| Patents for C07D 231 - Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings (25,550) |
|---|
| 04/14/1981 | US4261729 Herbicidal compositions and pyrazole derivatives |
| 04/14/1981 | CA1099259A1 Polycyclic nitrogenous compounds |
| 04/07/1981 | US4260775 Substituted 3-aminopyrazoles |
| 04/07/1981 | US4260632 Adrenergic blocking agents, cardiovascular disorders |
| 04/01/1981 | EP0026034A1 5-Amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole, process for its preparation, herbicidal compositions containing it and their use |
| 04/01/1981 | EP0025889A1 Diagnostic agent for the detection of bilirubin in body fluids and use of a reagent suitable therefor |
| 03/31/1981 | US4259235 Tricyclic nitrogenous compounds having string plant growth regulating properties |
| 03/31/1981 | CA1098527A1 1-amino-lower-alkyl-3,4-diphenyl-1h-pyrazoles |
| 03/24/1981 | US4258047 Pyrazole derivatives, pharmaceutical formulations thereof |
| 03/24/1981 | EP0018991A4 1,5-diazabicyclo(3.3.0)octadienedione derivatives, preparation and use thereof as fluorescent labelling agents. |
| 03/18/1981 | EP0025383A1 Substituted derivatives of cyclopropene, their preparation and use in the synthesis of precursors of dl cis chrysanthemic acid |
| 03/17/1981 | US4256902 Forming an alkaline salt by reacting a hydrazine with a b,b-dichloro-acryloyl chloride, acidifying |
| 03/17/1981 | US4256665 Preparation of β-aminopropionamides |
| 03/17/1981 | CA1097661A1 Pyrazol-1-yl-phenylacetic acids, and processes for their preparation |
| 03/10/1981 | US4255425 Sulphoxides |
| 03/10/1981 | CA1097357A1 Preparation of isotopically labelled aminopyrine |
| 03/03/1981 | US4254267 Mercaptoacyldihydropyrazole carboxylic acid derivatives |
| 03/03/1981 | US4254213 Bis-pyrazolones |
| 02/24/1981 | US4252945 4(1h)-quinolones reacted with hydrazine to form 5-(2-aminophenyl)pyrazoles which are cyclized with phosgene, thiophosgene or ethyl chloroformate |
| 02/24/1981 | US4252720 Pyrazoline compounds |
| 02/24/1981 | CA1096385A1 5-(indol-3-ylmethylene)-1,3-dimethyl-2-methylimino-4- imidazolidinone |
| 02/18/1981 | EP0024038A2 4-Phenyl-5,6,7,8-tetrahydropyrazolo(3,4-b)-(1,5)-diazepin-1H,4H-5,7-diones, process for their preparation and pharmaceutical compositions containing them |
| 02/17/1981 | CA1095907A1 Meso-ionic didehydro derivatives of 1,7-dehydro-1- substituted -3h-pyrazolo [4,3-e]-1,2,4-triazolo [4,3-c]-pyrimidine-3-thiones and 3-ones |
| 02/11/1981 | EP0023773A1 Process for preparing pyrazolo(1,5-c)-quinazoline derivatives and novel intermediates |
| 02/11/1981 | EP0023707A1 Substituted tetraazatricyclic compounds, process for their preparation, their use and medicines containing them |
| 02/11/1981 | EP0023636A1 Pyrazolin-5-on-yl-methyl-(di)thiophosphoric acid esters, process for their preparation and their use as pesticides |
| 02/10/1981 | US4250185 1-(3,5-Dichlorobenzoyl)-3-phenylpyrazolines and their use as mildewicides |
| 02/04/1981 | EP0023326A1 N-Methyl-0-pyrazol(4)yl-carbamic acid esters, process for their synthesis and their use as pesticides |
| 02/04/1981 | EP0023308A1 N-acyl-piperidone cetals, process for their preparation and their use as antidotes in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
| 02/04/1981 | EP0023287A1 Antidote for the protection of cultivated plants against damage by herbicides |
