| Patents for C07D 307 - Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom (47,108) |
|---|
| 05/04/2006 | WO2006047503A2 Inhibitors of c-fms kinase |
| 05/04/2006 | WO2006047479A2 C-fms kinase inhibitors |
| 05/04/2006 | WO2006047302A1 Bissulfonamide compounds as agonists of galr1, compositions, and methods of use |
| 05/04/2006 | WO2006047288A2 Asymmetric synthesis of dihydrobenzofuran derivatives |
| 05/04/2006 | WO2006047228A1 Asymmetric synthesis of substituted dihydrobenzofurans |
| 05/04/2006 | WO2006046916A1 Novel sulphonamide derivatives as glucocorticoid receptor modulators for the treatment of inflammatory diseases |
| 05/04/2006 | WO2006046593A1 Benzene compound having 2 or more substituents |
| 05/04/2006 | WO2006046508A1 Ruthenium complex and process for producing tert-alkyl alcohol therewith |
| 05/04/2006 | WO2006046131A1 Tetralin histamine-3 receptor antagonists |
| 05/04/2006 | WO2006032994A3 Muscarinic receptor antagonists |
| 05/04/2006 | WO2006012227A3 Amido compounds and their use as pharmaceuticals |
| 05/04/2006 | WO2005061475A3 Ornithine derivatives as prostaglandin e2 agonists or antagonists |
| 05/04/2006 | US20060094902 Amino acid analogues |
| 05/04/2006 | US20060094888 Reacting furfural with 1,3-dithiopropane (via acid catalyst) to form 1,3-dithiane derivative, metallizing to form metalodithiane derivative which reacts with halide/pseudohalide to form ketone precursor, then hydrolyzing ketone precursor to form furyl ketone; for use as marine antifouling agents |
| 05/04/2006 | US20060094887 Catalyst useful for various asymmetric synthesis reactions |
| 05/04/2006 | US20060094789 Alpha- and beta-amino acid hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| 05/04/2006 | US20060094776 Insecticidal (dihalopropenyl) phenylalkyl substituted dihydrobenzofuran and dihydrobenzopyran derivatives |
| 05/04/2006 | US20060094773 3-Phenyl substituted 3-substituted-4ketolactams and ketolactones |
| 05/04/2006 | US20060094721 Sulfonamides as potassium channel blockers |
| 05/04/2006 | US20060094042 comprising combining the dye with a base and/or a detergent; for staining or labeling of organic molecules such as in electrophoresis |
| 05/04/2006 | CA2585248A1 Substituted tetracycline compounds |
| 05/04/2006 | CA2584775A1 Asymmetric synthesis of dihydrobenzofuran derivatives |
| 05/04/2006 | CA2584728A1 Asymmetric synthesis of substituted dihydrobenzofurans |
| 05/04/2006 | CA2584465A1 Heterocyclic carbonyl compounds and their use as sgk-inhibitors |
| 05/04/2006 | CA2584413A1 Novel sulphonamide derivatives as glucocorticoid receptor modulators for the treatment of inflammatory diseases |
| 05/04/2006 | CA2580690A1 Bissulfonamide compounds as agonists of galr1, compositions, and methods of use |
| 05/03/2006 | EP1652845A2 Process for preparing lactones and the use thereof as odoriferous material |
| 05/03/2006 | EP1652844A2 Fluorinated monomer having cyclic structure, manufacturing method, polymer, photoresist composition and patterning process |
| 05/03/2006 | EP1652839A2 Drug efflux pump inhibitor |
| 05/03/2006 | EP1652832A1 Hydroxy-protecting reagent and method of protecting hydroxy with the same |
| 05/03/2006 | EP1651626A1 Urea derivatives and their use as tyrosinkinase inhibitors |
| 05/03/2006 | EP1651597A2 N-sulphonylated amino acid derivatives, method for the production and use thereof |
