| Patents for C07C 217 - Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton (13,958) |
|---|
| 01/24/2007 | CN1296331C Method of deuterating aromatic ring |
| 01/23/2007 | US7167353 Ionic liquid, method of dehydration, electrical double layer capacitor, and secondary battery |
| 01/23/2007 | US7166746 Fungicides for controlling and preventing an infestation of crop plants by phytopathogenic microorganisms; 2-hydroxy-N-[trans-2-(3-methoxy-4-prop-2-ynyloxy-phenyl)-cyclohexyl]-2-phenyl-acetamide |
| 01/23/2007 | US7166745 Acyclic and macrocyclic, aliphatic diammonium surfactants for use in forming lipid aggregates for drug delivery of macromolecules; improved versatility among different cell types and broadened range of molecules to be carried |
| 01/23/2007 | CA2257362C Process for the selective alkylation of epoxy-alcohols |
| 01/18/2007 | WO2007006132A1 An efficient method for preparing 3-aryloxy-3- arylpropylamines and their optical stereoisomers |
| 01/17/2007 | CN1896043A Diphenylether compound, its preparation and use |
| 01/17/2007 | CN1295307C Friction modifier alkoxyamine salts of carboxylic acids as additives for fuel compsns. and methods of use thereof |
| 01/17/2007 | CN1295221C Substituted heterocyclic compounds |
| 01/17/2007 | CN1295200C 2-butyl-3-(4-[3-(dibutylamino) propoxy] benzoyl)-5-nitro-benzofuran hydrochloride and preparation thereof |
| 01/16/2007 | US7164027 Aralkyl ester soft drugs |
| 01/16/2007 | CA2257234C Compounds active at a novel site on receptor-operated calcium channels useful for treatment of neurological disorders and diseases |
| 01/16/2007 | CA2221397C Process for the production of aromatic halogen-amino compounds |
| 01/11/2007 | WO2007005643A2 Novel aryloxyphenylpropanamines |
| 01/11/2007 | WO2007005583A1 Compounds for preparing immunological adjuvant |
| 01/11/2007 | WO2006083692A3 Methods of identifying modulators of bromodomains |
| 01/11/2007 | US20070010494 Amino-propanol derivatives as sphingosine-1-phosphate receptor modulator |
| 01/11/2007 | CA2611721A1 Compounds for preparing immunological adjuvant |
| 01/10/2007 | EP1740552A1 2- ( arylalkoxy ) -1- phenylethylamine derivatives as nk1 antagonist and serotonin reuptake inhibitors |
| 01/10/2007 | EP1740522A2 Bisphenyl compounds useful as vitamin d sb 3 /sb receptor agonists |
| 01/10/2007 | CN1894306A Modified alkoxylated polyol compounds |
| 01/10/2007 | CN1894200A Omega substituted naphthyloxy-amino alkane den-ivative used as anti-hyperglycaemia agent and its preparation therefor |
| 01/10/2007 | CN1891682A Method for preparing 3-aryloxy-3-aryl propylamine |
| 01/10/2007 | CN1294121C Substituted anilide derivatives, intermediates thereof, agricultural and horticultural chemicals and their usage |
| 01/09/2007 | US7161038 Reacting a glycerol-initiated polyoxyalkylene triol with ammonia and hydrogen in the presence of ruthenium supported on alumina, silica, silica-alumina, titanium dioxide or titanium dioxide-silica |
| 01/09/2007 | US7160507 Using a quaternary ammonium compound containing ether groups |
| 01/08/2007 | CA2511683A1 An efficient method for preparing 3-aryloxy-3-arylpropylamines and their optical stereoisomers |
| 01/04/2007 | WO2007000334A1 Phenyl-pyrazole derivatives as non-steroidal glucocorticoid receptor ligands |
| 01/04/2007 | US20070004718 Ion channel modulating compounds and uses thereof |
| 01/04/2007 | US20070003788 Organic electroluminescence device |
| 01/04/2007 | DE102005031041A1 Isomerizing water-soluble salts of trans-tramadol, useful for preparing the cis-isomer, a known analgesic, comprises treatment with warm water in presence of acid catalyst |
