| Patents for C07D 487 - Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups (57,272) |
|---|
| 06/28/2007 | WO2007070984A1 Spiroketals |
| 06/28/2007 | WO2007053352A3 Pyrroloquinolinone derivatives as 5-hydroxytryptamine-6 ligands |
| 06/28/2007 | WO2007048066A3 Pyrazolo-pyrimidines as casein kinase ii (ck2) modulators |
| 06/28/2007 | WO2007045060B1 Pharmaceutical compositions containing erythrine mulungu derivatives and processes for their production |
| 06/28/2007 | WO2007042784A3 Pyrimidin-4-yl-3, 4-dihydr0-2h- pyrrolo [1, 2a] pyrazin-1-one compounds |
| 06/28/2007 | WO2004000210A3 Indole, azaindole and related heterocyclic sulfonylureido piperazine derivatives |
| 06/28/2007 | US20070149603 Ppar active compounds |
| 06/28/2007 | US20070149598 M3 muscarinic acetylcholine receptor antagonists |
| 06/28/2007 | US20070149588 6-(2,3,6-Trifluorophenyl)triazolopyrimidines, their preparation and their use for controlling harmful fungi, and compositions comprising these compounds |
| 06/28/2007 | US20070149563 N-(1-Azabicyclo[2.2.2]oct-3-yl)(2-(3-pyridyl)thiazole-4-carboxamide); nicotinic acetylcholine receptor ligands; psychotic and intellectual impairment disorders; antidepressant, anxiolytic agent; Alzheimer's disease, cognitive or attention disorders |
| 06/28/2007 | US20070149560 Novel fused triazolones and the uses thereof |
| 06/28/2007 | US20070149536 2-[4-Bromomethyl)phenyl-3-phenylquinoxaline 1-2; selectively inhibits one or two of the serine/threonine protein kinase isoforms; antiproliferative |
| 06/28/2007 | US20070149534 Inhibit tyrosine kinase activity of Trk receptors; antiproliferative agents, anticancer agents; cancer, psoriasis or rheumatoid arthritis; 1-(5-{[4-amino-7-(1-methylethyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]carbonyl}-3-pyridinyl)-3-(2,4-dichlorophenyl)urea |
| 06/28/2007 | US20070149523 Thiazole Analogues and Uses Thereof |
| 06/28/2007 | US20070149521 Prevention of hyperproliferative diseases such as cancer, inflammation, psoriasis, allergy/asthma, disease and conditions of the immune system, disease and conditions of the central nervous system; 1-(3-Benzyloxy-phenyl)-3-ethoxy-imidazo[1,5-a]pyrazin-8-ylamine |
| 06/28/2007 | US20070149516 to treat cellular proliferative diseases, hyperplasias, solid tumor, cardiac hypertrophy, immune disorders and inflammation; modulators of one or more mitotic kinesins; N-(2-(2-dimethylamino-acetylamino)-1-{4-[8-(1-hydroxy-ethyl)-imidazo[1,2-a]pyridin-2-yl]-benzyl}-ethyl)-3-chloro-4-isopropoxy-benzamide |
| 06/28/2007 | US20070149515 6-(2,4,6-Trifluorophenyl)-triazolopyrimidines, method for the production thereof, use thereof for controlling harmful fungi, and substances containing the same |
| 06/28/2007 | US20070149506 Azepine inhibitors of Janus kinases |
| 06/28/2007 | US20070149498 Cancer therapy |
| 06/28/2007 | US20070149497 A tetrapyrollic photosensitizer compound having at least one pendant CH2CH2CON(CH2CON(CH2COOH)2)2 or N(CH2COOH)2 group, being a chlorin, bacteriochlorin, porphyrin, pyropheophorbide, purpurinimide, or bacteriopurpurinimide |
| 06/28/2007 | US20070149484 Novel pyridopyrazines and their use as modulators of kinases |
| 06/28/2007 | US20070149481 N,n-bridged, nitrogen-substituted carbacyclic indolocarbazoles as protein kinase inhibitors |
| 06/28/2007 | US20070149400 6-(2-Chloro-4-alkoxyphenyl)triazolopyrimidines, their preparation and their use for controlling harmful fungi, and compositions comprising these compounds |
| 06/28/2007 | US20070148093 Non-terminal method of identifying anti-migraine compounds |
| 06/28/2007 | US20070145361 Organic semiconductor material and organic electronic device |
| 06/28/2007 | DE102005061840A1 Triazolderivate Triazole derivatives |
| 06/28/2007 | DE102005061655A1 Diazepinone Diazepinones |
| 06/28/2007 | CA2634468A1 Spiroketals |
| 06/28/2007 | CA2634165A1 Pyrrolo [1,2-a]quinoxaline derivatives as adenosine a3 receptor modulators and uses thereof |
