| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 06/17/1980 | US4208357 Process for preparing phosphorus and sulfur containing amides and thioamides |
| 06/17/1980 | US4208344 Corrosion resistance, antiscaling agents |
| 06/17/1980 | US4208340 Uv absorbers, insecticides and antioxidant intermediates |
| 06/17/1980 | US4208292 Phosphomolybdate compounds and their use as lubricant additives |
| 06/17/1980 | CA1079745A1 Process for preparing 1,2-oxa-phospholanes |
| 06/17/1980 | CA1079724A1 Derivatives of psoralene and their preparation process |
| 06/11/1980 | EP0012106A1 Ammonium salts of methyl phosphonic acid, their preparation, their use as additives for hydraulic fluids and hydraulic fluids containing them |
| 06/10/1980 | US4207422 Prostaglandins |
| 06/10/1980 | US4207420 2,2-Difluoro-PGF1 analogs |
| 06/10/1980 | US4207417 Phosphorus containing polyols |
| 06/10/1980 | US4207334 Acylformamidine insecticidal and miticidal compounds |
| 06/10/1980 | US4207272 Tetrachloro-butyl secondary phosphites |
| 06/10/1980 | US4207271 Bis(2,2,2-trihydroxymethyl ethane) methylphosphonate |
| 06/10/1980 | US4207270 Phosphites of polyalcohols |
| 06/10/1980 | US4207229 Stabilizing polypropylene against thernal, oxidative and ultraviolet light degradation |
| 06/10/1980 | US4207195 Sulfurized olefin adducts of dihydrocarbyl phosphites and lubricant compositions containing same |
| 06/10/1980 | CA1079301A1 Production of tertiary phosphine oxides |
| 06/10/1980 | CA1079027A1 Separation of linear (npci2)n from cyclic (npci2)n |
| 06/03/1980 | US4206311 2-Decarboxy-2-hydroxy-methyl-13,14-didehydro-17-phenyl PGF compounds |
| 06/03/1980 | US4206219 Antibiotics |
| 06/03/1980 | US4206156 Antimicrobial |
| 06/03/1980 | US4206153 Treatment of methanolic-aqueous residues from syntheses employing triphenylphosphonium salts |
| 06/03/1980 | US4206133 Flame retardants and smoke suppressants |
| 06/03/1980 | US4205977 Agent and method for influencing plant growth |
| 06/03/1980 | CA1078991A1 Stabilization systems from triarylphosphites and phenols |
| 06/03/1980 | CA1078862A1 Preparation of organic phosphites |
| 06/03/1980 | CA1078854A1 Process for the production of polyisocyanates which contain carbodiimide groups and which are stable in storage |
| 06/03/1980 | CA1078851A1 Integrated process for the preparation of 2-dialkoxyphosphinylimino-1,3-dithietane |
| 06/03/1980 | CA1078731A1 Skeletal imaging kit utilizing triethylene tetramine hexa (methylene phosphonic acid) |
| 05/28/1980 | EP0011456A1 Organotin compounds and resins or polymers stabilized therewith |
| 05/28/1980 | EP0011363A1 Pyrazole phosphates and phosphonates, preparation thereof and use thereof as insecticides |
| 05/28/1980 | EP0011245A1 Process for the preparation of phosphorus-containing cyanhydrine derivatives and those cyanhydrine derivatives |
| 05/28/1980 | EP0011169A1 Process for the stereo-selective preparation of (E),(E)-diolefines |
| 05/27/1980 | US4205023 By contacting with a chelating agent and precipitating the metallic salts |
| 05/27/1980 | US4205022 Fireproofing wood |
| 05/27/1980 | US4204996 Preparation of O,O-dialkyl phthalimido-phosphonothioate |
| 05/27/1980 | CA1078399A1 Insecticidal active thiophene phosphorous derivatives |
| 05/27/1980 | CA1078398A1 Preparation of 2-diethoxyphosphinylimino-1,3-dithietane |
| 05/27/1980 | CA1078374A1 Phosphorus- and sulfur-containing compositions |
| 05/20/1980 | USRE30279 From alkyl or aryl halide with halo-substituted trivalent phosphorus compounds and phosphorus pentasulfide or -oxide |
| 05/20/1980 | US4204073 Trimethyl oxo or hydroxy-substituted cyclopentenes; intermediates for violerythrin and actinioerythrol |
| 05/20/1980 | US4204072 Hydrolysis of the phosphonium salt by a base |
| 05/20/1980 | US4203979 Miticides |
| 05/20/1980 | US4203978 Amidino-phosphoric acid thiol esters for combating pests |
| 05/20/1980 | US4203977 Phosphoric acid esters, composition and use |
| 05/20/1980 | US4203933 For use as dielectric oils |
| 05/20/1980 | US4203932 Insecticides, miticides |
| 05/20/1980 | US4203888 Tetraphenyl metaphenylenediphosphate flame retardant |
| 05/20/1980 | US4203757 Herbicides, algicides, lubricants |
| 05/20/1980 | US4203756 Method for increasing the sucrose content of growing plants |
| 05/20/1980 | CA1077944A1 Herbicidal compositions and pyrazole derivatives |
| 05/20/1980 | CA1077940A1 Hydroxybenzylmalonic acid derivatives and their use as stabilizers for plastics |
| 05/20/1980 | CA1077848A1 Anti-viral composition containing phosphonoformic acid |
| 05/20/1980 | CA1077840A1 Tumor antigen and process for the preparation thereof |
