| Patents for C07D 211 - Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings (37,939) |
|---|
| 11/23/2006 | WO2006123020A1 Peptidomimetics selective for the somatostatin receptor subtypes 1 and/or 4 |
| 11/23/2006 | WO2006122661A1 Heteroaryl-carboxylic acid (sulfamoyl alkyl) amide - derivatives as factor xa inhibitors |
| 11/23/2006 | WO2006110173A3 Novel compounds |
| 11/23/2006 | US20060264673 Copper-catalyzed formation of carbon-heteroatom and carbon-carbon bonds |
| 11/23/2006 | US20060264626 INHIBITORS OF FACTOR Xa AND OTHER SERINE PROTEASES INVOLVED IN THE COAGULATION CASCADE |
| 11/23/2006 | US20060264468 Use of substituted-1, 5-dideoxy-1, 5-imino-D-glucitol compounds for treating hepatitis virus infections |
| 11/23/2006 | US20060264466 N-(1-methylpiperidin-4-yl)-N-(4-flourophenylmethyl)-N-'-(4-(2-methylpropyloxy)phenylmethyl)carbamide ; antipsychotic and anti-dyskinetic; use as novel therapeutics, sometimes in conjunction with other therapeutics, for Parkinson's Disease, related human neurodegenerative diseases, and psychosis |
| 11/23/2006 | US20060264465 N-(1-methylpiperidin-4-yl)-N-(4-flourophenylmethyl)-N-'-(4-(2-methylpropyloxy)phenylmethyl)carbamide ; antipsychotic and anti-dyskinetic; use as novel therapeutics, sometimes in conjunction with other therapeutics, for Parkinson's Disease, related human neurodegenerative diseases, and psychosis |
| 11/23/2006 | US20060264464 Amidino compounds as cysteine protease inhibitors |
| 11/23/2006 | US20060264463 Chemical compounds |
| 11/23/2006 | US20060264416 Phenylcarboxamide beta-secretase inhibitors for the treatment of Alzheimer's disease |
| 11/23/2006 | CA2609288A1 Heteroaryl-carboxylic acid (sulfamoyl alkyl) amide - derivatives as factor xa inhibitors |
| 11/23/2006 | CA2609161A1 Peptidomimetics selective for the somatostatin receptor subtypes 1 and/or 4 |
| 11/22/2006 | EP1724248A1 Process for production of aromatic compounds |
| 11/22/2006 | EP1723140A1 Process for the preparation of tryptase inhibitors |
| 11/22/2006 | EP1723129A1 1-akan-2-ol substituted piperazine and piperidine compounds |
| 11/22/2006 | EP1723115A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723114A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723113A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723112A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723111A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723110A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723109A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723108A1 Biphenyl compounds useful as muscarinic receptor antagonists |
| 11/22/2006 | EP1723102A2 N-substituted benzene sulfonamides |
| 11/22/2006 | EP1722795A1 Piperidinyl prostaglandin e analogs |
| 11/22/2006 | EP1501798A4 SULFONYLAMINOVALEROLAC TAMS AND DERIVATIVES THEREOF AS FACTOR Xa INHIBITORS |
| 11/22/2006 | EP1351933B1 Il-8 receptor antagonists |
| 11/22/2006 | EP1311272B1 Novel methods using cholinesterase inhibitors |
| 11/22/2006 | EP1268412B1 Sulphonamido-substituted bridged bicycloalkyl derivatives |
| 11/22/2006 | EP1238970B1 Cycloamine ccr5 receptor antagonists |
| 11/22/2006 | CN1867549A Cyclopropyl derivatives as NK3 receptor antagonists |
| 11/22/2006 | CN1867542A Process of preparing O-carbamoyl compounds in the presence of active amine group |
| 11/22/2006 | CN1867331A Thalidomide analogs as TNF-alpha modulators |
| 11/22/2006 | CN1867330A N-substituted azacycles |
| 11/22/2006 | CN1865259A Process for preparing piperidine derivative |
