| Patents for C07C 1 - Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon (18,898) |
|---|
| 06/07/1988 | US4749812 N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| 06/07/1988 | US4749677 In situ decomposition of ruthenium carbonyl complex in the presence of titanium oxide; fischer-tropsch synthesis |
| 06/07/1988 | US4749675 Catalysts for the selective dimerization of ethylene or propylene to monoolefines, of the type based on nickel on a silica support, process for preparing it and dimerization process employing it |
| 06/07/1988 | US4749674 Catalyst for the non-oxidative dehydrogenation of alkylbenzene to alkenylbenzene |
| 06/01/1988 | EP0269503A2 Ferrierites, process for their preparation and their use |
| 06/01/1988 | EP0269297A1 Process for the production of aromatic hydrocarbons incorporating by-product utilisation |
| 06/01/1988 | EP0269089A1 Perhydrofluorene derivatives, process for producing same and fluids for traction drive |
| 06/01/1988 | CN87107910A New magnesium alkali-zeolite, and process and application thereof |
| 05/31/1988 | US4748145 Catalysts having alkoxide-modified supports and method of increasing the catalytic activity of a catalytic metal |
| 05/31/1988 | CA1237447A1 Conversion of paraffins to aromatics |
| 05/25/1988 | EP0268525A1 Process for the production of a rhenium-containing catalyst, catalyst thus obtained and its use in the production of olefins by the metathesis process |
| 05/24/1988 | US4746762 Upgrading light olefins in a turbulent fluidized catalyst bed reactor |
| 05/24/1988 | US4746761 High octane gasoline |
| 05/24/1988 | US4746643 Method for the preparation of a catalyst for the dehydrogenation of C3 -C5 paraffins |
| 05/24/1988 | CA1237117A1 PROCESS FOR THE OLIGOMERIZATION OF .alpha. OLEFINS AND CATALYST THEREFOR |
| 05/19/1988 | WO1988003523A1 Process for producing alkyl group-substituted aromatic hydrocarbons |
| 05/19/1988 | WO1988003436A1 Photochemical dimerization and functionalization of alkanes, ethers, primary and secondary alcohols, phosphine oxides and silanes |
| 05/18/1988 | EP0267778A2 Azole derivatives useful in controlling plant diseases and regulating plant growth |
| 05/17/1988 | CA1236815A1 Preparation of modified zeolites and their utilization |
| 05/11/1988 | EP0266898A2 Surface-supported particulate metal compound catalysts, their preparation and their use in hydrocarbon synthesis reactions |
| 05/11/1988 | EP0266727A1 Process for hydrogenating carbon dioxide and catalyst |
| 05/11/1988 | CN87105310A Process for extracting paraffins from their mixtures with alkanesulphonic acids |
| 05/10/1988 | CA1236469A1 Recovery of sulfolane |
| 05/03/1988 | US4741891 Selective catalyst for hydrocarbon conversion |
| 05/03/1988 | CA1236126A1 Manganese - spinel catalysts in co/h.sub.2 olefin synthesis |
| 05/03/1988 | CA1236121A1 Electrical insulating oil and electrical appliances impregnated with the same |
| 05/03/1988 | CA1236078A1 Hydrocarbon conversion process |
| 04/27/1988 | EP0265017A2 Process for the mutual condensation of aromatic and carbonylic compounds |
| 04/27/1988 | EP0264468A1 Catalytic composite for conversion of hydrocarbons |
| 04/26/1988 | US4740650 Xylene isomerization |
| 04/26/1988 | US4740492 Process for the production of a synthesis gas conversion catalyst |
| 04/26/1988 | CA1235683A1 Zeolite catalysts |
| 04/20/1988 | EP0264226A1 Separation process by crystallisation |
| 04/20/1988 | EP0263843A1 Liquid crystal compounds, mixtures and devices. |
| 04/20/1988 | CN87105311A Process for extracting paraffins from their mixtures with paraffinsulphonic acids |
| 04/19/1988 | US4738948 Cobalt-ruthenium catalysts for Fischer-Tropsch synthesis and process for their preparation |
| 04/19/1988 | US4738946 High temperature stable catalyst and process for preparing same |
| 04/13/1988 | EP0263259A2 Process and catalyst system for the trimerization of acetylene and acetylene compounds |
| 04/13/1988 | CN87106596A Conversion catalyst for synthetic gas and preparation and application thereof |
| 04/12/1988 | CA1235144A1 Method for producing compounds having a double bond at the terminal |
