| Patents for C07D 487 - Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups (57,272) |
|---|
| 03/08/2007 | US20070054913 4-(2-Butylamino)-2,7-dimethyl-8-(2-methyl-6-methoxypyrid-3-yl)pyrazolo-[1,5-a]-1,3,5-triazine, its enantiomers and pharmaceutically acceptable salts as corticotropin releasing factor receptor ligands |
| 03/08/2007 | US20070054906 Novel pyrazolopyrimidines as cyclin dependent kinase inhibitors |
| 03/08/2007 | US20070054894 Quinazoline potassium channel inhibitors |
| 03/08/2007 | US20070054881 Anxiolytic agents with reduced sedative and ataxic effects |
| 03/08/2007 | US20070053840 A tetrapyrollic photosensitizer compound with one pendant CH2CH2CON(CH2CON(CH2COOH)2)2 or N(CH2COOH)2 group, being a chlorin, bacteriochlorin, porphyrin, pyropheophorbide, purpurinimide, or bacteriopurpurinimide; water soluble photosensitizing and imaging compounds; hyperproliferative tissue |
| 03/08/2007 | DE102005042742A1 Substituierte Imidazo[1,2b]pyridazine als Kinase-Inhibitoren, deren Herstellung und Verwendung als Arzneimittel Substituted imidazo [1,2-b] pyridazines as kinase inhibitors, their production and use as a medicament |
| 03/08/2007 | CA2620834A1 Use of fused imidazole derivatives to mediate ccr3 related conditions |
| 03/08/2007 | CA2620740A1 Pyridazinone derivatives used for the treatment of pain |
| 03/08/2007 | CA2620534A1 Substituted imidazo[1,2b]pyridazines as kinase inhibitors, their preparation and use as medicaments |
| 03/08/2007 | CA2619284A1 Novel crystalline form of a pyridazino [4,5-b] indole derivative |
| 03/08/2007 | CA2618970A1 Lisofylline analogs and methods for use |
| 03/08/2007 | CA2617495A1 Pharmaceutical compositions as inhibitors of dipeptidyl peptidase-iv (dpp-iv) |
| 03/08/2007 | CA2614232A1 Pyrazolo [3,4-d] azepine derivatives as histamine h3 antagonists |
| 03/08/2007 | CA2607999A1 Derivatives of 6,7-dihydro-5h-imidazo[1,2-a]imidazole-3-sulfonic acid |
| 03/07/2007 | EP1760083A1 Rapamycin hydroxyesters, process for their preparation and pharmaceutical compositions containing them |
| 03/07/2007 | EP1760066A2 Processes for the preparation of cyclopropyl carboxylic acid derivatives and intermediates provided by these processes |
| 03/07/2007 | EP1758917A1 Substituted azaporphyrins as fluorescence labels |
| 03/07/2007 | EP1758907A1 Diphenylimidazopyrimidine and -imidazole amines as inhibitors of b-secretase |
| 03/07/2007 | EP1758906A2 1, 2, 4-triazolo[1,5a]pyrimidines and use thereof for controlling plant-pathogenic fungi |
| 03/07/2007 | EP1758903A1 Pyrrolopyramidine and pyrrolopyridine derivatives substituted with a cyclic amino group as crf antagonists |
| 03/07/2007 | EP1758895A1 Gonadotropin releasing hormone receptor antagonists |
| 03/07/2007 | EP1758871A1 Pyrazolo pyrimidines |
| 03/07/2007 | EP1758847A1 Inhibitors of histone deacetylase |
| 03/07/2007 | EP1758585A2 Hiv integrase inhibitors |
| 03/07/2007 | EP1758457A1 Triazolopyrimidine compounds and use thereof for controlling harmful fungi |
| 03/07/2007 | EP1758453A2 C-purine nucleoside analogs as inhibitors of rna-dependent rna viral polymerase |
| 03/07/2007 | EP1704149B1 Triaza-cyclopenta[cd]indene derivatives |
| 03/07/2007 | EP1692137B1 Process for the preparation of tubulin inhibitors |
| 03/07/2007 | EP1513842B1 Substituted hexahydropyrrolo (1,2-a)pyrazines, octahydropyrido(1,2-a)pyrazines and decahydropyrazino(1,2-a)azepines |
| 03/07/2007 | EP1442025B1 Pyrimidinones as melanin concentrating hormone receptor 1 |
| 03/07/2007 | EP1427728B1 6,7-DIHYDRO-5H-PYRAZOLO 1,2-A PYRAZOL-1-ONES WHICH CONTROL INFLAMMATORY cYTOKINES |
| 03/07/2007 | EP1381370B1 N-biphenylcarbonyl- and n-phenylpyridylcarbonyl substituted bi- and tricyclic azepines and diazepines as vasopressing agonists |
