| Patents for C07D 215 - Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems (27,676) |
|---|
| 03/03/1981 | US4254128 2-Adamantyl hydrazines and biocidal compositions thereof |
| 03/03/1981 | CA1096870A1 4-quinolylamino-benzamide compounds |
| 02/24/1981 | US4252959 Sulfonylhydrazines, metal complexes thereof, and solutions containing such compounds for use in extraction of metal values |
| 02/24/1981 | US4252957 Heterocyclylcarbonyl derivatives of urea |
| 02/24/1981 | US4252945 4(1h)-quinolones reacted with hydrazine to form 5-(2-aminophenyl)pyrazoles which are cyclized with phosgene, thiophosgene or ethyl chloroformate |
| 02/24/1981 | US4252804 Tranquilizers, anticonvulsants, muscle relaxants |
| 02/17/1981 | US4251661 Preparation of 2-trifluoromethyl cinchoninic acids |
| 02/17/1981 | US4251534 Antihypertensive polyfluorohydroxyisopropyl bicyclic and tricyclic carbostyrils |
| 02/17/1981 | CA1095914A1 4-hydroxy-2-quinolinone-3-carboxylic acid compounds |
| 02/17/1981 | CA1095909A1 9-hydroxyhexahydrobenzol¬c| quinolines and intermediates therefor |
| 02/17/1981 | CA1095905A1 2,5-methanobenzo¬g| quinoline-3-carboxylate esters |
| 02/11/1981 | EP0023773A1 Process for preparing pyrazolo(1,5-c)-quinazoline derivatives and novel intermediates |
| 02/10/1981 | CA1095306A1 Hardening photographic protein layers using a 1- sulphonyl-4-amino-pyridinium salt |
| 02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
| 01/28/1981 | EP0022958A1 Urea derivatives for use in the treatment of fat metabolism disorders |
| 01/27/1981 | US4247699 Process for making 2-amino-4-hydroxyquinolines |
| 01/13/1981 | US4245096 Useful as ph indicators of for the detection of ammonia |
| 01/13/1981 | US4244864 Poly(6-oxy-2,2,4-trialkyl-1,2-dihydroquinoline)alkylene compounds as antidegradants for rubber |
| 01/07/1981 | EP0022078A1 Pyrazolo-quinolines, processes for their production, and pharmaceutical compositions containing them |
| 01/07/1981 | EP0020765A1 Medicament against glaucoma |
| 01/06/1981 | CA1093077A1 Preparation process of novel substituted quinoleins |
| 01/06/1981 | CA1093074A1 Substituted oximino anti-ulcer compounds and compositions |
| 12/30/1980 | US4242516 Fluorinated amphoteric surfactants |
| 12/30/1980 | US4242348 Analgesics; antiiflammatory agents |
| 12/23/1980 | US4241068 2-(Pyridyl-amino)-benzoic acids and salts thereof |
| 12/23/1980 | US4241058 Heterocyclics useful as fungicides and fungicidal compositions thereof |
| 12/02/1980 | US4237135 2-(4-Ethyl-1-piperazinyl)-4-phenylquinoline, process for preparation thereof, and composition thereof |
| 12/02/1980 | US4236912 Quinolinyloxyphenoxy and quinolyinylthiophenoxy alkanoic acids and derivatives thereof and methods of herbicidal use |
| 11/25/1980 | US4235931 Antidepressants |
| 11/25/1980 | US4235909 Dopamine antagonists, in the treatment of parkinson's disease |
| 11/25/1980 | US4235908 4-Aminoquinoline derivatives, useful as anti-inflammatory agents |
| 11/25/1980 | CA1090145A1 Extraction recovery of certain metal values |
| 11/18/1980 | US4234585 1,2-Dihydroquinoline-2-one derivatives |
| 11/18/1980 | US4234584 Substituted phenylpiperazine derivatives |
| 11/11/1980 | US4233431 Heat and chemical resistant stabilizers-polycarbonate |
| 11/11/1980 | US4233305 Novel derivatives of 2-(4-quinolinylamino)-5-fluoro-benzoic acids |
| 11/11/1980 | CA1089464A1 Process for the preparation of novel derivatives of 3- quinolein carboxylic acid |
| 11/11/1980 | CA1089459A1 Antihypertensive hexafluorohydroxyisopropyl bicyclic and tricyclic carbostyrils |
| 11/04/1980 | US4232027 1,2-Dihydro-2-oxo-4-phenyl-3-quinolinecarbonitrile derivatives |
| 10/29/1980 | EP0017946A1 Salts of alpha-aminoacetanilides, process for their preparation and their use as plant growth regulators |
| 10/28/1980 | US4230861 Dopamine antagonists |
| 10/28/1980 | CA1088518A1 Cyanomethylthioacetylcephalosporins |
| 10/15/1980 | EP0017477A1 Spiro-quinolone hydantoins, pharmaceutical compositions containing them, and processes for their preparation |
| 10/15/1980 | EP0016978A1 Process for preparing nitriles |
| 10/07/1980 | US4227006 Antithrombotics |
| 10/07/1980 | US4226997 8-Chloro-5,6,7,8-tetrahydro-2-quinolone and 8-bromo-5,6,7,8-tetrahydro-2-quinolone, the hydrochloride or hydrobromide thereof and process for their manufacture |
| 10/07/1980 | US4226766 Alkyl polyphosphate, 2-amino-/2-hydroxyethyl/ketenimine of benzophenone |
| 09/30/1980 | CA1086736A1 Pyrimid-2-one derivatives |
| 09/23/1980 | CA1086322A1 6,7 dialkoxy-2,2-dialkyl-3-chromene compounds |
| 09/23/1980 | CA1086317A1 Aminoalkyl heterocycles |
| 09/17/1980 | EP0015543A1 5,6,7,8-Tetrahydro-2,8-quinoline dione and process for its preparation |
