| Patents for C07C 255 - Carboxylic acid nitriles (27,066) |
|---|
| 12/13/2006 | EP1731503A2 Method for the preparation of benzoyl cyanides |
| 12/13/2006 | EP1729756A2 Novel pharmaceutical compositions |
| 12/13/2006 | EP0738260B2 Pesticides |
| 12/13/2006 | CN1878748A Process of hydrocyanation of unsaturated carboxylic acid derivatives |
| 12/13/2006 | CN1878746A N-substituted p-menthane carbosamided |
| 12/13/2006 | CN1878466A Biphenyl derivative or salt thereof, pest control agent containing the same as active ingredient |
| 12/13/2006 | CN1876624A Method for preparing hexafluoropropane |
| 12/13/2006 | CN1876623A Method for producing 4-cyano -4úº-hydroxy biphenyl |
| 12/13/2006 | CN1876622A Method for producing alkylcyanobiphenyl |
| 12/13/2006 | CN1289539C Supported bis(phosphorus) ligands and their use in the catalysis |
| 12/13/2006 | CN1289471C 3,4-di-substituted cyclobutene-1,2-diones as CXC-chemokine receptor ligands |
| 12/13/2006 | CN1289467C Dibenzylamine compound and medicinal use thereof |
| 12/13/2006 | CN1289072C Aniline derivatives or salts thereof and cytokine prodn inhibitors containing same |
| 12/12/2006 | US7148372 1,1-bis(alkoxycarbonyl)-omega-tert-amino branched chain alkenes or conjugated polyenes; especially for the synthesis of retinoic acid, vitamin A (retinol), retinal, retinonitrile and etretinate |
| 12/12/2006 | US7148255 Amidoacetonitrile compounds |
| 12/12/2006 | US7148227 Fungicidal triazolopyrimidines, methods for producing the same, use thereof for combating harmful fungi and agents containing said substances |
| 12/12/2006 | US7148176 (adamantyl)nP(alkyl)m(1a); (adamantyl)o(Alkyl)qP (alkylene')P(adamantyl)r(alkyl)s , wherein adamantyl bonded to phosphorus atom in position 1, or 2, useful for refining halogenoaromatics |
| 12/12/2006 | US7148055 Process for production of optically active 3-hydroxypentanenitrile |
| 12/12/2006 | US7147757 Method for separating an azepine derivative out of a mixture containing an amine an azepine derivative |
| 12/12/2006 | CA2207583C Process for the production of 2-(substituted benzoyl)1,3 cyclohexanediones |
| 12/07/2006 | US20060276667 N-substituted p-menthane carboxamides |
| 12/07/2006 | US20060276540 Selective androgen receptor modulators |
| 12/07/2006 | US20060276518 Aryl and heteroaryl compounds and methods to modulate coagulation |
| 12/07/2006 | US20060276467 Sodium channel modulators |
| 12/07/2006 | US20060275913 Carbonyl compound scavenger and method of quantifying carbonyl compound using the same |
| 12/06/2006 | EP1727822A1 Novel compounds for modulating cell proliferation |
| 12/06/2006 | EP1727791A1 Polymorphic forms of (1-{3-[3-(4-cyano-3-methoxy-phenyl)ureido]-phenyl}-ethyl)-carbamic acid-2-cyano-1-ethyl-ethyl ester |
| 12/06/2006 | EP1727620A1 C1-symmetric bisphosphine ligands and their use in the asymmetric synthesis of pregabalin |
| 12/06/2006 | CN1875025A Sterically hindered chelate phosphinite-phosphite ligand, catalyst, comprising at least one nickel(0) complex stabilized by said ligand and method for production of nitriles |
| 12/06/2006 | CN1875013A Method for the preparation of citalopram |
| 12/06/2006 | CN1874995A 2-halogen-6-alkyl-phenyl substituted tetramic acid derivatives |
| 12/06/2006 | CN1874992A Resolution of 3-amino alkylnitriles |
| 12/06/2006 | CN1874991A Compound capable of binding S1P receptor and pharmaceutical use thereof |
| 12/06/2006 | CN1874845A Method for producing of nickel(0)/phosphorus ligand complexes |
| 12/06/2006 | CN1874844A Method for the production of nickel(0)-phosphorous ligand complexes |
