| Patents for C07D 317 - Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms (18,224) |
|---|
| 05/16/2006 | CA2195724C Process for the stereoselective preparation of a hetero-bicyclic alcohol enantiomer |
| 05/11/2006 | US20060100283 Phenylcyclohexylpropanolamine derivatives, preparation and therapeutic application thereof |
| 05/11/2006 | US20060100258 Growth promotion method |
| 05/11/2006 | US20060099476 high softening temperature higher than the conventional perfluorosulfonic acid polymer; strength; catalyst layer; copolymer of tetrafluoroethylene and a perfluorinated 2-methylenedioxolanealkylsulfonic acid or a perfluorinated 2-methyldioxole 2-alkylsulfonic acid |
| 05/10/2006 | EP1654247A1 Alkynyl aryl carboxamides |
| 05/10/2006 | EP1654246A1 Acetals, use thereof as fragrances and methods for production thereof |
| 05/10/2006 | CN1771224A Process for the preparation of alkanediol |
| 05/10/2006 | CN1255399C Method for purifying piperonyl butoxide synthesized from sassafras oil |
| 05/09/2006 | US7041820 Reacting carboxylic acid compound such as sodium salt 2.5 hydrate of (5R,6S)-6-((R)-1-hydroxyethyl)-7-oxo-3-((R)-2-tetrahydrofuryl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate with 4-chloromethyldioxolenone comound in solvent |
| 05/09/2006 | US7041690 Viricides; hepatitis virus infections |
| 05/09/2006 | US7041670 Florfenicol-type antibiotics |
| 05/09/2006 | US7041345 Chiral compounds III |
| 05/09/2006 | CA2345717C Method for preparing trion-bis(oxime ether) derivatives andrion-mono and trion-bis(oxime ether) derivatives obtained therewith |
| 05/04/2006 | WO2006032994A3 Muscarinic receptor antagonists |
| 05/04/2006 | WO2005058862A3 Method for producing glycerol carbonate methacrylate |
| 05/04/2006 | US20060094769 e.g. methyl 4-{[(5-ethoxy-5-oxopentyl)(2-methoxyphenethyl)amino]methyl}benzoate; stimulant of guanylate cyclase; catalyse the biosynthesis of cGMP from guanosine triphosphate (GTP); cardiovascular disorders; liver fibrosis |
| 05/04/2006 | US20060094718 O-substituted hydroxyaryl derivatives |
| 05/04/2006 | US20060094000 Destructible surfactants and uses thereof |
| 05/03/2006 | EP1652838A1 Diol (meth)acrylate compound having urethane bond method for producing the same and polymer thereof |
| 05/03/2006 | EP1651626A1 Urea derivatives and their use as tyrosinkinase inhibitors |
| 05/03/2006 | EP1651595A2 Ubiquitin ligase inhibitors |
| 05/03/2006 | EP1194404B1 Inhibitors of aspartyl protease |
| 05/03/2006 | EP1099692B1 N,n-substituted cyclic amine derivatives |
| 05/03/2006 | CN1768072A Glycolipids derivatives, process for production of the same, intermediates for synthesis thereof, and process for production of the intermediates |
| 05/03/2006 | CN1768027A Process for the preparation of propylene glycol |
| 05/03/2006 | CN1765880A Diol (meth) acrylate compound having urethane bond, method for producing the same, and polymer thereof |
| 05/03/2006 | CN1254470C Process for preparation of baccatin III derivatives |
| 05/03/2006 | CN1254465C Calcilytic compounds |
| 05/02/2006 | US7037997 Beads; crosslinking addition polymer |
| 05/02/2006 | US7037914 Carboxylic acid derivative and a pharmaceutical composition containing the derivative as active ingredient |
| 05/02/2006 | US7037669 Assays for amphetamine and methamphetamine using stereospecific reagents |
| 05/02/2006 | CA2250426C Amidinohydrazones as protease inhibitors |
| 04/27/2006 | WO2006044379A2 Novel curcumin analogues and uses thereof |
| 04/27/2006 | US20060089506 Reacting a diol with bromine in the presence of a trivalent bismuth compound and a base of an alkali metal carbonate or alkali metal hydroxide, to form carbonyl compounds |
