| Patents for C07F 5 - Compounds containing elements of the 3rd group of the periodic system (13,801) |
|---|
| 04/12/2007 | WO2007012377A3 Methods for the electromanipulation of cells in order to modify the membrane permeability of said cells with the aid of lipophilic ions as a medium additive |
| 04/12/2007 | WO2007002673A3 Beta-diketiminate ligand sources and metal-containing compounds thereof, and systems and methods including same |
| 04/12/2007 | US20070083051 Amido-organoborate initiator systems |
| 04/12/2007 | US20070081945 Magnetic resonance imaging contrast agents |
| 04/12/2007 | US20070081941 F-18 Labeled Amino Acid Analogs |
| 04/12/2007 | DE102006048036A1 New asymmetrical or asymmetrical borate salts are useful as additives, stabilizers, flame protectors and/or conductivity enhancers in polymers and as electrolytes |
| 04/11/2007 | CN1947275A Electroluminescent polymers and use therof |
| 04/11/2007 | CN1944440A Process for preparing 8-hydroxy quinoline aluminum |
| 04/11/2007 | CN1944357A Recovery method for ionic liquid |
| 04/11/2007 | CN1309791C Processes, compositions and compounds |
| 04/11/2007 | CN1309724C Prepn process of alkyl aluminoxane |
| 04/10/2007 | US7202317 Aqueous suspension or aqueous emulsion cationic polymerization of an olefin monomer in the presence of water using a fluorinated aryl compound containing two or more B, Al or Zn atoms |
| 04/10/2007 | CA2281860C Photoactivatable nitrogen-containing bases based on .alpha.-ammonium ketones, iminium ketones or amidinium ketones and aryl borates |
| 04/05/2007 | US20070077197 Cancer diagnosis; antitumor agents, radiotherapy |
| 04/05/2007 | US20070077195 "N and/or nalpha derivatized, metal and organic protected l-histidine for coupling to biomolecules for highly efficient labeling with [m(oh2)3 (co)3]+ by fac coordination" |
| 04/05/2007 | DE102005033902B3 Perfluoralkylhaltige Komplexe, Verfahren zu deren Herstellung, sowie deren Verwendung und diese enthaltende pharmazeutische Mittel Perfluoroalkyl-containing complexes, processes for their preparation, and their use and pharmaceutical compositions containing them |
| 04/04/2007 | EP1769247A1 Biotin recognition sensors and high-throughput assays |
| 04/04/2007 | EP1768988A1 Novel phenyl-boronic acid derivatives and methods for the preparation thereof |
| 04/04/2007 | EP1768968A1 2-((hetero) aryl)-benzoxazole compounds and derivatives, compositions and methods for stabilizing transthyretin and inhibiting transthyretin misfolding |
| 04/04/2007 | EP1576015A4 Preparation of metallotexaphyrins |
| 04/04/2007 | CN1308414C Pyrromethene metal complex and light emitting device composition and light emitting devices using the same |
| 04/03/2007 | US7199251 Process for the production of linear organic thiophene-phenylene oligomers |
| 04/03/2007 | US7198776 Metal complex compounds |
| 04/03/2007 | US7198732 Rare earth metal compounds having at least one lanthanide metal and a 2-hydroxyquinoline-4-carboxylic acid |
| 03/29/2007 | WO2007034975A1 Diphosphine ligand and transition metal complex using the same |
| 03/29/2007 | WO2007034755A1 Biphenyl sulfide compounds and insecticides and miticides |
| 03/29/2007 | US20070072838 High-purity texaphyrin metal complexes |
| 03/29/2007 | US20070071893 Organic aluminum precursor and method of manufacturing a metal wiring using the same |
| 03/29/2007 | US20070071673 Trifunctional reagent for conjugation to a biomolecule |
| 03/28/2007 | EP1768200A1 Dopant and its production method |
| 03/28/2007 | EP1765835A1 Process for the preparation of amino acids useful in the preparation of peptide receptor modulators |
| 03/28/2007 | EP1765359A2 Antibiotics containing borinic acid complexes and methods of use |
| 03/28/2007 | EP1765358A2 Treatment or prevention of skin conditions or tissue conditions in animals using boryloxypyridylmethanones |
| 03/28/2007 | CN1938322A Ionic liquids comprising fluoralkyltriffluoroborate anions |
| 03/28/2007 | CN1935812A Metal fullerol and its pharmaceutical use for inhibiting tumour growth |
