| Patents for C07D 249 - Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms (17,749) |
|---|
| 04/01/1981 | EP0025949A1 Acylated triazolyl-gamma-fluoropinacolyl derivatives, process for their preparation and their use as fungicides |
| 04/01/1981 | EP0025882A1 N-Phenylpropyl-substituted azoles, process for their preparation and fungicides containing them |
| 04/01/1981 | EP0025859A2 Process for the synthesis of 1,2,4-triazoles |
| 03/31/1981 | US4259504 Antiinflammatory agents, antiarthritic agents |
| 03/31/1981 | US4259503 Triazole intermediates for triazolobenzazepines |
| 03/31/1981 | US4259502 From a 1,2,3-thiadiazole-5-carboxylic acid hydrazide and an alcohol |
| 03/31/1981 | US4259437 Development inhibitor releasing compounds and their use in photographic materials |
| 03/31/1981 | US4259339 Cyanoaralkylheterocyclic compounds |
| 03/25/1981 | EP0025516A2 Plant growth regulating agents containing triazolyl ethers, methods for production of the agents and methods for regulating the plant growth |
| 03/24/1981 | CA1098121A1 Phenylazophenyloxytriazolyl compounds |
| 03/24/1981 | CA1098036A1 Antimicrobial agents and their use |
| 03/17/1981 | US4256881 Blocked benzotriazole compounds as development restrainer precursors |
| 03/17/1981 | CA1097660A1 Triazoles |
| 03/11/1981 | EP0024538A1 1,2,4-Triazolyl-enol ethers, process for preparing them and their use as fungicides |
| 03/10/1981 | US4255510 Diffusion transfer, azoles |
| 03/10/1981 | US4255435 Insecticides, nematocides |
| 03/10/1981 | US4255434 Combatting fungi with 1-(azol-1-yl)-4-halo-(1)-phenoxy-butan-2-ones and -ols |
| 03/10/1981 | US4255425 Sulphoxides |
| 03/10/1981 | CA1097354A1 2,4-dichlorophenyl-triazolyl-ethan-ones and -ols, and their use as fungicides |
| 03/04/1981 | EP0024309A2 Triazolopyridazine derivatives, process and intermediates for their preparation and medicaments containing them |
| 03/03/1981 | US4254132 Combating fungi with 2-acyloxy-1-azolyl-3,3-dimethyl-2-phenoxy-butanes |
| 02/25/1981 | EP0024105A1 Prostaglandin analogons, their preparation and their pharmaceutical compositions |
| 02/24/1981 | US4252965 Process for the production of 1-substituted-3-hydroxy-5-chloro-1,2,4-triazoles |
| 02/24/1981 | CA1096386A1 Triazole compounds |
| 02/17/1981 | US4251262 1-Carbamoyl-1,2,4-triazole herbicidal agents |
| 02/11/1981 | EP0023756A2 Triazol and imidazol derivatives; processes for their preparation, pesticidal compositions containing them and their use; preparation of intermediates |
| 02/11/1981 | EP0023653A1 Pharmaceutical compositions containing 1,2,4-triazolylenol ethers and their preparation |
| 02/11/1981 | EP0023578A1 Aminoalkylbenzene derivatives, process for their preparation and pharmaceutical compositions |
| 02/04/1981 | EP0023308A1 N-acyl-piperidone cetals, process for their preparation and their use as antidotes in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
| 02/04/1981 | EP0023287A1 Antidote for the protection of cultivated plants against damage by herbicides |
| 02/04/1981 | EP0023286A2 Azolyl-alkenols, process for their preparation and their use as fungicides |
| 02/03/1981 | US4248961 Material for color photography |
| 02/03/1981 | US4248879 Benzopyranotriazoles |
| 02/03/1981 | CA1095058A1 Phosphoric esters derived from 1,2,4-triazole having an insecticidal, nematocidal and acaricidal action, and their preparation |
