| Patents for C07C 243 - Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes (2,826) |
|---|
| 06/30/1981 | CA1104151A1 Hydrazinium phosphites (fungicides) |
| 06/09/1981 | US4272606 Hydrazide, thioamide |
| 06/03/1981 | EP0029657A2 Pesticidal tetrazines, their use and compositions, processes for their preparation and preparation intermediates |
| 06/02/1981 | US4271307 Bichromophoric benzotriazole-benzoxazole ultraviolet stabilizers and their use in organic compositions |
| 06/02/1981 | CA1102327A1 Tetrazine derivatives |
| 05/26/1981 | CA1101871A1 Long-chain fatty acid amides and hydrazides and cyclopropano analogues thereof, their production and their use as anti-atherosclerotic agents |
| 05/20/1981 | EP0028723A1 Process for the preparation of N,N'-diformyl hydrazine |
| 05/20/1981 | EP0028609A1 Use of chloronitrophenyl derivatives as selective herbicides and new chloronitrophenyl derivatives. |
| 05/12/1981 | US4267175 For use as an antiemetic, and treatment for gastrointestinal disorders |
| 05/12/1981 | CA1100988A1 Phenoxy-alkane carboxylic acids derivatives |
| 05/05/1981 | US4266013 Phenyl or naphthyl hydrazides as fogging agents |
| 04/29/1981 | EP0027645A1 Process for preparing hydrazines |
| 04/29/1981 | EP0027555A1 Process for the preparation of diphenyl ethers |
| 04/14/1981 | US4261997 4-Alkyl-pyrazolo[5,1-b]-quinazolin-9(4H)-ones and anti-allergic compositions containing them |
| 04/14/1981 | US4261996 Pyrazolo[5,1-b]quinazolin-9-(4H)-ones and anti-allergic pharmaceutical compositions containing them |
| 03/25/1981 | EP0025692A1 Quinone derivatives, their production and use |
| 03/25/1981 | EP0025505A2 N.N'-Bis-salicyloyl hydrazine as metal stabilizer |
| 03/03/1981 | US4254128 2-Adamantyl hydrazines and biocidal compositions thereof |
| 02/11/1981 | EP0023569A1 Derivatives of carboxylic acids, their preparation and medicaments containing them |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/03/1981 | US4248800 Manufacture of organic hydrazines |
| 02/03/1981 | US4248783 Steroids having a 3-(4-hydroxyphenyl)pentanedioic acid monohydrazide substituent |
| 02/03/1981 | CA1095042A1 Heterocyclic phenyl ethers and herbicides containing same |
| 01/27/1981 | US4247555 4,9-Dihydro-9-oxo-N-1H-tetrazol-5-yl-pyrazolo[5,1-b]-quinazoline-2-carboxamides and antiallergic compositions and methods using them |
| 01/06/1981 | US4243739 Silver halide photographic light-sensitive material |
| 01/06/1981 | US4243608 Radioimmunoassay, haptens, radioiodination |
| 01/06/1981 | US4243408 Herbicidal N-triazolylmethyl-substituted alpha-haloacetanilide |
| 01/06/1981 | CA1093095A1 Amines |
| 12/30/1980 | US4242273 4-(Monoalkylamino)benzoic acid amides and imidates |
| 12/23/1980 | US4241164 Highly-sensitive high-contrast photographic materials |
| 12/02/1980 | US4237127 Miticides, larvicides, ovicides |
| 11/27/1980 | WO1980002493A1 Herbicides |
| 11/12/1980 | EP0018510A1 N-acylated alpha-naphthyl amines, their preparation and their use as plant fungicides, and plant-fungicidal agents containing them |
| 11/11/1980 | US4233209 Hindered phenol hydrazones and compositions stabilized therewith |
| 11/04/1980 | CA1088946A1 Stabilized polyolefin composition |
| 10/21/1980 | US4229343 Azo dyes from an oxadiazolyl-substituted aniline |
| 10/21/1980 | CA1088097A1 Process for preparing n'-methyl acethydrazide |
| 09/30/1980 | CA1086728A1 Manufacture of 2,1,3-thiadiazin-4-one-2,2-dioxide derivatives |
| 09/03/1980 | EP0015065A1 Pyrazolo (5,1-b) quinazolin-9(4H)-one derivatives, process for their preparation and pharmaceutical compositions containing them |
| 08/12/1980 | US4217364 Quaternary nitrogen-containing aminimides |
| 08/12/1980 | US4217307 Process for the preparation of 2,2'-dichloro-hydrazobenzene |
| 08/05/1980 | US4216162 Novel derivatives of cyclopropanecarboxylic acid useful as intermediates for the preparation of insecticides |
| 08/05/1980 | CA1083174A1 .alpha.-SUBSTITUTED NEGAMYCIN DERIVATIVES AND SYNTHESES |
| 07/22/1980 | CA1082181A1 Benzamide derivatives |
| 06/10/1980 | US4207338 Microbicidal composition |
| 06/03/1980 | CA1078870A1 N-trichloroacetyl-n'-chlorobenzoylhydrazine derivatives |
| 05/29/1980 | WO1980001068A1 3-(2,2,2-trimethylhydrazine)propionate method of obtaining it and use |
| 05/13/1980 | US4202892 Fungicides, viricides, antiprotozoa agents, parkinson's disease |
| 05/13/1980 | US4202827 Process for the production of 1-anthraquinonyl hydrazine |
| 05/06/1980 | US4201785 Anticholesterol agents |
| 04/15/1980 | CA1075712A1 X-ray contrast media |