| 03/07/2007 | EP1363915B1 Substituted calix (4) pyrroles and process for the synthesis of calix (4) pyrroles over molecular sieve catalysts |
| 03/07/2007 | EP1032387B1 Novel metal complexes |
| 03/07/2007 | EP1001970B1 Dipeptide derivatives as growth hormone secretagogues |
| 03/07/2007 | CN1926141A Metal complexes of N-heterocyclic carbenes as radiopharmaceuticals and antibiotics |
| 03/07/2007 | CN1926140A Pyrrolopyrimidine derivatives |
| 03/07/2007 | CN1926139A Fused derivatives of pyrazole |
| 03/07/2007 | CN1925860A Methods for the production of sildenafil base and citrate salt |
| 03/07/2007 | CN1923833A Diamine containing N-aminophthalimide structure unit, polyimide with the same as diamine and preparation method thereof |
| 03/07/2007 | CN1923820A Novel carboxylic acid derivatives, their preparation and use |
| 03/07/2007 | CN1923818A Irreversible inhibitors of tyrosine kinases |
| 03/07/2007 | CN1923816A Method for producing condensed imidazole compound, reformatsky reagent having stable form and production thereof |
| 03/07/2007 | CN1923365A Method for producing indolopyrrolocarbazole derivative |
| 03/07/2007 | CN1303090C Novel, water-soluble porphyrin platinum compounds with high tumor selectivity and their use for the treatment of benign and malignant tumor diseases |
| 03/07/2007 | CN1303084C New cephalotaxanes, their method of preapartion and their use in treatment of cancers, leukemias, parasites including thus resistant to usual chemotherapentic agents and reversal agents |
| 03/07/2007 | CN1303083C 红色有机电致发光材料 Red organic electroluminescent material |
| 03/07/2007 | CN1303074C Heteroaryl alkyl piperazine derivatives as fatty acid oxidation inhibitors |
| 03/07/2007 | CN1303067C Spiroheterocyclic nitriles useful as reversible inhibitors of cysteine proteases |
| 03/06/2007 | US7186847 Process for the direct preparation of pyrrolo[3,4-c]pyrroles |
| 03/06/2007 | US7186832 anticancer agents; antidiabetic agents; autoimmune disease; restenosis; antiarthritic agents; skin disorders; cardiovascular disorders; antiinflammatory agents |
| 03/06/2007 | US7186831 Antigrowth agents |
| 03/06/2007 | US7186830 Tricyclic 2-pyrimidone compounds useful as HIV reverse transcriptase inhibitors |
| 03/06/2007 | US7186828 Cyclic urea compounds and preparation thereof |
| 03/06/2007 | US7186825 Polyamines for treatment of diseases such as cancer or treatment of tumors |
| 03/06/2007 | US7186792 Methods for polymerization of electronic and photonic polymers |
| 03/06/2007 | US7186791 Methods for polymerization of electronic and photonic polymers |
| 03/06/2007 | US7186740 Imidazopyrazines as cyclin dependent kinase inhibitors |
| 03/06/2007 | US7186732 For therapy and prophylaxis of upper airway allergic response, nasal congestion, or allergic rhinitis, dementia, mild cognitive impairment (pre-dementia), cognitive dysfunction, schizophrenia, depression, manic disorders |
| 03/06/2007 | US7186731 2-cyanopyrrolidinecarboxamide compound |
| 03/06/2007 | US7186725 Anti-inflammatory compositions and methods |
| 03/06/2007 | US7186721 Substituted hexahydropyrrolo[1,2-a]pyrazines, octahydropyrido[1,2-a]-pyrazines and decahydropyrazino[1,2-a]azepines |
| 03/06/2007 | US7186711 Can be administered orally or parenterally, in small intervals until an effective dose is achieved |
| 03/06/2007 | US7186710 PDE4/7 inhibitors useful in treatment of airway disorders, autoimmune system disorders, skin disorders, arthritis, nerve system disorders |
| 03/06/2007 | CA2294990C Pharmaceutical compositions and methods for effecting dopamine release |
| 03/01/2007 | WO2007025090A2 Heterobicyclic and - tricyclic inhibitors of mapk/erk kinase |
| 03/01/2007 | WO2007024993A2 Fused aminopiperidines as dipeptidyl peptidase-iv inhibitors for the treatment or prevention of diabetes |
