| Patents for C07C 255 - Carboxylic acid nitriles (27,066) |
|---|
| 04/06/2011 | CN1946680B 非核苷逆转录酶抑制剂 Non-nucleoside reverse transcriptase inhibitors |
| 04/06/2011 | CN102007095A Method for producing optically active cyanohydrin compound |
| 04/06/2011 | CN102001967A Method for synthesizing para-cyanobiphenyl |
| 04/05/2011 | US7919648 Lateral α-substituted acrylate compound and polymer thereof |
| 04/05/2011 | US7919647 N-(3-substituted-4-cyano)phenyl-2-hydroxy-2-methyl-3-(4-cyano)phenoxy propamides; spermatogenesis inhibitors, hormone replacement therapy, anticarcinogenic, antiproliferative agents for prostate cancer, apoptotic agents; bone and muscle disorders |
| 04/05/2011 | US7919529 δ-amino-γ-hydroxy-ω-aryl-alkanoic acid amides |
| 04/05/2011 | US7919528 Antibiotic; bactericides |
| 04/05/2011 | CA2475434C Aromatic amino acid derivatives and medicinal compositions |
| 03/31/2011 | WO2011015287A3 Process for the preparation of derivatives of 1-(2-halobiphenyl-4-yl)-cyclopropanecarboxylic acid |
| 03/31/2011 | WO2010123589A3 Chain-selective synthesis of fuel components and chemical feedstocks |
| 03/31/2011 | US20110077407 Functionalized Polymers Using Protected Thiols |
| 03/30/2011 | EP1742927B1 Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof |
| 03/30/2011 | CN101993393A Method for artificially synthesizing cyclopropanecarbonitrile |
| 03/30/2011 | CN101993392A Multi-cyano substituted triphenylamine derivatives and synthesis method and use thereof |
| 03/30/2011 | CN101993391A Method for preparing 2,2-dibromo-2-cyanoacetamide |
| 03/30/2011 | CN101993382A 芳香胺类衍生物或其类似物及其应用 Aromatic amine derivatives or analogues thereof and its application |
| 03/30/2011 | CN101992128A Regeneration method of ammoxidation fluid catalyst |
| 03/30/2011 | CN101992107A Method for preparing catalyst for alkane ammonia oxidation reaction |
| 03/30/2011 | CN101992106A Alkane ammoxidation catalyst |
| 03/30/2011 | CN101992091A Unsaturated nitrile fluid catalyst prepared by ammoxidation and preparation method thereof |
| 03/29/2011 | US7914707 Additive for non-aqueous electrolyte and secondary battery using the same |
| 03/29/2011 | US7914706 Charge transport compositions and electronic devices made with such compositions |
| 03/29/2011 | CA2573315C Benzoic acid derivatives as non-nucleoside reverse transcriptase inhibitors |
| 03/29/2011 | CA2547052C Nitrile compound and its use in pest control |
| 03/29/2011 | CA2489276C Tricyclic steroid hormone nuclear receptor modulators |
| 03/29/2011 | CA2460640C Diaryl ether derivatives, salts thereof and immunosuppressive agents using the same |
| 03/29/2011 | CA2412750C Substituted metal-phthalocyanines, their preparation and the use thereof |
| 03/24/2011 | WO2011034078A1 Glycine compound |
| 03/24/2011 | WO2011033479A1 Novel aldehydes and nitriles from isophorone, and the use thereof in perfumery |
| 03/24/2011 | WO2011032277A1 Quinazolinone derivatives as viral polymerase inhibitors |
| 03/24/2011 | WO2011008725A3 Metal-catalyzed carbon-fluorine bond formation |
| 03/24/2011 | CA2773832A1 Compounds useful against kinetoplastideae parasites |
| 03/24/2011 | CA2773226A1 Novel aldehydes and nitriles from isophorone, and the use thereof in perfumery |
| 03/24/2011 | CA2772689A1 Glycine compound |
| 03/23/2011 | EP2298761A1 HIV inhibiting pyrimidines derivatives |
| 03/23/2011 | EP2298749A1 Process for the preparation of Thioethers |
| 03/23/2011 | EP2298731A1 Amide compound |
| 03/23/2011 | EP2297075A1 Dihydro-iso-ca-4 and analogues: potent cytotoxics, inhibitors of tubulin polymerization |
| 03/22/2011 | US7910770 3-Isopropoxy-7-methoxy-N-(1H-1,2,3,4-tetrazol-5-yl)-1-benzo[b]thiophene-2-carboxamide; autoimmune diseases such as rheumatoid arthritis, immune thrombocytopenia purpura, systemic lupus erythematosus and Crohn's disease |
| 03/22/2011 | US7910766 dehydrogenation of hydrocarbon gases in the presence of heterogeneous halogenation catalysts, to form unsaturated hydrocarbon intermediates, used to form unsaturated carboxylic acids and nitriles |
| 03/22/2011 | US7910735 insecticides or acaricides; claimed intermediates are a 3-alkyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]aniline and a pyrazine-2-carboxylic acid |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/22/2011 | CA2432572C Oxybenzamides derivatives as factor xa inhibitors |
| 03/17/2011 | US20110065939 Method for the separation of acetonitrile from water |
| 03/17/2011 | US20110065937 Method for the separation of intermediates which may be used for the preparation of escitalopram |
| 03/17/2011 | US20110065905 Ligand and metal complex |
| 03/17/2011 | US20110065789 Ester Compound and Use Thereof |
| 03/17/2011 | US20110065762 Methods of use of antiviral compounds |
