettes, digital video discs (DVD), candy and/or cigarette wrapping |
| 09/02/2004 | US20040170837 Non-halogenated flame retardant material |
| 09/02/2004 | US20040170816 Gas permeability (air permeability) and moisture permeability (water vapor permeability), anti-leakage properties and anti-bleeding properties against a liquid and hiding properties; useful for sanitary materials |
| 09/02/2004 | US20040170790 Stiffness, impact strength even at low temperatures; containing beta nucleated polymers |
| 09/02/2004 | US20040170785 Cosmetic containers |
| 09/02/2004 | US20040168820 Insulated electric wire |
| 09/02/2004 | US20040168757 Monolithic belts containing ethylene-alpha-olefin copolymers |
| 09/02/2004 | DE19542157B4 Flammfeste, vernetzte oder unvernetzte Polymermischung Flame resistant crosslinked or uncrosslinked polymer mixture |
| 09/02/2004 | DE10305088A1 Gleitbelag für Wintersportgeräte Sliding coating for winter sports equipment |
| 09/02/2004 | CA2516587A1 Metallized opaque film with barrier properties |
| 09/02/2004 | CA2516586A1 Metallisied opaque film |
| 09/02/2004 | CA2516330A1 Polymer packaging layer with improved release properties |
| 09/01/2004 | EP1452570A1 Primer composition for polyolefin materials |
| 09/01/2004 | EP1452567A1 Flame-retardant resin composition |
| 09/01/2004 | EP1452566A1 Thermosetting resin composition, process for producing the same, and suspension-form mixture |
| 09/01/2004 | EP1452563A1 Flame-retardant resin composition |
| 09/01/2004 | EP1452559A1 Flameproof expanded polyolefins containing carbon black |
| 09/01/2004 | EP1452557A1 Non-halogenated flame retardant material |
| 09/01/2004 | EP1451249A1 Thermoplastic elastomer compositions |
| 09/01/2004 | EP1451240A1 Preventing discoloration in an elastomer rubber |
| 09/01/2004 | EP1451137A1 Neutral carbonated alkaline earth metal carboxylates |
| 09/01/2004 | EP1189985B1 Polypropylene with high melt strength and drawability |
| 09/01/2004 | EP1023388B1 Polypropylene composition useful for making solid state oriented film |
| 09/01/2004 | CN1525997A Expoxy functionalized ethylene copolymer asphalt reaction products |
| 09/01/2004 | CN1525992A Disodium hexahydrophthalate salt compositions and nucleated polymers comprising such compositions |
| 09/01/2004 | CN1525990A Low permeability nanocomposites |
| 09/01/2004 | CN1525985A Expanded polypropylene granule composition |
| 09/01/2004 | CN1524900A Non-halogenated flame retardant material |
| 09/01/2004 | CN1524899A Special cross-linked polyethylene material for rotational molding and preparing process thereof |
| 09/01/2004 | CN1524898A Formula of plastic cement solar energy heat collection pipe material |
| 09/01/2004 | CN1524681A Markite laminate sheet |
| 09/01/2004 | CN1164668C Toughened composite polymer material and its preparation |
| 09/01/2004 | CN1164667C Polypropylene resin composition and injection-molded product thereof |
| 09/01/2004 | CN1164666C Polyethylene/nylon blend separation material |
| 09/01/2004 | CN1164665C Method for preparing visible light catalytic degraded plastic |
| 09/01/2004 | CN1164664C Polyolefin composition with high content of efficient inorganic modifier, its preparing process and disposable chopsticks made of it |
| 09/01/2004 | CN1164663C Thermoplastic full-sulfurized butyronitrile rubber/polypropylene elastomer and its preparing process |
| 09/01/2004 | CN1164658C Dynamic fully-cross-linked thermoplastic sulfurized rubber composition and its preparing process |
| 09/01/2004 | CN1164627C Method for preparing transparent polypropylene |
| 08/31/2004 | US6784269 Propylene homopolymer composition having a molecular weight distribution in the range from greater than 4.0, and hexane extractables of less than 2.0 wt %. |
| 08/31/2004 | US6784257 Polyamideether copolymer |
| 08/31/2004 | US6784252 Blow moldable propylene polymer compositions |
| 08/31/2004 | US6784250 Containing propylene polymer in an amount of 1 to 99 mass %, and an olefin-based polymer in an amount of 99 to 1 mass %; superior in flexibility and transparency |
| 08/31/2004 | US6784249 Rubbery polymer |
| 08/31/2004 | US6784248 Thermosetting compositions containing alternating copolymers of isobutylene type monomers |
| 08/31/2004 | US6784247 Powder coating compositions having improved mar and acid resistance |
| 08/31/2004 | US6784246 Non-gelling high molecular weight polymer compositions and thermosplastic blends thereof |
| 08/31/2004 | US6784245 High-frequency weldable and low-temperature flexible polymer mixture and its use |