| 01/03/2007 | EP1737812A1 Methods of amination |
| 01/03/2007 | EP0706982B1 Method of separating optical isomers |
| 01/03/2007 | CN1293063C Substituted heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them |
| 01/03/2007 | CN1293054C Processes for preparation of bicyclic compounds and intermediates therefor |
| 01/02/2007 | US7157581 Monocyclic compounds and their use in medicine: process for their preparation and pharmaceutical compositions containing them |
| 01/02/2007 | US7157488 N-(2-(6-Fluoro-1H-indol-3-yl)ethyl)-3-(2,2,3,3-tetrafluoropropoxy)benzylamine; treating schizophrenia, anxiety, Alzheimer's disease, and cognitive disorders |
| 12/28/2006 | WO2006136063A1 Aporphine and secoaporphine compounds for treatment of diabetes |
| 12/27/2006 | EP1736464A1 Quaternary ammonium compound, process for producing the same, therapeutic agent for cerebrovascular disorder, and therapeutic agent for heart disease |
| 12/27/2006 | EP1735268A1 Opioid receptor antagonists |
| 12/27/2006 | EP1735267A1 Aminoalkyl substituted esters and amides of fumaric acid for neutralising malodor |
| 12/27/2006 | CN1884265A Aporphine for treating diabetes mellitus and aporphine compounds |
| 12/27/2006 | CN1884251A Method for refining bevantolol hydrochloride |
| 12/27/2006 | CN1291970C Method for preparing combretastatins |
| 12/26/2006 | US7154737 Nonaqueous electrolyte, electrical double-layer capacitors, and nonaqueous electrolyte secondary cells |
| 12/22/2006 | CA2550252A1 Novel process for the preparation of crystalline venlafaxine hydrochloride |
| 12/21/2006 | WO2006135694A2 Uii-modulating compounds and their use |
| 12/21/2006 | WO2006133652A1 Compounds, preparation process, and uses thereof used for interrupting reuptake of 5-hydroxytryptamine and norepinephrine or treating diseases such as depression et al. |
| 12/21/2006 | DE19816526B4 Verwendung von alkoxylierten Aminen zur Stabilisierung von flüssigen oder festen Verbindungen gegen Alterungsprozesse The use of alkoxylated amines for stabilizing liquid or solid compounds against aging processes |
| 12/21/2006 | CA2612413A1 Compounds for inhibition of 5-hydroxytryptamine and norepinephrine reuptake or for treatment of depression disorders, their preparation processes and uses thereof |
| 12/20/2006 | EP1732533A1 Thyroid receptor agonists |
| 12/20/2006 | CN1880298A Cavity-transferring material and its preparation method |
| 12/20/2006 | CN1290485C Compounds for a controlled release of active molecules |
| 12/19/2006 | CA2251169C Quaternary cytofectins |
| 12/14/2006 | WO2006133339A2 Monoamine re-uptake inhibitors and methods relating thereto |
| 12/14/2006 | US20060281926 Synthesis of 2-alkylcysteine via phase transfer catalysis |
| 12/14/2006 | US20060281812 For urogenital disorders; improved side effect reduction, bioavailability, pharmacokinetics and half-life; N,N-diisopropyl-3-(2-methoxy-5-trifluoromethylphenyl)-3-phenylpropanamine tartrate |
| 12/14/2006 | US20060281742 Amines that inhibit a mammalian anandamide transporter, and methods of use thereof |
| 12/13/2006 | EP1730103A1 Formamide derivatives useful as adrenoceptor |
| 12/13/2006 | EP1730095A2 Novel cyclopentenedione antifungal compounds and methods for their use |
| 12/13/2006 | EP1730094A1 Method for the preparation of aryl ethers |
| 12/12/2006 | US7148176 (adamantyl)nP(alkyl)m(1a); (adamantyl)o(Alkyl)qP (alkylene')P(adamantyl)r(alkyl)s , wherein adamantyl bonded to phosphorus atom in position 1, or 2, useful for refining halogenoaromatics |