| 02/03/1981 | CA1095057A1 Rust inhibitor and compositions thereof |
| 02/03/1981 | CA1095054A1 .beta.-AZOLYLKETONES |
| 01/28/1981 | EP0022975A1 Triazolyl-alkene derivatives, process for their preparation and their use as fungicides |
| 01/28/1981 | EP0022969A1 Antimycotic compositions containing azolylalkenols and their preparation |
| 01/28/1981 | EP0022958A1 Urea derivatives for use in the treatment of fat metabolism disorders |
| 01/27/1981 | US4247628 Stable cyan dye image from naphthol or phenol couplers, 2-(2'-(r-o-)phenyl)benzotriazoles |
| 01/27/1981 | US4247457 Cationic dyes containing an aryloxy group linked through a bridging radical to a quaternized nitrogen atom |
| 01/27/1981 | CA1094559A1 1-(1,3-dioxolan-2-ylmethyl)-1h-imidazoles and 1h-1,2, 4-triazoles |
| 01/27/1981 | CA1094553A1 1-amino substituted indoline derivatives as vasoconstricting agents |
| 01/21/1981 | EP0022531A1 1-(2,4-Dichlorophenyl)-1-(2,6-dihalogenobenzylmercapto)-2-(1,2,4-triazol-1-yl)-ethanes, process for their preparation and their use as fungicides |
| 01/21/1981 | EP0022491A1 Stilbene compounds, process for their preparation and their use as optical brighteners |
| 01/20/1981 | US4246020 Imidazole and triazole compounds, fungicidal and plant growth regulating compositions, method of combating fungal infections in plants and method of regulating plant growth |
| 01/13/1981 | US4244964 Fungicides, bactericides |
| 01/13/1981 | US4244962 Fungicidal N-(piperidinoacetyl)anilines |
| 01/07/1981 | EP0021377A1 1,2,4-Triazole derivatives, process for their preparation and their use as pesticides |
| 01/07/1981 | EP0021345A1 Alpha-azolylglycol derivatives, their preparation, plant growth regulating agents containing them, and their use |
| 01/07/1981 | EP0021327A1 Beta-triazolyl ethers, their preparation, fungicides containing them, process for combating fungi and for producing fungicides |
| 01/07/1981 | EP0021076A1 Process for regulating plant growth |
| 01/07/1981 | EP0020970A1 Alpha-chloroacetophenonoxime ethers and process for their preparation |
| 01/07/1981 | EP0020968A1 N,O-acetals of glycolic aldehyde, their preparation and their use as fungicides |
| 01/07/1981 | EP0020955A1 Geometrical isomers of 4,4-dimethyl-1-phenyl-2-(1,2,4-triazole-1-yl)-1-penten-3-ols, process for their preparation and medicament containing them |
| 01/07/1981 | EP0020859A1 Substituted N-allyl acetanilides, process for their preparation and their use as fungicides |
| 01/07/1981 | EP0020437A1 Haloacetanilides, their preparation and herbicides containing them. |
| 01/06/1981 | USRE30473 Benzophenone glycinamide derivatives |
| 01/06/1981 | US4243670 α-(4-Biphenylyl)-benzyl-azolium salts and their use for combating micro-organisms |
| 01/06/1981 | US4243589 Sedatives, muscle relaxants, anticonvulsants |
| 01/06/1981 | US4243408 Herbicidal N-triazolylmethyl-substituted alpha-haloacetanilide |
| 01/06/1981 | US4243405 Fungicidal compounds |
| 01/06/1981 | CA1093085A1 Diphenyl-triazolyl-methanes |
| 01/06/1981 | CA1093015A1 Plastics barrel |
| 12/30/1980 | US4242507 With n-hydroxybenzotriazoles and n-hydroxy oxo-substituted dihydrobenzotriazine, condensation agents |
| 12/23/1980 | USRE30456 2-Substituted phenyl-s-triazolo[5,1-a] isoquinoline compounds |
| 12/23/1980 | US4240822 Herbicides |
