| Patents for C07C 251 - Compounds containing nitrogen atoms doubly- bound to a carbon skeleton (9,928) |
|---|
| 04/20/2011 | EP2311799A1 4-dedimethylamino tetracycline compounds |
| 04/20/2011 | EP2311798A1 4-dedimethylamino tetracycline compounds |
| 04/20/2011 | EP2311797A1 4-dedimethylamino tetracycline compounds |
| 04/20/2011 | EP2311796A1 4-dedimethylamino tetracycline compounds |
| 04/20/2011 | EP2064218B1 Fluorinated alkoxy-imino catalyst components |
| 04/20/2011 | CN102026981A Method for the regioselective synthesis of 1-alkyl-3-haloalkyl-pyroazole-4-carboxylic acid derivatives |
| 04/20/2011 | CN102026961A Amide compound |
| 04/19/2011 | US7928224 Optically active quaternary ammonium salt having axial asymmetry and process for producing α-amino acid and derivative thereof with the same |
| 04/19/2011 | CA2717464A1 Self-assembled nano-structures |
| 04/14/2011 | US20110086822 Substituted Tetracycline Compounds |
| 04/14/2011 | US20110084230 Process for Synthesizing Organoelemental Compounds |
| 04/13/2011 | EP2307477A2 Novel coordination complexes and process of producing polycarbonate by copolymerization of carbon dioxide and epoxide using the same as catalyst |
| 04/13/2011 | CN1810772B Method of manufacturing cycloalkanone oxime |
| 04/13/2011 | CN102010349A Method for synthesizing 3-chloro-N-acetyliminodibenzyl |
| 04/13/2011 | CN101381368B Ethylenediamine schiff base type sweat fingerprint fluorescent reagent, synthesis and use thereof |
| 04/07/2011 | WO2011041737A2 Gain-of-function bcl-2 inhibitors |
| 04/07/2011 | US20110082064 Amine reaction compounds comprising one or more active ingredient |
| 04/07/2011 | US20110082053 Molecular Rectifiers Comprising Diamondoids |
| 04/06/2011 | EP2305638A1 Asymmetric azine compound and method for producing the same |
| 04/06/2011 | EP2303833A2 Oxime ester photoinitiators |
| 04/06/2011 | CN102001966A Method for synthesizing cyclohexanone-oxime from cyclohexane in one step |
| 03/31/2011 | WO2011017299A3 PROCESS FOR PREPARING A 2-ALKYNYL SUBSTITUTED 5-AMINO-PYRAZOLO-[4,3-e]-1,2,4-TRIAZOLO[1,5-c]PYRIMIDINE |
| 03/31/2011 | WO2010103531A3 A new method for the preparation of cinacalcet and new intermediates thereof |
| 03/31/2011 | US20110077410 Process for the Preparation of 1-Phenyl-1,2,4-triazoles |
| 03/30/2011 | EP2301916A2 4-aminotetracyclines and methods of use thereof |
| 03/30/2011 | EP2301914A1 7,9-Substituted tetracycline compounds |
| 03/30/2011 | EP2301913A1 7,9-Substituted tetracycline compounds |
| 03/30/2011 | EP1742927B1 Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof |
| 03/30/2011 | CN101602820B Synthesis and application of p-methoxyl-containing Schiff base type visible light photosensitizer with conjugated structure |
| 03/29/2011 | CA2489276C Tricyclic steroid hormone nuclear receptor modulators |
| 03/24/2011 | WO2011034839A2 Silicone polyoxamide and silicone polyoxamide-hydrazide copolymers |
| 03/24/2011 | WO2011032277A1 Quinazolinone derivatives as viral polymerase inhibitors |
| 03/24/2011 | US20110071316 Unsymmetrical Ligand Sources, Reduced Symmetry Metal-Containing Compounds, and Systems and Methods Including Same |
| 03/23/2011 | EP2298749A1 Process for the preparation of Thioethers |
| 03/23/2011 | EP2298732A1 7,9-Substituted tetracycline compounds |
| 03/23/2011 | CN101519247B Resource-based method for treating carvone production wastewater |
