| Patents for C07H 13 - Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids (4,753) |
|---|
| 03/30/1994 | CN1084563A Recombinant DNA molecules encoding aminopeptidase enzymes and their use in the preparation of vaccines against helminth infections |
| 03/29/1994 | US5298611 Sucralose pentaester production |
| 03/29/1994 | US5298494 Monosaccharides having anti-proliferation and anti-inflammatory activity, compositions and uses thereof |
| 03/22/1994 | US5296629 Recovering heavy metal from waste liquid by contacting with insoluble hydrolyzable tannin to adsorb metal on tannin, separating tannin, extracting metal with dilute mineral acid |
| 03/22/1994 | US5296620 Hexenol derivatives as intermediates for compounds for treatment of AIDS virus infections |
| 03/22/1994 | US5296594 Sialic acid glycosides, antigens, immunoadsorbents, and methods for their preparation |
| 03/22/1994 | US5296360 Process for producing ganglioside GM1 |
| 03/17/1994 | WO1994005619A1 4-hydroxy-2-cyclopentenone derivative and carcinostatic and osteogenesis promoter containing the same |
| 03/16/1994 | EP0586687A1 Trans-sialidase and methods of use and making thereof |
| 03/15/1994 | US5294723 Antitumor, immunology |
| 03/15/1994 | US5294703 Heating cellulose with acetic anhydride,acetic acid and a strong acid; quenching with a low molecular weight alcohol |
| 03/08/1994 | US5292899 Synthesis of 11-nor-Δ-9-tetrahydrocannabinol-9-carboxylic acid glucuronide |
| 03/08/1994 | CA1327476C Solid, nondigestible, fat-like compounds |
| 02/17/1994 | WO1994003469A1 New derivatives of neuraminic acid |
| 02/16/1994 | CN1082055A Polymeric lewis X saccharide and preparation of same |
| 02/15/1994 | US5286745 Perived from stroptomyces |
| 02/03/1994 | WO1994002624A1 A facile enzymatic synthesis of galactosyl-beta-1,3 glycals |
| 02/03/1994 | WO1994002495A1 Esterification process |
| 02/03/1994 | CA2141301A1 Esterification process |
| 02/02/1994 | EP0580763A1 Compositions and methods for endothelial binding |
| 02/02/1994 | EP0580676A1 Process for tanning hides and compounds for use therein |
| 02/01/1994 | US5283353 Enzymeric cleavage from glycoprotein |
| 02/01/1994 | CA1326664C Azidochlorination and diazidization of glycals |
| 01/31/1994 | CA2100600A1 New carbohydrate-based anti-inflammatory agents |
| 01/20/1994 | DE4223552A1 Glycoside cpd. e.g. neuraminic acid deriv. prepn. - from phosphate or phosphate deriv. glycosyl donor and glycosyl acceptor, giving e.g. ganglioside intermediate |
| 01/19/1994 | EP0578726A1 Virus inactivation method and pharmaceutical composition therefor. |
| 01/18/1994 | US5280113 Method for producing synthetic N-linked glycoconjugates |
| 01/18/1994 | CA1326163C Sucrose polyesters which behave like cocoa butters |
| 01/12/1994 | EP0578026A1 Polymeric Lewis X saccharides and process for their preparation |
| 01/11/1994 | US5278300 4,6-o-hydroxyphosphoryl-glucosamine derivatives |
| 01/06/1994 | WO1994000596A1 Acceptor for fucosyltransferase |
| 01/06/1994 | WO1994000509A1 Oxazolone derived materials |
| 01/06/1994 | WO1994000466A1 Broad host spectrum rhizobiaceae nodulation signals |
| 01/06/1994 | CA2139350A1 Oxazolone derived materials |
| 01/06/1994 | CA2137008A1 Acceptor for fucosyltransferase |
| 01/05/1994 | EP0577302A1 Process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates |
| 01/05/1994 | EP0576592A1 Oligosaccharide enzyme substrates and inhibitors: methods and compositions |
| 01/04/1994 | US5275939 Ganglosides for nerves |
| 12/31/1993 | CA2099306A1 Polymeric lewis x saccharides and a process for their preparation |
| 12/29/1993 | EP0576232A1 Process for separating 2-deoxy-2, 2-difluoro-D-ribofuranosyl alkylsulfonate anomers |
| 12/29/1993 | EP0576231A1 Process for preparing alpha-anomer enriched 1-halo-2-deoxy-2, 2-difluoro-D-ribofuranosyl derivatives |
| 12/29/1993 | EP0576229A1 Low temperature process for preparing alpha-anomer enriched 2-deoxy-2, 2-difluoro-D-ribofuranosyl sulfonates |
| 12/29/1993 | EP0576228A1 Process for preparing beta-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl-arylsulfonates |
| 12/29/1993 | EP0575517A1 Lipid a analog/immunogenic carrier conjugates, the use thereof as vaccines and polyvalent hyperimmune gammaglobulins |
| 12/29/1993 | CN1079967A Method for producing carbohydrates |
| 12/28/1993 | US5274169 Method of preparing insoluble hydrolysable tannin and method of treating waste liquid with the tannin |
| 12/28/1993 | US5274113 Long wavelength chemically reactive dipyrrometheneboron difluoride dyes and conjugates |
| 12/14/1993 | US5270461 Benzoate esters of alkoxylated methyl glucosides |
| 12/14/1993 | US5270460 Sucrose 6,4'-dicarboxylic esters |
| 12/09/1993 | WO1993024503A1 Sequential removal of monosaccharides from the reducing end of oligosaccharides and uses thereof |