| 05/03/2006 | EP1651595A2 Ubiquitin ligase inhibitors |
| 05/03/2006 | EP1543011B1 Thienopyrrolyl and furanopyrrolyl compounds and their use as histamine h4 receptor ligands |
| 05/03/2006 | EP1490049B1 Citalopram for the treatment of elevated blood pressure |
| 05/03/2006 | EP1346987B1 Benzofuran derivatives and pharmaceutical compositions containing the same |
| 05/03/2006 | EP1280791B1 N-heteroarylmethyl-m-phenylenediamine derivative-containing dyes for keratin fibers and novel n-heteroarylmethyl-m-phenylenediamine derivatives |
| 05/03/2006 | EP1208091B1 Benzophenones as inhibitors of reverse transcriptase |
| 05/03/2006 | EP0771794B1 Oxygen-containing heterocyclic compounds |
| 05/03/2006 | CN1768031A Novel hydroxamates as therapeutic agents |
| 05/03/2006 | CN1767823A Asthma and allergic inflammation modulators |
| 05/03/2006 | CN1765893A Process for the preparation of arylethanoldiamines useful as agonists of the beta-3-adrenoceptor |
| 05/03/2006 | CN1765886A Process for the preparation of arylethanoldiamines useful as agonists of the beta-3-adrenoceptor |
| 05/02/2006 | US7038070 Coordination polymerization catalysts |
| 05/02/2006 | US7038068 Solvent extraction; using mixture of alcohol and fluorinated solvent; separation |
| 05/02/2006 | US7038065 Partial oxidation of feedstock in the presence of oxygen, in one or more series connected reactors which constitues a cooling tube reactor with cooling tube for flowing coolant, and a catalyst is deposited as coating on outside the tube |
| 05/02/2006 | US7038064 Process for producing hydroxylactones |
| 05/02/2006 | US7037995 Tertiary (meth)acrylates having lactone structure, polymers, resist compositions and patterning process |
| 05/02/2006 | US7037940 Taxol enhancer compounds |
| 05/02/2006 | US7037937 Cytotoxic compounds |
| 05/02/2006 | US7037933 Compounds for treatment of cardiac arrhythmia, synthesis, and methods of use |
| 05/02/2006 | US7037932 such as (lepido%3S)-3-(1-Benzothien-7-yloxy)-N-methyl-3-phenyl-1-propanamine oxalate; for treatment of pain |
| 05/02/2006 | US7037930 3-arylphenyl sulfide derivative and insecticide and miticide |
| 05/02/2006 | CA2354877C Method for the preparation of citalopram |
| 05/02/2006 | CA2315849C Quaternary ammonium and waterproofing/preservative compositions |
| 04/27/2006 | WO2006043705A1 Type ii cubic liquid crystal composition |
| 04/27/2006 | WO2006003496A3 Preparation of 4-substituted-2-buten-4-olides from mucohalic acids |
| 04/27/2006 | WO2005118564A3 Methods for the synthesis of milnacipran and congeners thereof |
| 04/27/2006 | US20060089405 Asymmetric synthesis of dihydrobenzofuran derivatives |
| 04/27/2006 | US20060089402 Compounds from Antrodia camphorata and use thereof |
| 04/27/2006 | US20060089400 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolylcis/trans-isomerases |
| 04/27/2006 | US20060089336 4-Dedimethylamino tetracycline compounds |
| 04/27/2006 | DE102004051277A1 Heterocyclische Carbonylverbindungen Heterocyclic carbonyl |
| 04/27/2006 | DE10164687B4 Crystalline citalopram base and salts with high purity useful for treatment of depression |
| 04/27/2006 | CA2584560A1 Type ii cubic liquid crystal composition |
| 04/26/2006 | EP1648885A1 Novel compounds |
| 04/26/2006 | CN1764654A Method for preparing oxydiphthalic anhydrides using bicarbonate as catalyst |
| 04/26/2006 | CN1763060A Metallocene compound, indene compound and application thereof |