| 04/27/2006 | US20060089400 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolylcis/trans-isomerases |
| 04/27/2006 | US20060089336 4-Dedimethylamino tetracycline compounds |
| 04/27/2006 | US20060088485 Piperonyl alcohol; storage stability |
| 04/27/2006 | CA2583943A1 Novel curcumin analogues and uses thereof |
| 04/26/2006 | EP1649871A1 Retroviral protease inhibitor combinations |
| 04/26/2006 | CN1764635A carboxylic acid compounds |
| 04/26/2006 | CN1763032A Natural foodstuff antioxidant sesamol synthesis method |
| 04/26/2006 | CN1253455C 2-3-methylen-dioxy dibenzo [a,g] quinolizine onium hydrochloride and its uses in treatment of diabete |
| 04/25/2006 | US7034057 Controlling tumor necrosis factor; antiinflamamtory agents, autoimmune disease |
| 04/25/2006 | US7034056 Aryl and biaryl compounds having MCH modulatory activity |
| 04/25/2006 | US7034015 Interleukin 1 beta and tumour necrosis factor alpha inhibitors |
| 04/25/2006 | US7033401 3-Aminophenol derivatives substituted in the 2-position, and dyes containing these compounds |
| 04/20/2006 | WO2006040131A1 Iron or cobalt-catalyzed carbon-carbon coupling reaction of aryls, alkenes and alkines with copper reagents |
| 04/20/2006 | WO2006040064A1 Method for producing and dewatering cyclic formals |
| 04/19/2006 | EP1064274B1 Benzenesulfonamide derivatives and their use as medicaments |
| 04/19/2006 | CN1761640A Process for production of carbonyl compounds |
| 04/19/2006 | CN1252064C Preparation of a compound containing cyclic and linear carbonate groups |
| 04/19/2006 | CN1252063C Use of 1, 3-dioxolane-2, 2-dimethylalcohol |
| 04/18/2006 | CA2360943C N2-phenylamidine derivatives |
| 04/13/2006 | WO2006038594A1 N-type calcium channel inhibitor |
| 04/13/2006 | WO2005007621A3 Ubiquitin ligase inhibitors |
| 04/13/2006 | US20060079707 Cyclization by reacting 4-(2-CHLORO-4-TRIFLUOROMETHYL-PHENYL)-4-CYANO-BUT-3-ENOIC ACID METHYL ESTER in the presence of a palladium catalyst and a base; chemical intermediates for preparing 10-AZA-TRICYCLO[6.3.1.02,7] drugs; bind nicotinic acetylcholine receptor, modulate cholinergic function |
| 04/13/2006 | US20060079685 1-(4-Bromo-benzyl)-4-(4-isopropyl-phenyl)-6-propargyloxy-1H-quinazolin-2-one;osteoporosis, bone disorders, fractures, osteopathy, osteo-malacia, periodontal bone loss or bone loss due to arthritis or osteoarthritis; for promoting the release of parathyroid hormone |
| 04/13/2006 | US20060079506 Adamantyl acetamides as 11-beta hydroxysteroid dehydrogenase inhibitors |
| 04/13/2006 | DE102004049056A1 Verfahren zur Herstellung und Reinigung von zyklischen Formalen A process for the preparation and purification of cyclic formals |
| 04/13/2006 | DE102004049055A1 Verfahren zur Herstellung und Reinigung von zyklischen Formalen A process for the preparation and purification of cyclic formals |
| 04/12/2006 | EP1645556A1 Arylpiperazine-benzoylamide derivatives useful as pharmaceutical agents |
| 04/12/2006 | EP1418879B1 Oxidation hair dyes containing 3-aminophenol derivatives, and novel 3-aminophenol derivatives |
| 04/12/2006 | EP1311499B1 Bicyclic compounds as h3 receptor ligands |
| 04/12/2006 | EP1039897B1 Inadone and tetralone compounds for inhibiting cell proliferation |
| 04/12/2006 | CN1758925A Methods of radiofluorination of biologically active vectors |
| 04/11/2006 | US7026498 Coordination catalyst containing ligand |
| 04/11/2006 | US7026339 Inhibitors of HCV NS5B polymerase |
| 04/06/2006 | US20060074235 Glycolipids derivatives, process for production of the same, intermediates for synthesis thereof, and process for production of the intermediates |