| 03/28/2007 | CN1307208C Polyaddition catalyst component, polyaddition catalyst, and method for preparing addition polymer |
| 03/27/2007 | US7196219 Preparation of Anilineboronic acids and derivatives thereof |
| 03/27/2007 | US7196149 Polymerization of i-butane in hydrocarbon media using bis(borane) co-initiators |
| 03/22/2007 | WO2007032786A2 Apparatus for converting electromyographic (emg) signals for transference to a personal computer |
| 03/22/2007 | WO2007032363A1 Novel maleimide derivative |
| 03/22/2007 | WO2007032005A2 Novel amine-borane compounds and uses thereof |
| 03/22/2007 | WO2007031640A1 Method for obtaining highly luminescent lanthanide complexes |
| 03/22/2007 | WO2006086747A3 Methods for producing gallium and other oxo/hydroxo-bridgeged metal aquo clusters |
| 03/22/2007 | US20070066839 Aluminum hydride (alane, AlH3); utilizes a polymeric crystallization additive such as polystyrene or polybutadiene, but that does not use borohydride salts; cheaper; reacting aluminum trichloride and alkali metal hydride to form aluminum hydride/ether complex solution, hydrolyzing, then crystallizing |
| 03/22/2007 | US20070066576 Compounds which modulate 2OG (2-oxoglutarate) dependent oxygenases, in particular prolyl hydroxylases; may be useful as modulators of HIF (hypoxia inducible factor) alpha (HIF- alpha ) prolyl hydroxylase; for example, analogues of 2-oxoglutarate, N-phenoxy-acetyl-(L)-alanine-hydroxamide |
| 03/22/2007 | US20070065362 Gastrin receptor-avid peptide conjugates |
| 03/22/2007 | US20070063191 Crosslinkable substituted fluorene compounds |
| 03/22/2007 | DE102005042813A1 Verfahren zur kontinuierlichen Herstellung und Isolierung löslicher präkeramischer Oligomere und/oder Polymere Process for the continuous preparation and isolation of soluble preceramic oligomers and / or polymers |
| 03/22/2007 | CA2622283A1 Method for obtaining highly luminescent lanthanide complexes |
| 03/21/2007 | EP1764365A1 A process for the preparation of sartan derivates and intermediates useful in such process |
| 03/21/2007 | EP1763317A1 Synthesis of porphyrins designed for attachment to electroactive surfaces via one or more carbon tethers |
| 03/21/2007 | EP1474406B1 Disubstituted thiazolyl carboxanilides and their use as microbicides |
| 03/21/2007 | EP1373170A4 Cross-metathesis reaction of functionalized and substituted olefins using group 8 transition metal carbene complexes as metathesis catalysts |
| 03/21/2007 | EP0811044B2 Boron-containing aqueous solution particularly for addition to amyloid glue |
| 03/21/2007 | CN1305917C Initiator composition and method for anionic polymerisation |
| 03/21/2007 | CN1305864C Bivalent rare earth complex containing oxacyclo substituted indene ligand and its use |
| 03/21/2007 | CN1305475C Boronic ester and acid compounds, synthesis and uses |
| 03/20/2007 | US7193100 For use in polymerization catalyst systems |
| 03/20/2007 | US7193098 Reacting metal compound with silicon compound in the absence of any surfactant, ligand, or coordinating solvent under conditions effective to produce homogeneous nucleation, reacting to form nanocrystals |
| 03/20/2007 | CA2211100C Diagnostic imaging contrast agents with extended blood retention |
| 03/15/2007 | WO2007028712A1 Materials for n-doping the electron-transporting layers in organic electronic components |
| 03/15/2007 | WO2007028620A1 Method for continuously producing and insulating soluble pre-ceramic oligomers and/or polymers |
| 03/15/2007 | US20070060547 (2R)-1-{2-[(3R)-pyrrolidin-3-ylamino]-acetyl}-pyrrolidine-2-boronic acid; Dipeptidyl peptidase IV (DPP-IV) inhibitors; diabetes, hyperglycemia, Syndrome X, hyperinsulinemia, obesity, atherosclerosis |
| 03/14/2007 | EP1762642A2 Methods of preparing a multi-shell nanocrystal structure, multi-shell nanocrystal structures and fabricated device including the same |
| 03/14/2007 | EP1761571A1 Transition metal compound, ligand system., catalyst system and process for preparing polyolefins |
| 03/14/2007 | EP1761504A2 Factor viia inhibitor |
| 03/14/2007 | EP1434780B1 Catalyst systems for ziegler-natta propene polymerisation |