| 11/22/2006 | CN1285656C Fluorescent pigment composition |
| 11/22/2006 | CN1285575C Heterocyclic thioesters and ketones |
| 11/21/2006 | US7138533 acetylcholinesterase inhibitory action and an alpha 1 antagonistic action |
| 11/21/2006 | US7138525 Chemical intermediates for their production such as 1-ethyl-2-pyridone-5-carboxylic acid; neuropeptide Y receptor antagonists; for treatment of cardiovascular disorders, glaucoma, and eating disorders |
| 11/21/2006 | US7138524 Processes for preparing anhydrous and hydrate forms of antihistaminic piperidine derivatives, polymorphs and pseudomorphs thereof |
| 11/21/2006 | US7138523 Reacting arecoline or derivative with 4-fluorophenylmagnesium halide Grignard reagent in a solvent (free of diethyl ether solvent) |
| 11/21/2006 | US7138432 Arylsulfonamido-substituted hydroxamic acid derivatives |
| 11/21/2006 | US7138418 Pentafluorobenzenesulfonamides and analogs |
| 11/21/2006 | US7138414 Antidiabetic agents |
| 11/21/2006 | US7138413 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 11/21/2006 | US7138407 Phenyl-piperazine derivatives as serotonin reuptake inhibitors |
| 11/21/2006 | US7138406 Antiinflammatory agents; antiallergens; vision defects; anticancer agents; gastrointestinal disorders |
| 11/21/2006 | US7138400 N-substituted with a methylene-bridged nonaromatic ring system, e.g., N-(2-(benzyloxy)-5,6,7,8,9,10-hexahydro-6,9-methanobenzo(a)(8)annulen-11-yl)-N'-(2,2,2-trifluoroethyl)-sulfamide; preventing or treating Alzheimer's Disease |
| 11/21/2006 | US7138396 Treating androgen-dependent diseases, particularly benign prostatic hyperplasia, with a piperidinyl- or piperazinyl- N-(4-substituted pentamethylene)- or N-(4-substituted iminodiethylene)- acetamide derivative, optionally in combination with an alpha-1 adrenergic antagonist |
| 11/21/2006 | CA2247257C Novel aryl glycinamide derivatives, method of producing said derivatives and pharmaceutical compositions containing these compounds |
| 11/21/2006 | CA2120619C Novel potent inducers of terminal differentiation and methods of use thereof |
| 11/16/2006 | WO2006122238A1 Process for preparing memantine |
| 11/16/2006 | WO2006105035A3 Muscarinic modulators |
| 11/16/2006 | WO2005117882A3 Hydroxamic acid derivatives as metalloprotease inhibitors |
| 11/16/2006 | US20060258859 Histamine receptor antagonists; 4-[3-(4-Piperidin-1-yl-but-1-ynyl)-benzyl]-thiomorpholine; antiallergens, antihistamines, antiepileptic agents; asthma, alzheimer's disease, narcolepsy, motion sickness, attention deficit disorder, schizophrenia |
| 11/16/2006 | US20060258704 2-Oxo-piperidinyl- and 2-oxo-azepanyl alkanoic acid derivatives for the treatment of epilepsy and other neurological disorders |
| 11/16/2006 | US20060258703 Remedy for pruritus comprising piperidine derivative as the active ingredient |
| 11/16/2006 | CA2607257A1 Unsolvated and host-guest solvated crystalline forms of (2e,4s)-4-[(n-{[(2r)-1-isopropylpiperidin-2-yl]-carbonyl}-3-methyl-l-valyl)(methyl)amino]-2,5-dimethylhex-2-enoic acid and their pharmaceutical uses |
| 11/16/2006 | CA2598365A1 Analogs of 4-hydroxyisoleucine and uses thereof |
| 11/15/2006 | EP1720874A1 4-substituted piperidine derivatives |
| 11/15/2006 | EP1720872A1 Aryl and heteroaryl-piperidinecarboxylate derivatives, the preparation and the use thereof in the form of faah enzyme inhibitors |
| 11/15/2006 | EP1720857A1 Dihydropyridinone derivatives |
| 11/15/2006 | EP1720826A2 Heteroalkyl-substituted biphenyl-4-carboxylic acid arylamide analogues |