| 12/12/2006 | CA2253981C Novel bis-(2,4-diaminophenoxy) benzenes and their use as coupling components in oxidative hair coloring compositions and methods |
| 12/07/2006 | US20060276467 Sodium channel modulators |
| 12/06/2006 | EP1728782A2 Monomers and network polymers obtained therefrom |
| 12/06/2006 | CN1288184C Polyether polyamine agents and mixtures therefor |
| 12/05/2006 | US7145039 Transfection reagents |
| 12/05/2006 | US7145015 Benzocycloheptenes, process for their production, pharmaceutical preparations that contain that latter as well as their use for the production of pharmaceutical agents |
| 11/30/2006 | WO2006125675A1 Separation of stereoisomeric n,n-dialkylamino-2-alkyl-3-phenyl alkanes |
| 11/30/2006 | US20060270738 Novel derivatives of 3,3-diphenylpropylamines |
| 11/30/2006 | US20060269603 Controlled release tramadol formulations |
| 11/30/2006 | DE102005033732A1 Trennung stereoisomerer N,N-Dialkylamino-2-alkyl-3-hydroxy-3-phenyl-alkane Separation of stereoisomeric N, N-dialkylamino-2-alkyl-3-hydroxy-3-phenyl-alkanes |
| 11/29/2006 | EP1725518A1 Pharmaceutical compounds |
| 11/29/2006 | EP1032559B1 Aminoalkylphenol derivatives for treating depression and memory dysfunction |
| 11/29/2006 | EP0738149B1 1-aminoindan derivatives and compositions thereof |
| 11/28/2006 | US7141697 Hydrogenation of phenylacetonitriles in presence of a nickel or cobalt catalyst |
| 11/23/2006 | WO2006123672A1 Method for producing aminoalcohol derivative having biphenyl group |
| 11/23/2006 | WO2006123517A1 Crystal polymorph of hydroxynorephedrin derivative hydrochloride |
| 11/23/2006 | WO2006122788A1 DERIVATIVES OF 4-(2-AMINO-1-HYDROXYETHYL)PHENOL AS AGONISTS OF THE β2 ADRENERGIC RECEPTOR |
| 11/23/2006 | US20060264673 Copper-catalyzed formation of carbon-heteroatom and carbon-carbon bonds |
| 11/23/2006 | US20060264435 Novel compounds |
| 11/23/2006 | CA2608493A1 Derivatives of 4-(2-amino-1-hydroxyethyl)phenol as agonists of the .beta.2 adrenergic receptor |
| 11/23/2006 | CA2608451A1 Method for producing aminoalcohol derivative having biphenyl group |
| 11/23/2006 | CA2605337A1 Crystal polymorph of hydroxynorephedrin derivative hydrochloride |
| 11/22/2006 | EP1722766A2 Management of ophthalmologic disorders, including macular degeneration |
| 11/22/2006 | CN1867867A Electrophotographic photoreceptor and image forming apparatus including the same |
| 11/22/2006 | CN1867546A Novel compound and its uses in medicine, its preparation method and its pharmaceutical composition comprising same |
| 11/22/2006 | CN1865225A AB type dibasic aminoacid monomer containing hydroxy group and its preparation method |
| 11/21/2006 | US7138547 Antitumoral compounds |
| 11/21/2006 | US7138413 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 11/21/2006 | CA2272285C Amide derivatives and medicinal compositions thereof |
| 11/21/2006 | CA2140441C Inhibitors of c-amp phosphodiesterase and tnf |
| 11/21/2006 | CA2126518C Use of phenalkylamines |
| 11/16/2006 | US20060258745 Deramciclane-fumarate tablets |
| 11/15/2006 | EP1721889A1 Process for the preparation of phenethylamine derivatives |
| 11/15/2006 | EP1720824A1 Synthetic multiple quaternary ammonium salts |
| 11/15/2006 | EP1720823A1 New process for the synthesis of substituted alpha-aminoidan derivatives |
| 11/15/2006 | EP1351907B1 2-butyl-3-(4- 3(dibutylamino)propoxy benzoyl)-5-nitro-benzofuran hydrochloride and preparation thereof |
| 11/15/2006 | EP0877607B1 Biphenyl compounds and use thereof as oestrogenic agents |
| 11/15/2006 | CN1861572A Process of crystallizing separating amino methyl phenoxide mixture |