| 02/03/1981 | US4249015 Oxidation of trihaloalcohols |
| 02/03/1981 | US4248881 Imidazolylethoxymethyl derivatives of pyrazole |
| 02/03/1981 | CA1095055A1 Benzamidine derivatives, process for their preparation and applications thereof |
| 01/28/1981 | EP0022906A1 Process for the preparation of pyrazole derivatives |
| 01/27/1981 | CA1094568A1 Process for the preparation of sulfuric acid semi- ester compounds |
| 01/21/1981 | EP0022578A1 Pharmaceutical compositions containing 3-Amino-pyrazoline derivatives |
| 01/21/1981 | EP0022512A1 Azo compounds containing phosphorus, their preparation, and their use as pesticides, as light sensitive materials and as starting materials for the synthesis of pyrazolones |
| 01/20/1981 | US4246272 Treatment of gastic or duodenum ulcers |
| 01/13/1981 | US4245106 Process for the preparation of 1-alkyl-3-aryl-4-pyrazolecarboxylates |
| 01/13/1981 | US4244964 Fungicides, bactericides |
| 01/13/1981 | US4244962 Fungicidal N-(piperidinoacetyl)anilines |
| 01/07/1981 | EP0022078A1 Pyrazolo-quinolines, processes for their production, and pharmaceutical compositions containing them |
| 01/07/1981 | EP0021506A2 New pyrazoline derivatives, method of preparing the new compounds, as well as insecticidal composition on the basis of these new compounds |
| 01/07/1981 | EP0020968A1 N,O-acetals of glycolic aldehyde, their preparation and their use as fungicides |
| 01/07/1981 | EP0020964A1 Process for the preparation of pyrazoles |
| 01/07/1981 | EP0020859A1 Substituted N-allyl acetanilides, process for their preparation and their use as fungicides |
| 01/07/1981 | EP0020437A1 Haloacetanilides, their preparation and herbicides containing them. |
| 01/06/1981 | US4243747 Magenta coupler, 2,5-bis/1*,1*-dimethylbutyl/hydroquinone |
| 01/06/1981 | US4243583 Process for the preparation of azo dyes |
| 12/23/1980 | US4241168 Two-equivalent magenta coupler |
| 12/16/1980 | US4239901 Analgesics, antipyretics, antiinflammatory agents |
| 12/16/1980 | US4239896 5-(Optionally substituted 2-aminophenyl)-1H-pyrazole-3-methanol |
| 12/10/1980 | EP0020077A1 Quaternary pyrazole derivatives, process for their preparation and their use as fungicides and bactericides |
| 12/10/1980 | EP0019760A1 Esters of 3-aryl-5-methyl-pyrazole-4-carboxylic acid, herbicides containing them, process for their preparation and their use |
| 12/10/1980 | EP0019745A1 2-Aminopropanal acetals, their preparation, fungicidal formulations containing them, their preparation and process for combating fungi |
| 12/02/1980 | US4237217 Silver halide emulsion containing two-equivalent magenta coupler |
| 12/02/1980 | CA1090810A1 N,n-dimethyl-0-pyrazolyl-carbamic acid esters and their use as insecticides |
| 11/26/1980 | EP0018991A1 1,5-diazabicyclo(3.3.0)octadienedione derivatives, preparation and use thereof as fluorescent labelling agents |
| 11/25/1980 | US4236005 Antianxiety |
| 11/25/1980 | US4235995 3-Nitropyrazole derivatives |
| 11/25/1980 | CA1090339A1 7-aminoalkyl-3,7-diaryl-3,3a,4,5,6,7-hexahydro-2h- indazoles |
| 11/18/1980 | US4234725 Viricides |
| 11/18/1980 | US4234594 Pyrazolyl amino imidazolines as antihypertensive agents |
| 11/12/1980 | EP0018510A1 N-acylated alpha-naphthyl amines, their preparation and their use as plant fungicides, and plant-fungicidal agents containing them |
