| Patents for C07D 207 - Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom (40,304) |
|---|
| 04/14/1981 | US4261895 Hypotensive agents |
| 04/14/1981 | CA1099268A1 Aminoalkyl-furanylalkyl-urea derivatives |
| 04/14/1981 | CA1099267A1 Cyclic derivatives of 1,4-benzoxazine and 1,4- benzothiazine and process for their preparation |
| 04/08/1981 | EP0026640A2 Long lasting agonists and antagonists of LHRH and compositions containing them |
| 04/07/1981 | CA1098911A1 N-(1'-ethyl 2'-oxo 5'-pyrrolidinyl methyl) benzamids, preparation process and use as behaviour modifiers |
| 04/01/1981 | EP0025884A1 4,5-Diaryl-alpha-polyfluoroalkyl-1H-pyrrole-2-methanols and 1-(4,5-diaryl-1H-pyrrol-2-yl)-polyfluoroalkanones, processes for preparing them and pharmaceutical compositions |
| 03/31/1981 | US4259484 Bis-substituted succinamides and their utility as herbicides |
| 03/31/1981 | US4259347 Control of phytopathogens using dinitroaniline compounds |
| 03/31/1981 | US4259345 Thromboxane synthetase enzyme inhibitors |
| 03/31/1981 | US4259238 N-Phenyl amidines |
| 03/24/1981 | US4257954 Indolyl-phenylsulfonyl-phenyl methane |
| 03/17/1981 | US4256822 Electrophotographic plate containing quaternary ammonium salt polymer interlayer |
| 03/17/1981 | US4256761 Antihypertensive amides |
| 03/17/1981 | US4256759 Antiinflammatory agents, antiarthritic agents |
| 03/17/1981 | US4256758 4-Substituted-3-hydroxy-3-pyrroline-2,5-dione inhibitors of glycolic acid oxidase |
| 03/17/1981 | CA1097663A1 Substituted aryl-aliphatic acids |
| 03/17/1981 | CA1097662A1 Process for preparing an optically active benzamide, the optically active benzamide so obtained, and pharmaceutical compositions containing it |
| 03/17/1981 | CA1097637A1 M-phenoxybenzamide derivatives |
| 03/11/1981 | EP0024960A2 Substituted heterocyclic phenoxy amines, their preparation method and their use as local anaesthetics |
| 03/11/1981 | EP0024906A1 Miticidal, insecticidal, ovicidal and fungicidal diarylaminothio derivatives, and preparation, compositions and use thereof |
| 03/11/1981 | EP0024807A1 Benzocycloheptapyrrolealkanoic acids and their derivatives, processes for their preparation and pharmaceutical compositions containing them |
| 03/11/1981 | EP0024796A1 Chiral amino-alcohol complexes and process for their preparation |
| 03/11/1981 | EP0024650A1 Di- and/or oligomerisation of organic heterocyclic compounds containing nitrogen atoms |
| 03/11/1981 | EP0024510A1 Phenoxypropyl amine derivatives, process for their preparation, and pharmaceutical compositions containing them |
| 03/10/1981 | US4255440 Antiallergens, antiulcer agents |
| 03/10/1981 | US4255425 Sulphoxides |
| 03/10/1981 | US4255335 Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid derivatives |
| 03/04/1981 | EP0024382A1 Piperidine derivatives, their preparation and pharmaceutical compositions containing them |
| 03/03/1981 | US4254284 From a 5-vinyl-2-pyrrolidone derivative |
| 03/03/1981 | US4254273 Process for preparing esters of α-methyl-3,4-dihydroxyphenylalanine |
| 03/03/1981 | US4254135 3-Amino-4-hydroxypyrrolidines |
| 03/03/1981 | US4254107 Long-lasting agonists of enkephalin |
| 03/03/1981 | US4254043 Using a trifluoro anhydride |
| 03/03/1981 | US4253979 Having good high temperature properties |
| 02/25/1981 | EP0024112A1 Method for the separation and isolation of conjugated and unconjugated bilirubin, isolated conjugated bilirubin, and reference composition containing same |
| 02/24/1981 | US4252943 Carbamate derivatives of mercaptoacyl hydroxy prolines |
| 02/24/1981 | US4252722 Chemical intermediate |
| 02/24/1981 | US4252542 A crosslinked aminomethylene sulfonic acid; fuel additive; jet fuels |
| 02/18/1981 | EP0024030A1 Pyrrolidine derivatives, processes for their preparation and pharmaceutical compositions containing them |
| 02/18/1981 | EP0023938A1 Preparation of pyrrole-2-acetates |
| 02/17/1981 | US4251626 Silver halide photographic materials containing gelatin reactive antistatic agents |
| 02/17/1981 | US4251542 Imino compounds |
| 02/17/1981 | US4251541 Antidepressants |
| 02/17/1981 | US4251454 Benzylpyrimidines |
| 02/17/1981 | US4251446 Color precursors |
| 02/17/1981 | US4251445 Enzyme conjugates |
| 02/17/1981 | CA1095918A1 Pyrrolidine derivatives |
| 02/17/1981 | CA1095917A1 Method for making organic polycarboxylic acids |
| 02/17/1981 | CA1095913A1 3-amino-2-hydroxypropoxyphenyl derivatives |
| 02/11/1981 | EP0023751A1 Process for producing five, six or seven membered saturated nitrogen containing heterocyclic compounds |
