| Patents for C07C 217 - Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton (13,958) |
|---|
| 03/30/2011 | CN101993383A New method for synthesizing dronedarone key intermediate 4-(3-(dibutylamino) propoxy] methyl benzoates |
| 03/29/2011 | US7915450 Transfection reagents |
| 03/29/2011 | US7914905 π-conjugated aromatic ring-containing compound and organic electroluminescent device |
| 03/29/2011 | US7914706 Charge transport compositions and electronic devices made with such compositions |
| 03/29/2011 | CA2489276C Tricyclic steroid hormone nuclear receptor modulators |
| 03/29/2011 | CA2460640C Diaryl ether derivatives, salts thereof and immunosuppressive agents using the same |
| 03/24/2011 | WO2011032476A1 Method for preparing levo-betaxolol hydrochloride |
| 03/23/2011 | EP2298728A1 Transfection reagents |
| 03/23/2011 | EP2297089A1 Benzocycloheptane and benzoxepine derivatives |
| 03/23/2011 | EP2297088A2 New compounds with activity that protects against the action of toxins and viruses in intracellular action mode |
| 03/23/2011 | EP2297075A1 Dihydro-iso-ca-4 and analogues: potent cytotoxics, inhibitors of tubulin polymerization |
| 03/23/2011 | EP2296707A2 Compounds suited as nanocarriers for active agents and their use |
| 03/23/2011 | EP1578353B1 4-hydroxypiperidine derivatives useful as antimycobacterial agents |
| 03/23/2011 | CN101265200B Secondary resolution method for eptazocine intermediate |
| 03/22/2011 | US7910735 insecticides or acaricides; claimed intermediates are a 3-alkyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]aniline and a pyrazine-2-carboxylic acid |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |
| 03/17/2011 | WO2011029614A1 Crystalline modifications of 6-dimethylaminomethyl-1-(3-methoxy-phenyl)-cyclohexane-1,3-diol |
| 03/17/2011 | US20110065760 Compounds for the inhibition of rotamases and use thereof |
| 03/16/2011 | EP2295399A2 Liquid electrolytes for electrical storage devices |
| 03/16/2011 | EP2025661B1 Fluoroalkyloxy-containing combretastatin derivatives, preparation and use thereof |
| 03/16/2011 | EP1708987B1 L-(-)-moprolol l-(+)-tartrate |
| 03/16/2011 | CN1926093B Synthetic multiple quaternary ammonium salts |
| 03/16/2011 | CN101161634B Method for preparing optical active 1-(3-methoxy phenyl) ethylamine |
| 03/15/2011 | US7906653 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/15/2011 | CA2514114C Amino alcohol derivatives, pharmaceutical compositions containing the same, and use thereof |
| 03/15/2011 | CA2496708C New process for the synthesis of (1s)-4,5-dimethoxy-1-(methylaminomethyl)-benzocyclobutane and its addition salts and application to the synthesis of ivabradine and its addition salts with a pharmaceutically acceptable acid |
| 03/10/2011 | WO2011027359A2 Novel process for the preparation of 4-hydroxy atomoxetine |
| 03/10/2011 | WO2011026314A1 The preparation method of tapentadol and intermediates thereof |
| 03/10/2011 | US20110060053 Crystalline Modifications of 6-Dimethylaminomethyl-1-(3-methoxyphenyl)-cyclohexane-1,3-diol |
| 03/09/2011 | EP2292628A2 Compounds for preparing immunological adjuvant |
| 03/09/2011 | EP2292585A1 Screening for solid forms by ultrasound crystallization and cocrystallization using ultrasound |
| 03/09/2011 | EP2292583A2 Triarylamine compounds for use as charge transport materials |
| 03/08/2011 | US7902372 Therapy for obesity; using a secondary amino compound |
| 03/03/2011 | US20110054217 Hydrogenation of imines |
| 03/03/2011 | US20110054021 Calcilytic Compounds |
| 03/03/2011 | US20110053980 Indane-amine derivatives, their preparation and use as medicaments |
| 03/02/2011 | EP2289962A2 Polyurea compositions and compounds for the preparation thereof |
| 03/02/2011 | EP2289868A1 Carboxylic acid compound |
| 03/02/2011 | EP1578715B1 Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| 03/02/2011 | EP1286952B1 Ester quaternary mixtures |
| 03/02/2011 | CN101983186A Ruthenium compound and method for producing optically active aminoalcohol compound |
| 02/24/2011 | US20110046231 Solid forms of (±)-o-desmethylvenlafaxine salts |
| 02/24/2011 | US20110046146 Phosphodiesterase 4 inhibitors |
| 02/23/2011 | EP2286915A2 Ionic liquids with a cation comprising a basic moiety |
| 02/23/2011 | EP2285770A1 Process for the synthesis of arformoterol |
| 02/23/2011 | EP2285764A2 Monoetherified diols of diamondoids |
| 02/22/2011 | CA2350882C Transfection reagents |
| 02/16/2011 | EP1805131B1 Ionic liquids comprising nitrogen containing cations |
| 02/16/2011 | CN101973897A Synthesis method of valdoxan intermediate 2-(7-methoxy-1-naphthyl)ethylamine |
| 02/16/2011 | CN101972672A S-acylation L-cysteine and application of salt thereof as catalyst for asymmetrical organic synthesis reaction |
| 02/16/2011 | CN101786956B Method for deacylating N-acylated diphenylamine or ring-substituted derivatives thereof |
