| Patents for C07C 43 - Ethers; Compounds having groups, groups or groups (24,599) |
|---|
| 09/07/1993 | US5243110 Dehydrochlorination of 1,1-bis(r-phenyl)-2,2,2-trichloroethanes |
| 09/07/1993 | US5243097 Intermediates for vitamins A & E |
| 09/07/1993 | US5243091 Method for the manufacture and recovery of methyl tertiary butyl ether |
| 09/07/1993 | US5243089 Coatings and adhesives when cured by heat and light; chemical resistance |
| 09/07/1993 | US5243088 1-monodebromination of dibromonaphthalene compounds |
| 09/07/1993 | US5243086 Process for the preparation of diglycerol and/or polyglycerol |
| 09/07/1993 | US5243085 Starting materials for improved radiation hardenable diluents |
| 09/07/1993 | US5243079 For carbon monoxide-ethylene-propylene polymer formation |
| 09/07/1993 | US5243076 Adrenergic stimulant intermediates |
| 09/07/1993 | US5243058 Allyl or propenyl group-containing naphthalene derivatives |
| 09/07/1993 | US5243025 Reaction of perfluoroolefins with bis(silyl) ethers to produce fluorinated compounds |
| 09/07/1993 | US5242936 Phenoxy alkanol esters for treatment of allergic conditions |
| 09/07/1993 | US5242618 Di- and trifluorotolans |
| 09/03/1993 | CA2090535A1 Dioxolane derivatives |
| 09/02/1993 | WO1993017052A1 Fluorinated resins with low dielectric constant |
| 09/02/1993 | WO1993016969A1 Polyfluoroalkylation of aromatic compounds |
| 09/02/1993 | CA2131027A1 Fluorinated resins with low dielectric constant |
| 09/01/1993 | EP0558157A1 Naphthalene compounds |
| 09/01/1993 | EP0557404A1 ANTIVIRAL USE OF A 2,6-DI-t-BUTYLPHENOL COMPOUND SUBSTITUTED IN POSITION 4, PARTICULARLY IN RELATION TO HERPESVIRUSES AND PAPILLOMAVIRUSES. |
| 09/01/1993 | EP0404931B1 Conversion of olefins to ethers |
| 08/25/1993 | EP0556218A1 Local anaesthetic. |
| 08/25/1993 | EP0556174A1 Etherification process. |
| 08/25/1993 | EP0377729B1 Improved methods of using chemiluminescent 1,2-dioxetanes |
| 08/25/1993 | CN1021906C Method for the preparation of ethers |
| 08/24/1993 | US5239112 Reacting vinyl ester and alcohol in solvent having specific dielectric constant using palladium or platinum catalyst |
| 08/24/1993 | US5239055 Process for purifying perfluoro(propylvinylether) |
| 08/24/1993 | US5238602 Electrooptical cells |
| 08/24/1993 | US5238600 Electrooptical cells |
| 08/24/1993 | US5238598 Having trifluoromethyl group; high speed response |
| 08/19/1993 | WO1993016150A1 Composition and method for producing a multiple boiling point ether gasoline component |
| 08/19/1993 | WO1993016029A1 Substituted phenylethenyl compounds having retinoid-like biological activity |
| 08/19/1993 | WO1993016022A1 Palladium catalyzed alkylative cyclization useful in synthesis of vitamin d and analogues |
| 08/19/1993 | DE4205970A1 Novel fluoro:vinylene cpds. - useful as low viscosity components of liq. crystal media e.g. for displays |
| 08/19/1993 | CA2129830A1 Substituted phenylethenyl compounds having retinoid-like biological activity |
| 08/19/1993 | CA2129136A1 Palladium catalyzed alkylative cyclization useful in synthesis of vitamin d and analogues |
| 08/18/1993 | EP0555592A1 Catalytic decomposition of impurities in methyl tertiary butyl ether |
| 08/18/1993 | EP0555265A1 Bicyclo-compounds with an anti-seborrhoeic action |
| 08/18/1993 | EP0555260A1 Process for the production of diaryls. |
| 08/18/1993 | CN1021823C Process for substituted benzodihydropyran compound for treating asthma, arthritis and other diseases |
| 08/17/1993 | US5237109 Reacting tertiary olefins with primary alcohols in presence of acidic ion exchange resin catalyst; yields alkyl tertiary alkyl ethers |
| 08/17/1993 | US5237091 Naphthalene derivatives |
| 08/17/1993 | US5237026 Chemical and heat resistant molding materials |
| 08/17/1993 | US5236663 Reaction-distillation apparatus and its use |
| 08/12/1993 | DE4203719A1 New 2-substd. 1,3,4-tri: and 1,3,4,5-tetra:fluoro-benzene cpds. - used in liquid crystal medium for electro=optical display with positive dielectric anisotropy and wide nematic range |
| 08/11/1993 | CA2079932A1 Catalytic decomposition of peroxide impurities in a methyl tertiary butyl ether recycle stream |
| 08/10/1993 | US5235115 Preparation of 2-alkoxy-6-ethylnaphthalenes |
| 08/10/1993 | US5234918 Certain phosphinyl-oxy-phenyl-methyl-pyridinium-hydroxide inner salts useful as antagonists of PAF |