| 02/20/1980 | EP0007972A1 Process for the preparation of dichloro-hydrazobenzenes by catalytic hydrogenation of monochloro-nitrobenzenes |
| 02/19/1980 | US4189481 Fungicidex, bactericides |
| 02/12/1980 | US4188381 Fungicides hydrazinium phosphites |
| 01/23/1980 | EP0007205A1 Optically active phenethanolamines, their formulations, use and preparation |
| 01/23/1980 | EP0007204A1 Phenethanolamines, their formulations, use and preparation |
| 01/09/1980 | EP0006766A1 Phenethanolamines, their formulations, use and preparation |
| 01/09/1980 | EP0006540A1 N-Dichloroacetyl-1,2,3,4-tetrahydroquinaldine, process for obtaining it, its use for preventing crops from being damaged by herbicides and selective herbicidal compositions based on N-dichloroacetyl-1,2,3,4-tetrahydroquinaldine and herbicidal acetanilides or thiolcarbamates |
| 12/12/1979 | EP0005912A1 Acaricidal, larvicidal and ovicidal tetrazine derivatives and compositions, processes for their preparation and methods of using them |
| 11/20/1979 | US4175203 Interphenylene 11,12-secoprostaglandins |
| 11/20/1979 | US4175184 Reaction of anthranilic acid amide or aminopyridine carboxamide with sulfur trioxide, cyclization |
| 11/14/1979 | EP0005211A2 Process for the preparation of 2,2'-dichlorohydrazobenzene |
| 10/23/1979 | US4172096 Process for the preparation of asymmetric dimethylhydrazine in the presence of hydrazine |
| 10/02/1979 | US4169720 2-[4-(4-Chlorophenoxymethyl)-phenoxy]-propionic acid compounds as herbicides |
| 09/11/1979 | CA1062260A1 N,n-disubstituted alanine derivatives |
| 09/04/1979 | US4166742 Contrasty light-sensitive silver halide material containing a hydrazine derivative and a heterocyclic mercaptan |
| 08/22/1979 | EP0003586A1 Phenoxyacetic acid derivatives, process for their preparation and their application as herbicides |
| 08/22/1979 | EP0003584A1 Phenoxypropanoic acid derivatives, process for their preparation and their use as herbicides |
| 08/14/1979 | CA1060473A1 Bis-naphthoyl hydrazine derivatives |
| 07/31/1979 | CA1059534A1 Process for preparing n', n'-disubstituted acid hydrazides |
| 07/24/1979 | US4162247 Stabilizers for polyethylene and polypropylene |
| 07/11/1979 | EP0002800A1 Optically active alpha-phenoxypropionic acid dervatives |
| 07/11/1979 | EP0002721A2 Process for preparing hydrazines |
| 07/10/1979 | US4160862 1-Acyl-3-(amino-lower-alkyl)indoles |
| 07/10/1979 | CA1058216A1 Production of aluminum salts of n-nitroso-n-alkylhydroxylamines |
| 05/30/1979 | EP0002066A1 2-Adamantyl hydrazines and pharmaceutical compositions containing them |
| 05/30/1979 | EP0002065A1 Methyladamantyl hydrazines, their pharmaceutically acceptable salts and pharmaceutical compositions containing them |
| 05/16/1979 | EP0001804A1 Beta-naphthyl- and beta-tetrahydronaphthylphenyl ethers, process for their preparation and their use as herbicides |
| 05/15/1979 | US4154850 Certain di-(substituted phenoxy) alkanes and hypolipidaemic use thereof |
| 05/01/1979 | CA1053704A1 Process for the manufacture of organic hydrazines |
| 04/17/1979 | US4150235 Antibody inhibitors, hypotensive agents, diuretics, vasodilator |
| 04/03/1979 | CA1051928A1 Process for preparing n,n-dimethylhydrazine |
| 03/13/1979 | US4144260 In the presence of water, an acid and an organic solvent |
| 02/20/1979 | US4140861 Renal disfunction, antibody inhibitors |
| 02/07/1979 | EP0000519A1 Process for the preparation of 2,2'-dichlorohydrazobenzene |
| 01/24/1979 | EP0000390A1 Derivatives of 2-(2,2-Dihalogenvinyl)-3,3-dimethyl-cyclopropane carboxylic acid and process for preparing them |
| 01/23/1979 | US4136256 4-(monoalkylamino)benzoic acid imidates |
| 01/16/1979 | US4134753 Herbicidal agents |
| 12/19/1978 | US4130413 Heterocyclic phenyl ethers and herbicides containing same |
| 11/14/1978 | US4125625 Troponyl-oxamic acid derivatives |
| 10/10/1978 | US4119635 Sedatives, hypnotics, tranquilizers |
| 08/29/1978 | US4110375 Intermediates |
| 08/08/1978 | US4105631 Multichromophoric ultraviolet stabilizers and their use in organic compositions |
| 07/11/1978 | US4100132 Resistance to metal-catalyzed oxidative degradation |
| 05/16/1978 | US4089874 Ultraviolet stabilizers |
| 03/21/1978 | US4080474 Hypolipidaemic compositions |
| 01/31/1978 | US4071633 Fungicidal N-trichloroacetyl-N'-chlorobenzoylhydrazine derivatives |
| 01/03/1978 | US4066698 Process for the manufacture of organic hydrazines |
| 12/27/1977 | US4065495 δ-Substituted negamycin derivatives and syntheses |
| 12/20/1977 | US4064349 Novel 2-hydroxynaphthalene-1-aldehydes, process for preparing them and their use |