| 12/06/2006 | CN1872836A Organic semiconductor material, organic semiconductor thin film and organic semiconductor device |
| 12/05/2006 | US7145047 Useful as electro-optical liquid crystal display material; can operate within wide temperature range; high speed response, low voltage driving |
| 12/05/2006 | US7144879 Substituted metal-phthalocyanines, their preparation and the use thereof |
| 12/05/2006 | CA2207572C Process for the production of 2-(substituted benzoyl)-1,3 cyclohexanediones |
| 11/30/2006 | WO2006125778A1 Novel trifluoromethoxy-substituted aryl anilides |
| 11/30/2006 | WO2006092076A3 Carboxylic acid amides provoking a cooling sensation |
| 11/30/2006 | WO2006017409A3 1,3-disubstituted heteroaryl nmda/nr2b antagonists |
| 11/30/2006 | US20060270855 Methods of preparing retroviral proteases inhibitor intermediates |
| 11/29/2006 | EP1725522A1 Aniline derivatives as selective androgen receptor modulators |
| 11/29/2006 | EP1725521A1 Method for the preparation of 3-substituted-3'-hydroxypropionitrile |
| 11/29/2006 | CN1871208A Aralkyl amines as cannabinoid receptor modulators |
| 11/29/2006 | CN1286809C Arylphenyl-substituted cyclic ketoenols compound |
| 11/29/2006 | CN1286803C Process for preparing aminonitrile taking cyanide as additive |
| 11/28/2006 | US7141693 Reacting ester with nitrile in hermetic sealed vessel in presence of base; heating |
| 11/28/2006 | US7141312 Narrow emission bands, low driver voltages, high photometric efficiency and high thermal stability within a broad spectral range; 2,5-bis-(N-(2,4-dimethoxyphenyl)amino)terephthalic acid diethyl ester for example |
| 11/23/2006 | WO2006123767A1 Method for producing asymmetric tetrasubstituted carbon atom-containing compound |
| 11/23/2006 | WO2006123672A1 Method for producing aminoalcohol derivative having biphenyl group |
| 11/23/2006 | US20060264673 Copper-catalyzed formation of carbon-heteroatom and carbon-carbon bonds |
| 11/23/2006 | US20060264653 Aminoacetonitrile derivatives and their use for controlling parasites |
| 11/23/2006 | US20060264652 Process for preparing 4-chloro-3-hydroxybutanoic acid ester |
| 11/23/2006 | US20060264651 Method for hydrocyanating an olefinically unsaturated compound |
| 11/23/2006 | US20060264484 Fc receptor modulating compounds and compositions |
| 11/23/2006 | US20060264435 Novel compounds |
| 11/23/2006 | US20060264416 Phenylcarboxamide beta-secretase inhibitors for the treatment of Alzheimer's disease |
| 11/23/2006 | US20060264356 Increased or improved bioavailability of the active agents for oral, intracolonic, pulmonary, and other routes of administrations |
| 11/23/2006 | CA2608451A1 Method for producing aminoalcohol derivative having biphenyl group |
| 11/22/2006 | EP1724255A1 Process for production of cyclopentenenitrile derivatives |
| 11/22/2006 | EP1724248A1 Process for production of aromatic compounds |
| 11/22/2006 | EP1467982B1 Glucocorticoid mimetics, methods of making them, pharmaceutical formulations containing them, and uses thereof |
| 11/22/2006 | CN1867551A Phenyl or pyridyl amide compounds as prostaglandin E2 antagonists |
| 11/22/2006 | CN1865240A Intramolecular charge transfer chromophore containing triphenylamine group and its synthesis method |
| 11/22/2006 | CN1865239A 4-nor-amyl diphenic acid-3-fluor-4-cyan phenol ester production process |
| 11/22/2006 | CN1865238A Method for preparing 2- chlor-6- dialkoxy benzene nitrile |
| 11/22/2006 | CN1865237A Method for preparing 3- chlor-4- dialkoxy benzene nitrile |
| 11/22/2006 | CN1865236A Method for preparing 2,6- dialkoxy benzene nitrile |
| 11/22/2006 | CN1865219A 2- and 2,5-substituted phenylketo-enols |