| 12/23/1980 | CA1092130A1 Azolyl-carboxylic acid derivatives and their use as fungicides |
| 12/23/1980 | CA1092129A1 1-azolyl-4-hydroxy-butane derivatives and their use as fungicides and bactericides |
| 12/23/1980 | CA1092128A1 Combatting fungi with 1-(azol-1-yl)-4-halo-1-phenoxy- butan-2-ones and -ols |
| 12/16/1980 | US4239766 Combating fungi with 1-(4-phenoxy)-3,3-dimethyl-2-(N-halogenoalkylmercapto-carbamoyloxy)-1-(1,2,4-triazol-1-yl)-butanes |
| 12/16/1980 | US4239765 Antimycotic agents |
| 12/16/1980 | US4239525 1,2,4-Triazole derivatives |
| 12/16/1980 | CA1091677A1 (1-phenyl-2-triazolyl-ethyl)-thioether derivatives and their use as fungicides and plant growth regulators |
| 12/10/1980 | EP0019858A2 N-Oximinoalkyl anilides, process for their preparation and their use as fungicides |
| 12/10/1980 | EP0019762A1 Triazolyl derivatives, process for their preparation and plant growth regulation agents containing them |
| 12/10/1980 | EP0019745A1 2-Aminopropanal acetals, their preparation, fungicidal formulations containing them, their preparation and process for combating fungi |
| 12/10/1980 | EP0019742A2 N-(2,5-diazolyl) alkyl-haloacetanilides, processes for their preparation and their use as herbicides |
| 12/09/1980 | US4238617 From hydrazine, an amine and a nitrile |
| 12/02/1980 | US4237142 Combating fungi with 2-carbamoyloxy-3,3-dimethyl-1-phenoxy-1-(1,2,4-tri azol-1-yl)-1-butanes |
| 12/02/1980 | CA1090809A1 Heat developable imaging materials and process |
| 11/26/1980 | EP0019359A1 Agrochemical formulations |
| 11/26/1980 | EP0019189A1 Fungicidal agents, process for their preparation and their use as fungicides |
| 11/26/1980 | EP0019153A1 Carbinol ethers, process for their preparation and fungicides containing them |
| 11/26/1980 | EP0019133A2 Fungicidal agents, process for their preparation and their use as fungicides |
| 11/26/1980 | EP0019131A1 Fluorinated derivatives of 1-triazolyl butane, process for their preparation and their use as fungicides |
| 11/26/1980 | EP0019130A1 Antimycotic agents and process for preparing them |
| 11/25/1980 | US4236014 Production of the ammonium salt of 3,5-dinitro-1,2,4-triazole by solvent extraction |
| 11/25/1980 | US4236013 Benzotriazole ultraviolet stabilizers and their use in organic compositions |
| 11/25/1980 | US4235999 Bichromophoric benzotriazole-styrene ester ultraviolet stabilizers and their use in organic compositions |
| 11/25/1980 | US4235741 Optical brighteners of 2,4-bis-(stilben-4'-yl)-v-triazoles |
| 11/25/1980 | US4235620 Azolyl-substituted unsaturated ketones and herbicidal use thereof |
| 11/12/1980 | EP0018943A1 1-Triazolo-N-(phenyl)-azomethine derivatives, process for their preparation, compositions containing them and their use as pesticides |
| 11/12/1980 | EP0018510A1 N-acylated alpha-naphthyl amines, their preparation and their use as plant fungicides, and plant-fungicidal agents containing them |
| 11/12/1980 | EP0018509A1 N-Allenyl acetanilides, process for their preparation and their use as fungicides |
| 11/11/1980 | US4233440 Optical brighteners |
| 11/11/1980 | US4233311 Antimicrobial agents and their use |
| 11/11/1980 | US4233293 Insecticidal and acaricidal O-alkyl-O-[1-(2-cyanoalkyl)-5-halo-1,2,4-triazol(3)yl]-(thiono)(thiol)-phosphoric(phosphonic) acid esters and ester-amides |