| Patents for C07F 7 - Compounds containing elements of the 4th group of the periodic system (40,376) |
|---|
| 08/25/1993 | EP0556780A2 Organic silicon compounds |
| 08/25/1993 | EP0556381A1 N-(4-pyridyl or 4-quinolinyl) arylacetamide pesticides |
| 08/24/1993 | US5239113 Anticoagulants |
| 08/24/1993 | US5239102 Method for making organohalosilanes |
| 08/24/1993 | US5239101 Rearrangement of chlorine end-terminated polyorganosiloxanes having one or more hydrogen atoms bonded to silicon to organosiloxy end-blocked polyorganohydrosiloxanes |
| 08/24/1993 | US5239099 Room temperature vulcanization; noncorrosive byproducts |
| 08/24/1993 | US5239085 Coupling agent; silicon bonded alkoxy and organofunctional groups |
| 08/24/1993 | US5239073 Preparation of isocyanurate-containing organosilicon compounds |
| 08/24/1993 | US5239030 Silated to protect amine during polymerization; Ziegler-Natta catalysts |
| 08/24/1993 | US5238988 Rapid cure room temperature vulcanizable organosiloxane compositions |
| 08/24/1993 | CA1321598C Cyclic silethynyl polymers and a method for making them |
| 08/24/1993 | CA1321597C2 Intermediates for the production of podophyllotoxin and related compounds and processes for the preparation and use thereof |
| 08/24/1993 | CA1321596C2 Intermediates for the production of podophyllotoxin and related compounds and processes for the preparation and use thereof |
| 08/24/1993 | CA1321595C2 Intermediates for the production of podophyllotoxin and related compounds and processes for the preparation and use thereof |
| 08/22/1993 | CA2089128A1 Polymer-supported catalysts |
| 08/19/1993 | WO1993016085A1 Method of producing light-coloured tetraalkoxysilanes |
| 08/19/1993 | WO1993016074A1 Novel isoindolinone derivative, preparation thereof, and pharmaceutical compositions containing same |
| 08/19/1993 | WO1993016050A1 Antipsychotic nitrogen-containing bicyclic compounds |
| 08/19/1993 | WO1993016040A1 Fluorine-containing vitamin d3 analogues |
| 08/19/1993 | WO1993016022A1 Palladium catalyzed alkylative cyclization useful in synthesis of vitamin d and analogues |
| 08/19/1993 | CA2130110A1 Antipsychotic-nitrogen-containing bicyclic compounds |
| 08/19/1993 | CA2129136A1 Palladium catalyzed alkylative cyclization useful in synthesis of vitamin d and analogues |
| 08/18/1993 | EP0555893A1 Oxamidic stabilizers |
| 08/18/1993 | EP0555488A1 Pyrimidine or triazine derivative and herbicide |
| 08/18/1993 | EP0555469A1 4-(aralkoxy or aralkylamino)pyridine pesticides----------------- |
| 08/18/1993 | EP0555388A1 Insecticidal, acaricidal and fungicidal aminopyrimidines |
| 08/18/1993 | EP0555247A1 Epoxycarbacyclin precursors, their preparation and their use |
| 08/18/1993 | EP0259366B1 Polysilazanes and related compositions, processes and uses |
| 08/18/1993 | CN1075315A Method for semi-synthesis of taxalkane derivative with metal alkane oxide and beta-lactam |
| 08/17/1993 | US5237082 Radiation-curable silicone elastomers and pressure sensitive adhesives |
| 08/17/1993 | US5237069 Hydridotris(pyrazolyl)borate metal complexes and polymerization process |
| 08/17/1993 | US5237064 Process for producing 7β-substituted-aza-5αandrostan-3-ones |
| 08/17/1993 | CA1321398C Process for producing trialkoxysilanes from the reaction of silicon metal and alcohol |
| 08/17/1993 | CA1321397C N-silyl substituted 1-sila-2-azacyclopentanes |
| 08/17/1993 | CA1321396C Organotin alkoxycarbonylphenyl mercaptides and the use thereof |
| 08/17/1993 | CA1321395C Titanium compounds, composition containing them and their preparation |
| 08/17/1993 | CA1321346C Nmr imaging with paramagnetic polyvalent metal salts of poly-(acid-alkylene-amino)-alkanes |
| 08/12/1993 | DE4203352A1 Verfahren zur herstellung von hellfarbigen tetraalkoxysilanen Process for the production of light-colored tetralkoxysilanes |
| 08/12/1993 | DE4203156A1 New tert.-butyl-silane-tri:ol and new condensate with rhenium hept:oxide - prepd. by hydrolysing tert.-butyl-tri:chloro-silane and used in catalyst prodn. |
| 08/11/1993 | EP0554933A1 Method of preparing vicinal aminoalcohols |
| 08/11/1993 | EP0554455A1 Optically active intermediate and production thereof |
| 08/11/1993 | CN1075146A Process for making antimicrobial quinolonyl lactams |
| 08/10/1993 | US5235083 Reaction of dichlorohydrocarbon with an alkyl chloride or hydrogen chloride and silicon |
| 08/10/1993 | US5235082 Fabric softeners and conditioners |
| 08/10/1993 | US5235072 2-oxabicyclo(2,2,1)heptane derivatives and pharmaceutical |
| 08/10/1993 | US5235066 FK-506 type macrolide intermediate |
| 08/10/1993 | US5235061 2,4-disilaalkanes; agriculture |
| 08/10/1993 | US5235053 Process for the synthesis of 4-hydroxy-5-halopyrrold[2,3-d]pyrimidine intermediates |