| 11/25/1993 | WO1993023542A1 Recombinant dna molecules encoding aminopeptidase enzymes and their use in the preparation of vaccines against helminth infections |
| 11/25/1993 | WO1993023029A1 Antitussive |
| 11/25/1993 | CA2134326A1 Recombinant dna molecules encoding aminopeptidase enzymes and their use in the preparation of vaccines against helminth infections |
| 11/24/1993 | EP0570682A1 Synthetic lipid A glycoconjugate antigens for use in vaccines |
| 11/24/1993 | EP0512031B1 Bleaching detergent composition |
| 11/23/1993 | US5264567 Disaccharide derivatives |
| 11/23/1993 | CA2092675A1 Physiologically active substances of plant, process for the preparation thereof, and utilities thereof |
| 11/23/1993 | CA1324604C Method of purifying crude polyol fatty acid polyesters |
| 11/16/1993 | CA1324376C Process for the synthesis of polyol fatty acid polyesters |
| 11/11/1993 | WO1993022322A1 PROCESS FOR PREPARING α-D-CELLOBIOSE OCTAACETATE |
| 11/09/1993 | US5260206 Antibiotics |
| 11/09/1993 | CA1324128C 2', 2'-difluoronucleosides |
| 11/08/1993 | CA2095588A1 Synthetic lipid a glycoconjugate antigens for use in vaccines |
| 10/28/1993 | WO1993021195A1 Water-soluble retinoids |
| 10/28/1993 | WO1993021194A1 Method of preparing fatty-acid partial esters of polyols |
| 10/26/1993 | US5256798 Process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates |
| 10/26/1993 | US5256797 Treating mixture with solvent, heating, adding countersolvent, cooling |
| 10/26/1993 | CA1323625C Process for synthesizing sucrose derivatives by regioselective reaction |
| 10/20/1993 | EP0566459A1 Reagent and catalytic process for cleaving protected functional groups |
| 10/20/1993 | EP0566438A1 Method for the preparation of D-maltose monoesters with a high 6-0'-ester content and their use in the cosmetic, dental-care, pharmaceuticals and food stuff fields |
| 10/20/1993 | EP0566366A2 Process for producing maltooligosaccharide derivative |
| 10/16/1993 | CA2093989A1 Reagent and catalytic process for clearing a protected function |
| 10/16/1993 | CA2093867A1 Process for producing maltooligosaccharide derivative |
| 10/14/1993 | WO1993019761A1 Lipid-a analogs: new monosaccharide and disaccharide intermediates for eliciting therapeutic antibodies and for antitumor and antiviral activities |
| 10/14/1993 | DE4212155A1 Verfahren zur Herstellung von Polyol-Fettsäure-Partialestern A process for preparing polyol fatty acid partial esters |
| 10/14/1993 | CA2126341A1 Lipid-a analogs: new monosaccharide and dissaccharide intermediates for eliciting therapeutic antibodies and for antitumor and antiviral activities |
| 10/13/1993 | EP0565241A1 Oligosaccharides |
| 10/12/1993 | US5252756 Process for preparing beta-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl-arylsulfonates |
| 10/12/1993 | US5252472 Process for the production of furans and lactones from streptomyces |
| 10/05/1993 | US5250155 Contacting alkali-added reaction product with acid to convert to free fatty acid; neutralization; removal; high temperature distillation or deodorizing |
| 09/30/1993 | WO1993019077A1 Edible fat-containing products |
| 09/30/1993 | WO1993018787A1 Trans-sialidase and methods of use and making thereof |
| 09/22/1993 | EP0561523A2 Sugar compound, sialic acid-containing sugar chains' biosynthesis inhibitor, production process thereof and intermediate |
| 09/21/1993 | US5246961 β-d-phenylthioxylosides, and their use as therapeutic agents |
| 09/15/1993 | EP0560409A2 Sialic acid glycosides, antigens, immunoadsorbents, and methods for their preparation |
| 09/15/1993 | EP0560081A1 Process for production of high-monoester sucrose higher fatty acid esters |
| 09/15/1993 | EP0560055A1 Immuno-suppressing enepyranose derivatives |
| 09/13/1993 | CA2091521A1 Method for producing carbohydrates |
| 09/08/1993 | EP0558515A1 Process for preparing n-alkyl polyhydroxy amines and fatty acid amides therefrom in hydroxy solvents. |
| 09/01/1993 | CN1075635A Immuno-suppressing agent |
| 09/01/1993 | CN1021969C Sialosylcerebrosioles and preparation method thereof |
| 08/31/1993 | US5241072 Oligosaccharide oxazolines, oligosaccharide conjugates and methods of preparation thereof |
| 08/24/1993 | US5239097 Process for refining soap-containing crude polyol fatty-acid polyester reaction products |
| 08/24/1993 | US5238680 Contacting bark with tannin-enriched aqueeous solution, slurrying, separating by pressure filtration, and multistage washing |
| 08/18/1993 | EP0555385A1 Agents and methods for binding to elam-1 |
| 08/17/1993 | CA1321388C Production of polyol esters having reduced color content |
| 08/10/1993 | CA2042053C Lipid a monosaccharide analogues |
| 08/04/1993 | EP0553786A2 Salts of glucopyranose derivative and its intermediate |
| 08/04/1993 | EP0553673A1 N,N-bis-(2-chloroethyl)phosphoric acid diamidates as cytostatics |
| 08/04/1993 | EP0553107A1 Protein kinase c modulators with anti-inflammatory and antiviral activity |