| Patents for C07D 271 - Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms (7,144) |
|---|
| 04/14/1982 | EP0049604A1 CNS stimulants |
| 04/13/1982 | US4324897 1,2,3 Oxadiazolium salts |
| 04/13/1982 | CA1121816A1 Cyanocarboxamidines and quinazoline process |
| 04/07/1982 | EP0049071A1 N-arylbenzamide derivatives |
| 02/17/1982 | EP0045955A1 Alkyl and cycloalkyl substituted 2-(2-(2-hydroxy-3-tert.-butylamino-propoxy)-5-acylaminophenyl)-1,3,4-oxadiazoles, their preparation and pharmaceutical preparations containing them |
| 02/16/1982 | US4316035 Cyclizing imidoylamidoximes also polyoxadiazoles |
| 02/16/1982 | US4316034 Isocyanate precursor |
| 02/16/1982 | CA1118426A1 Herbicidally active 1,2,4-oxadiazole derivatives, a process for their manufacture and their use |
| 02/09/1982 | US4315009 Antisecretory guanidine derivatives and pharmaceutical compositions containing them |
| 02/02/1982 | US4313953 Heterocyclic derivatives of (4-aryloxymethyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles |
| 01/26/1982 | US4312982 Bactericides |
| 01/26/1982 | US4312664 Compositions and methods for improving the tolerance by crop plants of herbicidally active acetanilides |
| 01/26/1982 | CA1117131A1 Substituted cyanamides, their manufacture and their use as fungicides |
| 01/20/1982 | EP0044266A2 Substituted 3,5-diamino-1,2,4-oxadiazoles and 3,5-diamino-1,2,4-thiadiazoles, their preparation and pharmaceutical compositions containing them |
| 01/19/1982 | CA1116607A1 PROCESS FOR THE PREPARATION OF N-SUBSTITUTED .alpha.-HALOGENOACETANILIDES |
| 01/05/1982 | US4309435 Antisecretory guanidine derivatives and pharmaceutical compositions containing them |
| 01/05/1982 | US4309433 Pyridinecarbonamido-oxy or thio loweralkyl-1-(diloweralkylaminoloweralkyl)benzene and derivatives thereof, compositions containing same and method of using same |
| 12/22/1981 | CA1114825A1 Heterocyclic-substituted anilide derivatives |
| 12/22/1981 | CA1114824A1 N-dichloroacetyl-1,2,3,4-tetrahydro-quinaldine, a process for its preparation and its use for preventing damage to crop plants by herbicides |
| 12/15/1981 | US4305939 Hypotensive |
| 12/15/1981 | CA1114287A1 Control of manure breeding insects |
| 12/08/1981 | US4304845 Silver halide photographic materials containing photographic yellow coupler |
| 11/25/1981 | EP0040310A2 Fungicidal heterocyclic substituted thioglycolic acid-anilides, their preparation and pesticides containing them |
| 11/18/1981 | EP0039811A2 Agents for plant growth regulation, production and utilization thereof |
| 11/17/1981 | US4301285 Comprising 3-(1-(hydroxymethyl)-2-phenylethyl)sydnomines |
| 10/28/1981 | EP0038438A2 Substituted 1,2,5-oxadiazole-2-oxides for use as medicaments and medicaments containing them |
| 10/27/1981 | US4297490 Bicyclic heterocyclic amino derivatives |
| 10/20/1981 | US4295876 N-(2,5-Diazolyl)-alkyl-haloacetanilides, compounds and herbicidal compositions |
| 10/14/1981 | EP0037465A2 Amino azo compounds |
| 10/13/1981 | US4294843 Anti-protozoal oxadiazole derivatives |
| 10/13/1981 | US4294842 Malaria |
| 09/30/1981 | EP0036711A2 Pesticidal heterocyclic compounds, processes for preparing them, compositions containing them, and their use |
| 09/15/1981 | US4289885 3-[2-(Dimethylamino)-2-phenylethyl]N-[phenylamino)carbonyl]sydnone imine, a new central nervous system stimulant |
| 09/09/1981 | EP0035228A1 Tetrazole derivatives, process for the preparation thereof, and anti-ulcer composition containing the same |
| 08/26/1981 | EP0034481A1 2-Methyl-5-thiazole-methylamine and carboxamide derivatives |
| 08/26/1981 | EP0034276A2 Phenylpiperazine derivatives of 1,3,4-oxadiazolyl phenols, their preparation and pharmaceutical compositions containing them |
| 08/25/1981 | CA1107742A1 Oxadiazole derivatives |
| 07/21/1981 | US4279638 To thiolcarbamate herbicides |
| 07/08/1981 | EP0031796A2 4-Heterocyclyl-4'-vinyl-stilbenes |
| 07/07/1981 | US4277609 Sydnone imines |
| 06/30/1981 | CA1104148A1 Production of isocyanates |
| 06/24/1981 | EP0030630A2 7-Acylamino-3-vinylcephalosporanic acid derivatives, processes for their preparation, pharmaceutical compositions containing them; their starting compounds and their preparation |
| 06/03/1981 | EP0029557A2 7-Acylamino-3-substituted cephalosporanic acid derivatives, processes for their preparation and pharmaceutical compositions containing them |
| 06/02/1981 | US4271307 Bichromophoric benzotriazole-benzoxazole ultraviolet stabilizers and their use in organic compositions |
| 06/02/1981 | CA1102345A1 Soft anticholinergic agents exhibiting anti-secretory activity |
| 05/27/1981 | EP0029171A1 Azolyloxy-carboxylic acid N-oxy-amides, process and intermediates for their preparation, their use, herbicides containing them and their preparation |