| 02/11/1981 | EP0023649A1 Process for preparing alicyclic isocyanates |
| 02/11/1981 | EP0023578A1 Aminoalkylbenzene derivatives, process for their preparation and pharmaceutical compositions |
| 02/11/1981 | EP0023569A1 Derivatives of carboxylic acids, their preparation and medicaments containing them |
| 02/10/1981 | US4250183 Gastointestinal disorders; diseases of the pancreas, gall bladder, and liver |
| 02/10/1981 | US4250093 Hydrogenation-cyclization of b-, g-, or d-cyano esters using a ruthenium or iron metal catalyst |
| 02/10/1981 | US4250086 Method and composition for preparation of H-SAR-LYS-SAR-GLN-NH2 |
| 02/10/1981 | US4249933 N-ethyl-n-ethyl-bicyclo(2.2.1) hept-2-yl thiocarbamate and a haloacylamide as antagonist; pre- and postemergence herbicides |
| 02/10/1981 | CA1095522A1 Prostaglandin analogues and their preparation |
| 02/10/1981 | CA1095516A1 Process for the preparation of imides |
| 02/10/1981 | CA1095515A1 Process for preparing n-chloroimides |
| 02/04/1981 | EP0023308A1 N-acyl-piperidone cetals, process for their preparation and their use as antidotes in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023306A1 N-(Alpha-chloropropionyl)-1,2,3,4-tetrahydro-quinaldine, process for its preparation and its use as antidote in preventing damage to crops by herbicides |
| 02/04/1981 | EP0023287A1 Antidote for the protection of cultivated plants against damage by herbicides |
| 02/03/1981 | US4249003 Using cyclic alkylene sulfates |
| 02/03/1981 | US4249002 Polycyclic amines and intermediates therefor |
| 02/03/1981 | US4248962 Photographic emulsions, elements and processes utilizing release compounds |
| 02/03/1981 | US4248884 Hypolipemic agents, psychostimulants |
| 02/03/1981 | US4248883 Antihypertension agents |
| 02/03/1981 | US4248865 Novel aminoglycoside derivatives |
| 02/03/1981 | US4248786 Hydroxy-succinimide ester compounds |
| 02/03/1981 | US4248784 Pyrrole-3-acetamides |
| 02/03/1981 | US4248719 Quaternary ammonium salts and lubricating oil containing said salts as dispersants |
| 02/03/1981 | CA1095040A1 N-substituted lactams |
| 01/27/1981 | US4247559 N-substituted maleimides in liquid concentrates |
| 01/27/1981 | US4247549 Piperazine-1-carboxylic acid esters possessing antidepressant or analgesic activity |
| 01/22/1981 | WO1981000108A1 Stabilizers for chlorinated thermoplast |
| 01/21/1981 | EP0022551A1 2-Dihalogenmethylen-3-halogen-3-carboalkoxy-5-oxopyrrolidines, process for their preparation and their use as fungicides, bactericides and algicides |
| 01/20/1981 | US4246269 Antidepressant piperidinones |
| 01/20/1981 | US4246176 Synthesis of 5-aroyl-1-hydrocarbylpyrrole-2-acetic acid |
| 01/20/1981 | US4246175 Synthesis of 5-cyano-1-hydrocarbylpyrrole-2-acetic acid |
| 01/20/1981 | US4246077 Silver complex of 3-pyrroline-2,5-dione or pyrrolidine-2,5-dione |
| 01/20/1981 | CA1094084A1 Halo-substituted 1-loweralkyl-5-aroylpyrrole-2-acetic acid compounds |
| 01/20/1981 | CA1094083A1 3-hydroxy-pyrrolin-2-one derivatives |
| 01/20/1981 | CA1094082A1 3-pyrrolin-2-one-derivatives |
| 01/20/1981 | CA1094080A1 Preparation of maleimides and dimaleimides |
| 01/14/1981 | EP0022408A1 Derivatives of alpha-phenyl-2-pyrrolidine methanol and their salts, process for their preparation, use as medicines and compositions containing them |
| 01/14/1981 | EP0022292A1 Process for the preparation of a 2-pyrrolidone |
| 01/14/1981 | EP0022288A2 Method of sterilizing male anthers in plants, compositions and compounds suitable for use in such a method, and method of producing F1 hybrid seed |
| 01/14/1981 | EP0022219A1 5-Oxo- and 5-Thioxoproline derivatives, process for their production and pharmaceutical compositions containing them |
| 01/13/1981 | US4245097 4-[(Monosubstituted-alkyl) amino] benzoic acids and analogs as hypolipidemic and antiatherosclerotic agents |
| 01/13/1981 | US4244962 Fungicidal N-(piperidinoacetyl)anilines |
| 01/13/1981 | CA1093565A1 Process for preparing pyrrolo-benzoic acid derivatives |
| 01/13/1981 | CA1093564A1 Process for producing 2-pyrrolidone |
| 01/13/1981 | CA1093559A2 Pyridine derivatives |
| 01/13/1981 | CA1093550A1 Cephalosporin derivatives |
| 01/07/1981 | EP0022087A1 Stabilizers for thermoplasts that contain chlorine |
| 01/07/1981 | EP0021883A2 N-acyl-amino acid derivatives and pharmaceutical compositions containing them, intermediates and starting compounds |
| 01/07/1981 | EP0021772A1 Method of preparing 2-oxo- and 2-unsubstituted-hexahydroazepine derivatives |
| 01/07/1981 | EP0021592A1 Phenylsulphonamide derivatives, a process for their preparation and their use as medicines |