| Patents for C07D 213 - Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members (63,273) |
|---|
| 11/28/2006 | US7141673 ozonation of 2-methyl-5-vinylpyridine, then reducing to 2-methylpyridine-5-carbaldehyde, which is reacted with dialkylamines and cyano compounds to give N,N dialkylamino-(6-methyl-3-pyridyl)-acetonitrile, and then with 4-(methylsulfonyl)benzyl halide to form intermediates of COX-2 inhibitors |
| 11/28/2006 | US7141609 α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| 11/28/2006 | US7141595 Amino benzothiazole compounds with NOS inhibitory activity |
| 11/28/2006 | US7141590 Pharmaceutical uses and synthesis of nicotinanilide-N-oxides |
| 11/28/2006 | US7141586 Nicotinamide derivatives useful as PDE4 inhibitors |
| 11/28/2006 | US7141581 Modulates and/or inhibits tyrosine kinase signal transduction; antiproliferative agents; treating, prevention of cancer and other disease states associated with unwanted angiogenesis and/or cellular proliferation, such as diabetic retinopathy, neovascular glaucoma, rheumatoid arthritis |
| 11/28/2006 | US7141312 Narrow emission bands, low driver voltages, high photometric efficiency and high thermal stability within a broad spectral range; 2,5-bis-(N-(2,4-dimethoxyphenyl)amino)terephthalic acid diethyl ester for example |
| 11/28/2006 | CA2379640C Certain alkylene diamine-substituted heterocycles |
| 11/28/2006 | CA2239138C Process for preparation of a salt of .gamma.-(piperidyl) butyric acid with an acid |
| 11/23/2006 | WO2006125194A2 Piperazine derivatives and their uses as therapeutic agents |
| 11/23/2006 | WO2006123786A1 Cyanine coloring matter and optical recording medium |
| 11/23/2006 | WO2006123726A1 Pharmaceutical composition |
| 11/23/2006 | WO2006123667A1 Monoamine compound, charge-transporting material, and organic electroluminescent device |
| 11/23/2006 | WO2006123229A2 Novel heterocyclic derivatives |
| 11/23/2006 | WO2006123061A2 Fluorene derivatives, composition containing said derivatives and the use thereof |
| 11/23/2006 | WO2006122952A1 2-pyridinylcycloalkylbenzamide derivatives and their use as fungicides |
| 11/23/2006 | WO2006122546A1 Non-peptidic inhibitors of akap/pka interaction |
| 11/23/2006 | WO2006099410A3 Amide derivatives as ion-channel ligands and pharmaceutical compositions and methods of using the same |
| 11/23/2006 | WO2006034004A3 Processes and intermediates for preparing cysteine protease inhibitors |
| 11/23/2006 | US20060264673 Copper-catalyzed formation of carbon-heteroatom and carbon-carbon bonds |
| 11/23/2006 | US20060264642 Mixtures of ionic liquids with lewis acids |
| 11/23/2006 | US20060264641 Process for preparing 3-heteroaryl-3-hydroxypropanoic acid derivatives |
| 11/23/2006 | US20060264640 Process for the preparation of aryl-piridyl compounds |
| 11/23/2006 | US20060264633 Use of manganese, titanium, iron, cobalt, nickel or copper complex compounds having pyrimidinebispyrimidine or triazinebispyrimidine ligands as catalysts for peroxide oxidations involving hard surfaces, waste-printed paper, and papermaking pulp to enhance the action of the peroxides |
| 11/23/2006 | US20060264626 INHIBITORS OF FACTOR Xa AND OTHER SERINE PROTEASES INVOLVED IN THE COAGULATION CASCADE |
| 11/23/2006 | US20060264625 Platinum complex |
| 11/23/2006 | US20060264480 Novel thiocarbamic acid derivatives and the pharmaceutical compositions containing the same |
| 11/23/2006 | US20060264479 Nicotinamide Derivatives Useful as p38 Inhibitors |
| 11/23/2006 | US20060264471 3-(cyclopenten-1-yl)-benzyl-or 3-(cyclopenten-1-yl)-heteroarylmethyl-amine derviatives and use thereof as medicines for treating schizophrenia |
| 11/23/2006 | US20060264445 Compounds Capable of Activating Cholinergic Receptors |