| 11/15/2006 | EP1720825A1 New compounds, methods for their preparation and use thereof |
| 11/15/2006 | EP1720550A1 Derivatives of piperidinylalkylcarbamates, preparation method thereof and use of same as faah enzyme inhibitors |
| 11/15/2006 | EP1648868B1 Hydroxamate sulfonamides as cd23 shedding inhibitors |
| 11/15/2006 | EP1633703A4 Isotopically labeled chemically stable reagents and process for the synthesis thereof |
| 11/15/2006 | EP1323711B1 Novel phenylalanine derivatives |
| 11/15/2006 | EP1309557B9 Amlodipine hemimaleate |
| 11/15/2006 | CN1863797A Cyclic amine BACE-1 inhibitors having a benzamide substituent |
| 11/15/2006 | CN1863773A 四氢吡啶衍生物 Tetrahydropyridine derivatives |
| 11/15/2006 | CN1863530A (3,4-phenyl)piperidin-3-yl- phenylcarboxylate derivatives and related compounds as beta-secretase inhibitors for the treatment of alzheimer's disease |
| 11/15/2006 | CN1862871A Electrolytic solution and battery |
| 11/15/2006 | CN1861580A Process of extracting lycopdine A from plant |
| 11/15/2006 | CN1861555A Triphenylalkene derivatives and their use as selective estrogen receptor modulators |
| 11/15/2006 | CN1284770C Method for preparing 4-amino-4-phenylpiperidines |
| 11/14/2006 | US7135586 Biphenylcarboxamides useful as lipid lowering agents |
| 11/14/2006 | US7135574 Converting substituted mono or bicyclic lactones in presence of an amine base and a catalytic amount of a cyanide or alkali or alkaline metal alcoholate, to a salt, reacting the salt with carbonyl compound containing an organic substituent |
| 11/14/2006 | US7135571 Processes for preparing anhydrous and hydrate forms of antihistaminic piperidine derivatives, polymorphs and pseudomorphs thereof |
| 11/14/2006 | US7135487 Sulphonamide derivatives |
| 11/14/2006 | US7135483 Substituted heterocyclic compounds for treating multidrug resistance |
| 11/14/2006 | CA2342271C Gem substituted hydroxamic acids |
| 11/14/2006 | CA2244363C Synthetic derivatives of rapamycin as multimerizing agents for chimeric proteins with immunophilin-derived domains |
| 11/14/2006 | CA2128493C Aminobenzoic acid derivatives |
| 11/09/2006 | WO2006118210A1 Method of preventing dihydropyridine compound from degradation |
| 11/09/2006 | WO2006117669A1 Amide resorcinol compounds |
| 11/09/2006 | WO2006117609A2 Phenoxypropylpiperidines and -pyrrolidines and their use as histamine h3 -receptor ligands |
| 11/09/2006 | WO2006117183A1 3 -m0n0- and 3 , 5-disubstituted piperidine derivatives as renin inhibitors |
| 11/09/2006 | WO2006116848A1 Substituted butyrophenone derivatives |
| 11/09/2006 | WO2006040181A3 4-phenylsulfonamidopiperidines as calcium channel blockers |
| 11/09/2006 | WO2006014968A3 Propargyl nitroxydes and indanyl nitroxides and their use for the treatment of neurologic diseases and disorders |
| 11/09/2006 | WO2005013988A8 2-`4(phenylamino)-piperidin-1-yl!-n-phenyl-acetamine derivatives and related compounds as neuropeptide y5 (npy5) ligands for the treatement of obesity |
| 11/09/2006 | US20060252797 Receptor regulator |
| 11/09/2006 | US20060252747 Substitituted 1-piperidin-3-yl-piperidin 4-yl-piperazine derivatives and their use as neurokinin auantagonists |
| 11/09/2006 | CA2606757A1 Substituted butyrophenone derivatives |
| 11/09/2006 | CA2606538A1 3 -m0n0- and 3 , 5-disubstituted piperidine derivatives as renin inhibitors |
| 11/09/2006 | CA2606262A1 Novel histamine h3-receptor ligands and their therapeutic applications |
| 11/09/2006 | CA2605985A1 Amide resorcinol compounds |
| 11/08/2006 | EP1719529A1 Contrast medium for thrombus formation |