| Patents for C07D 215 - Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems (27,676) |
|---|
| 04/12/2011 | US7923457 Quinoline derivatives |
| 04/12/2011 | US7923446 Biaryl sulfonamides and methods for using same |
| 04/12/2011 | CA2471099C .alpha.-(n-sulphonamido)acetamide derivatives as .beta.-amyloid inhibitors |
| 04/12/2011 | CA2426461C Nitrogen-containing aromatic derivatives |
| 04/07/2011 | WO2011041287A1 Condensed ring pyridine compounds as subtype-selective modulators of sphingosine-1-phosphate-2 (s1p2) receptors |
| 04/07/2011 | US20110082298 Crystal form of quinoline compound and process for its production |
| 04/07/2011 | US20110082132 [4-(1-amino-ehtyl) - cyclohexyl] -methyl-amine and [6-(1-amino-ehtyl) -tetrahydro-pyran-3-yl] -methyl-amine derivatives as antibacterials |
| 04/07/2011 | CA2775587A1 Condensed ring pyridine compounds as subtype-selective modulators of sphingosine-1-phosphate-2 (s1p2) receptors |
| 04/06/2011 | EP2306789A1 Phenyl-pyridine compounds |
| 04/06/2011 | EP2306788A1 Iridium compounds and devices made therewith |
| 04/06/2011 | EP2305649A1 Method for producing 6-aryloxyquinoline derivative and intermediate thereof |
| 04/06/2011 | EP2305636A1 Selective androgen receptor modulators and methods of use thereof |
| 04/06/2011 | EP2303844A1 Styrylquinolines, their process of preparation and their therapeutic uses |
| 04/06/2011 | EP2303015A2 Chemical compounds |
| 04/06/2011 | EP1706371B1 Aryl aniline derivatives as beta2 adrenergic receptor agonists |
| 04/06/2011 | EP1219607B1 Integrase inhibitors containing aromatic heterocycle derivatives |
| 04/06/2011 | CN102001996A Compound for inhibiting growth of tubercle bacillus and preparation method thereof |
| 04/06/2011 | CN101151249B 环戊吡啶及四氢喹啉衍生物 Cyclopentyl and tetrahydro-quinoline derivatives of pyridine |
| 04/05/2011 | US7919625 4-anilino-3-quinolinecarbonitriles for the treatment of chronic myelogenous leukemia (CML) |
| 04/05/2011 | US7919528 Antibiotic; bactericides |
| 04/05/2011 | US7919505 Xinafoate salt of a substituted 5-oxazol-2-yl-quinoline compound |
| 04/05/2011 | CA2475434C Aromatic amino acid derivatives and medicinal compositions |
| 04/05/2011 | CA2344168C Substituted 3-cyanoquinolines as protein tyrosine kinases inhibitors |
| 03/31/2011 | WO2011035434A1 Gallium complex anti microbial compounds, compositions, uses and methods |
| 03/31/2011 | WO2010141074A3 O-glcnac transferase inhibitors and uses thereof |
| 03/31/2011 | WO2010001257A3 Novel solid state forms of laquinimod and its sodium salt |
| 03/31/2011 | US20110077233 C-Met Modulators and Method of Use |
| 03/31/2011 | US20110077221 Selective androgen receptor modulators, analogs and derivatives thereof and uses thereof |
| 03/31/2011 | DE102010030589A1 Agent, useful e.g. for dyeing and optionally simultaneous brightening of keratin fibers, preferably human hair, and increasing skin compatibility of dyes or brightening agent, comprises a cationic compound having a quinolinium salt |
| 03/30/2011 | EP2301934A1 Nitrocatechol derivatives as COMT inhibitors |
| 03/30/2011 | EP2301914A1 7,9-Substituted tetracycline compounds |
| 03/30/2011 | EP2301913A1 7,9-Substituted tetracycline compounds |
| 03/30/2011 | EP2301544A1 Quinoline derivatives as intermediates to mycobacterial inhibitors |
| 03/30/2011 | EP2300005A1 Small molecule inhibitors of botulinum neurotoxins |