| 09/17/1980 | EP0015505A1 3-Amino-1,2-propane diols, process for their preparation, pharmaceutical compositions containing them and use thereof |
| 09/16/1980 | US4223137 Carbostyril derivatives and process for preparing the same |
| 09/16/1980 | US4223089 Colorimetric analysis |
| 09/09/1980 | US4221815 Benzoic acids, their derivatives and process for preparing them |
| 09/09/1980 | US4221807 Alkanolamine derivatives |
| 09/09/1980 | US4221797 Antiallergens, antihistamines |
| 09/09/1980 | CA1085404A1 Process for the manufacture of new 1-(azacyclic aralkoxyphenyl)-2- or -3-(bis-arylalkylamino)-alkanes |
| 09/02/1980 | US4220779 Intermediates for insecticides, dyestuffs and analgesics |
| 09/02/1980 | US4220646 Heterocyclic compounds |
| 09/02/1980 | CA1084934A1 Process for producing 2,3-cycloalkenopyridines |
| 08/26/1980 | CA1084505A1 Certain sulfonamidoquinolines, metal complexes thereof, and solutions containing such sulfonamidoquinolines and metal complexes |
| 08/26/1980 | CA1084503A1 Substituted decahydroquinolines and their use as ultraviolet light stabilizers |
| 08/20/1980 | EP0014409A1 Process for the preparation of alpha-hydroxy carboxylic-acid amides |
| 08/19/1980 | US4218448 Antihypertensive polyfluorohydroxyisopropyl bicyclic and tricyclic carbostyrils |
| 08/06/1980 | EP0014079A1 Spiro-quinolylhydantoins, process for their preparation and pharmaceutical compositions thereof |
| 08/06/1980 | EP0013894A1 Arylethers, process for their preparation and medicines containing them |
| 08/06/1980 | EP0013788A1 Octahydro-2H-pyrrolo(3,4-g)quinolines, process for their preparation and pharmaceutical compositions containing them |
| 08/06/1980 | EP0013787A1 Octahydro pyrazolo (3,4-g)quinolines, process for their preparation and pharmaceutical compositions containing them |
| 08/05/1980 | US4216284 Color photographic light-sensitive material |
| 08/05/1980 | US4216220 Platelet aggregation inhibiting 2-oxyindoles, their compositions and method of use |
| 08/05/1980 | US4216160 Substituted mercapto acid amides and their use |
| 08/05/1980 | CA1083157A1 N,n'-bis-substituted imidazolin-2-thiones and method of preparing same |
| 07/29/1980 | US4215219 Reagents from phenolic and 8-hydroxyquinolinic aldehyde oximes |
| 07/29/1980 | US4215218 Aniline-rhodium complex |
| 07/29/1980 | US4215119 Vasodilators, antidepressants |
| 07/29/1980 | CA1082711A1 Azanaphthaleneacetic acid derivative |
| 07/29/1980 | CA1082707A1 Antihypertensive aminoquinolines |
| 07/23/1980 | EP0013666A1 Phenanthroline derivatives, process for their preparation and pharmaceutical compositions containing them |
| 07/15/1980 | US4212877 1-Aryloxy-2-hydroxy-3-[(benzimidazolin-one-substituted alkyl)-amino]-propanes and salts thereof |
| 07/09/1980 | EP0012925A1 Quinolon-carboxylic acid derivatives, process for their preparation and pharmaceutical compositions containing them |
| 07/08/1980 | CA1081232A1 5-(3-substituted-2-hydroxypropoxy)-8-substituted-carbostyril and 3,4-dihydrocarbostyril compounds |
| 07/01/1980 | US4210753 Carbostyril compounds |
| 06/25/1980 | EP0012639A2 Quinolein-3-carboxylic acid derivatives, process for their preparation, their use in medicines and pharmaceutical compositions containing them |
| 06/25/1980 | EP0012158A2 Oxime derivatives and their use in the protection of cultivated plants |
| 06/24/1980 | US4209519 4-methyl-6-methoxy-8-aminoquinone derivatives |
| 06/24/1980 | US4209419 Certain sulfonamidoquinolines, metal complexes thereof, and solutions containing such sulfonamidoquinolines and metal complexes |
| 06/10/1980 | US4207341 Hypoglycaemically and hypolipidaemically active derivatives of phenylacetic acid |
| 06/10/1980 | US4207320 Amino-substituted imidazo[1,2-a:3,4-a']diquinolin-15-ium salts compositions and method of use |
| 06/10/1980 | CA1079283A1 2-quinolinyl-1,3-indandione compounds |
| 06/03/1980 | US4206216 Antihypertensive N-heterocyclicalanines |
| 05/27/1980 | CA1078323A1 Acid copper plating baths |
| 05/20/1980 | US4203988 Pyridinyl ureas and pharmaceutical use |
| 05/13/1980 | US4202985 Antifungal and antibacterial agents |
| 05/13/1980 | US4202894 Agriculture |
| 05/13/1980 | US4202892 Fungicides, viricides, antiprotozoa agents, parkinson's disease |
| 05/13/1980 | CA1077506A1 O-(3-amino-2-hydroxy-propyl)-amidoxime derivatives, process for the preparation thereof and pharmaceutical compositions comprising the same |
| 05/13/1980 | CA1077474A1 1-aryloxy-4-amino-2-butanols |
| 05/06/1980 | CA1077040A1 Pharmaceutically active decahydroquinoline derivatives |
| 04/30/1980 | EP0010452A1 Tris-(polyalkoxyalkylated) isocyanurate compounds and their use as functional fluids |