| 05/26/1981 | CA1101853A1 Bicyclic heterocyclic derivatives |
| 05/19/1981 | US4268591 Material for color photography |
| 05/19/1981 | US4268299 Method and composition for plant growth regulation containing trifluoromethyl 1,3,4 oxadiazol benzoates |
| 05/12/1981 | US4267338 N-Azolylalkyl-anilines |
| 05/12/1981 | US4267179 As fungicides and bactericides |
| 05/12/1981 | CA1100968A1 No translation available |
| 05/12/1981 | CA1100966A1 Process for the preparation of sulphoalkyl quaternary salts |
| 05/05/1981 | CA1100521A1 2-imino substituted isothioureidobenzene |
| 04/14/1981 | US4261994 1,2,4-Oxadiazole derivatives, their preparation and pharmaceutical use |
| 03/31/1981 | US4259497 Oxadiazoline-1,3,4 one-5s |
| 03/31/1981 | US4259104 Postemergent selectivity for broad leaf plants |
| 03/31/1981 | CA1098524A1 Process for the preparation of new derivatives of piperazincarbodithioic acid |
| 03/17/1981 | CA1097659A1 Sydnonimine n-acylderivatives and method for preparing same |
| 03/11/1981 | EP0024924A2 Sydnonimines, their preparation and pharmaceutical compositions containing them |
| 03/05/1981 | WO1981000567A1 Sydnone imines |
| 02/11/1981 | EP0023578A1 Aminoalkylbenzene derivatives, process for their preparation and pharmaceutical compositions |
| 02/04/1981 | EP0023343A2 Substituted 3-amino-sydnonimines, process for their synthesis and pharmaceutical preparations containing them |
| 02/04/1981 | EP0023308A1 N-acyl-piperidone cetals, process for their preparation and their use as antidotes in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
| 02/04/1981 | EP0023287A1 Antidote for the protection of cultivated plants against damage by herbicides |
| 02/03/1981 | CA1095055A1 Benzamidine derivatives, process for their preparation and applications thereof |
| 01/20/1981 | US4246403 Optical brighteners |
| 01/20/1981 | US4246272 Treatment of gastic or duodenum ulcers |
| 01/13/1981 | US4245100 Acylation of n-nitroso derivatives of n-substituted nitriles of x-amino acids in the presence of a tertiary amine catalyst to produce psychostimulants |
| 01/06/1981 | US4243409 1,2,4-Oxadiazole derivatives and herbicide composition containing same |
| 01/06/1981 | US4243408 Herbicidal N-triazolylmethyl-substituted alpha-haloacetanilide |
| 12/30/1980 | US4242352 Hypotensive |
| 12/30/1980 | US4242351 Antisecretory oxadiazoles and pharmaceutical compositions containing them |
| 12/10/1980 | EP0020304A1 Guanidines, process for their preparation, pharmaceutical preparations containing such compounds and their application |
| 12/10/1980 | EP0019742A2 N-(2,5-diazolyl) alkyl-haloacetanilides, processes for their preparation and their use as herbicides |
| 11/25/1980 | US4236013 Benzotriazole ultraviolet stabilizers and their use in organic compositions |
| 11/25/1980 | US4235928 Substituted cyanamides and their use as fungicides |
| 11/18/1980 | US4234593 3-(N-Alkylcarbamyl)-5-(carboalkoxy)-1,3,4-oxadiazole-2-thiones and their use as anti-inflammatory agents |
| 11/12/1980 | EP0018497A1 Azolyloxy-acetamides, process for their preparation and their use as herbicides |
| 11/11/1980 | US4233249 Method for the preparation of alkali metal salts of dinitromethane |
| 11/04/1980 | US4232106 Photosensitive compositions containing 2-halomethyl-5-vinyl-1,3,4-oxadiazoles as free radical progenitors |
| 10/21/1980 | US4229343 Azo dyes from an oxadiazolyl-substituted aniline |
| 09/16/1980 | CA1085860A1 Acylamino derivatives |
| 08/26/1980 | US4219476 Free radical generators |
| 08/19/1980 | US4218458 Heterocyclic derivatives of (4-aryloxy-methyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles |
| 08/06/1980 | EP0014057A1 Guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| 08/05/1980 | US4216105 Compositions for the optical whitening of organic materials and use thereof |
| 07/29/1980 | US4215129 Method for the control of manure-breeding insects |
| 07/15/1980 | US4212970 Photoinitiators |
| 07/15/1980 | US4212867 For agricultural use |
| 07/01/1980 | US4210762 2[5-(3-Trifluoromethylphenyl)-1,3,4-oxadiazol-2-yl] benzoates |
| 06/25/1980 | EP0012428A1 Substituted cyanamides, process for their preparation and their use as fungicides |
| 06/24/1980 | CA1080233A1 Process for the preparation of novel derivatives of oxadiazole and of their salts thereof |
| 06/11/1980 | EP0011693A1 N-trifluoromethane-sulfonylaminophenyl-substituted N-heterocycles, their preparation, compositions containing them and their use in regulating plant growth |
| 04/30/1980 | EP0010418A1 Antisecretory guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| 04/30/1980 | EP0010163A1 N-Diazolylalkyl-chloroacetanilides, process for their preparation and their use as herbicides |
| 04/29/1980 | US4200745 Antibiotics |
| 04/22/1980 | CA1076121A1 Oxadiazoline derivatives |