| Patents for C07F 9 - Compounds containing elements of the 5th group of the periodic system (55,377) |
|---|
| 08/17/1993 | US5236695 MRI image enhancement of bone and related tissue using complexes of paramagnetic cations and polyphosphonate ligands |
| 08/17/1993 | CA1321346C Nmr imaging with paramagnetic polyvalent metal salts of poly-(acid-alkylene-amino)-alkanes |
| 08/12/1993 | DE4203548A1 New Fmoc-phospho-tyrosine - useful as intermediate in prodn. of phospho-tyrosine-contg. peptide derivs. |
| 08/12/1993 | CA2089141A1 Imidazo[1,2-a]pyridines, pharmaceutical compositions containing these compounds and processes for preparing them |
| 08/11/1993 | EP0554861A1 The use of inositoltriphosphate for the treatment of renal diseases |
| 08/11/1993 | EP0554455A1 Optically active intermediate and production thereof |
| 08/11/1993 | EP0554303A1 Cosmetic composition |
| 08/11/1993 | EP0554274A1 Nucleoside derivatives |
| 08/11/1993 | EP0478686B1 Fluorine and phosphorous-containing amphiphilic molecules with surfactant properties |
| 08/11/1993 | EP0340295B1 Low molecular weight viscosity modifying compositions |
| 08/10/1993 | US5235113 Reacting olefin with hydrogen and carbon monoxide in the presence of a group 8 metal catalyst and a phosphite compound |
| 08/10/1993 | US5235086 Process for the preparation of tris(2,4-ditert-butylphenyl)phosphite |
| 08/10/1993 | US5235085 Process for forming bis(pentaerythritol phosphate) carbonate |
| 08/10/1993 | US5235078 For producing thin films on substrates by vapor deposition |
| 08/10/1993 | US5234923 Hypotensive agents |
| 08/10/1993 | US5234918 Certain phosphinyl-oxy-phenyl-methyl-pyridinium-hydroxide inner salts useful as antagonists of PAF |
| 08/10/1993 | US5234716 For gas phase deposition of thin films |
| 08/10/1993 | CA2042053C Lipid a monosaccharide analogues |
| 08/10/1993 | CA1321206C Process for the preparation of alkali metal salts of phosphonic acid monoalkyl esters |
| 08/10/1993 | CA1321204C Acylation products of bis(2-imidazolin-2- ylhydrazones) of 9,10-anthracenedicarboxaldehyde |
| 08/10/1993 | CA1321200C Process for the preparation of phosphoric acid derivatives and intermediates |
| 08/10/1993 | CA1321198C Heterocycle-substituted diphosphonate compounds, pharmaceutical compositions, and methods of treating abnormal calcium and phosphate |
| 08/07/1993 | WO1993016086A1 Process for making pure phosphatidylethanolamine and phosphatidylmyoinositol |
| 08/07/1993 | CA2107912A1 Process for making pure phosphatidylethanolamine and phosphatidylmyoinositol |
| 08/05/1993 | WO1993015091A1 Diphosphine ligands |
| 08/05/1993 | WO1993015090A1 Diphosphine ligands |
| 08/05/1993 | WO1993015089A1 Diphosphine ligands |
| 08/05/1993 | WO1993015088A1 Crystallisation process for preparing glycerophosphocholine |
| 08/05/1993 | WO1993015078A1 Carbapenems containing a carboxy substituted phenyl group, processes for their preparation, intermediates and use as antibiotics |
| 08/05/1993 | WO1993014772A1 Utilization of niobium derivatives as active principle of medicaments useful in the treatment and/or prevention of glucid and/or lipid metabolium troubles |
| 08/05/1993 | WO1993012781A3 Creatine analogs having antiviral activity |
| 08/05/1993 | WO1993007905A3 Treated apatite particles for medical diagnostic imaging |
| 08/05/1993 | CA2126106A1 Crystallisation process for preparing glycerophosphocholine |
| 08/04/1993 | EP0554006A1 Polyunsaturated diazonium compounds |
| 08/04/1993 | EP0553984A2 Process for making phosphite esters |
| 08/04/1993 | EP0553890A1 Diphenyl heteroalkyl derivatives, their preparation, as well as medicinal and cosmetic preparations prepared therefrom |
| 08/04/1993 | EP0553778A1 Asymmetric hydrogenation |
| 08/04/1993 | EP0553710A2 Phospholene oxides |
| 08/04/1993 | EP0553673A1 N,N-bis-(2-chloroethyl)phosphoric acid diamidates as cytostatics |
| 08/04/1993 | EP0553630A1 Pyridyloxy-naphthalines as herbicides |
| 08/04/1993 | EP0553225A1 Acyl-(2'-hydroxydiphenyl-2-yl)-phosphinic acid salts, their production and use |
| 08/04/1993 | EP0553107A1 Protein kinase c modulators with anti-inflammatory and antiviral activity |
| 08/03/1993 | US5233092 Diphosphonate compounds, their preparation and application |
| 08/03/1993 | US5233088 Process for the preparation of alkali metal salts of 2-phosphonobutane-1,2,4-tricarboxylic acid |
| 08/03/1993 | US5233080 Preparation of N-acylaminomethylphosphonic acids and aminomethylphosphonic acids |
| 08/03/1993 | US5233067 Silane coupling agent for improved adhesion |
| 08/03/1993 | US5233045 Process for the preparation of imidazothiazolone derivatives |
| 08/03/1993 | US5232938 For treatment of respiratory tract disorders, hypertension and urinary tract disorders |
