| Patents for C07D 233 - Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings (34,408) |
|---|
| 02/24/1981 | US4252887 Dimers derived from unsymmetrical 2,4,5-triphenylimidazole compounds as photoinitiators |
| 02/24/1981 | US4252819 Antisecretory agents; gastric juice |
| 02/24/1981 | US4252556 Method of increasing plant yield with soil conditioners |
| 02/24/1981 | US4252555 Imidazolinium cationic surfactant |
| 02/24/1981 | CA1096389A1 5-secondary alkylidene hydantoins |
| 02/24/1981 | CA1096388A1 Imidazole derivatives |
| 02/24/1981 | CA1096387A1 Process for the production of polymorph of cimetidine |
| 02/24/1981 | CA1096385A1 5-(indol-3-ylmethylene)-1,3-dimethyl-2-methylimino-4- imidazolidinone |
| 02/24/1981 | CA1096305A1 Clonidine assay |
| 02/19/1981 | WO1981000405A1 Di-cyano-guanidines |
| 02/17/1981 | US4251542 Imino compounds |
| 02/17/1981 | US4251540 Combating crop damaging fungi with α-(4-biphenylyl)-benzyl-azolium salts |
| 02/17/1981 | US4251535 Antiarthritic agents |
| 02/17/1981 | US4251524 β-Lactam antibiotics |
| 02/17/1981 | CA1095910A1 Imidazole carboxylic acids and derivatives thereof |
| 02/17/1981 | CA1095817A1 Compositions for the detection of hydrogen peroxide |
| 02/11/1981 | EP0023651A1 Imidazolyl-enol ethers, process for their preparation and their use as fungicides |
| 02/11/1981 | EP0023614A1 Antimycotic compositions containing imidazolylenol ethers, their preparation and their use |
| 02/11/1981 | EP0023578A1 Aminoalkylbenzene derivatives, process for their preparation and pharmaceutical compositions |
| 02/10/1981 | USRE30511 Enzyme inhibitor, herbicide, cyclization |
| 02/10/1981 | US4250238 Photographic products and processes employing novel dye developer compounds |
| 02/10/1981 | US4250186 Method of slowing heart rate |
| 02/10/1981 | US4250179 N,n-disubstituted carbamoyl imidazole metal salt complexes |
| 02/10/1981 | US4250092 Derivatives of N-cyano-azomethines and process for their preparation |
| 02/05/1981 | WO1981000255A1 Imino-alkyl and amino-nitril cyano-guanidines |
| 02/04/1981 | EP0023335A1 N-Hydroxyalkylimidazoline derivatives, a method for their preparation and their application |
| 02/04/1981 | EP0023308A1 N-acyl-piperidone cetals, process for their preparation and their use as antidotes in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
| 02/04/1981 | EP0023287A1 Antidote for the protection of cultivated plants against damage by herbicides |
| 02/04/1981 | EP0023286A2 Azolyl-alkenols, process for their preparation and their use as fungicides |
| 02/03/1981 | US4249011 Curing agents for addition photopolymerization |
| 02/03/1981 | US4249005 Non-hypnotic anticonvulsive |
| 02/03/1981 | US4248961 Material for color photography |
| 02/03/1981 | US4248956 Photographic products and processes employing heterocyclic azo dye developer compounds |
| 02/03/1981 | US4248881 Imidazolylethoxymethyl derivatives of pyrazole |
| 02/03/1981 | US4248620 Fungicidal and herbicidal 5-haloaminoalkylimino-1,3-imidazolidine-2,4-diones |
| 02/03/1981 | CA1095059A1 Lubricant compositions and anti-wear and friction modifiers employed therein |
| 02/03/1981 | CA1095038A1 Substituted bis-benzimidazolyl compounds; preparation and use thereof |
| 02/03/1981 | CA1095032A1 Mono-deuterated, 15-hydroxyprostaglandins |
| 01/28/1981 | EP0023103A1 Antifungal imidazole derivatives, process for their preparation and pharmaceutical compositions thereof |
| 01/28/1981 | EP0023083A1 Oxodiazole derivatives, processes for their production and pharmaceutical composition containing them |
| 01/28/1981 | EP0023045A1 Imidazolecarboxylic acid derivatives of penicillins and cephalosporins |
| 01/28/1981 | EP0022969A1 Antimycotic compositions containing azolylalkenols and their preparation |
| 01/27/1981 | US4247705 4-Substituted 2-iminoimidazolidine compounds |
| 01/27/1981 | US4247689 Cyclization of the reaction product of a diisocyanate and an amino or hydroxy nitrile by heating |
| 01/27/1981 | US4247558 Pyridyl alkylguanidines |
| 01/27/1981 | US4247300 Imidazoline fuel detergents |
| 01/27/1981 | CA1094567A1 Process for the production of ethylene thiourea |
| 01/27/1981 | CA1094566A1 Imidazoline derivatives |
| 01/27/1981 | CA1094559A1 1-(1,3-dioxolan-2-ylmethyl)-1h-imidazoles and 1h-1,2, 4-triazoles |
