| Patents for C07D 213 - Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members (63,273) |
|---|
| 03/24/2011 | CA2768924A1 Heterocyclic antiviral compounds |
| 03/23/2011 | EP2299785A1 Iridium compounds |
| 03/23/2011 | EP2299510A1 Organic electroluminescent element |
| 03/23/2011 | EP2298779A1 Sulfonamide derivatives as glycokinase activators useful in the treatment of type 2 diabetes |
| 03/23/2011 | EP2298742A1 Phenoxy acetic acids as PPAR delta activators |
| 03/23/2011 | EP2298736A1 Hydrazine-based and carbonyl-based bifunctional crosslinking reagents |
| 03/23/2011 | EP2298732A1 7,9-Substituted tetracycline compounds |
| 03/23/2011 | EP2298728A1 Transfection reagents |
| 03/23/2011 | EP2298332A1 BAFF, inhibitors thereof and their use in the modulation of the B-cell response |
| 03/23/2011 | EP2298311A1 w-Carboxy aryl substituted diphenyl ureas as p38 kinase inhibitors |
| 03/23/2011 | EP2297106A1 Phenoxypyridinylamide derivatives and their use in the treatment of pde4 mediated disease states |
| 03/23/2011 | EP2297105A1 Substituted amides, method of making, and use as btk inhibitors |
| 03/23/2011 | EP2297104A1 2-alkoxy-substituted dicyanopyridines and use thereof |
| 03/23/2011 | EP2297103A1 Hydroxyphenylsulfonamides as antiapoptotic bcl inhibitors |
| 03/23/2011 | EP2297102A1 Heteroaromatic monoamides as orexinin receptor antagonists |
| 03/23/2011 | EP2297091A1 Insecticidal compounds |
| 03/23/2011 | EP2297088A2 New compounds with activity that protects against the action of toxins and viruses in intracellular action mode |
| 03/23/2011 | EP2296653A1 Compounds and methods for treating inflammatory and fibrotic disorders |
| 03/23/2011 | EP1896417B1 Linear urea mimics antagonists of p2y1 receptor useful in the treatment of thrombotic conditions |
| 03/23/2011 | EP1608624B1 6-alkyl or alkenyl-4-aminopicolinates and their use as herbicides |
| 03/23/2011 | EP1140836B1 Amide compounds |
| 03/23/2011 | CN1942436B Lysine based compounds |
| 03/23/2011 | CN101990532A Method for making methylpentamethylene diamine and methylpiperidine |
| 03/23/2011 | CN101602714B Novel method for synthesizing 2-chloronicotinic acid |
| 03/22/2011 | US7910712 Fungal cell wall synthesis gene |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | CA2498091C Sulfonylamino-acetic acid derivatives |
| 03/22/2011 | CA2493036C Process for producing 5-(2'-pyridyl)-2-pyridone derivative |
| 03/22/2011 | CA2432572C Oxybenzamides derivatives as factor xa inhibitors |
| 03/17/2011 | WO2011030873A1 Benzyl compounds |
| 03/17/2011 | WO2011030872A1 Sulfonamide compounds |
| 03/17/2011 | WO2011030865A1 Substituted zenzyl compounds |
| 03/17/2011 | WO2011030864A1 Aniline compounds |
| 03/17/2011 | WO2011030665A1 Novel photosensitizer and photovoltaic device |
| 03/17/2011 | WO2011029827A1 5- (3, 4-dichloro-phenyl) -n- (2-hydroxy-cyclohexyl) -6- (2,2, 2-trifluoro-ethoxy) -nico tinamide and salts thereof as hdl cholesterol raising agents |
| 03/17/2011 | WO2010028776A8 Piperazine derivatives for binding and imaging amyloid plaques and their use |
| 03/17/2011 | US20110065760 Compounds for the inhibition of rotamases and use thereof |
| 03/17/2011 | US20110065759 5-(3,4-dichloro-phenyl)-n-(2-hydroxy-cyclohexyl)-6-(2,2,2-trifluoro-ethoxy)-nicotinamide and salts thereof |
| 03/17/2011 | US20110065745 Polysubstituted 2-aryl-6-phenylimidazo[1,2-a]pyridine derivatives, and preparation and therapeutic use thereof |
| 03/17/2011 | US20110065734 Novel bifunctional compounds which inhibit protein kinases and histone deacetylases |
| 03/17/2011 | US20110065727 POLYSUBSTITUTED DERIVATIVES OF 2-HETEROARYL-6-PHENYLIMIDAZO[1,2-a]PYRIDINES, AND PREPARATION AND THERAPEUTIC USE THEREOF |
| 03/17/2011 | US20110065717 Sulfoximine derivatives as factor xa inhibitors |
| 03/17/2011 | US20110065710 Insecticidal N-(Heteroarylalkyl)Alkanediamine Derivatives |
| 03/17/2011 | US20110065705 Compositions and Methods of Treating Cell Proliferation Disorders |
| 03/17/2011 | US20110065681 Amide compounds, compositions and uses thereof |
| 03/17/2011 | US20110065578 Substituted Pyridin-4-ylmethyl Sulfonamides |
| 03/17/2011 | US20110064657 Labeled inhibitors of prostate specific membrane antigen (psma), biological evaluation, and use as imaging agents |
| 03/17/2011 | US20110061723 Dye sensitised solar cell |
| 03/17/2011 | CA2773997A1 Aniline compound |
| 03/17/2011 | CA2771493A1 5-(3, 4-dichloro-phenyl) -n- (2-hydroxy-cyclohexyl)-6-(2,2, 2-trifluoro-ethoxy) -nicotinamide and salts thereof as hdl cholesterol raising agents |