| 08/05/1993 | WO1993015162A1 Novel refrigerant compositions |
| 08/05/1993 | WO1993015063A1 Uv light stabilizing, antioxidant and colorant compounds |
| 08/05/1993 | CA2126563A1 Novel refrigerant compositions |
| 08/04/1993 | EP0554025A2 Fluorinated cyclobutyl purines and pyrimidines |
| 08/04/1993 | EP0553890A1 Diphenyl heteroalkyl derivatives, their preparation, as well as medicinal and cosmetic preparations prepared therefrom |
| 08/04/1993 | EP0553673A1 N,N-bis-(2-chloroethyl)phosphoric acid diamidates as cytostatics |
| 08/04/1993 | EP0540648A4 Ferroelectric liquid crystal compositions containing chiral haloalkoxy tail units |
| 08/04/1993 | EP0362318B1 2,3-difluorobiphenyls |
| 08/03/1993 | US5233111 Catalytic process for selective alkylation of aromatic hydrocarbons |
| 08/03/1993 | US5233094 Process for the preparation of perfluorinated ethers |
| 08/03/1993 | US5233074 Process for selectively ortho-fluorinating substituted aromatic compounds |
| 08/03/1993 | US5233063 Antilipemic agents |
| 08/03/1993 | US5233058 Partially fluorinated compounds and polymers |
| 08/03/1993 | US5233056 Tocopherol derivatives; decyclizing a tricyclic benzoquinone monometal |
| 08/03/1993 | US5233046 Diarylacetylenes, enamines and acetylenic polymers and their production |
| 08/03/1993 | US5232635 9,10-bis(halo-or phenoxy)-2-haloanthracenes as emitters when reacted with hydrogen peroxide |
| 08/03/1993 | US5232628 Polyadducts of alkylene oxide and styrene oxide with aryl alkanols |
| 08/03/1993 | US5232624 Chiral 1,2-difluorobenzene derivatives |
| 07/28/1993 | EP0525177A4 Unimolecular micelles and method of making the same |
| 07/28/1993 | EP0458965A4 Process for the preparation of vinyl ethers |
| 07/28/1993 | EP0416069B1 New leucotriene b 4 derivatives, a method of preparing them, and their use as drugs |
| 07/28/1993 | EP0292564B1 Process for preparing alkoxyalkyl-substituted phenols |
| 07/28/1993 | CA2088196A1 Fluorinated cyclobutyl purines and pyrimidines |
| 07/27/1993 | US5231220 Derivatives of norbornylane and of dimethanodecahydronaphthylane which can be used for obtaining new polymers |
| 07/27/1993 | US5231196 Calixarene derivatives and process for the preparation thereof |
| 07/27/1993 | US5230829 Phenylcyclohexanes, and a liquid-crystalline medium |
| 07/27/1993 | US5230826 Electrooptics |
| 07/27/1993 | US5230778 Purification of isoflurane by extractive distillation |
| 07/27/1993 | CA1320748C Inclination measuring device and a capsule therefor |
| 07/22/1993 | WO1993014175A1 Compositions useful as refrigerants |
| 07/22/1993 | WO1993014174A1 Compositions useful as refrigerants |
| 07/22/1993 | WO1993014173A1 Compositions useful as refrigerants |
| 07/22/1993 | WO1993009074A3 Chlorination process, alkylation of products of said process and some products thereof |
| 07/22/1993 | CA2126187A1 Compositions useful as refrigerants |
| 07/22/1993 | CA2126186A1 Compositions useful as refrigerants |
| 07/22/1993 | CA2126185A1 Compositions useful as refrigerants |
| 07/21/1993 | CN1021651C Processing of anise camphor with high freezing point |
| 07/20/1993 | US5229426 Ethers useful for controlling pests |
| 07/20/1993 | US5229162 Article having biocompatible surface |
| 07/20/1993 | CA1320503C Process for the production of polyfluorinated ethers |
| 07/14/1993 | EP0550611A1 Process for the production of di-trimethylolpropane. |
| 07/14/1993 | CN1074208A Production of hydrofluorocarbons |
| 07/13/1993 | US5227533 Alk-1-enyl ethers |
| 07/13/1993 | US5227484 Anisotropic compounds having nematic phase and liquid crystal mixtures |
| 07/13/1993 | US5227141 Membrane catalytic reactor comprising heteropolyacid catalyst and polysulfone membrane |
| 07/08/1993 | WO1993013191A1 Cleaning |
| 07/08/1993 | WO1993013089A1 Macrocyclic polyether carboxylic acids |
| 07/08/1993 | WO1993012775A1 Pharmaceutical composition and process for the preparation thereof |
| 07/08/1993 | CA2125776A1 Pharmaceutical composition and process for the preparation thereof |
| 07/07/1993 | EP0487714A4 Selective ethylation of naphthalene compounds |
| 07/07/1993 | CN1073935A Synthesizing method of CYOCTOL |
| 07/06/1993 | US5225608 Sandalwood odorants |
| 07/06/1993 | US5225607 Multistage etherification or dehydrohalogenation and reductive dechlorination |