| Patents for C08K 5 - Use of organic ingredients (139,022) |
|---|
| 09/02/2004 | WO2004074359A2 Flame retardant molding compositions containing group iva metal oxides |
| 09/02/2004 | WO2004074328A1 Photocurable compositions |
| 09/02/2004 | WO2004074250A1 Novel compounds and compositions containing the same |
| 09/02/2004 | WO2004073905A1 Method of producing molds for lost wax precision casting |
| 09/02/2004 | WO2004016681A3 Multi-functional color concentrate compositions |
| 09/02/2004 | US20040171847 From a pyrrolidinone compound; coloring high molecular weight material |
| 09/02/2004 | US20040171788 Main chain type liquid crystal polyester, liquid crystalline composition, method for producing liquid crystal film, optical film and display |
| 09/02/2004 | US20040171787 Waterproofing, durability, stability , heat resistance; reacting phenyl with sulfur chloride in presence of waterproofingaryl or alkyl halide |
| 09/02/2004 | US20040171769 Phosphorus element -containing crosslinking agents and flame retardant phosphorus element-containing epoxy resin compositions prepared therewith |
| 09/02/2004 | US20040171762 Mixture of a polymer and polyesteretheramide polymer as antistatic agents |
| 09/02/2004 | US20040171758 Thermoplastic elastomers and process for making same |
| 09/02/2004 | US20040171743 Organometallic polymer dissolving in solvent ; metal oxide dissolved in polymer |
| 09/02/2004 | US20040171736 Fluoropolymer dispersion containing no or little low molecular weight fluorinated surfactant |
| 09/02/2004 | US20040171734 Amine oxide coating compositions |
| 09/02/2004 | US20040171730 Polyoxymethylene composition |
| 09/02/2004 | US20040171729 Blend containing peroxy compound and metal oxide; melt processability |
| 09/02/2004 | US20040171726 Using polyethersiloxane copolymer |
| 09/02/2004 | US20040171724 Mixture containing nucleated talc, hydrotalc |
| 09/02/2004 | US20040171723 Phosphorus compounds as stabilizers |
| 09/02/2004 | US20040171722 Flame retardant polyurethanes and additive compositions for use in producing them |
| 09/02/2004 | US20040171721 Stabilizing polyalkylene carbonate resins |
| 09/02/2004 | US20040171720 Moldings, films, fibers, or foams comprising mixtures of polyacetals, polyamines, hindered amine light stabilizers and adjuvants, having chemical and heat resistance |
| 09/02/2004 | US20040171714 Fluororubber molded article and method for producing the same |
| 09/02/2004 | US20040171711 Sealing material for air-conditioner |
| 09/02/2004 | US20040171709 flame-retarded, polyurethane foam comprising brominated and/or phosphorous flame retardants and 7-Oxabicyclo[4.1.0]heptane-3-carboxylic acid as an acid scavenger; prevents poor cure and loss of strength by neutralizing acids |
| 09/02/2004 | US20040171708 Polyolefin resin expanded particle and in-mold foamed article prepared therefrom |
| 09/02/2004 | US20040171699 Containing polyoxyethylene sorbitan monolaurate; stability, health, environmentally friendly; cosmetics |
| 09/02/2004 | US20040170908 Showing sufficient absorption within the predetermined visible ray region and no unnecessary absorption in the other region; no burn-in due to the decolorization of dyes under normal operating conditions |
| 09/02/2004 | US20040170837 Non-halogenated flame retardant material |
| 09/02/2004 | US20040170790 Stiffness, impact strength even at low temperatures; containing beta nucleated polymers |
| 09/02/2004 | US20040170785 Cosmetic containers |
| 09/02/2004 | US20040170775 Shape persistent triptycene based moieties; dielectric coatings; liquid crystal displays which exhibit unusual responses when subjected to stimuli |
| 09/02/2004 | US20040170768 Coating with a one part room temperature vulcanizable composition that cures through exposure to moisture and contains a fire retardant filler such as melamine; excellent exterior durability |
| 09/02/2004 | US20040169317 Polyisoprene articles and process for making the same |
| 09/02/2004 | US20040168760 Organosilane-isocyanate adduct and an isocyanato-organosilane; post-chlorinated polypropylenel; injection molding, extrusion; heat treatment not required |
| 09/02/2004 | DE202004007739U1 Aroma angereicherte Verpackungen, Textilien, Stoffe, Kunststoffe und andere Materialien sowie daraus hergestellte Gegenstände Aroma-enriched packaging, textiles, fabrics, plastics and other materials and articles made therefrom |
| 09/02/2004 | DE10309570B3 Modifizierte Polyethylenphosphinsäuren und deren Salze Modified Polyethylenphosphinsäuren and salts thereof |
| 09/02/2004 | DE10308197A1 Production of non-sticky preparations of oligo- or poly-meric hindered amine light stabilisers, especially for use with polyolefin, involves mixing a solution or melt with metal stearate and converting into a required usage form |
| 09/02/2004 | DE10307137A1 Zusammensetzung Composition |
| 09/01/2004 | EP1452571A1 Fluoropolymer dispersion containing no or little low molecular weight fluorinated surfactant |
| 09/01/2004 | EP1452567A1 Flame-retardant resin composition |
| 09/01/2004 | EP1452565A1 Modified bitumen and asphalt produced therefrom |
| 09/01/2004 | EP1452564A1 Flame-retardant resin composition |
| 09/01/2004 | EP1452563A1 Flame-retardant resin composition |
| 09/01/2004 | EP1452561A1 Fluororubber molded article and method for producing the same |