| 08/31/2004 | US6784235 A polyolefin films having incorporated therein a compound of the formula ch3ch2(ch2ch2)ach2ch2(och2ch2)boh, where a is 9 to 25 and b is 1 to 10, exhibit superior fog resistance; useful as packaging film for food and as greenhouse film |
| 08/31/2004 | US6783844 Polypropylene resin foam-molded article |
| 08/31/2004 | US6783825 Elastomer finely dispersed in polyester and capsulated by vinyl polymer; beverage cans |
| 08/26/2004 | WO2004072374A2 Sheet material and method of manufacture thereof |
| 08/26/2004 | WO2004072200A2 Multilayer metallised film |
| 08/26/2004 | WO2004072178A1 Compositions containing polyphenylene ether and/or polystyrene having improved tribological properties and methods for improving tribological properties of polyphenylene ether and/or polystyrene compositions |
| 08/26/2004 | WO2004072177A1 Diene-modified propylene polymer nucleating agents |
| 08/26/2004 | WO2004072176A2 Film layers made from polymer blends |
| 08/26/2004 | WO2004072175A1 Laser light trnasmitting colored polyolefin resin compositions and process for laser welding |
| 08/26/2004 | WO2004072174A1 Syndiotactic propylene polymer composition |
| 08/26/2004 | WO2004072125A1 Pressure polymerisation process |
| 08/26/2004 | WO2004071375A1 Medical container |
| 08/26/2004 | WO2004071151A2 Electrically conductive plastics moulded article |
| 08/26/2004 | WO2004058865A3 Flame-retardant polyvinyl chloride compositions |
| 08/26/2004 | WO2004044048A3 Mold-in color panels |
| 08/26/2004 | WO2004037916A3 Scratch and mar resistant soft ethylene elastomer compositions |
| 08/26/2004 | US20040167286 Polymer blend and fabricated article made from diverse ethylene interpolymers |
| 08/26/2004 | US20040167281 suitable for use in tires |
| 08/26/2004 | US20040167270 investment casting of metals and alloys; a substantially random interpolymer, and a low molecular weight polymer other than said interpolymer; having a lower shrink as compared to a wax pattern and a polystyrene pattern |
| 08/26/2004 | US20040167269 Aqueous emulsion of macromolecular monomers; addition polymers |
| 08/26/2004 | US20040167247 Biodegradable plastic composition |
| 08/26/2004 | US20040167020 useful as a receiver for thermal dye transfer or other printing techniques; preferably the tie-layer composition has a viscosity not more than 10 times or less than {fraction (1/10)} that of the image-receiving layer during coextrusion. |
| 08/26/2004 | US20040166351 Resin compositions for producing biaxially oriented polypropylene films |
| 08/26/2004 | US20040166350 laminate compositions comprising polyethylenimine and one or both of polyvinyl alcohol and polyvinyl alcohol co-ethylene for protection against harmful and/or noxious agents |
| 08/26/2004 | US20040166348 polystyrene compatibilizing layers situate between each polyethylenic layer and polystyrenic layer; biaxial orientation |
| 08/26/2004 | DE10305557A1 Composition comprising thermoplast and aluminum silicate hydrate as reinforcing filler, useful for preparation of e.g. boards, films or tubes, includes maleic anhydride-modified thermoplast as adhesion promoter |
| 08/26/2004 | DE10297213T5 Polyphenylenehter-Zusammensetzung Polyphenylene ether composition |
| 08/26/2004 | CA2515992A1 Sheet material and method of manufacture thereof |
| 08/26/2004 | CA2512041A1 Film layers made from polymer blends |
| 08/25/2004 | EP1449885A1 Compositions based on polyamides and polyolefins containing carbon nanotubes |
| 08/25/2004 | EP1449884A1 Resin film and method for production thereof and resin laminated metal plate using the resin film and method for manufacture thereof |
| 08/25/2004 | EP1449883A1 Polymer packaging layer with improved release properties |
| 08/25/2004 | EP1449882A1 Impact-resistant cyclic olefin based resin composition and moldings |
| 08/25/2004 | EP1449878A1 Polypropylene compositions |
| 08/25/2004 | EP1449877A1 Highly flexible polyolefin foam containing metallocene polyethylene |
| 08/25/2004 | EP1449876A1 Highly flexible polyolefin foam containing chlorinated polyethylene |
| 08/25/2004 | EP1449859A1 Process for production of high-isoprene butyl rubber |
| 08/25/2004 | EP1448731A2 Antimicrobial polyolefin articles and methods for their preparation |
| 08/25/2004 | EP1448705A1 Easy tearable cable component and telecommunication cable comprising said component |
| 08/25/2004 | EP1448704A1 Pipe systems of polypropylene compositions |
| 08/25/2004 | EP1448703A1 Melt blended high density polyethylene compositions with enhanced properties and method for producing the same |
| 08/25/2004 | EP1448702A1 Pipe for hot fluids |
| 08/25/2004 | EP1448701A1 Method for reducing the toughness of shaped plastic parts to be mechanically worked and the use thereof |