| 08/03/1993 | US5232895 Postemergence herbicides |
| 08/03/1993 | US5232628 Polyadducts of alkylene oxide and styrene oxide with aryl alkanols |
| 08/03/1993 | CA1320961C Reaction products of dialkyl and trialkyl phosphites with elemental sulfur and method of preparing same |
| 08/03/1993 | CA1320954C .alpha.-adrenergic receptor antagonists |
| 08/03/1993 | CA1320953C .alpha.-adrenergic receptor antagonists |
| 07/29/1993 | DE4202183A1 Substd. salicylic aldehyde derivs. for treating type II diabetes - inhibit the prodn. of glucose in the liver |
| 07/29/1993 | CA2088175A1 Phospholene oxides |
| 07/28/1993 | EP0553059A1 Novel cycloalkylidine-bis phenol phosphites |
| 07/28/1993 | EP0552875A2 Water repellents containing organosilicon compounds |
| 07/28/1993 | EP0552767A2 3'-derivatised oligonucleotide analogues with non-nucleotidic groups, their preparation and use |
| 07/28/1993 | EP0552766A2 Oligonucleotide analogues, their preparation and use |
| 07/28/1993 | EP0552309A1 New process for biophosphorylating organic compounds |
| 07/28/1993 | EP0552185A1 Synthesis of oligonucleotides |
| 07/28/1993 | EP0458965A4 Process for the preparation of vinyl ethers |
| 07/27/1993 | US5231221 Process for the preparation of acylals |
| 07/27/1993 | US5231202 Optically active tertiary phosphine compound and transition metal complex using the same as ligand |
| 07/27/1993 | US5231191 Rhodamine phosphoramidite compounds |
| 07/27/1993 | US5231180 Process for the manufacture of diazinon |
| 07/27/1993 | US5231091 Bis-arylphosphate ester antagonists of platelet activating factor |
| 07/27/1993 | US5230964 High density recording; durability, wear and friction resistance |
| 07/27/1993 | US5230816 Stabilized to light, heat and oxygen |
| 07/27/1993 | CA1320739C Process for the preparation of metal salts of phosphoric and phosphonic acid esters |
| 07/27/1993 | CA1320727C Pharmaceutical compositions containing geminal diphosphonates |
| 07/22/1993 | WO1993014114A1 Peptide linkage unit comprising methylene phosphinic acid |
| 07/22/1993 | WO1993014112A1 Substituted phosphinic acid-containing peptidyl derivatives as antidegenerative agents |
| 07/22/1993 | WO1993014097A1 Novel bisphosphonic acid derivatives and their use |
| 07/22/1993 | WO1993013765A1 Lecithin-containing solutions with levemopamil |
| 07/22/1993 | DE4201527A1 Lecithinhaltige loesungen mit levemopamil Lecithin-containing loesungen with levemopamil |
| 07/22/1993 | CA2127295A1 Peptide linkage unit comprising methylene phosphinic acid |
| 07/22/1993 | CA2126687A1 Substituted phosphinic acid-containing peptidyl derivatives as antidegenerative agents |
| 07/22/1993 | CA2087582A1 Cycloalkylidene bisphenol phosphites |
| 07/22/1993 | CA2083545A1 Polyunsaturated diazonium compounds |
| 07/21/1993 | EP0551850A1 Flame retardant thermoplastic polyester moulding compositions and use thereof |
| 07/21/1993 | EP0551760A2 Polyether phosphate esters |
| 07/21/1993 | EP0466730B1 Geminal bisphosphonic acids and derivatives as anti-arthritic agents |
| 07/21/1993 | CN1074447A Bicyclopolyazamacrocyclophosphonic acids, their complexes and conjugates, for use as contrast agents, and processes for their preparation |
| 07/20/1993 | US5229424 Insecticides, acaricides |
| 07/20/1993 | US5229379 Certain n-substituted-amino-alkane phosphinic acid derivatives having anti-epileptic properties |
| 07/20/1993 | US5229378 Antioxidant, antiinflammatory, antiallergen |
| 07/20/1993 | US5229377 Process for the preparation of the (R) stereoisomer of the monobutyric ester of 2,2-bis(hydroxymethyl)-tetrahydrofuran, its use in preparing stereoisomers of pharmacologically active compounds, and certain specific stereoisomers produced thereby |
| 07/20/1993 | US5229375 Antitumor agents, antigrowth agents and DNA cleaving property |
| 07/20/1993 | US5229343 Catalyst for preparation of ethylene-propylene-carbon monoxide terpolymers |
| 07/20/1993 | US5229238 Electroconductive layer with a light sensitive layer and charge generating compound |
| 07/20/1993 | US5229162 Article having biocompatible surface |
| 07/20/1993 | US5229023 Telomerized triglyceride vegetable oil for lubricant additives |
| 07/20/1993 | CA1320486C .alpha. -adrenergic receptor antagonists |
| 07/20/1993 | CA1320485C .alpha. -adrenergic receptor antagonists |
| 07/16/1993 | WO1993014096A1 Phosphono derivatives of amino acids as metalloproteinase inhibitors |
| 07/16/1993 | CA2105309A1 Phosphono derivatives of amino acids as metalloproteinase inhibitors |
| 07/14/1993 | EP0551153A1 Derivatives of 2,4-diamino-1,3,5-triazinyl-6-phosphonic acid |
| 07/14/1993 | EP0550924A1 2-Pyrrolidinone derivatives as HIV protease inhibitors |
| 07/14/1993 | EP0550574A1 Heterocyclic compounds |