| 09/01/2004 | EP1452559A1 Flameproof expanded polyolefins containing carbon black |
| 09/01/2004 | EP1452557A1 Non-halogenated flame retardant material |
| 09/01/2004 | EP1452535A1 Basic silane coupling agent-organic carboxylic acid salt composition, process for preparing the salt composition and epoxy resin compositions containing the same |
| 09/01/2004 | EP1452344A1 Tire with tread of natural rubber-rich rubber composition |
| 09/01/2004 | EP1451887A1 Proton-conducting electrolyte membrane, method for production and use thereof in a fuel cell |
| 09/01/2004 | EP1451252A1 Stabilized resin compositions |
| 09/01/2004 | EP1451250A1 Castable compositions |
| 09/01/2004 | EP1451248A1 2-hydroxyphenyl-s-triazine crosslinkers for polymer networks |
| 09/01/2004 | EP1451247A1 Cycloolefin copolymer resins having improved optical properties |
| 09/01/2004 | EP1451244A1 A method and composition for bonding fibres to rubbers |
| 09/01/2004 | EP1451240A1 Preventing discoloration in an elastomer rubber |
| 09/01/2004 | EP1451137A1 Neutral carbonated alkaline earth metal carboxylates |
| 09/01/2004 | EP1274801B1 Thermoplastic silicone polyamide elastomers |
| 09/01/2004 | EP1268593A4 Fire resistant foam and foam products, method and dispersions for making same |
| 09/01/2004 | EP1189985B1 Polypropylene with high melt strength and drawability |
| 09/01/2004 | CN1526181A Lithium polymer secondary cell |
| 09/01/2004 | CN1526144A Proton conductor, single-ion conductor, and processes for producing these |
| 09/01/2004 | CN1525996A Conductive member for oa equipment |
| 09/01/2004 | CN1525993A Optical material containing functional fluoropolymer |
| 09/01/2004 | CN1525992A Disodium hexahydrophthalate salt compositions and nucleated polymers comprising such compositions |
| 09/01/2004 | CN1525991A Composition for pretreating fiber materials |
| 09/01/2004 | CN1525990A Low permeability nanocomposites |
| 09/01/2004 | CN1525985A Expanded polypropylene granule composition |
| 09/01/2004 | CN1525975A Tert. alkylphenoxy substituted polycyclic compounds |
| 09/01/2004 | CN1524900A Non-halogenated flame retardant material |
| 09/01/2004 | CN1524899A Special cross-linked polyethylene material for rotational molding and preparing process thereof |
| 09/01/2004 | CN1524896A Method for improve stability of dibenzylidene sorbitols nucleation agent |
| 09/01/2004 | CN1164676C Water soluble resin composition and water soluble film |
| 09/01/2004 | CN1164673C Fluoroelastomer composition for crosslinking |
| 09/01/2004 | CN1164671C Composition of ABS and/or ASA copolymers and SAN copolymers with high chemical resistance |
| 09/01/2004 | CN1164661C Starch-based biodegradable material and its preparation method |
| 09/01/2004 | CN1164657C Pressure sensitive adhesives |
| 09/01/2004 | CN1164627C Method for preparing transparent polypropylene |
| 08/31/2004 | US6784258 Modified aminoplast crosslinkers and powder coating compositions containing such crosslinkers |
| 08/31/2004 | US6784255 Rubber composition for extrusion to give a ribbon- like compound prepared prior to extrusion having no crack nor tear, stable cross sectional shape of extrudate, and foamed products with little variation in foaming |
| 08/31/2004 | US6784248 Thermosetting compositions containing alternating copolymers of isobutylene type monomers |
| 08/31/2004 | US6784247 Powder coating compositions having improved mar and acid resistance |
| 08/31/2004 | US6784245 High-frequency weldable and low-temperature flexible polymer mixture and its use |
| 08/31/2004 | US6784241 Heat resistance, oil repellents, chemical resistance, waterproofing |
| 08/31/2004 | US6784239 Durable water repellent and coated articles |
| 08/31/2004 | US6784237 Water-and oil-repellent, antistatic composition |
| 08/31/2004 | US6784235 A polyolefin films having incorporated therein a compound of the formula ch3ch2(ch2ch2)ach2ch2(och2ch2)boh, where a is 9 to 25 and b is 1 to 10, exhibit superior fog resistance; useful as packaging film for food and as greenhouse film |
| 08/31/2004 | US6784234 High performance plastic pallets |
| 08/31/2004 | US6784233 Thermoplastic polyester, polycarbonate, elastomeric polymer, phosphorus-containing stabilizer; molding material |
| 08/31/2004 | US6784232 Flame-resistant polycarbonate blends |
| 08/31/2004 | US6784226 Process for producing a styrenic resin composition |
| 08/31/2004 | US6784225 Surface enhancer for making a molded metal/ceramic article |
| 08/31/2004 | US6784150 For use as blowing agents for polymer foams, refrigerants, aerosol propellants, metered dose inhalers, heat transfer media, and gaseous dielectrics |
| 08/31/2004 | US6783916 Hydroxyl-containing polymer, amino cross-linking agent, thermal acid generator; for use as undercoat layer in deep uv lithography |
| 08/31/2004 | US6783897 Crosslinking agent and crosslinkable solid polymer electrolyte using the same |
| 08/31/2004 | US6783859 Waterproofing; protective coatings for semiconductor |
| 08/31/2004 | US6783814 Graft polymer of porous polymer and interpenetrating polymer network |
| 08/31/2004 | US6783692 Heat softening thermally conductive compositions and methods for their preparation |
| 08/26/2004 | WO2004072179A1 Halogen free ignition resistant thermoplastic resin compositions |
| 08/26/2004 | WO2004072170A2 Halogen free ignition resistant thermoplastic resin compositions |