Patents for C07D 257 - Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms (9,612) |
---|
05/06/1981 | EP0028063A1 Phenol derivatives, processes for their preparation and pharmaceutical compositions containing them |
05/05/1981 | US4265820 Antiasthmatic activity |
05/05/1981 | CA1100699A1 Bis-tetrazoles as chemical blowing agents |
04/29/1981 | EP0027599A2 Cephem compounds, processes for their preparation and pharmaceutical compositions containing them |
04/28/1981 | US4264595 7-[2-(2-Imino-4-thiazolin-4-yl)-2-(syn)-hydroxy-iminoacetamido]-cephalosporins |
04/21/1981 | US4263210 19-Hydroxy-4-oxo-PGI1 compounds |
04/14/1981 | US4261903 Antiasthmatic prostaglandins |
04/14/1981 | US4261902 19-Hydroxy-6-alkoxy-PGI1 compounds |
04/08/1981 | EP0026519A1 Photographic silver halide emulsion material containing an antifoggant precursor |
03/31/1981 | US4259515 Anti-asthmatic prostaglandins |
03/31/1981 | US4259474 Metal working lubricants |
03/31/1981 | US4259340 Prophylactic chemotherapy of allergic conditions such as asthma |
03/31/1981 | US4259245 19-Hydroxy-19-methyl-6-hydroxy-PGI1 compounds |
03/25/1981 | EP0025692A1 Quinone derivatives, their production and use |
03/25/1981 | EP0025687A1 15-Methanesulfonamidoprostaglandin derivatives, pharmaceutical compositions thereof and process therefor |
03/24/1981 | US4257965 19-Hydroxy-19-methyl-5-hydroxy-PGI compounds |
03/24/1981 | US4257964 19-Hydroxy-6,7-didehydro-PGI1 compounds |
03/24/1981 | US4257963 19-Hydroxy-19-methyl-7,8-didehydro-PGI1 compounds |
03/24/1981 | US4257779 Hydrocarbylsuccinic anhydride and aminotriazole reaction product additive for fuel and mineral oils |
03/24/1981 | CA1098116A1 Cephalosporin derivatives |
03/17/1981 | US4256905 19-Hydroxy-19-methyl-6a-carba-PGI2 compounds |
03/17/1981 | US4256667 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6a-carba-PGI2 compounds |
03/17/1981 | US4256663 19-Hydroxy-19-methyl-6a-carba-PGI2 amides |
03/17/1981 | US4256648 Antihistamines |
03/17/1981 | CA1097669A1 4-nitro-2-trichloromethylphenyl disulfides |
03/10/1981 | US4255575 Hypotensive, antispasmodic, adrenergic blocking agents |
03/10/1981 | US4255354 Antihistamines |
03/10/1981 | US4255339 Prostaglandins; asthma |
03/03/1981 | US4254260 3-Substituted-7-substituted alkanamido-3-cephem-4-carboxylic acid compounds |
03/03/1981 | US4254138 Esters of 4-(monoalkylamino)benzoic hydroxyalkanoic acids |
03/03/1981 | US4254058 Antiasthmatic prostaglandins |
03/03/1981 | US4254042 19-Hydroxy-19-methyl-4,5-didehydro-PGI1 compounds |
03/03/1981 | US4254041 19-Hydroxy-5-hydroxy-PGI compounds |
03/03/1981 | US4254040 Prostaglandins as antiasthmatic agents |
02/24/1981 | US4252978 19-Hydroxy-6-oxo-PGF1 sulfonylamides |
02/24/1981 | US4252815 Methods of treating cardiovascular diseases with phenyltetrazolyloxy propanolamines |
02/24/1981 | US4252747 Antiasthmatic; prostaglandins |
02/17/1981 | US4251531 Antiallergens |
02/17/1981 | US4251464 2-Decarboxy-2-aminomethyl-19-hydroxy-6-oxo-PGE1 compounds |
02/17/1981 | CA1095915A1 Bis(1h-tetrazole-5-carboxamide) compounds |
02/17/1981 | CA1095908A1 Morpholine derivatives as antibacterial agents |
02/17/1981 | CA1095735A1 Herbicidal compositions |
02/11/1981 | EP0023578A1 Aminoalkylbenzene derivatives, process for their preparation and pharmaceutical compositions |
02/10/1981 | US4250252 A development-inhibitor-releasing compound comprising a 5-(sulfoamido-1-indanone-2-yl)thio-tetrazole |
02/04/1981 | EP0023308A1 N-acyl-piperidone cetals, process for their preparation and their use as antidotes in the protection of crop plants against damage by herbicides |
02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
02/04/1981 | EP0023287A1 Antidote for the protection of cultivated plants against damage by herbicides |
02/03/1981 | US4248962 Photographic emulsions, elements and processes utilizing release compounds |
02/03/1981 | CA1095041A1 0-2-isocephem antibacterial agents and processes and intermediates for their production |