| 03/22/2011 | US7910770 3-Isopropoxy-7-methoxy-N-(1H-1,2,3,4-tetrazol-5-yl)-1-benzo[b]thiophene-2-carboxamide; autoimmune diseases such as rheumatoid arthritis, immune thrombocytopenia purpura, systemic lupus erythematosus and Crohn's disease |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/17/2011 | US20110065766 Methods of use of antiviral compounds |
| 03/17/2011 | US20110065762 Methods of use of antiviral compounds |
| 03/17/2011 | US20110065622 Novel nitrile and amidoxime compounds and methods of preparation for semiconductor processing |
| 03/16/2011 | EP2295477A1 Polymerizable liquid crystal compounds, polymerizable liquid crystal compositions, liquid crystal polymers and optically anisotropic materials |
| 03/16/2011 | EP2295402A2 Antibacterial agents |
| 03/10/2011 | WO2009106230A3 Method for the regioselective synthesis of 1-alkyl-3-haloalkyl–pyroazole-4-carboxylic acid derivatives |
| 03/10/2011 | US20110060038 Nitrogenated trans-stilbene analogs, method for the obtention and medical applications thereof |
| 03/09/2011 | EP2292608A1 Intermediates for the preparation of substituted Aminosalicylic acid amides with fungicidal activity |
| 03/09/2011 | EP1095128B2 Amine reaction compounds comprising one or more active ingredient |
| 03/08/2011 | US7902231 Anthropodicidal anthranilamides |
| 03/08/2011 | CA2391304C Methods of blocking an ethylene response in plants using cyclopropene derivatives |
| 03/02/2011 | EP2289962A2 Polyurea compositions and compounds for the preparation thereof |
| 03/02/2011 | EP2289871A1 7-substituted tetracycline compounds |
| 03/02/2011 | EP2288597A2 Method for preparing 1,3,4-substituted pyrazol compounds |
| 03/02/2011 | EP1954710B1 Accelerants for the modification of non-natural amino acids and non-natural amino acid polypeptides |
| 03/02/2011 | CN101982170A Amide compound and application thereof in preparing monoamine oxidase inhibitor |
| 02/24/2011 | WO2011020883A1 Enhancers of protein degradation |
| 02/24/2011 | WO2011020579A1 Method for producing 1-phenyl-1,2,4-triazoles |
| 02/24/2011 | US20110041263 Azomethine direct dyes or reduced precursors of azomethine direct dyes obtained from 2-alkylresorcinols, and hair dyeing process using these dyes or precursors |
| 02/24/2011 | US20110041261 Azomethine direct dyes or reduced precursors of these dyes obtained from 2-chloro-3-amino-6-methylphenol, and hair dyeing method starting from these dyes and precursors |
| 02/24/2011 | DE102004036213B4 Nichtglykosidische und nichtpeptidische Selektininhibitoren, deren Herstellung und pharmazeutische Zusammensetzungen Nichtglykosidische and non-peptidic selectin inhibitors, their preparation and pharmaceutical compositions |
| 02/23/2011 | EP2287153A1 Synthesis Of Renin Inhibitors Involving A Cycloaddition Reaction |
| 02/23/2011 | EP2287149A1 Enhancers of protein degradation |
| 02/23/2011 | EP2285836A1 Photoinitiator mixtures |
| 02/23/2011 | EP2049469B1 Process for preparing amidrazones |
| 02/23/2011 | EP1000023B1 Novel nitric oxide-releasing amidine- and enamine-derived diazeniumdiolates, compositions and uses thereof and method of making same |
| 02/22/2011 | US7893288 Poly-halogenated triazapentadiene compositions |
| 02/17/2011 | WO2011019066A1 Method for producing optically active 1-amino-2-vinylcyclopropanecarboxylic acid ester |
| 02/17/2011 | CA2770801A1 Pesticidal carboxamides |
| 02/16/2011 | CN101977890A Process for production of optically active fluoroamine |