| 06/28/2007 | CA2633563A1 Antibacterial pyrrolopyridines, pyrrolopyrimidines, and pyrroloazepines |
| 06/28/2007 | CA2633484A1 Condensed heterocyclic compounds useful as dpp-iv inhibitors |
| 06/28/2007 | CA2631721A1 Sulphonamidoaniline derivatives being janus kinases inhibitors |
| 06/27/2007 | EP1801112A1 Bicyclic pyrimidines and bicyclic 3,4-dihydropyrimidines as inhibitors of cellular proliferation |
| 06/27/2007 | EP1801106A2 New spirotricyclic derivatives and their use as phosphodiesterase-7 inhibitors |
| 06/27/2007 | EP1799685A2 Polymorphic and amorphous forms of the phosphate salt of 8-fluoro-2-{4-[(methylamino)methyl]phenyl}-1,3,4,5-tetrahydro-6h-azepino[5,4,3-cd]indol-6-one |
| 06/27/2007 | EP1799684A2 Lactam compounds useful as protein kinase inhibitors |
| 06/27/2007 | EP1799683A1 Hexahydro-pyrazino[1,2-a]pyrimidine-4, 7-dione derivatives substituted with amino acids |
| 06/27/2007 | EP1799650A2 Imidazole derivatives as large conductance calcium activated k channel openers |
| 06/27/2007 | EP1504004B1 Substituted pyrazolopyrimidines |
| 06/27/2007 | EP1485376B1 Compositions useful as inhibitors of protein kinases |
| 06/27/2007 | EP1392259B1 Delivery of erectile dysfunction drugs through an inhalation route |
| 06/27/2007 | EP0863903B1 Synthetic metal-substituted bacteriochlorophyll derivatives and use thereof |
| 06/27/2007 | CN1989140A Compounds containing a n-heteroaryl moiety linked to fused ring moieties for the inhibition of nad(p)h oxidases and platelet activation |
| 06/27/2007 | CN1989106A N-羟基酰胺衍生物及其应用 N- hydroxyamide derivatives and their Applications |
| 06/27/2007 | CN1988956A Process for the photoactivation and use of a catalyst by an inverted two-stage procedure |
| 06/27/2007 | CN1988907A Dual small molecule inhibitors of cancer and angiogenesis |
| 06/27/2007 | CN1988848A Carboranylporphyrins and uses thereof |
| 06/27/2007 | CN1986545A Folid acid derivatives and their salts for preparing antitumor medicine |
| 06/27/2007 | CN1986544A Preparing process of 4,4-diazaindole |
| 06/27/2007 | CN1323080C Pyrimido compounds having antiproliferative activity |
| 06/26/2007 | US7235659 Coupling with 2-hydroxyethylhydrazine in presence of base; concurrent cyclization and halogenation in presence of metal halide or halide salt and dehydrating agent |
| 06/26/2007 | US7235656 Anxiolytic agents with reduced sedative and ataxic effects |
| 06/26/2007 | US7235578 Used as cytotoxins for cancer therapy and as prodrugs for gene-directed enzyme-prodrug therapy and antibody-directed enzyme-prodrug theraphy |
| 06/26/2007 | US7235564 11'-substituted; potent inhibitors of cellular mitosis and proliferation |
| 06/26/2007 | US7235557 Benzo-1,5-naphthyridine and benzo-2,5-naphthyridine derivatives are used as poly(ADP-ribose) polymerase inhibitors for treating vascular stroke, cerebral ischemia, heart ischemia/reperfusion injury and gout |
| 06/26/2007 | US7235554 Water soluble; treating diseases in which peripheral benzodiazepine receptors are involved such as spinal amyotrophy, amyotrophic lateral sclerosis, cranial and medullar trauma, multiple sclerosis, and diabetic nephropathy |
| 06/26/2007 | US7235551 1,5-disubstituted-3,4-dihydro-1h-pyrimido[4,5-d]pyrimidin-2-one compounds and their use in treating csbp/p38 kinase mediated diseases |
| 06/26/2007 | US7235550 Polycyclic azaindole compounds |
| 06/26/2007 | CA2413037C Intermediates for producing antitumor indolopyrrolocarbazole derivatives |
| 06/21/2007 | WO2007070872A1 Kinase inhibitors and their uses |
| 06/21/2007 | WO2007070796A1 Azepinoindole derivatives as pharmaceutical agents |
| 06/21/2007 | WO2007070514A1 Heteroaryl substituted pyrrolo[2,3-b]pyridines and pyrrolo[2,3-b]pyrimidines as janus kinase inhibitors |
| 06/21/2007 | WO2007070494A2 Heterocycles and derivatives thereof and methods of manufacture and therapeutic use |
| 06/21/2007 | WO2007070434A2 Fused aminopiperidines as dipeptidyl peptidase-4 inhibitors for the treatment or prevention of diabetes |