| 03/30/2011 | EP1742927B1 Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof |
| 03/30/2011 | EP1277738B1 Condensed heteroaryl derivatives |
| 03/30/2011 | EP0933354B1 Calcium receptor-active compounds |
| 03/30/2011 | CN1876664B Organometallic complex and organic electroluminescent device using the same |
| 03/30/2011 | CN101998951A Acylthiourea compound or salt thereof, and use thereof |
| 03/30/2011 | CN101993416A Quinoline compound and preparation method thereof, medicament combination containing compound and application of compound |
| 03/30/2011 | CN101671302B Production process of enrofloxacin antibacterial drug for fowl and livestock |
| 03/30/2011 | CN101158680B Synthetic method of carbostyrile kind antibiotic multi cluster antigen |
| 03/29/2011 | US7915418 Intermediates and process for the production of optically active quinolonecarboxylic acid derivatives |
| 03/29/2011 | US7915416 Tetrahydroquinolines |
| 03/29/2011 | US7915293 Carbocyclic and heterocyclic sulfonamide derivatives, e.g., N-(2-bromo-5-(trifluoromethoxy)phenyl)-3,5-dichloro-4-(2-chloro-4-nitrophenoxy)benzenesulfonamide and 4-(2-(trifluoromethyl)phenoxy)-1-(3-trifluoromethyl)phenylsulfonyl)piperidine; treating proliferative diseases |
| 03/29/2011 | US7915292 2-{benzyl-[(6-methyl-2-phenyl-quinolin-3-yl)-phenyl-methyl]-amino}-N-(4-methyl-piperazin-1-yl)-acetamide; tuberculosis; antimycobacterial drugs; a tertiary nitrogen atom in the alpha position in the side chain attached to the 3-position of the quinoline nucleus to get fewer enantiomers possible |
| 03/29/2011 | US7915291 Hepatitis C virus inhibitors |
| 03/24/2011 | WO2011034071A1 Process for production of oxidation reaction product of aromatic compound |
| 03/24/2011 | WO2011033470A1 Crystalline form of montelukast sodium |
| 03/24/2011 | WO2011033010A1 4-alkoxy-n- (2-hydroxycarbamoyl-2-piperidinyl-ethyl) -benzamide compounds as selective tace-inhibitors for the treatment of inflammatory diseases |
| 03/24/2011 | WO2011033009A1 N- [2-hydroxycarbamoyl-2- (piperazinyl) ethyl] benzamide compounds, their preparation and their use as tace inhibitors |
| 03/24/2011 | WO2011009095A8 Crystalline forms of n-[3-fluoro-4-({6-(methyloxy)-7-[(3-morpholin-4-ylpropyl)oxy]-quinolin-4-yl}oxy)phenyl]-n'-(4-fluorophenyl)cyclopropane-1, 1-dicarboxamide |
| 03/24/2011 | WO2010070449A3 Highly pure laquinimod or a pharmaceutically acceptable salt thereof |
| 03/24/2011 | CA2771679A1 4-alkoxy-n- (2-hydroxycarbamoyl-2-piperidinyl-ethyl) -benzamide compounds as selective tace-inhibitors for the treatment of inflammatory diseases |
| 03/24/2011 | CA2771168A1 N-[2-hydroxycarbamoyl-2-(piperazinyl)ethyl]benzamide compounds, their preparation and their use as tace inhibitors |
| 03/23/2011 | EP2299785A1 Iridium compounds |
| 03/23/2011 | EP2298746A1 4-amino- quinazoline and quinoline derivatives having an inhibitory effect on signal transduction mediated by tyrosine kinases |
| 03/23/2011 | EP2298732A1 7,9-Substituted tetracycline compounds |
| 03/23/2011 | EP2297131A2 Di-substituted phenyl compounds as phosphodiesterase 10 inhibitors |
| 03/23/2011 | EP2297107A1 Ý4-(1-amino-ethyl) -cyclohexyl¨-methyl-amine and ý6-(1-amino-ethyl) -tetrahydro- pyran-3-yl¨-methyl-amine derivatives as antibacterials |
| 03/23/2011 | EP2297102A1 Heteroaromatic monoamides as orexinin receptor antagonists |
| 03/23/2011 | EP2296654A1 8-hydroxyquinoline derivatives for the treatment of hematological malignancies |