| 11/12/1980 | EP0018509A1 N-Allenyl acetanilides, process for their preparation and their use as fungicides |
| 11/11/1980 | US4233129 By reaction of an alkyl ester of an unsaturated acid or ester with diazo-2-propane |
| 11/04/1980 | US4232161 4-[6-(2-Chloro-4-methoxyphenoxy)hexyl]-3,5-diethyl-1-(2-pyridinyl)-1H-pyrazole |
| 11/04/1980 | US4232107 Photographic material suited for use in diffusion transfer photography and method of diffusion transfer photography using such material |
| 11/04/1980 | US4232034 Heterocyclic derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles |
| 11/04/1980 | US4232017 Treatment of psychic disorders and inflammation with fused isoquinolines |
| 10/29/1980 | EP0017850A1 N,N-disubstituted ethylglycine esters, their preparation and use, fungicides containing them and their preparation |
| 10/28/1980 | US4230870 Novel photographic color couplers |
| 10/28/1980 | US4230865 Antihistamines |
| 10/28/1980 | US4230481 Pyrazole derivatives useful as a herbicidal component |
| 10/21/1980 | USRE30420 Pyrazol-5-ones |
| 10/21/1980 | US4229581 Hydrazine carboxamide derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles and 1H-1,2,4-triazoles |
| 10/21/1980 | US4229579 Optical brighteners |
| 10/21/1980 | US4229460 Heterocyclic derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-1,2,4-triazoles having antifungal and antibacterial properties |
| 10/21/1980 | CA1088057A1 Light-sensitive copying compositions and photoinitiators contained therein |
| 10/15/1980 | EP0017066A1 N,N-dimethyl-O-pyrazolyl esters of carbamic acid, process for their preparation and their use as pesticides |
| 10/14/1980 | US4228291 Inhibitors of histamine activity |
| 10/07/1980 | US4226877 Pyrazoles active in the central nervous system |
| 10/07/1980 | US4226874 Antihistamines, antisecretory agents, gastric juice |
| 10/07/1980 | US4226773 Pyrazolyl amino imidazolines as diuretic agents |
| 10/07/1980 | CA1087196A1 1-substituted pyrazoles |
| 10/07/1980 | CA1087189A1 2-phenyl-3-(3'-pyridyl)-isoxazoline compounds |
| 10/07/1980 | CA1086977A1 Pyrazolium salt plant growth regulants |
| 09/30/1980 | CA1086748A1 N-sulphenylated oxime-carbamates and their use as insecticides, acaricides and nematocides |
| 09/30/1980 | CA1086740A1 Piperidinopropyl derivatives and the preparation thereof |
| 09/23/1980 | CA1086309A1 1-acyl-2-cyanoaziridines and the preparation thereof |
| 09/16/1980 | US4223143 Quinazoline derivatives |
| 09/09/1980 | US4221807 Alkanolamine derivatives |
| 09/09/1980 | US4221804 Mercaptoacyldihydropyrazole carboxylic acid derivatives |
| 09/09/1980 | US4221802 Pharmacologically active guanidine compounds for inhibiting H-2 histamine receptors |
| 09/09/1980 | US4221785 Coordination compound of a copper salt and a salicylic acid or its derivative |
| 09/03/1980 | EP0015156A1 Basically-substituted tricyclic pyrazoles, their preparation and their use as antiinflammatory agents |
| 09/03/1980 | EP0014959A1 8-Aryl-5,6,7,8-tetrahydropyrazolo(3,4-b) (1,5)diazepin-1H,4H-5,7-diones, process for their preparation and pharmaceutical compositions containing them |
| 09/03/1980 | EP0014951A2 Heterocyclic oxypropanolamine derivatives, process for their preparation and medicines containing these compounds |