| 02/16/2011 | CN101973934A 1,5-disubstituted aryl-1,4-pentadiene-3-ketoxime ether compound and preparation method thereof and insecticidal activity application |
| 02/16/2011 | CN101973910A Method for synthesizing triphenylmethane compounds marked with stable isotopes |
| 02/16/2011 | CN101973898A 2-p-octylphenethyl-2-aminopropylene glycol derivative and application thereof |
| 02/15/2011 | CA2456411C Stilbene derivatives and their use for binding and imaging amyloid plaques |
| 02/10/2011 | WO2011017299A2 PROCESS FOR PREPARING A 2-ALKYNYL SUBSTITUTED 5-AMINO-PYRAZOLO-[4,3-e]-1,2,4-TRIAZOLO[1,5-c]PYRIMIDINE |
| 02/10/2011 | WO2011015416A1 Process for the preparation of pyrazole carboxylic acid amides |
| 02/10/2011 | US20110034732 Process for Production of Optically Active Fluoroamine |
| 02/10/2011 | US20110033393 Hydrazone Compounds and Their Use |
| 02/10/2011 | CA2770144A1 Process for the preparation of pyrazole carboxylic acid amides |
| 02/09/2011 | EP2281861A2 Mixture of organic emission-enabled semiconductors and matrix materials, use of same and electronic components containing same |
| 02/09/2011 | CN101967112A Synthesis method for bis(5-bromosalicylaldehyde) thylenediamine synthetic iron |
| 02/08/2011 | US7884213 Process for the preparation of anastrozole |
| 02/08/2011 | CA2442319C Carboxylic acid derivative and salt thereof |
| 02/08/2011 | CA2403900C Substituted chalcones as therapeutic compounds |
| 02/03/2011 | WO2011013795A1 Metal complex, composition comprising same and light-emitting element using same |
| 02/03/2011 | US20110028756 Use of amidoxime carboxylic acid esters and n-hydroxyguanidine carboxylic acid esters for producing prodrugs |
| 02/01/2011 | US7879492 redox system; lithium batteries; nontoxic; improved electroconductivity |
| 02/01/2011 | CA2477931C O-cyclopropyl-carboxanilides and their use as fungicides |
| 02/01/2011 | CA2461218C Muscarinic agonists |
| 01/27/2011 | WO2011010677A1 Process for producing inorganic acid salt of 2-aminobutylamide |
| 01/27/2011 | US20110021835 Amino acid derivatives used as pharmaceutical substances |
| 01/26/2011 | CN101955445A Process for extracting and washing cyclohexane oxime |
| 01/25/2011 | US7875748 Prepared by reaction of tetraphenylcyclopentadienone with 1,4-diethynyl-2,5-dimethoxybenzene; can be used as a core material for an organic electroluminescence element or other optical devices |
| 01/25/2011 | CA2404125C Sulphonamido-substituted bridged bicycloalkyl derivatives |
| 01/20/2011 | WO2011007877A1 Method for producing optically active epoxy compound, ligand used in the method, complex, method for producing the ligand, and method for producing the complex |
| 01/20/2011 | WO2011007146A1 Herbicidally active 2-(substituted-phenyl)-cyclopentane-1,3-dione derivatives |
| 01/20/2011 | US20110015399 Stable vinamidinium salt and nitrogen-containing heterocyclic ring synthesis using the same |
| 01/20/2011 | CA2767851A1 Herbicidally active 2-(substituted-phenyl)-cyclopentane-1,3-dione derivatives |
| 01/19/2011 | EP2275395A2 Copper-catalyzed formation of carbon-carbon bonds |
| 01/19/2011 | EP1229020B1 Transition metal compound, olefin polymerization catalyst, and method of polymerizing olefin |
| 01/19/2011 | CN1898287B Non-fugitive catalysts containing imine linkages and tertiary amines, and polyurethane products made therefrom |
| 01/19/2011 | CN101952247A Intermediate compounds for the preparation of meso-substituted cyanine, merocyanine and oxonole dyes |