| 06/21/2007 | WO2007069924A1 Deazapurine analogs of 4'-aza-l-nucleosides |
| 06/21/2007 | WO2007069923A1 Deazapurine analogs of 1'-aza-l-nucleosides |
| 06/21/2007 | WO2007069847A1 Novel imidazoquinazoline derivative, process for preparing the same, and organic electronic device using the same |
| 06/21/2007 | WO2007069671A1 Bicyclic heterocyclic compound |
| 06/21/2007 | WO2007069635A1 Vla-4 inhibitory drug |
| 06/21/2007 | WO2007068637A1 Substituted pyrrolo-pyrazole derivatives active as kinase inhibitors |
| 06/21/2007 | WO2007068465A1 Tricyclic lactam derivatives, their manufacture and use as pharmaceutical agents |
| 06/21/2007 | WO2007050353A3 Tricyclic compounds useful as oxytocin receptor agonists |
| 06/21/2007 | WO2007005707A3 Intermediates useful in preparing certain pyrrolotriazine compounds and process for making such intermediates |
| 06/21/2007 | WO2006133261A3 Organic compounds |
| 06/21/2007 | US20070142635 Process for preparing hexahydropyrimido[1,2-a]azepine-2-carboxylates and related compounds |
| 06/21/2007 | US20070142413 Pyrazole derivatives as inhibitors of receptor tyrosone kinases |
| 06/21/2007 | US20070142407 Benzo (1,2,5) thiadiazole als crf-antagonisten |
| 06/21/2007 | US20070142405 Bicyclic heterocyclic p-38 kinase inhibitors |
| 06/21/2007 | US20070142404 6-(2,6-Dichlorophenyl)-triazolopyrimidines, methods for the production thereof, use thereof for controlling pathogenic fungi, and agents containing the same |
| 06/21/2007 | US20070142402 Kinase Inhibitors And Their Uses |
| 06/21/2007 | US20070142393 Sulfonyl-derivatives as novel inhibitors of histone deacetylase |
| 06/21/2007 | US20070142383 Use of these dipeptidylpeptidase-IV inhibitors; treating type I and II diabetes mellitus, arthritis, obesity, allograft transplantation, or calcitonin-induced osteoporosis; 2-amino-imidazo[4,5-d]pyridazine-4,7-diones |
| 06/21/2007 | US20070142381 Calcium receptor modulating agents |
| 06/21/2007 | US20070142380 1-Cyclopentyl-3-methyl-2-(2-pyridyl)indole-5-amino/thio/carbonyl derivatives; hepatitis C virus infection; synergistic with another inhibitor of HCV polymerase or immunomodulatory agent such as interferons |
| 06/21/2007 | US20070142364 Flumazenil for the Treatment of Cocaine Dependency |
| 06/21/2007 | US20070142363 Novel diazabicyclonene derivatives and use thereof |
| 06/21/2007 | US20070142353 such as 2-(3-(aminomethyl)pyrrolidin-1-yl)-4-(4-methoxybenzyl)-7-oxo-4,7-dihydro[1,3]thiazolo[4,5-b]pyridine-6-carboxylic acid, used for treating drug-resistant bacterial infections |
| 06/21/2007 | US20070142351 Novel heterocyclic amide derivatives and their use as dopamine D3 receptor ligands |
| 06/21/2007 | US20070142333 Cycloalkyl inhibitors of potassium channel function |
| 06/21/2007 | CA2633243A1 Azepinoindole derivatives as pharmaceutical agents |
| 06/21/2007 | CA2633035A1 Kinase inhibitors and their uses |
| 06/21/2007 | CA2632466A1 Heteroaryl substituted pyrrolo[2,3-b]pyridines and pyrrolo[2,3-b]pyrimidines as janus kinase inhibitors |
| 06/21/2007 | CA2631907A1 Substituted pyrrolo-pyrazole derivatives active as kinase inhibitors |
| 06/21/2007 | CA2631034A1 Tricyclic lactam derivatives, their manufacture and use as pharmaceutical agents |
| 06/20/2007 | EP1798234A1 Pharmaceutical composition comprising temozolomide ester |
| 06/20/2007 | EP1798233A1 Pyrrolo[1,2-a]quinoxaline derivatives as Adenosine A3 receptor modulators and uses thereof |
| 06/20/2007 | EP1798232A1 Inhibitors of cysteine proteases, the pharmaceutical compositions thereof and their therapeutic applications |
| 06/20/2007 | EP1798231A2 Intermediate products for the preparation of antibacterial compounds |
| 06/20/2007 | EP1797100A1 Nitrate esters and their use for mitigating cellular damage |
| 06/20/2007 | EP1797097A1 7-aminomethyl-1,2,4-triazolo[1,5-a]pyrimidine compounds and their use for controlling pathogenic fungi |