| 04/26/2006 | CN1763044A Method for synthesizing olefin type imidacloprid from imidacloprid by microorganism transformation |
| 04/26/2006 | CN1763043A Method for separating gas phase pyromellitic dianhydride from mixed gas |
| 04/26/2006 | CN1763028A Novel ascorbic acid compounds, methods of synthesis and application use thereof |
| 04/26/2006 | CN1763027A Novel ascorbic acid compounds, methods of synthesis and application use thereof |
| 04/26/2006 | CN1763026A Vitamin C crystallization process seed crystal production method |
| 04/26/2006 | CN1763025A Succinic anhydride and its preparation method |
| 04/26/2006 | CN1763024A Method for making furfuraldehyde using xylose mother liquor as material |
| 04/26/2006 | CN1763023A Lactone B of Artocarpus hypargyreus Hance and its extraction process |
| 04/26/2006 | CN1763022A Lactone A of Artocarpus hypargyreus Hance and its extraction process |
| 04/26/2006 | CN1762989A Semicarbazone synthesis method |
| 04/26/2006 | CN1762957A 2,3-dihydro-1-indene compound and preparation method thereof |
| 04/26/2006 | CN1762586A Cu-B catalyst for preparing tetrahydrofuran by hydrogenation of dimethyl maleate and its preparation process |
| 04/26/2006 | CN1253456C Improved process for preparing podophyllotoxin from Chinese podophyllum root |
| 04/26/2006 | CN1253450C Method of mycophenolate mofetil preparation |
| 04/26/2006 | CN1253445C Process for preparing 5-alkyl-2-furfural alcohol |
| 04/25/2006 | US7034182 Compounds to treat Alzheimer's disease |
| 04/25/2006 | US7034167 Catalytic hydrogenolysis |
| 04/25/2006 | US7034166 Process for producing benzofuran derivative |
| 04/25/2006 | US7034056 Aryl and biaryl compounds having MCH modulatory activity |
| 04/25/2006 | US7034053 beta-adrenoceptor agonist for the prevention or treatment of obesity; Suitable compounds of formula (I) of the invention include:2-(3-{2R-[2-(3-Chlorophenyl)-2R-hydroxyl-ethylamino]propylamino}phenyl)furan-3-carboxylic acid |
| 04/25/2006 | US7034043 Cell adhesion inhibitors |
| 04/25/2006 | US7034015 Interleukin 1 beta and tumour necrosis factor alpha inhibitors |
| 04/25/2006 | US7033401 3-Aminophenol derivatives substituted in the 2-position, and dyes containing these compounds |
| 04/25/2006 | CA2194885C Substituted benzamidines, their preparation and their use as pharmaceutical compounds |
| 04/20/2006 | WO2006041119A1 Hydrazide derivatives |
| 04/20/2006 | WO2006041038A1 Method of decomposing ester oligomer and process for producing c4 compound |
| 04/20/2006 | WO2006040652A2 Process for the preparation of n-(3,5-dichloropyrid-4-yl)-4difluoromethoxy-8-methanesulfonamido-dibenzo[b,d]furan-1-carboxamide |
| 04/20/2006 | WO2006012379A8 Processes for preparation of crystalline mycophenolate sodium |
| 04/20/2006 | WO2005096734A3 Non-imidazole heterocyclic compounds as histamine h3 receptor modulators |
| 04/20/2006 | WO2005030705A9 Inhibitors of histone deacetylase |
| 04/20/2006 | US20060084818 Gas phase synthesis of methylene lactones using catalysts derived from hydrotalcite precursors |
| 04/20/2006 | US20060084680 ((1S)-5-{2-[(3-methyl-7-propyl-1,2-benzisoxazol-6-yl)oxy]ethoxy}-2,3-dihydro-1H-inden-1-yl)acetic acid; diabetes, obesity, hyperlipidemia, and atherosclerotic diseases; hyperglycemia, hyperinsulinemia, impaired glucose tolerance, dyslipidemia, hypertriglyceridemia, and insulin resistance |