| Patents for C07D 277 - Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings (33,621) |
|---|
| 04/07/2011 | WO2011039735A2 Compounds with ddx3 inhibitory activity and uses thereof |
| 04/07/2011 | WO2010125414A8 Process for the preparation of [4-(2-chloro-4-methoxy-5-methylphenyl)-5-methyl-thiazolo-2-yl]-[2-cyclopropyl-1-(3-fluoro-4-methylphenyl)-ethyl]-amine |
| 04/07/2011 | US20110082107 Inhibitors of 11-beta-hydroxy steroid dehydrogenase type 1 |
| 04/07/2011 | US20110081426 Aminothiazole modulators of beta-3-adrenoreceptor |
| 04/07/2011 | CA2775309A1 Novel phenol derivative |
| 04/06/2011 | EP2305659A1 5-hydroxy-benzothiazole derivatives having beta-2-adrenoreceptor agonist activity |
| 04/06/2011 | EP2305658A1 Novel imino derivative, process for production of the same, and pesticide comprising the same |
| 04/06/2011 | EP2305648A1 Amide derivatives useful as glucokinase activators |
| 04/06/2011 | EP2305641A1 Sulfonamide compound or salt thereof |
| 04/06/2011 | EP2305253A1 Use of pramipexole to treat amyotrophic lateral sclerosis |
| 04/06/2011 | EP2305252A1 Use of pramipexole to treat amyotrophic lateral sclerosis |
| 04/06/2011 | EP2305035A1 Agents for combatting plant pests |
| 04/06/2011 | EP2305034A1 Agents for combatting plant pests |
| 04/06/2011 | EP2305031A1 Agents for combatting plant pests |
| 04/06/2011 | EP2303862A2 Wnt protein signalling inhibitors |
| 04/06/2011 | EP2303854A2 Process for making substituted 2-amino-thiazolones |
| 04/06/2011 | EP2303853A2 Novel salts and polymorphs of desazadesferrithiocin polyether analogues as metal chelation agents |
| 04/06/2011 | EP2303833A2 Oxime ester photoinitiators |
| 04/06/2011 | EP2303270A1 Acylamino-substituted fused cyclopentanecarboxylic acid derivatives and their use as pharmaceuticals |
| 04/06/2011 | EP2303021A2 Compounds for the treatment of cancer |
| 04/06/2011 | EP1353911B1 Antiviral agents |
| 04/06/2011 | EP1219607B1 Integrase inhibitors containing aromatic heterocycle derivatives |
| 04/06/2011 | CN1970547B Novel febuxostat crystal form and its preparation method |
| 04/06/2011 | CN102007103A Substituted sulfonic acid amide compounds |
| 04/06/2011 | CN102002018A (2-oxo-benzothiazole)-3-diacetyl hydrazone compound as well as preparation method and application thereof |
| 04/06/2011 | CN102002017A Method for preparing febuxostat intermediate |
| 04/06/2011 | CN102002016A Improvement method for synthesizing febuxostat |
| 04/06/2011 | CN101550112B 4,5-disubstituted thiazole derivative, preparation method and use thereof |
| 04/06/2011 | CN101068796B Compounds, compositions and thin films |
| 04/05/2011 | US7919628 2-[(1-Benzyloxy-naphthalene-2-carbonyl)-amino]-2-methyl-propionic acid; inhibitors of chemokine receptors; treatment or prophylaxis of acute and chronic inflammatory diseases such as atherosclerosis, ischemic or reperfusion injuries, chronic obstructive pulmonary disease, asthma, rheumatoid arthritis |
| 04/05/2011 | US7919496 5-[4-(2-Trifluoromethylbenzoyl)piperazin-1-yl]-[1,3,4]thiadiazole-2-carboxylic acid ethyl ester; metabolic disorders type II diabetes, impaired glucose tolerance, insulin resistance, obesity, fatty liver, non-alcoholic steatohepatitis, dyslipidemia and metabolic syndrome; cardiovascular disorders |
| 04/05/2011 | CA2494695C 2-(3-aminoaryl)amino-4-aryl-thiazoles and their use as c-kit inhibitors |
| 04/05/2011 | CA2475434C Aromatic amino acid derivatives and medicinal compositions |
| 04/05/2011 | CA2408747C Heterocyclic inhibitors of glycogen synthase kinase gsk-3 |
| 03/31/2011 | WO2011037192A1 Substituted amide compound |
| 03/31/2011 | US20110077409 Process for the preparation of certain substituted sulfilimines |
| 03/31/2011 | US20110077251 Novel 17 beta lupane derivatives |
| 03/31/2011 | US20110077234 Urea Glucokinase Activators |
| 03/31/2011 | US20110076721 Efficient production of heterologous proteins using mannosyl transferase inhibitors |
| 03/31/2011 | CA2774647A1 Substituted amide compound |
| 03/30/2011 | EP2301925A1 A methoxyl acrylic ester fungicide, the preparation method and uses thereof |
| 03/30/2011 | EP2301923A1 New compounds |
| 03/30/2011 | EP2301540A1 A therapeutic agent for impaired gastric accomodation |
| 03/30/2011 | EP2301538A1 Compounds for nonsense suppression, and methods for their use |
| 03/30/2011 | EP2301534A1 Amino-methyl substituted tetracycline compounds |
| 03/30/2011 | EP2301353A1 Agents for combatting plant pests |
| 03/30/2011 | EP2300446A1 Efficient production of heterologous proteins using mannosyl transferase inhibitors |
| 03/30/2011 | EP2300442A2 Compounds and methods for modulating g protein-coupled receptors |
| 03/30/2011 | EP2300004A2 Compositions and methods relating to heat shock transcription factor activating compounds and targets thereof |