| 03/17/2011 | US20110065631 Process for preparation of hiv protease inhibitors |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/16/2011 | EP2295400A2 Process of hydrocyanation of unsaturated carboxylic acid derivatives |
| 03/16/2011 | EP2294010A2 Hydrocyanic acid containing bioresource carbon |
| 03/16/2011 | CN201760269U Automatic chlorothalonil discharge device |
| 03/16/2011 | CN101985431A Method for preparing adiponitrile |
| 03/16/2011 | CN101985097A Novel isophthalonitrile carburetor |
| 03/16/2011 | CN101985094A Fluidized bed distribution plate for production of tetrachloro isophthalonitrile |
| 03/16/2011 | CN101985089A Tube-type fluid bed reactor in production of chlorothalonil |
| 03/16/2011 | CN101265215B Method for preparing (S)-citalopram intermediate S-type glycol |
| 03/15/2011 | US7906653 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/15/2011 | US7906235 Pentacyclic anion salts or tetrazapentalene derivatives and their uses as ionic conducting materials |
| 03/10/2011 | WO2011026529A1 Novel antibacterial hydroxyphenyl compound |
| 03/10/2011 | CA2770741A1 Novel antibacterial hydroxyphenyl compound |
| 03/09/2011 | EP2292595A1 Potassium channel modulators |
| 03/09/2011 | EP1873228B1 Polymerizable liquid crystal composition, optical anisotropic material, optical element, and optical head device |
| 03/09/2011 | EP1787983B1 Methods for producing isoindole derivatives |
| 03/09/2011 | EP1786760B1 Separation of 6-aminocapronitrile and hexamethylenediamine from a mixture comprising hexamethylenediamine, 6-aminocapronitrle and tetrahydroazepine |
| 03/09/2011 | EP1716106B1 Production of 3-pentenenitrile from 1,3-butadiene |
| 03/09/2011 | EP1632287B1 Catalyst for oxidation or ammoxidation |
| 03/09/2011 | EP1490412B1 Photoinitiator, novel compound, and photocurable composition |
| 03/09/2011 | CN101039901B Process for making phenoxy benzamide compounds |
| 03/08/2011 | US7902372 Therapy for obesity; using a secondary amino compound |
| 03/08/2011 | US7902224 Tetrahydro-naphthalene derivatives as glucocorticoid receptor modulators |
| 03/08/2011 | US7902112 Fluidized bed catalyst for producing acrylonitrile and process for producing acrylonitrile |
| 03/08/2011 | CA2391304C Methods of blocking an ethylene response in plants using cyclopropene derivatives |
| 03/03/2011 | WO2011024958A1 Acetylene compound and organic phosphor material containing same |
| 03/03/2011 | US20110052696 Dendrimers with interior and exterior functionalities comprising of azide or alkyne groups for post-functionalization by the huisgen click cycloaddition |
| 03/03/2011 | DE19529106B4 Flüssigkristallines Medium und seine Verwendung Liquid-crystalline medium and its use |
| 03/02/2011 | EP2289872A2 Selective androgen receptor modulators and medical uses thereof |
| 03/02/2011 | EP2289868A1 Carboxylic acid compound |
| 03/02/2011 | EP2207421B1 Haloalkylsubstituted aryloxyalkylimidazolines for use as pesticides |
| 03/02/2011 | EP1578715B1 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/02/2011 | CN101982447A Application of O-acylation amino acid and salts thereof as catalysts for asymmetric organic synthesis reaction |
| 03/01/2011 | US7897801 Process for the preparation of dinitriles |
| 02/24/2011 | US20110046334 Synthesis of inimers and hyperbranched polymers |
| 02/24/2011 | US20110046219 (het)aryl-p-quinone derivatives for treatment of mitochondrial diseases |
| 02/24/2011 | US20110046128 Novel compounds advantageous in the treatment of central nervous system diseases and disorders |
| 02/23/2011 | EP2285765A1 Process of preparing derivatives of 1-(2-halobiphenyl-4-yl)-cyclopropanecarboxylic acid |
| 02/23/2011 | EP1828108B1 5-(2,2-dimethyl-cycloprodyl)-3-methyl-pen-2-enenitrile as fragrance and flavour |
| 02/23/2011 | CN1419537B Insecticidal anthranilamides |
| 02/23/2011 | CN101981001A New process for the preparation of cyclohexanecarboxylic acid dericatives |
| 02/22/2011 | US7893292 Merocyanine derivatives for cosmetic use |
| 02/22/2011 | US7893110 Carboxylic acid amides provoking a cooling sensation |
| 02/22/2011 | US7893099 Cyclopentane derivatives |
| 02/17/2011 | US20110040115 Intermediates and process for the preparation of aromatic derivatives of 1-adamantane |
| 02/17/2011 | US20110039851 Ccr10 antagonists |
| 02/17/2011 | US20110039195 Photosensitive transparent resin composition, production method of color filter, and color filter |
| 02/17/2011 | CA2770801A1 Pesticidal carboxamides |
| 02/16/2011 | EP2284151A2 Substituted tetracycline compounds |
| 02/16/2011 | CN101973911A Method for synthesizing anastrozole intermediate-2,2'-(5-methyl-1,3-phenylene)-bis-(2-methyl propionitrile) |
| 02/16/2011 | CN101972672A S-acylation L-cysteine and application of salt thereof as catalyst for asymmetrical organic synthesis reaction |