| 03/01/2007 | WO2007024945A1 Condensed imidazolo derivatives for the inhibition of aldosterone synthase and aromatase |
| 03/01/2007 | WO2007024789A1 Pyrrolopyridine, pyrrolopyrimidine and pyrazolopyridine compounds, compositions comprising them, and methods of their use |
| 03/01/2007 | WO2007024754A1 Bis-aryl urea compounds for the treatment of protein kinase-mediated diseaes |
| 03/01/2007 | WO2007024680A1 Pyrazolopyridine and pyrazolopyrimidine compounds useful as kinase enzymes modulators |
| 03/01/2007 | WO2007023964A1 Electrode for use in oxygen reduction |
| 03/01/2007 | WO2007023382A2 Pyrimidine amino pyrazole compounds, potent kinase inhibitors |
| 03/01/2007 | WO2007023381A1 Methods for the preparation of hcv polymerase inhibitors |
| 03/01/2007 | WO2007023110A2 P38 map kinase inhibitors and methods for using the same |
| 03/01/2007 | WO2007023105A1 FUSED PYRAZOLE AS p38 MAP KINASE INHIBITORS |
| 03/01/2007 | WO2007023020A1 7-amino-6-heteroaryl-1,2,4-triazolo[1,5-a]pyrimidine compounds and the use thereof for controlling harmful fungi |
| 03/01/2007 | WO2007023018A1 7-amino-6-triazolyl-1,2,4-triazolo[1,5-a]pyrimidine compounds and the use thereof for controlling harmful fungi |
| 03/01/2007 | WO2006138265A3 Heterocyclic aspartyl protease inhibitors, preparation and use thereof |
| 03/01/2007 | WO2006138264A3 Aspartyl protease inhibitors |
| 03/01/2007 | WO2006124748A3 Multicyclic compounds and methods of their use |
| 03/01/2007 | WO2006119713A3 Antineoplastic compounds and pharmaceutical compositions thereof |
| 03/01/2007 | WO2006117672A3 Detection of ortho-diamine residues in analytes containing residual cyclizing agents |
| 03/01/2007 | WO2006116412A8 Fused heterocyclic compounds |
| 03/01/2007 | WO2006014325A3 C-met modulators and method of use |
| 03/01/2007 | WO2005117882A9 Hydroxamic acid derivatives as metalloprotease inhibitors |
| 03/01/2007 | WO2005117876A8 Dual small molecule inhibitors of cancer and angiogenesis |
| 03/01/2007 | WO2005030711A3 Bridged macrocyclic module compositions |
| 03/01/2007 | US20070049755 Novel triazolo pyrimidine compounds |
| 03/01/2007 | US20070049750 Method for synthesizing spiro quartenary ammonium systems |
| 03/01/2007 | US20070049608 Pyrrolopyridine, pyrrolopyrimidine and pyrazolopyridine compounds, compositions comprising them, and methods of their use |
| 03/01/2007 | US20070049607 Triazolo [4,5-d] pyrimidine derivatives and their use as purinergic receptor antagonists |
| 03/01/2007 | US20070049606 Bicyclic heterocycles as HIV-integrase inhibitors |
| 03/01/2007 | US20070049598 preferential enzyme inhibitors comprising fused pyrazolo derivatives, used for treating arthritis, Crohns disease, irritable bowel syndrome, adult respiratory distress syndrome, or chronic obstructive pulmonary disease |
| 03/01/2007 | US20070049597 p38 MAP kinase inhibitors and methods for using the same |
| 03/01/2007 | US20070049591 Inhibitors of MAPK/Erk Kinase |
| 03/01/2007 | US20070049590 Compositions comprising zopiclone derivatives and methods of making and using the same |
| 03/01/2007 | US20070049584 Antiinflammatory agents, antidepressants, analgesics, purinergic receptor antagonists; neurodegenerative diseases, spinal cord injuries; 1-(2,3-dichlorophenyl)-N-[(2-methylphenyl)methyl]-1H-tetraazol-5-amine |
| 03/01/2007 | US20070049580 Anxiolytic agents with reduced sedative and ataxic effects |
| 03/01/2007 | US20070049575 Reacting 2-carboxamidoethyl-Indolecarboxylic acid compound with methyl sulfonic acid and phosphorus pentoxide, reacting resulting indoloazepine compound with phenyl oxazolone and a transition metal catalyst, reacting resulting compound with with thiourea and a base in a solvent |