| 03/30/2011 | EP1898908B1 Novel chemical compounds and the uses thereof as a medicament |
| 03/30/2011 | EP1742927B1 Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof |
| 03/30/2011 | EP0933354B1 Calcium receptor-active compounds |
| 03/30/2011 | CN1976710B Compounds and compositions as cathepsin S inhibitors |
| 03/30/2011 | CN1876664B Organometallic complex and organic electroluminescent device using the same |
| 03/30/2011 | CN101998950A 3-(4-fluorophenyl)-3-hydroxy-2-amino-propionic acid amides and related compounds having analgesic activity |
| 03/30/2011 | CN101993382A 芳香胺类衍生物或其类似物及其应用 Aromatic amine derivatives or analogues thereof and its application |
| 03/30/2011 | CN101007790B Oxamic acid derivative, and its preparation method and medicinal uses |
| 03/29/2011 | US7915405 2,4-disubstituted-5-aminocarbonyl-1,3-thiazole derivatives for therapeutic agent of antiinflammatory disease, method thereof for preparation, therapeutic agent for antiinflammatory disease induced by SPC activity containing the same |
| 03/29/2011 | CA2610354C Substituted aryloxy-n-bicyclomethyl acetamide compounds as vr1 antagonists |
| 03/29/2011 | CA2489276C Tricyclic steroid hormone nuclear receptor modulators |
| 03/29/2011 | CA2463544C Cross-linked glycopeptide-cephalosporin antibiotics |
| 03/29/2011 | CA2452845C Dye-sulfenates for dual phototherapy |
| 03/24/2011 | US20110071285 Low-molecular serine proteases inhibitors comprising polyhydroxy-alkyl and polyhydroxy-cycloalkyl radicals |
| 03/24/2011 | US20110071150 Indole derivatives as crac modulators |
| 03/24/2011 | US20110071127 Compounds Which Modulate the CB2 Receptor |
| 03/24/2011 | US20110071125 Substituted phenylamino-benzene derivatives useful for treating hyper-proliferative disorders and diseases associated with mitogen extracellular kinase activity |
| 03/24/2011 | US20110071113 Thiazole Derivatives and Use Thereof |
| 03/23/2011 | EP2298779A1 Sulfonamide derivatives as glycokinase activators useful in the treatment of type 2 diabetes |
| 03/23/2011 | EP2298752A1 Alpha-form or beta-form crystal of acetanilide derivative |
| 03/23/2011 | EP2298751A2 Polymorphs of ritonavir |
| 03/23/2011 | EP2298308A2 Integrin-binding small molecules |
| 03/23/2011 | EP2298077A1 Agents for combatting plant pests |
| 03/23/2011 | EP2298076A1 Agents for combatting plant pests |
| 03/23/2011 | EP2297103A1 Hydroxyphenylsulfonamides as antiapoptotic bcl inhibitors |
| 03/23/2011 | EP2297102A1 Heteroaromatic monoamides as orexinin receptor antagonists |
| 03/23/2011 | CN101987847A Novel heterocyclic NF-kB inhibitors |
| 03/22/2011 | US7910770 3-Isopropoxy-7-methoxy-N-(1H-1,2,3,4-tetrazol-5-yl)-1-benzo[b]thiophene-2-carboxamide; autoimmune diseases such as rheumatoid arthritis, immune thrombocytopenia purpura, systemic lupus erythematosus and Crohn's disease |
| 03/22/2011 | US7910740 Modulators of amyloid beta |
| 03/22/2011 | US7910613 2-acylaminothiazole derivatives |
| 03/22/2011 | US7910609 Inhibitors of integrin alpha2beta1 with modified urea moiety |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | US7910592 CETP inhibitors |
| 03/22/2011 | US7910579 Benzoxazole derivatives |
| 03/22/2011 | CA2498091C Sulfonylamino-acetic acid derivatives |
| 03/17/2011 | WO2011031409A1 Processes for preparing febuxostat |
| 03/17/2011 | WO2011030929A1 Compound for inhibiting type 3 17β-hydroxysteroid dehydrogenase |
| 03/17/2011 | WO2011029596A1 Process for preparing 2-aminothiazol-4-yl-acetic acid derivates |
| 03/17/2011 | WO2010110631A3 Benzopyran derivatives, pharmaceutically acceptable salts thereof, method for preparing same, and pharmaceutical composition for preventing or treating inflammatory diseases containing same as an active ingredient |
| 03/17/2011 | US20110065760 Compounds for the inhibition of rotamases and use thereof |
| 03/17/2011 | US20110065729 Methods and compositions for ameliorating the undesirable effects of chemotherapy |
| 03/17/2011 | US20110065728 Lipoprotein lipase-activating compositions comprising benzene derivatives |
| 03/17/2011 | US20110065710 Insecticidal N-(Heteroarylalkyl)Alkanediamine Derivatives |
| 03/17/2011 | US20110065129 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/16/2011 | EP2295418A1 5-(benz-(z)-ylidene)-thiazolidin-4-one derivatives as immunosuppressant agents |
| 03/16/2011 | EP2295052A1 Use of ritonavir for improving the pharmacokinetics of drugs metabolized by cytochrome P450 |
| 03/16/2011 | EP2205562B1 1,1,1-trifluoro-2-hydroxy-3-phenylpropane derivatives |
| 03/15/2011 | US7906653 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/15/2011 | US7906629 Protease inhibitor conjugates and antibodies useful in immunoassay |
| 03/15/2011 | US7906235 Pentacyclic anion salts or tetrazapentalene derivatives and their uses as ionic conducting materials |
| 03/15/2011 | CA2618511C Novel benzothiazolone derivatives |