| 08/10/1993 | US5235051 Pyridinium salts containing alkoxysilyl groups |
| 08/10/1993 | US5234995 Coatings, seals, adhesives |
| 08/10/1993 | CA1321205C Process to produce silyl ketene acetals |
| 08/05/1993 | WO1993015087A1 Metallo-organic precursors |
| 08/05/1993 | WO1993015066A1 Benzopyran and related ltb4 antagonists |
| 08/05/1993 | WO1993012055A3 Photocurable cyclobutarene compositions |
| 08/05/1993 | DE4202889A1 Vapour deposition of metal-contg. films on substrates - by decompsn. of aluminium or transition metal 1,3-di:imine complexes |
| 08/05/1993 | DE4202695A1 Pyrogenic, hydrophobic titanium di:oxide modification for toner additives for copiers - comprises spraying with a mixt. of tri:methoxy:octyl:silane and di:amino:propyl:tri:ethoxy:silane and tempering, gives solvent-free toner |
| 08/05/1993 | CA2088552A1 Method of preparing vicinal aminoalcohols |
| 08/04/1993 | EP0553673A1 N,N-bis-(2-chloroethyl)phosphoric acid diamidates as cytostatics |
| 08/04/1993 | EP0553630A1 Pyridyloxy-naphthalines as herbicides |
| 08/04/1993 | EP0553107A1 Protein kinase c modulators with anti-inflammatory and antiviral activity |
| 08/04/1993 | CN1074891A Coating composition for glass |
| 08/04/1993 | CN1074890A Method for coating glass substrates |
| 08/04/1993 | CN1074889A Coated article |
| 08/03/1993 | US5233071 Hydrosilation of fluorinated olefins with cobalt catalysts |
| 08/03/1993 | US5233070 Process for converting chlorine end-terminated polyorganosiloxanes to polyorganocyclosiloxanes |
| 08/03/1993 | US5233069 Direct reaction of silicon with a-chloromethylsilanes and hydrogen chloride or alkylchlorides |
| 08/03/1993 | US5233068 Which can be copolymerized wtih cyclic polysiloxanes to produce a photoreactive material for use in photoresists |
| 08/03/1993 | US5233067 Silane coupling agent for improved adhesion |
| 08/03/1993 | US5233066 Silicon boron nitride ceramic and precursor compounds, a process for their preparation and their use |
| 08/03/1993 | US5233006 Forming photocurable or heat-curable di- or polyunsaturated di- or poly(meth)acrylate compounds having a hydrolizable silicon group; coatings; molding materials |
| 08/03/1993 | US5232940 Derivatives of N-phenylpyrazoles |
| 08/03/1993 | CA1320950C Macrolide compounds |
| 07/28/1993 | EP0552925A2 Equilibration of cyclic siloxanes with novel catalysts |
| 07/28/1993 | EP0552875A2 Water repellents containing organosilicon compounds |
| 07/28/1993 | EP0552658A1 3-Cyclohexyl propionic acid derivatives and their use in ferroelectric liquid crystal mixtures |
| 07/28/1993 | EP0552645A2 Process for the conversion of chlorinated aromatic compounds using electrophiles |
| 07/28/1993 | EP0552552A2 5-Deazafolic acid derivatives and their use as antineoplastics agents |
| 07/28/1993 | EP0552149A1 Method of rendering masonry materials water repellent with low voc organoalkoxysilanes |
| 07/28/1993 | EP0458965A4 Process for the preparation of vinyl ethers |
| 07/28/1993 | CN1074681A Benzopyran and related LTB4 Antagonists |
| 07/27/1993 | US5231208 Substituted cyclic ketones, substituted cyclic enones, and process for producing the same |
| 07/27/1993 | US5231207 Organosilicon compound |
| 07/27/1993 | US5231206 Cyclic organosiloxanes having nonlinear optical properties |
| 07/27/1993 | US5231205 Formation of silanes from magnesium salts and dienes |
| 07/27/1993 | US5231204 Using a triazine compound containing a phenol group |
| 07/27/1993 | US5231202 Optically active tertiary phosphine compound and transition metal complex using the same as ligand |
| 07/27/1993 | US5231158 One part heat curable organopolysiloxane compositions and method |
| 07/27/1993 | CA2024076C Plasma reactor for material processing at very high temperatures |
| 07/27/1993 | CA1320748C Inclination measuring device and a capsule therefor |
| 07/27/1993 | CA1320738C Preparation of alkyl silanes |
| 07/27/1993 | CA1320736C Organosilicon compounds |
| 07/25/1993 | CA2087549A1 Metallo-organic precursors to titanium nitride |
| 07/24/1993 | CA2087945A1 Equilibration of cyclic siloxanes with novel catalysts |
| 07/22/1993 | WO1993014069A1 Heterocyclic sulfonamide derivatives as antagonists of paf and angiotensin ii |
| 07/22/1993 | DE4201053A1 New bis:hydroxy ester(s) of di:carboxyalkyl-siloxane(s) - useful as poly:ol components for prodn. of polyurethane(s) |
| 07/22/1993 | CA2127367A1 Heterocyclic sulfonamide derivatives as antagonists of paf and angiotensin ii |
| 07/20/1993 | US5229526 Chemical intermediates for baccatin III derivatives, taxol, taxotere, other taxanes |
| 07/20/1993 | US5229424 Insecticides, acaricides |
| 07/20/1993 | US5229344 Olefin polymerization catalyst |
| 07/15/1993 | DE4200494A1 New allyl silane derivs. - are intermediates for 3-oxa-carbacycline derivs., esp. with E configuration |