| 01/27/1981 | CA1094555A1 Tricyclic compounds |
| 01/22/1981 | WO1981000109A1 Process for preparing imidazole derivatives |
| 01/21/1981 | EP0022446A1 Process for the preparation of biotin esters and biotin |
| 01/20/1981 | US4246393 From an unsaturated dicarboxylic acid and an isocyanate or isothiocyanate having two or more isocyanate or isothiocyanate groups |
| 01/20/1981 | US4246273 1,5-Disubstituted imidazolid-4-ones |
| 01/20/1981 | US4246021 Imidazole derivatives |
| 01/20/1981 | US4246020 Imidazole and triazole compounds, fungicidal and plant growth regulating compositions, method of combating fungal infections in plants and method of regulating plant growth |
| 01/14/1981 | EP0022206A2 Optically pure heterocyclic amino acids, process for their preparation and their use |
| 01/13/1981 | US4245103 From styrene oxide, alkoxyethylamines, nitriles, carbon disulfide |
| 01/13/1981 | US4245102 From imidoyl halides, alkoxyethylamines, carbon disulfide |
| 01/13/1981 | US4245095 Treatment of disorders of the central nervous system |
| 01/13/1981 | US4244964 Fungicides, bactericides |
| 01/13/1981 | US4244957 Hypotensive agents |
| 01/13/1981 | CA1093562A1 Imidazole derivatives |
| 01/08/1981 | WO1981000011A1 Poly(ethylenically unsaturated alkoxy)heterocyclic compounds and crosslinked polymeric coatings |
| 01/07/1981 | EP0022059A2 N-substituted esters of aspartic acid, their preparation and use |
| 01/07/1981 | EP0021345A1 Alpha-azolylglycol derivatives, their preparation, plant growth regulating agents containing them, and their use |
| 01/07/1981 | EP0021076A1 Process for regulating plant growth |
| 01/07/1981 | EP0020970A1 Alpha-chloroacetophenonoxime ethers and process for their preparation |
| 01/07/1981 | EP0020968A1 N,O-acetals of glycolic aldehyde, their preparation and their use as fungicides |
| 01/07/1981 | EP0020859A1 Substituted N-allyl acetanilides, process for their preparation and their use as fungicides |
| 01/07/1981 | EP0020858A1 Cyclic thiaaza compounds, process for their preparation, pharmaceutical preparations containing them and their use |
| 01/07/1981 | EP0020437A1 Haloacetanilides, their preparation and herbicides containing them. |
| 01/06/1981 | US4243814 Process for the chemical catalytic hydrolysis of an α-aminonitrile or of one of the salts thereof |
| 01/06/1981 | US4243670 α-(4-Biphenylyl)-benzyl-azolium salts and their use for combating micro-organisms |
| 01/06/1981 | US4243667 2-Benzhydrylimino-1,3-diazacarbocyclic compounds as inhibitors of gastric secretion |
| 01/06/1981 | US4243405 Fungicidal compounds |
| 01/06/1981 | CA1093015A1 Plastics barrel |
| 12/30/1980 | US4242517 4-methyl-1 -hydroxymethylimidazole and cysteamine in boiling aqueous hydrochloric acid |
| 12/30/1980 | US4242489 Process for preparing polyurethanes |
| 12/30/1980 | US4242355 Dopaminergic activity |
| 12/30/1980 | US4242343 Phenylpiperazine derivatives |
| 12/30/1980 | CA1092605A1 Nitrogenous condensation products |
| 12/23/1980 | USRE30457 Histamine receptor antagonists |
| 12/23/1980 | US4241075 Acaricidal 1-alkylthio-substituted and 1-phenylthio substituted 2-(phenoxyalkyl)-2-imidazolines |
| 12/23/1980 | US4241074 Prostaglandin analogues |
| 12/23/1980 | US4241073 Asthma |
| 12/23/1980 | US4241072 Gastric secretion inhibitory properties |
| 12/23/1980 | US4241060 Nitroimidazoles and compositions thereof |
| 12/23/1980 | US4240957 For use as sedatives, muscle relaxants, hypnotics, anticonvulsants, and tranquilizers |
| 12/23/1980 | CA1092131A1 Imidazole derivatives |
| 12/23/1980 | CA1092130A1 Azolyl-carboxylic acid derivatives and their use as fungicides |
| 12/23/1980 | CA1092129A1 1-azolyl-4-hydroxy-butane derivatives and their use as fungicides and bactericides |
| 12/23/1980 | CA1092128A1 Combatting fungi with 1-(azol-1-yl)-4-halo-1-phenoxy- butan-2-ones and -ols |
| 12/23/1980 | CA1092104A1 Acylated 4-carbamoylimidazolium-5-olates |
| 12/16/1980 | US4239908 N-aralkenyl-N'-cyano-N"-(heterocyclylthioalkyl)-guanidines |
| 12/16/1980 | US4239895 Process for producing 1-hydroxymethylimidazoles |
| 12/16/1980 | US4239768 Method for relieving irritable bowel syndrome symptoms |
| 12/16/1980 | US4239767 Antimycotic diaryloxy-imidazolyl-O,N-acetals |