| 02/15/2011 | CA2456411C Stilbene derivatives and their use for binding and imaging amyloid plaques |
| 02/15/2011 | CA2450213C Crystalline form of a phenylethanolamine, the preparation thereof and pharmaceutical compositions comprising the same |
| 02/09/2011 | EP2280929A1 An improved process for the preparation of amines |
| 02/09/2011 | EP1434755B1 A nitrogen-containing ortho ester-based surfactant, its preparation and use |
| 02/09/2011 | CN101970406A Novel triaryl derivatives useful as modulators of nicotinic acetylcholine receptors |
| 02/09/2011 | CN101970394A Novel cyclic hydrocarbon compounds for the treatment of diseases |
| 02/09/2011 | CN101967347A Preparation method of high-temperature resistant insulating self-adhesive enamel |
| 02/09/2011 | CN101967103A Novel preparation method of itopride intermediate body |
| 02/08/2011 | US7884256 Polymerizable higher diamondoid derivatives |
| 02/08/2011 | CA2496480C Polyether polyamine agents and mixtures therefor |
| 02/03/2011 | WO2011013108A1 Polymorphic form of toremifene citrate and process for its preparation |
| 02/03/2011 | WO2011012560A1 Macrophotoinitiators |
| 02/03/2011 | CA2769765A1 Polymorphic form of toremifene citrate and process for its preparation |
| 02/02/2011 | EP2279166A1 Substituted phenoxybenzamides |
| 02/02/2011 | CN101962350A Beta-aryl homoallylic amine compound with optical activity, synthesis method and application |
| 02/02/2011 | CN101962328A Method for preparing antidepressant fluoxetine |
| 02/02/2011 | CN101962327A New process for synthesizing 4-(N,N-dimethylamino)-butyraldehyde dimethylacetal |
| 02/01/2011 | CA2560547C Formamide derivatives useful as adrenoceptor |
| 02/01/2011 | CA2429268C 2-butyl-3-(4-[3(dibutylamino)propoxy]benzoyl)-5-nitro-benzofuranhydrochloride and its preparation |
| 02/01/2011 | CA2380857C Substituted 2-dialkylaminoalkylbiphenyl derivatives |
| 01/27/2011 | WO2010136036A3 Calcium-sensing receptor-active compounds |
| 01/27/2011 | US20110021577 Aryloxy amine compounds and their use as sodium channel modulators |
| 01/26/2011 | EP2276840A1 Diamine salts of carboxylic acids |
| 01/26/2011 | CN1726603B Charge transport compositions and electronic devices made with such compositions |
| 01/26/2011 | CN101955436A Naphthyloxy benzedrine derivatives and preparation method thereof |
| 01/25/2011 | US7875611 Ion channel modulating compounds and uses thereof |
| 01/25/2011 | CA2477714C New cinnamic acid salts, processes for the preparation thereof and use thereof as medicament |
| 01/20/2011 | WO2010136035A3 Novel calcium sensing receptor modulating compounds and pharmaceutical use thereof |
| 01/20/2011 | US20110015240 Thiazole derivative and use thereof as vap-1 inhibitor |
| 01/19/2011 | EP2275395A2 Copper-catalyzed formation of carbon-carbon bonds |
| 01/19/2011 | EP2275099A1 Treatment of faecal incontinence with 1r,2s-methoxamine |
| 01/19/2011 | CN101948398A Novel method for synthesizing 4-hydroxy-5-ethoxyaniline |
| 01/19/2011 | CN101948397A Method for preparing important intermediate of tapentadol hydrochloride analgesic |
| 01/19/2011 | CN101948396A Polyether amine, production method thereof and application of polyether amine in methanol gasoline |
| 01/19/2011 | CN101948395A Amido-containing neutral cathode buffer layer molecular material and preparation method and application thereof |
| 01/19/2011 | CN101948394A Method for synthesizing tris(dioxa-3,6-heptyl)amine |
| 01/19/2011 | CN101948366A Method for preparing 4-(diphenylamino)biaryl compound in water phase |
| 01/18/2011 | US7872026 retinoic acid receptor (RAR) activators such as 4'-(4-Isopropylaminobutoxy)-3'-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphth-2-yl)biphenyl-4-carboxylic acid, suited for administration in human or veterinary medicine; dermatology |
| 01/18/2011 | CA2321881C Non-imidazole alkylamines as histamine h3-receptor ligands and their therapeutic applications |
| 01/13/2011 | WO2011005959A1 Process for the preparation of n-protected-decylaminoethanal |
| 01/13/2011 | US20110009631 Phenethanolamine Derivatives for Treatment of Respiratory Diseases |
| 01/12/2011 | EP2272821A2 Trinuclear phenolic compounds |
| 01/12/2011 | EP2272813A2 Copper-catalyzed formation of carbon-oxygen bonds |
| 01/12/2011 | EP1682513B1 Method for producing cyclic, n-substituted alpha-iminocarboxylic acids |
| 01/12/2011 | CN101941913A Synthesis method of 2,4,4'-trichlorine-2'-aminodiphenyl ether |
| 01/12/2011 | CN101940926A Catalyst for reduction of aromatic nitro-compounds by hydrazine hydrate and preparation method thereof |
| 01/12/2011 | CN101240062B Synthetic method for triethanolamine block polyether |
| 01/12/2011 | CN101239919B Method for synthesizing aromatic diamines monomer |
| 01/12/2011 | CN101157623B Method for preparing 1,4-di(4-amino-benzene oxygen) benzene |