| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 08/17/2011 | CN101195640B Method for continuous production of 0,0-dimethyl thiophosphoryl chloride |
| 08/17/2011 | CN101163710B Phosphine transition metal complex, process for producing the same and anticancer drug containing the same |
| 08/17/2011 | CN101143878B Method for preparing tetrakis(hydroxymethyl)phosphonium chloride from phosphine generated in sodium hypophosphite production |
| 08/17/2011 | CN101143877B Method for preparing tetrakis(hydroxymethyl)phosphonium sulfate from phosphine generated in sodium hypophosphite production |
| 08/17/2011 | CN101054393B Adefovir dipivoxil anhydrous crystal, preparation method and medicine composition thereof |
| 08/16/2011 | US7999111 Reacting an onium halide or carboxylate with a symmetrically substituted dialkyl sulfite or with an asymmetrically substituted dialkyl sulfite; 1-hexyl-3-methylimidazolium chloride and dimethyl sulfite; 1-Hexyl-3-methylimidazolium methanesulfonate |
| 08/16/2011 | US7998895 Catalysts for olefin polymerization |
| 08/16/2011 | CA2556356C Ligand synthesis |
| 08/16/2011 | CA2462045C Novel diphosphines, their complexes with transition metals and their usein asymmetric synthesis |
| 08/16/2011 | CA2408329C Catalysis using phosphine oxide and sulfoxide compounds |
| 08/11/2011 | WO2011097269A1 Crystallization method and bioavailability |
| 08/11/2011 | WO2011095277A1 Phosphinyl hydrazides |
| 08/11/2011 | WO2011095052A1 1, 4, 6, 10-tetra-double bond pentadec-carbon phosphonate, preparation method thereof, and preparation method of lycopene using same |
| 08/11/2011 | WO2009050731A3 Novel process for preparing risedronic acid |
| 08/11/2011 | WO2008138088A3 Solid and water-soluble gluphosinate for herbicide formulation, production process therefor, and process for controlling weeds |
| 08/11/2011 | US20110196172 Process for preparing n-(hydrocarbyl) phosphoric or thiophosphoric triamides |
| 08/11/2011 | US20110196166 Slurry process for synthesis of bisphosphites and situ use thereof for producing bisphosphite |
| 08/11/2011 | US20110196077 Production process of phosphonic acid metal salt and thermoplastic resin composition containing phosphonic acid metal salt |
| 08/11/2011 | US20110196038 Bipolar trans carotenoid salts and their uses |
| 08/11/2011 | US20110195937 Oxidized thiophospholipid compounds and uses thereof |
| 08/11/2011 | US20110195936 Bicyclic sphingosine 1-phosphate analogs |
| 08/11/2011 | US20110195934 Azolopyrrolone melanin concentrating hormone receptor-1 antagonists |
| 08/11/2011 | US20110195933 Pyrazolo[1,5-a]pyridines as mark inhibitors |
| 08/11/2011 | US20110195932 Drug Combinations for the Treatment of Duchenne Muscular Dystrophy |
| 08/11/2011 | US20110195876 Olefinically Unsaturated Phosphonate Compounds, Polymers Made Therefrom And Their Use |
| 08/11/2011 | US20110195574 Niobium and vanadium organometallic precursors for thin film deposition |
| 08/11/2011 | US20110195246 Inorganic substrates with hydrophobic surface layers |
| 08/11/2011 | US20110195094 Triazole compounds that modulate hsp90 activity |
| 08/11/2011 | US20110195028 Magnetic resonance imaging and/or spectroscopy contrast agents and methods of use thereof |
| 08/11/2011 | DE102010001836A1 Verfahren zur Hydrosilylierung mit Platinkatalysator Hydrosilylation process with platinum catalyst |
| 08/11/2011 | CA2826548A1 Crystallization method and bioavailability |
| 08/10/2011 | EP2354146A1 Method for introducing functional group to surface of material |
| 08/10/2011 | EP2352742A2 Phosphorus-containing silsesquioxane derivatives as flame retardants |
| 08/10/2011 | EP2352741A1 Method for producing mono amino-functionalised dialkylphosphinite acids esters and salts and use thereof |