| 03/16/2011 | EP2295424A1 Processes for the preparation of novel phenylaminopyrimidine derivatives as inhibitors of BCR-ABL kinase |
| 03/16/2011 | EP2295410A1 HDAC inhibitor |
| 03/16/2011 | EP2295407A1 Hydrazine-based and carbonyl-based bifunctional crosslinking reagents |
| 03/16/2011 | EP2295404A2 Substituted tetracycline compounds |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP2295057A1 Aryl urea compounds in combination with other cytostatic or cytotoxic agents for treating human cancers |
| 03/16/2011 | EP2205562B1 1,1,1-trifluoro-2-hydroxy-3-phenylpropane derivatives |
| 03/16/2011 | EP2155683B1 Pyridone derivatives as p38a mapk inhibitors |
| 03/16/2011 | EP1448535B1 Benzamide and heteroarylamide as p2x7 receptor antagonists |
| 03/16/2011 | CN101985443A Ethylenedicysteine (EC)-drug conjugates, compositions and methods for tissue specific disease imaging |
| 03/16/2011 | CN101985434A Method for preparing nicotinic acid |
| 03/16/2011 | CN101985413A Onium salt compound |
| 03/16/2011 | CN101648905B Preparation method of 2- chloro-6-trichloromethyl pyridine |
| 03/16/2011 | CN101565400B Preparation method of 4-amino-3, 5, 6-chloropyridine-2-methanoic acid |
| 03/16/2011 | CN101491520B Local application medicine formulation |
| 03/16/2011 | CN101433835B Mesoporous TiO2 supported V2O5 catalyst with high specific surface area as well as preparation method and use thereof |
| 03/15/2011 | US7906653 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/15/2011 | US7906651 Catalytic system of asymmetric reactions in aqueous media; react a silicon enolate and formaldehyde; catalyst obtained by mixing chiral ligands with scandium triflate |
| 03/15/2011 | US7906650 Caspase inhibitors and uses thereof |
| 03/15/2011 | US7906629 Protease inhibitor conjugates and antibodies useful in immunoassay |
| 03/15/2011 | US7906537 Substituted p-diaminobenzene derivatives |
| 03/15/2011 | US7906517 Trisubstituted amine compound |
| 03/15/2011 | US7906496 Carboxylic acid derivatives |
| 03/15/2011 | US7906235 Pentacyclic anion salts or tetrazapentalene derivatives and their uses as ionic conducting materials |
| 03/15/2011 | CA2471814C Hydroxamic acid derivative and mmp inhibitor containing the same as active ingredient |
| 03/15/2011 | CA2461438C Process for preparation of .alpha.-hydroxycarboxylic acid amides |
| 03/15/2011 | CA2458266C Substituted urea retinoid agonists ii |
| 03/15/2011 | CA2450820C Processes for preparing calcium salt forms of statins |
| 03/15/2011 | CA2232191C Inhibition of tumor necrosis factor alpha |
| 03/10/2011 | WO2011028657A1 Synergistic fungicidal compositions containing a 5-fluoropyrimidine derivative for fungal control in cereals |
| 03/10/2011 | WO2011027888A1 Diamide-phenyl derivative and pharmaceutically acceptable salt thereof |
| 03/10/2011 | WO2011027324A1 Polymorphic forms of atazanavir sulfate |
| 03/10/2011 | WO2011027321A1 Dihalide germanium(ii) precursors for germanium-containing film depositions |
| 03/10/2011 | WO2011027106A1 Therapeutic aryl-am i do-aryl compounds and their use |
| 03/10/2011 | WO2011026959A1 Novel ethane diamine hepcidin antagonists |
| 03/10/2011 | WO2011026781A1 Novel multifunctional peptidase inhibitors, especially for medical use |
| 03/10/2011 | WO2011026193A1 Cytotoxic compounds |
| 03/10/2011 | WO2011007038A3 Use of compounds derived from bis-benzamidines as fluorogenic agents for signalling specific sequencecs of double-strand dna, and novel compounds |
| 03/10/2011 | US20110060019 Heteroaryl-ureas and their use as glucokinase activators |
| 03/10/2011 | US20110059957 Benzene or thiophene derivative and use thereof as vap-1 inhibitor |
| 03/10/2011 | US20110059950 Aniline derivative having anti-rna viral activity |
| 03/10/2011 | US20110059940 2-Aryl Glycinamide Derivatives |
| 03/10/2011 | US20110059939 Therapeutic compounds |
| 03/10/2011 | US20110056562 Photoelectric conversion material, film containing the material, photoelectric conversion device, production method thereof, photosensor, imaging device and their use methods |
| 03/10/2011 | CA2772975A1 Novel multifunctional peptidase inhibitors, especially for medical use |
| 03/10/2011 | CA2772618A1 Fatty acid niacin conjugates and their uses |
| 03/10/2011 | CA2772080A1 Synthesis of a neurostimulative piperazine |
| 03/10/2011 | CA2771097A1 Therapeutic aryl-amido-aryl compounds and their use |
| 03/09/2011 | EP2292630A1 O2-substituted 1- (2-carboxylato)pyrrolidin-1-yl diazen-1-ium-1,2-diolates |
| 03/09/2011 | EP2292608A1 Intermediates for the preparation of substituted Aminosalicylic acid amides with fungicidal activity |