| 11/23/2006 | US20060264435 Novel compounds |
| 11/23/2006 | US20060264434 Chemokine receptor binding heterocyclic compounds |
| 11/23/2006 | US20060264432 Adenosine A1, A2a, and A2b receptor ligands; coupling the 2-mercapto-3,5-dicyano-4-aryl-6-aminopyridine to a substituted alkyl or alkenyl compound; antiischemic agents; cardiovascular disorders |
| 11/23/2006 | DE4245018B4 New alk(en)-yl-terminated liquid crystal cpds. and use as achiral component - for stabilising smectic C phase in chiral tilted smectic medium used in LCD, esp. ferroelectric LCD |
| 11/23/2006 | CA2611896A1 Non-peptidic inhibitors of akap/pka interaction |
| 11/22/2006 | EP1724261A1 Photocharge separation using supramolecular complex of pi-electron type extended viologen derivative and porphyrin |
| 11/22/2006 | EP1724254A2 Novel compositions for the delivery of negatively charged molecules |
| 11/22/2006 | EP1723156A1 Process for the preparation of pyridine derivatives |
| 11/22/2006 | EP1723140A1 Process for the preparation of tryptase inhibitors |
| 11/22/2006 | EP1723132A1 Ep2 receptor agonists |
| 11/22/2006 | EP1723128A1 Heteroaryl-ureas and their use as glucokinase activators |
| 11/22/2006 | EP1722863A1 Microcapsules with uv filter activity and process for producing them |
| 11/22/2006 | EP1521528B1 Malononitrile compounds and their use as pesticides |
| 11/22/2006 | EP1501815B1 Substituted phenylacetamides and their use as glucokinase activators |
| 11/22/2006 | EP1458683B1 Heteroaryl-substituted aminocyclohexane derivatives |
| 11/22/2006 | EP1366008B1 Method for producing monocarbonyl compounds or biscarbonyl compounds or hydroxyl compounds |
| 11/22/2006 | EP1268412B1 Sulphonamido-substituted bridged bicycloalkyl derivatives |
| 11/22/2006 | EP1120114B1 Compositions and methods for treating conditions responsive to estrogen |
| 11/22/2006 | EP1080070B1 Antiangiogenic drug to treat cancer, arthritis and retinopathy |
| 11/22/2006 | EP1066247B1 Inhibitors of serine proteases, particularly hepatitis c virus ns3 protease |
| 11/22/2006 | CN1867823A Method of measuring surface plasmon resonance and noble metal compound for use in the method |
| 11/22/2006 | CN1867563A Novel imidazole derivatives and their use as pharmaceutical agents |
| 11/22/2006 | CN1867561A Novel triarylimidazoles |
| 11/22/2006 | CN1867554A Piperazine with or-substituted phenyl group and their use as GLYT1 inhibitors |
| 11/22/2006 | CN1867551A Phenyl or pyridyl amide compounds as prostaglandin E2 antagonists |
| 11/22/2006 | CN1867550A Compositions and methods for reducing the risk of epileptic occurrence and/or for treatment of seizure disorders |
| 11/22/2006 | CN1865259A Process for preparing piperidine derivative |
| 11/22/2006 | CN1865258A Ortho-substituted aryl amides for controlling invertebrate pests |
| 11/22/2006 | CN1865219A 2- and 2,5-substituted phenylketo-enols |
| 11/22/2006 | CN1285578C Substituted benzoic acid amides and use for inhibition of angiogenesis thereof |
| 11/22/2006 | CN1285572C Cannabinod receptor ligands |
| 11/21/2006 | US7138538 Reagent based on enantiopure amino acid in which amino group carries activating group to form active precursor of isocyanate group and carboxyl group is substituted; separation of enantiomers having free functional group |
| 11/21/2006 | US7138525 Chemical intermediates for their production such as 1-ethyl-2-pyridone-5-carboxylic acid; neuropeptide Y receptor antagonists; for treatment of cardiovascular disorders, glaucoma, and eating disorders |
| 11/21/2006 | US7138432 Arylsulfonamido-substituted hydroxamic acid derivatives |
| 11/21/2006 | US7138418 Pentafluorobenzenesulfonamides and analogs |
| 11/21/2006 | US7138417 Inhibitors of integrin αvβ6 |