| 08/10/2011 | EP2352740A1 Method for producing dialkylphosphinic acids and esters and salts thereof by means of acrylic acid derivatives and use thereof |
| 08/10/2011 | EP2352739A2 Method for producing mono-vinylfunctionalized dialkylphosphinic acid, salts and esters thereof, and the use thereof |
| 08/10/2011 | EP2352738A1 Method for producing mono-carboxyfunctionalized dialkylphosphinic acids and esters and salts thereof by means of vinylenes/nitriles and use thereof |
| 08/10/2011 | EP2352737A1 Method for producing dialkylphosphinic acids and esters and salts thereof by means of vinyl compounds and use thereof |
| 08/10/2011 | EP2352736A1 Method for producing mono-aminofunctionalized dialkylphosphinic acids and esters and salts thereof and use thereof |
| 08/10/2011 | EP2352735A1 Method for producing mono-hydroxyfunctionalized dialkylphosphinic acids and esters and salts thereof by means of allyl alcohols and use thereof |
| 08/10/2011 | EP1899289B1 Method for producing aryl amines, aryl ethers and aryl thioethers |
| 08/10/2011 | EP1802641B1 Bisphosphonate compounds and methods for bone resorption diseases, cancer, bone pain, immune disorders, and infectious diseases |
| 08/10/2011 | EP1775301B1 Novel supported phosphazene catalysts, novel compounds for the catalysts, and use thereof |
| 08/10/2011 | EP1644314B1 Method for producing difluoro-acetyl-acetic acid alkylesters |
| 08/10/2011 | EP1637538B1 Crystalline carbapenem intermediate |
| 08/10/2011 | EP1343545B2 Endosseous implant |
| 08/10/2011 | CN1972940B Pyrrolopyrimidine and pyrrolopyridine derivatives substituted with a cyclic amino group as CRF antagonists |
| 08/10/2011 | CN1958594B Method for preparing solid of glyphosate isopropyl amine salt |
| 08/10/2011 | CN102149722A Acetylene tolerant hydroformylation catalysts |
| 08/10/2011 | CN102149721A Aminophosphinic derivatives that can be used in the treatment of pain |
| 08/10/2011 | CN102149675A Reagents and methods for the Beta-keto amide synthesis of a synthetic precursor to immunological adjuvant E6020 |
| 08/10/2011 | CN102146097A Method for preparing 9,10-dihydro-9-oxa-10-phosphaphenanthrene-10-oxide |
| 08/10/2011 | CN102146096A Aniline quinazoline compound as well as preparation method and application thereof |
| 08/10/2011 | CN102146095A Pyrrole indolone compounds and preparation method and use thereof |
| 08/10/2011 | CN102146094A Adsorption method for preparing soybean lecithin |
| 08/10/2011 | CN102146089A Method of preparing organometallic compounds |
| 08/10/2011 | CN101781331B Method for extracting glyphosate from glyphosate dilute solution |
| 08/10/2011 | CN101531680B Method for synthesizing (R)-9(2-(diethyl phosphonyl methoxyl) propyl)-adenine |
| 08/10/2011 | CN101395089B Nano-size euse crystal, and process for producing nano-size euse crystal |
| 08/10/2011 | CN101307074B Process for preparing N-phosphonomethyliminodiacetic acid |
| 08/09/2011 | US7994363 Bis(bis(o-fluorophenyl)phosphino) isopropylamine; ethylene oligomerization catalyst; trimerization and tetramerization to 1-hexene and 1-octene also in the presence of a chromium source and a methalumoxane activator; further copolymerization, or separating 1-hexene by distillation; by-product inhibition |
| 08/09/2011 | US7994358 Phosphorus-containing compound and method for preparing the same |
| 08/09/2011 | US7994335 Electronically tuned ligands for asymmetric hydrogenation |
| 08/09/2011 | US7994320 Narcistatin prodrugs |
| 08/09/2011 | CA2572208C 3-carbamoyl-2-pyridone derivative |
| 08/09/2011 | CA2486964C Polymeric ammonium and or phosphonium salts having added .pi. electrons and higher molecular weight as enhancers for chemiluminescent systems |