| 04/05/2006 | CN1249046C Method for producing L-(R) propylidene glycerin |
| 04/04/2006 | US7022869 Methods of asymmetrically synthesizing enantiomers of casodex, its derivatives and intermediates thereof |
| 04/04/2006 | US7022492 Ecstasy haptens and immunogens |
| 04/04/2006 | CA2256492C Diarylalkyl cyclic diamine derivatives as chemokine receptor antagonists |
| 03/30/2006 | WO2006032994A2 Muscarinic receptor antagonists |
| 03/30/2006 | WO2006032716A1 Catalytic composition for the insertion of carbon dioxide into organic compounds |
| 03/30/2006 | WO2005123089A3 Multicyclic sulfonamide compounds as inhibitors of histone deacetylase for the treatment of disease |
| 03/30/2006 | WO2005075450A3 Spiro-benzodioxoles and their use as cb1 antagonists |
| 03/30/2006 | US20060069273 1-acetoxy-2-methyl-3-(3,4-methylenedioxyphenyl)propene; alkylation of a benzene compound with alkenylidene diacetate in the presence of a catalyst halogenated boron compounds, triflate compounds, Group 12 halogenated compounds, triflate compounds and halogenated compounds of tin and lanthanoid elements |
| 03/30/2006 | US20060069257 Use of specific bidentate ligands, e.g., 2-dicyclohexylphosphino-2'-dimethylamino-biphenyl, in transition metal-catalyzed carbon-heteroatom and carbon-carbon bond-forming reactions including amination and arylation and with aryl halide reactants and amine, boronic acid, borane or ketone reactants |
| 03/30/2006 | US20060069255 Novel aryl ureido benzoic acid derivatives and their use |
| 03/30/2006 | CA2577996A1 Catalytic composition for the insertion of carbon dioxide into organic compounds |
| 03/29/2006 | EP1639061A1 Method for producing an oxygen-containing compound used as fuel additive, in particular in diesel fuels, gasoline and rapeseed methyl ester |
| 03/29/2006 | EP1638912A2 Process for the preparation of cinnamaldehyde compounds |
| 03/29/2006 | EP1638909A2 Process for preparing alkoxy- and aryloxy-phenols |
| 03/29/2006 | EP1532093B1 Hydroxylation process for aromatic compounds containing a dioxa- heterocyclic system |
| 03/29/2006 | EP1200395B1 Urea derivatives as inhibitors of ccr-3 receptor |
| 03/29/2006 | EP0837677B1 Brominated hexahydroxybiphenyl derivatives |
| 03/29/2006 | CN1753875A Growth promotion method |
| 03/29/2006 | CN1753673A Prodrugs of gaba analogs, compositions and uses thereof |
| 03/29/2006 | CN1752083A Production techinology of piperonyl butoxide synthesized from sassafras oil |
| 03/29/2006 | CN1247592C Optics decomposing method for coumarin dimer |
| 03/29/2006 | CN1247566C Optical activity cyclic carbonates preparation method |
| 03/29/2006 | CN1247565C Process for producing L-(S) propylidene glycerin aldehyde solution |
| 03/29/2006 | CN1247527C 6-fluorobicyclo [3.1.0] hexame derivatives |
| 03/28/2006 | US7019150 1-deoxy taxol analogs |
| 03/28/2006 | US7019030 Immunotherapeutic agents |
| 03/28/2006 | US7019028 for producing a medicament, in particular for the treatment of allergic disorders, of asthmatic disorders, of inflammatory concomitant symptoms of asthma and/or of diseases which can be treated by inhibiting c-maf and NFAT |
| 03/28/2006 | US7019024 Pharmaceutical for treatment of neurological and neuropsychiatric disorders |
| 03/28/2006 | US7019003 Bactericides |
| 03/28/2006 | US7019000 administering nitrogen-sulfur compounds, e.g. 4,4-dithiodimorpholine to inhibit binding of the E6 protein by human papilloma virus; treatment of cervical cancer |
| 03/23/2006 | WO2006030747A1 Dioxolane derivative and method for producing same |