| 11/21/2006 | US7138413 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 11/21/2006 | US7138406 Antiinflammatory agents; antiallergens; vision defects; anticancer agents; gastrointestinal disorders |
| 11/21/2006 | US7138400 N-substituted with a methylene-bridged nonaromatic ring system, e.g., N-(2-(benzyloxy)-5,6,7,8,9,10-hexahydro-6,9-methanobenzo(a)(8)annulen-11-yl)-N'-(2,2,2-trifluoroethyl)-sulfamide; preventing or treating Alzheimer's Disease |
| 11/21/2006 | CA2334843C Diarylselenide compounds and their use in human or veterinary medicine and in cosmetics |
| 11/21/2006 | CA2247257C Novel aryl glycinamide derivatives, method of producing said derivatives and pharmaceutical compositions containing these compounds |
| 11/21/2006 | CA2140441C Inhibitors of c-amp phosphodiesterase and tnf |
| 11/21/2006 | CA2120619C Novel potent inducers of terminal differentiation and methods of use thereof |
| 11/16/2006 | WO2006121095A1 Substituted acrylamide derivative and pharmaceutical composition comprising the same |
| 11/16/2006 | WO2006120349A1 Novel phenyl-pyridinyl-piperazine derivatives, a method for the production thereof and pharmaceutical compositions containing said derivatives |
| 11/16/2006 | WO2006120348A1 Novel phenyl-pyridinyl-piperazine derivatives, a method for the production thereof and pharmaceutical compositions containing said derivatives |
| 11/16/2006 | WO2006120133A2 Process for coloring keratin fibers comprising metal complexes |
| 11/16/2006 | WO2006120125A1 Diacylglycerol acyltransferase inhibitors |
| 11/16/2006 | WO2006067103A3 Process for the preparation of a 2-pyridylethylcarboxamide derivative |
| 11/16/2006 | US20060258870 Process for producing bipyridinium compound |
| 11/16/2006 | US20060258866 Carboxylic derivates |
| 11/16/2006 | US20060258859 Histamine receptor antagonists; 4-[3-(4-Piperidin-1-yl-but-1-ynyl)-benzyl]-thiomorpholine; antiallergens, antihistamines, antiepileptic agents; asthma, alzheimer's disease, narcolepsy, motion sickness, attention deficit disorder, schizophrenia |
| 11/16/2006 | US20060258723 Substituted Heteroaryl- and Phenylsulfamoyl Compounds |
| 11/16/2006 | US20060258683 Para-sulfonyl substituted phenyl compounds as modulators of ppars |
| 11/16/2006 | US20060258669 Therapeutic agents useful for treating pain |
| 11/16/2006 | US20060257987 Ppar modulators |
| 11/16/2006 | US20060257613 Metal complexes as light-absorbing compounds in the information layer of optical data carriers |
| 11/16/2006 | CA2608248A1 Soluble epoxide hydrolase inhibitors and methods of using same |
| 11/16/2006 | CA2607298A1 Antineoplastic compounds and pharmaceutical compositions thereof |
| 11/16/2006 | CA2607121A1 Diacylglycerol acyltransferase inhibitors |
| 11/15/2006 | EP1721955A1 Fuel additives and compositions |
| 11/15/2006 | EP1721897A1 Phenylpyridinylpiperazin derivatives, the process to make them and the pharmaceutical compositions containing them |
| 11/15/2006 | EP1721896A1 Phenylpyridinylpiperazin derivatives, the process to make them and the compositions containing them |
| 11/15/2006 | EP1720853A1 Novel polymorphic form of imatinib mesylate and a process for its preparation |
| 11/15/2006 | EP1720847A1 Histamine-3 receptor modulators |
| 11/15/2006 | EP1720834A1 Ionic liquids of heterocyclic amines |
| 11/15/2006 | EP1720829A1 Derivatives of heteroaryl-alkylcarbamates, preparation method thereof and use of same as faah enzyme inhibitors |
| 11/15/2006 | EP1720826A2 Heteroalkyl-substituted biphenyl-4-carboxylic acid arylamide analogues |
| 11/15/2006 | EP1562907B1 Pyridine derivatives as cb2 receptor modulators |
| 11/15/2006 | EP1450799B1 Aryl urea compounds in combination with other cytostatic or cytotoxic agents for treating human cancers |