| 11/22/2006 | CN1865206A 2,5-diphenyl-1,4-distyyl benzene derivative and its uses in electroluminescent device |
| 11/22/2006 | CN1285570C Process for producing 4'-bromomethyl-2-cyanobiphenyl |
| 11/21/2006 | US7138413 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 11/21/2006 | US7138406 Antiinflammatory agents; antiallergens; vision defects; anticancer agents; gastrointestinal disorders |
| 11/21/2006 | CA2158060C Process for the preparation of .beta.-phenylisoserine derivatives |
| 11/21/2006 | CA2140441C Inhibitors of c-amp phosphodiesterase and tnf |
| 11/21/2006 | CA2126518C Use of phenalkylamines |
| 11/21/2006 | CA2120619C Novel potent inducers of terminal differentiation and methods of use thereof |
| 11/16/2006 | WO2006121391A1 New compounds i |
| 11/16/2006 | WO2006121081A1 High-purity acetonitrile and process for producing the same |
| 11/16/2006 | WO2006120628A2 PROCESS FOR PREPARATION OF ALKYL AND ALCOXYALKYL-α-CYANOACRYLATES BY DEPOLYMERISATION OF POLY(ALKYL-α CYANOACRYLATES) OR POLY(ALCOXYALKYL-α-CYANOACRYLATES) AND ITS USAGE AS TECHNICAL AND/OR MEDICAL ADHESIVE |
| 11/16/2006 | WO2006120144A1 Method for isolating methyl glycine nitrile-n,n-diacetonitriles from an aqueous crude mixture |
| 11/16/2006 | WO2006120125A1 Diacylglycerol acyltransferase inhibitors |
| 11/16/2006 | WO2006119745A2 Method for the production of olefins from carbonyl compounds |
| 11/16/2006 | US20060258878 chemical intermediate organic acid salt of N-[(2'-cyanobiphenyl-4-yl)methyl]-(L)-valine ester for hypotensive agents; treating anxiety, glaucoma and cardiovascular disorders |
| 11/16/2006 | US20060258876 Carbonylation of 3-pentenenitrile to 5-cyanovaleric acid or its corresponding esters |
| 11/16/2006 | US20060258874 in presence of a catalyst mixture containing Ni, a Ni complex with p-tolyl phosphite, Lewis acid, titanium tetraalkoxide or aluminum trialkoxide; improve space-time yield; convert 3-pentenenitrile, 4-pentenenitrile to adiponitrile as chemical intermediate for nylon-6 and nylon-6,6 |
| 11/16/2006 | US20060258873 Method of producing dinitrile compounds |
| 11/16/2006 | US20060257338 For protecting human skin from ultraviolet radiation; sunscreen; mixture of a photoactive compound and a polymer terminated with alpha -cyano acrylates, acrylamides, and/or thioacrylates |
| 11/16/2006 | CA2608183A1 Process for preparation of alkyl and alcoxyalkyl-.alpha.-cyanoacrylates by depolymerisation of poly(alkyl-.alpha.-cyanoacrylates) or poly(alcoxyalkyl-.alpha.-cranoacrylates) and its usage as technical and/or medical adhesive |
| 11/16/2006 | CA2607246A1 Process for isolating methylglycinenitrile-n,n-diacetonitriles from an aqueous crude mixture |
| 11/16/2006 | CA2607121A1 Diacylglycerol acyltransferase inhibitors |
| 11/15/2006 | EP1721892A1 Method for producing cyanophenyl derivatives |
| 11/15/2006 | EP1721891A1 Method for producing cyanophenyl derivatives |
| 11/15/2006 | EP1474127B1 Biphenyl derivatives and their use as antiandrogenic agents |
| 11/15/2006 | EP1401434B1 Modulators of peroxisome proliferator activated receptors (ppar) |
| 11/15/2006 | CN1861567A Triarylamine-based compound for organic electroluminescent device and organic electroluminescent device employing the same |
| 11/15/2006 | CN1284775C Process for producing 3-unsubstituted 5-amino-4-nitrosopyrazole compound, and 2-hydroxyimino-3-oxopropionitrile, 3-hydrazono-2-hydroxyiminopropionitrile compound, and processes for producing these |
| 11/14/2006 | US7135585 Pyrrole derivatives, for controlling plant diseases caused by fungal plant pathogens |