| 03/23/2011 | CN1942436B Lysine based compounds |
| 03/23/2011 | CN101851197B Method for synthesizing and refining quinclorac |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | US7910589 Low hygroscopic aripiprazole drug substance and processes for the preparation thereof |
| 03/22/2011 | CA2498091C Sulfonylamino-acetic acid derivatives |
| 03/22/2011 | CA2400977C Processes for preparing quinoline derivatives and intermediates thereof |
| 03/17/2011 | WO2011030575A1 Therapeutic agent for chronic pain |
| 03/17/2011 | WO2011030213A1 Improved process for the preparation of 7.(4-bromobutoxy) 3,4-dihydrocarbostyril, a precursor of aripiprazole |
| 03/17/2011 | WO2010083414A8 Malate salt of n- (4- { [ 6, 7-bis (methyloxy) quin0lin-4-yl] oxy}phenyl)-n' - (4 -fluorophenyl) cyclopropane-1,1-dicarboxamide, and crystalline forms therof for the treatment of cancer |
| 03/17/2011 | US20110065760 Compounds for the inhibition of rotamases and use thereof |
| 03/17/2011 | US20110065703 Novel agents of calcium ion channel modulators |
| 03/17/2011 | US20110065681 Amide compounds, compositions and uses thereof |
| 03/17/2011 | US20110064811 Solid forms of N-[2,4-BIS(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| 03/17/2011 | US20110061651 Formoterol superfine formulation |
| 03/17/2011 | CA2773253A1 Therapeutic agent for chronic pain |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP2205562B1 1,1,1-trifluoro-2-hydroxy-3-phenylpropane derivatives |
| 03/16/2011 | EP2167470B1 Triazolo [1, 5-a]quinolines as adenosine a3 receptor ligands |
| 03/16/2011 | EP1879866B1 Dihydropyridine derivatives |
| 03/15/2011 | US7906653 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/15/2011 | US7906650 Caspase inhibitors and uses thereof |
| 03/15/2011 | CA2450820C Processes for preparing calcium salt forms of statins |
| 03/15/2011 | CA2426921C Low hygroscopic aripiprazole drug substance and processes for the preparation thereof |
| 03/10/2011 | WO2011027290A1 Antibiotic compounds |
| 03/10/2011 | WO2011026398A1 Synthetic method of montelukast sodium intermediate |
| 03/10/2011 | US20110059979 Piperidine/Cyclohexane Carboxamide Derivatives For Use as Vanilloid Receptor Modulators |
| 03/10/2011 | US20110059972 1,4-naphthoquinones derivatives and therapeutic use thereof |
| 03/10/2011 | US20110059948 Quinoline, naphthalene and conformationally constrained quinoline or naphthalene derivatives as anti-mycobacterial agents |
| 03/10/2011 | CA2772742A1 Antibiotic compounds |
| 03/09/2011 | EP2292621A1 Vasopressin v1a antagonists |
| 03/09/2011 | EP2292620A2 Fused-aryl and heteroaryl derivatives as modulators of metabolism and the prohylaxis and treatment of disorders related thereto |
| 03/09/2011 | EP2292088A1 Mutant receptors and their use in a nuclear receptor-based inducible gene expression system |
| 03/09/2011 | EP2291381A1 Novel 2-substituted quinoline derivatives, and method for preparing same |
| 03/09/2011 | EP2291355A2 Novel tetrahydroquinolines as aromatase inhibitors |
| 03/09/2011 | CN101983961A Preparation method of 5-amino-2-methyl quinoline |
| 03/09/2011 | CN101311166B Tyrosine kinase restraining agent, preparation method thereof and use |
| 03/08/2011 | US7902365 Using a 2-sulfone, 3-carboxylate, 4-oxoquinoline as chemical intermediate ; cyclization |
| 03/08/2011 | US7902227 C-7 isoxazolinyl quinolone / naphthyridine derivatives useful as antibacterial agents |