| 03/14/2007 | CN1930921A Composition for charge transport membrane and ionic compound, charge transport membrane and organic electroluminescent device each using the same, and method for producing the device and membrane |
| 03/14/2007 | CN1927872A Alkoxy rare-earth potassium multi-metal cluster compound and use thereof |
| 03/14/2007 | CN1927871A Alkoxy rare-earth potassium multi-metal cluster compound and use thereof |
| 03/13/2007 | US7188725 Kits for preparing transition metal carbonyl complexes |
| 03/08/2007 | WO2007026831A1 Zirconium-borane complex and method for producing siloxanes using such complex |
| 03/08/2007 | WO2007026808A1 Novel fluorescent labeling compound |
| 03/08/2007 | WO2007026014A1 Solutions of anhydrous lanthanide salts and its preparation |
| 03/08/2007 | WO2007005400A3 Aluminoxanate salt compositions having improved stability in aromatic and aliphatic solvents |
| 03/08/2007 | WO2006127893A3 Processes for production of 4-(biphenylyl)azetidin-2-one phosphonic acids |
| 03/08/2007 | US20070055068 Method for the in situ preparation of chiral compounds derived from oxazaborolidine-borane complexes which are used in asymmetric reduction reactions |
| 03/08/2007 | US20070054148 Aluminum chelate complex for organic el material |
| 03/08/2007 | US20070053840 A tetrapyrollic photosensitizer compound with one pendant CH2CH2CON(CH2CON(CH2COOH)2)2 or N(CH2COOH)2 group, being a chlorin, bacteriochlorin, porphyrin, pyropheophorbide, purpurinimide, or bacteriopurpurinimide; water soluble photosensitizing and imaging compounds; hyperproliferative tissue |
| 03/08/2007 | US20070053834 Radioligands for the TRP-M8 receptor and methods therewith |
| 03/08/2007 | US20070051929 Rare metal compounds and mixtures of these |
| 03/08/2007 | DE102005035456A1 Verfahren zur Elektromanipulation von Zellen zur Veränderung der Membranpermeabilität dieser Zellen unter Verwendung von lipophilen Ionen als Mediumzusatz Process for the electrochemical manipulation of cells to change the membrane permeability of these cells using the lipophilic ions as a medium additive |
| 03/07/2007 | EP1759765A1 Solutions of anhydrous lanthanide salts and its preparation |
| 03/07/2007 | EP1758816A2 Method of production of b10h10² ammonium salts and methods of production of b18h22 |
| 03/07/2007 | EP1620476A4 Polymerization of i-butene in hydrocarbon media using bis(borane)co-initiators |
| 03/07/2007 | EP1613666A4 Polymerization of i-butene in hydrocarbon media using bis(borane) co-initiators |
| 03/07/2007 | CN1926144A Method for preparing tetra(fluoroaryl) borate |
| 03/07/2007 | CN1926116A Method for the production of compounds with quaternary sp<2>-hybridised nitrogen atoms |
| 03/06/2007 | US7186400 Multidentate aza ligands able to complex metal ions and the use thereof in diagnostics and therapy |
| 03/01/2007 | WO2007024227A1 Inorganic polymers and use of inorganic polymers for detecting nitroaromatic compounds |
| 03/01/2007 | WO2007023503A1 A process for the preparation of fluvastatin sodium |
| 03/01/2007 | WO2007023134A1 Method for producing organometallic framework materials containing main group metal ions |
| 03/01/2007 | WO2007023119A1 Mesoporous metal-organic framework |
| 03/01/2007 | WO2007005364A3 Haloaluminoxane compositions |
| 03/01/2007 | WO2006134074A3 Process for synthesis of dialkoxyorganoboranes |
| 03/01/2007 | WO2006122186A3 1,4-diphenyl-3-hydroxyalkyl-2-azetidinone derivatives for treating hypercholestrolemia |
| 03/01/2007 | US20070049765 Process for producing semiconductor nanocrystal cores, core-shell, core-buffer-shell, and multiple layer systems in a non-coordinating solvent utilizing in situ surfactant generation |
| 03/01/2007 | US20070048605 Stable electrolyte counteranions for electrochemical devices |
| 03/01/2007 | US20070048216 Non-invasive diagnostic agents of cancer and methods of diagnosing cancer, especially leukemia and lymphoma |
| 03/01/2007 | DE102005039654A1 Mesoporöses metallorganisches Gerüstmaterial Mesoporous metal-organic framework |