| 08/09/2011 | CA2441146C Fluorescent cobalamins and uses thereof |
| 08/09/2011 | CA2412534C New compositions for the isolation and/or stabilisation of nucleic acids in biological materials |
| 08/04/2011 | WO2011093848A1 Thermosetting monomers and compositions containing phosphorus and cyanato groups |
| 08/04/2011 | WO2011093401A1 Novel chain transfer agent and emulsion polymerization using same |
| 08/04/2011 | WO2011092194A1 N-methyl-melaminium salt of monomethylmethane phosphonic acid ester as a flame retardant |
| 08/04/2011 | WO2011023756A4 Organophosphorus compounds based on tetraphenol (tp)-substituted structures |
| 08/04/2011 | US20110190505 Iodonium Cyclophanes for SECURE Arene Functionalization |
| 08/04/2011 | US20110190489 Novel Tricyclic Compounds |
| 08/04/2011 | US20110190480 Cyanoborate, fluoroalkylphosphate, fluoroalkylborate or imide dyes |
| 08/04/2011 | US20110190370 Modulation of hif1(alpha) and hif2(alpha) expression |
| 08/04/2011 | US20110190237 Macrocyclic Prodrug Compounds Useful as Therapeutics |
| 08/04/2011 | US20110190137 Method to inhibit ethylene responses in plants |
| 08/04/2011 | US20110189689 Riboswitches |
| 08/04/2011 | US20110189212 Oxidized lipids and uses thereof in the treatment of inflammatory diseases and disorders |
| 08/03/2011 | EP2351762A1 NOVEL PYRIMIDINE DERIVATIVE AND METHOD FOR PRODUCING HMG-CoA REDUCTASE INHIBITOR INTERMEDIATE |
| 08/03/2011 | EP2351761A1 Novel metal complex, and method for producing -olefin polymer and method for producing -olefin/(meth)acrylate copolymer each using the metal complex |
| 08/03/2011 | EP2351758A1 Metal complexes, a method for preparing same, radiopharmaceutical means based thereon |
| 08/03/2011 | EP2351730A1 Ethoxy diphenyl ethane derivates, preparation processes and uses thereof |
| 08/03/2011 | EP2350104A1 Method for producing 6-chlorodibenzoýd,f¨ý1,3,2¨-dioxaphosphepin |
| 08/03/2011 | EP2350103A1 Process for the production of organic dithiopyrophosphates |
| 08/03/2011 | EP2350102A1 Process for the preparation of ý1-hydroxy-2-(1h-imidazol-1-yl)- ethylidene¨bisphosphonic acid |
| 08/03/2011 | EP2350076A2 Imidazoý1,2- ¨pyridinyl bisphosphonates |
| 08/03/2011 | EP2348866A1 Oxidized lipid compounds and uses thereof |
| 08/03/2011 | EP2348864A2 Oxidized thiophospholipid compounds and uses thereof |
| 08/03/2011 | EP2348857A1 Novel cyclic benzimidazole derivatives useful anti-diabetic agents |
| 08/03/2011 | EP2114970B1 Tricyclic compounds and their use as glucocorticoid receptor modulators |
| 08/03/2011 | CN1832951B Organophosphorus compound having phosphate-phosphonate bond, and flame-retardant polyester fiber and flame-retardant polyurethane resin composition each containing the same |
| 08/03/2011 | CN102143967A Purification method for adefovir dipivoxil |
| 08/03/2011 | CN102142316A Ionic liquid, electrolyte salt for storage device, electrolytic solution for storage device, electric double layer capacitor, and secondary battery |
| 08/03/2011 | CN102140380A Method for preparing nitrogenous phosphate extreme-pressure anti-wear additive by vegetable-oil solid alkali method |
| 08/03/2011 | CN102140379A Method for preparing nitrogen phosphate-containing extreme pressure abrasion-resistant lubricating additive by using biodiesel |
| 08/03/2011 | CN102140120A Visible photochromic compound and synthesis method and application thereof |
| 08/03/2011 | CN102140118A Cage-shaped silicon-containing quaternary phosphonium inflaming retarding surfactant and preparation method thereof |
| 08/03/2011 | CN102140117A 1, 4, 6, 10-tetra-double bond pentadec-carbon phosphonate, preparation method thereof and method for preparing lycopene |