02/03/1981 | CA1095033A2 Preparation of optically active cyclopentyl derivatives |
02/03/1981 | CA1095032A1 Mono-deuterated, 15-hydroxyprostaglandins |
01/27/1981 | CA1094565A1 Benzamide derivatives |
01/20/1981 | US4246333 Development inhibitor precursor and a photographic element containing the same |
01/14/1981 | EP0022229A1 Substituted phenol ethers, their preparation, intermediates therefor, pharmaceutical compositions containing them and the preparation thereof |
01/13/1981 | US4244887 Fertility control, abortion, oxytocic, antiulcer, antisecretory |
01/06/1981 | CA1093082A2 Preparation of optically active cyclopentyl derivatives |
12/30/1980 | US4242507 With n-hydroxybenzotriazoles and n-hydroxy oxo-substituted dihydrobenzotriazine, condensation agents |
12/23/1980 | US4241057 Cephalosporins |
12/23/1980 | CA1092103A1 11-deoxy acetylenic aryl prostaglandins |
12/09/1980 | US4238414 2-Decarboxy-2-aminomethyl-6a-carba-PGI2 compounds |
12/02/1980 | US4237127 Miticides, larvicides, ovicides |
11/26/1980 | EP0019308A1 Tetrazole derivatives and a process for their preparation |
11/25/1980 | US4236002 Antibiotics |
11/18/1980 | US4234678 Light-sensitive silver halide photographic materials |
11/12/1980 | EP0018669A1 1-(2-Sulfamoylaminoethyl)-1,4-dihydro-5H-tetrazole-5-thione and its salts |
11/04/1980 | US4232173 15-Sulfonamidoprostaglandin derivatives |
11/04/1980 | CA1088931A2 Preparation of 9-oxo tetrahydropyranyl substituted prostaglandin intermediates |
11/04/1980 | CA1088930A2 Preparation of 9-hydroxy tetrahydropyranyl substituted prostaglandin intermediates |
10/28/1980 | US4230849 Conversion to amides and esters |
10/21/1980 | US4229363 Intermediates for cephalosporin and penicillin derivatives |
10/21/1980 | CA1088049A1 3-substituted-7-substituted alkanamido-3-cephem-4- carboxylic acid compounds and processes for preparation thereof |
10/14/1980 | CA1087613A1 Prostaglandin synthesis and novel intermediates therefor |
10/07/1980 | US4226934 Silver halide emulsions, hetero-heterothioacetophenones |
09/30/1980 | US4225508 19-Hydroxy-PGI2 compounds |
09/30/1980 | US4225507 Prostaglandins, inhibition of blood platelate aggregation |
09/30/1980 | CA1086760A1 Process for preparing bis(amidinoureas) |
09/30/1980 | CA1086729A1 Tetrazole-5-carboxamide derivatives |
09/23/1980 | US4224441 Antibiotics |
09/16/1980 | CA1085831A1 Preparation of substituted w-pentanorprostaglandins |
09/02/1980 | US4220644 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
08/19/1980 | CA1084051A1 3,4-dihydro-quinazoline derivatives and process for their preparation |
08/06/1980 | EP0013762A2 Cephem and cepham compounds, processes for their preparation, pharmaceutical compositions containing them |
08/05/1980 | US4216330 Hypolipidemic and antiatherosclerotic agents |
08/05/1980 | US4216313 Antiviral thiazinyl benzimidazoles |
07/08/1980 | CA1081219A1 Acylamino derivatives |
07/01/1980 | US4210587 7-Acylamino-3-[1-[2-(carboxymethylamino)ethyl]tetrazol-5-ylthio methyl]-3-cephem-4-carboxylic acids |
06/25/1980 | EP0012230A1 Process for producing 1H-tetrazole-1 acetic acid and its esters |
06/24/1980 | US4209624 Process for preparing substituted bis(amidinoureas) |
05/06/1980 | CA1076871A1 Indanone derivatives with a sulphamyl group in the aromatic ring as dir compounds |
04/29/1980 | US4200466 Light-sensitive silver halide photographic materials |
04/29/1980 | CA1076582A1 Antiviral thiazolinyl or thiazinyl ketobenzimidazoles |
04/15/1980 | US4198522 Hypolipidemic acnd anti-atherosclerotic agents |
04/15/1980 | US4198406 Antibiotic |
04/08/1980 | US4197240 Penicillin derivatives |
04/01/1980 | US4196208 Antilipemic agents |
04/01/1980 | CA1074797A1 Process for the preparation of substituted phenyl-amidines |
03/25/1980 | CA1074296A1 3-acyloxymethylcephem compounds |
03/04/1980 | US4191840 Oxamic acid derivatives |
03/04/1980 | CA1072965A1 2-substituted 5-trifluoromethyl-1,3,4-thiadiazoles and their use as fungicides and insecticides |