| 05/14/1980 | EP0010891A1 Heterocyclic substituted triazolyl phosphorous compounds, insecticidal compositions containing them and method for controlling insects |
| 05/14/1980 | EP0010872A1 Process for producing alpha-aminophosphonic acids and their peptides and compounds thus obtained |
| 05/14/1980 | EP0010857A2 Layered or amorphous organometallic inorganic polymers and their use |
| 05/14/1980 | EP0010759A2 Pyrimido (6,1-a) isoquinolin-4-ones, process for their preparation and their application in medicaments; intermediates and their preparation |
| 05/14/1980 | EP0010754A2 1-Phosphorylated 2-phenoxy-alkyl-2-imidazoline derivatives, process for their preparation, compositions containing these derivatives and their application to pest control |
| 05/14/1980 | EP0010612A1 N-iso-propyl-S-(1,6-dihydro-6-(thi)oxo-pyridazin(1)-yl-methyl-thiolphosphoric acid esteramides, process for their preparation and their use as pesticides |
| 05/13/1980 | US4202946 Fire retardant polyurethanes prepared from hydroxy substituted aminomethanephosphonates |
| 05/13/1980 | US4202889 Combating arthropods with O-alkyl-O-(6-alkoxy-2-cyclopropyl-pyrimidin-4-yl)-(thiono)(thiol)-phosphoric (phosphonic) acid esters or ester-amides |
| 05/13/1980 | US4202844 Oxidation of organic phosphites with nitrogen dioxide as catalyst |
| 05/13/1980 | US4202843 Process for the production of organic phosphates by nitric acid oxidation of organic phosphites |
| 05/13/1980 | US4202842 Used as fire retardants |
| 05/13/1980 | US4202781 Lubricants with improved oxidation inhibition, friction resistance and extreme pressure properties |
| 05/13/1980 | US4202779 Fire retardants for polyurethanes |
| 05/13/1980 | CA1077518A1 Process for producing 1-aminoalkane-1,1-diphosphonic acids |
| 05/13/1980 | CA1077507A1 Organo titanate chelates and their uses |
| 05/13/1980 | CA1077499A1 Phosphorus-containing compounds |
| 05/13/1980 | CA1077498A1 Thymol blue monophosphates and salts thereof |
| 05/13/1980 | CA1077477A1 Synthesis of methotrexate |
| 05/13/1980 | CA1077473A1 2-decarboxy-2-aminomethyl-prostaglandin analogs |
| 05/06/1980 | US4201879 Vitamin e intermediate |
| 05/06/1980 | US4201873 9-Deoxy-9,10-didehydro-PGD2 analogs |
| 05/06/1980 | US4201733 Pesticides |
| 05/06/1980 | CA1077054A1 Detergent compounds |
| 05/06/1980 | CA1077034A1 Prostanoic acid derivatives |
| 05/06/1980 | CA1077033A1 Cyclopentane derivatives |
| 04/30/1980 | EP0010368A1 Process for production of benzene phosphonic dihalide |
| 04/30/1980 | EP0010366A1 Solid organometallic inorganic polymers and their application |
| 04/30/1980 | EP0010317A1 6-, 1- and 2-substituted-1-carbapen-2-em-3-carboxylic acids, processes for the preparation of such compounds and pharmaceutical composition comprising such compounds |
| 04/30/1980 | EP0010316A1 1-, 6- and 2-substituted-1-carba-2-penem-3-carboxylic acids, process for preparing the same and pharmaceutical compositions containing the same |
| 04/30/1980 | EP0010283A1 Thiol-phosphoric-acid-S-4-nitro-2-trichloromethylphenyl esters, their preparation and their application |
| 04/30/1980 | EP0010208A1 Pharmaceutical composition containing all-E- or 13-Z-7,8-dehydro-retinoic acid and process for its preparation |
| 04/30/1980 | EP0010147A1 N,N'-dialkyl-ureidomethane-diphosphonic acid, its preparation and use |
| 04/30/1980 | EP0010120A1 1-(benzothiazol-2-yl)-4-dialkoxyphosphinyl methylbenzene derivatives and pharmaceutical compositions containing them |
| 04/29/1980 | US4200721 Heat resistant polymers of oxidized styrylphosphine |
| 04/29/1980 | US4200594 3-(1,6-)Diaminohexyl-diloweralkyl) Phosphonates |
| 04/29/1980 | US4200450 N-Alkyl or alkoxy-N'-substituted hydrocarbyl urea |
| 04/29/1980 | CA1076608A1 Insect maturation inhibitors |
| 04/29/1980 | CA1076596A1 Brominated phosphoramidates |
| 04/29/1980 | CA1076594A1 Titanate phosphite adducts and their use |
| 04/29/1980 | CA1076587A1 Prostaglandin derivatives and process for preparing the same |
| 04/29/1980 | CA1076585A1 Phosphoric acid derivatives |
| 04/29/1980 | CA1076576A1 0-(1-fluoro-2-halo-ethyl) (thiono) phosphoric(phosphonic)acid ester-amides,processes for their preparation and their use as insecticides, acaricides and nematocides |
| 04/29/1980 | CA1076572A1 Diazepine derivatives |
| 04/22/1980 | USRE30260 1-(2,6,6-Trimethyl-3-hydroxy-1-cyclohexen-1-yl)-3-methyl-penta-1,4-diene[or 1-yn-4-en]-3-ols |
| 04/22/1980 | US4199534 Poly (oxyorganophosphate/phosphonate) and process for preparing |
| 04/22/1980 | US4199494 Metal complexes of α-aminophosphonic acid half-esters and of α-a |