| 04/07/1988 | WO1988002361A1 Acid catalyzed process |
| 04/07/1988 | WO1988002357A2 Process for the production of alkylene or cyclically linked compounds |
| 04/06/1988 | EP0262238A1 Catalytic dehydrocyclization of naphtha |
| 04/06/1988 | EP0249614A4 Oligomerization process. |
| 04/05/1988 | US4735789 Process for the production of catalytically-active metallic glasses |
| 04/05/1988 | US4735704 Liquid removal enhancement |
| 04/05/1988 | CA1234843A1 Methane conversion |
| 04/05/1988 | CA1234841A1 Process for the synthesis and purification of diisopropenylbenzene |
| 03/31/1988 | DE3632410A1 Verfahren zur herstellung von alkylen- bzw. ringverknuepften verbindungen A process for preparing alkylene or compounds ringverknuepften |
| 03/30/1988 | EP0262049A2 Process for up-grading steam-cracking products |
| 03/30/1988 | EP0261870A1 Syngas conversion catalyst, its production and use thereof |
| 03/30/1988 | EP0261771A2 Manufacture of organic liquids |
| 03/30/1988 | EP0261730A2 Olefin dimerization method |
| 03/30/1988 | EP0261701A1 Process for removing paraffins from their mixtures with paraffinsulphonic acids |
| 03/30/1988 | EP0261700A1 Process for extracting paraffins from their mixtures with parraffinsulphonic acids |
| 03/30/1988 | EP0261288A1 High surface area dual Promoted iron/manganese spinel compositions and their use for catalyzing conversion of CO/H2 mixtures to alpha olefins |
| 03/30/1988 | EP0261129A1 Process for the production of tertiary olefins by decomposition of alkyl-tert.alkyl-ethers. |
| 03/30/1988 | CN87106233A Process to produce high methane content gas mixture from coal |
| 03/29/1988 | US4734824 Electrical insulating oil and electrical appliances impregnated with the same |
| 03/29/1988 | US4734538 Contacting aldehydes with a non-zeolitic molecular sieve |
| 03/29/1988 | US4734533 Process for the preparation of (2,2)-paracyclophane and derivatives thereof |
| 03/24/1988 | WO1988001994A1 Lubricants comprising novel cyclopentanes, cyclopentadienes, cyclopentenes, and mixtures thereof and methods of manufacture |
| 03/24/1988 | WO1988001993A1 Oxidative coupling with methyl-substituted benzenes |
| 03/23/1988 | CN87105306A Process for removing paraffins from their mixtures with paraffinsulphonic acids |
| 03/23/1988 | CN87105159A Oligomerization of olefins |
| 03/22/1988 | US4732918 Heat interchanging process and reactor therefor |
| 03/22/1988 | CA1234396A1 Process for the preparation of hydrocarbons |
| 03/22/1988 | CA1234395A1 Process for the preparation of hydrocarbons and a fuel gas |
| 03/22/1988 | CA1234274A1 Crystalline metal aluminophosphates |
| 03/16/1988 | EP0260151A1 Oxidative coupling with methyl-substituted benzenes |
| 03/16/1988 | EP0259954A1 Process for converting C2 to C12 aliphatics to aromatics over a zinc activated zeolite |
| 03/16/1988 | EP0259927A1 Process to produce a high methane content gas mixture from coal |
| 03/16/1988 | EP0259423A1 Liquid crystal compounds, mixtures and devices. |
| 03/15/1988 | CA1234162A1 Process for the production of naphthalene |
| 03/15/1988 | CA1234158A1 Process for the preparation of hydrocarbons |
| 03/10/1988 | WO1988001611A1 Hydrogasification of biomass to produce high yields of methane |
| 03/09/1988 | EP0258973A2 Process for propylene dimerization |
| 03/09/1988 | CN87105841A Oligomerization to alpha-olefins |
| 03/09/1988 | CN87105160A Layered metal oxides containing interlayer oxides and their synthesis |
| 03/09/1988 | CN87105158A Layered metal chalcogenides containing interspathic polymeric chalcogenides |
| 03/08/1988 | US4729981 ROR-activated catalyst for synthesis gas conversion |
| 03/08/1988 | US4729979 Pore size/catalysts/, drying, roasting, copper on (copper) aluminum borate support, reduction |
| 03/08/1988 | CA1233835A1 Process using iron-thallium catalysts in co hydrogenation |
| 03/08/1988 | CA1233833A1 Process for producing alcohols using iron-thallium catalysts |
| 03/03/1988 | DE3347797C2 Process for the preparation of hydrocarbons from gases containing hydrogen and carbon monoxide, or for the methanisation of gases containing hydrogen and carbon monoxide |
| 03/02/1988 | EP0257921A2 New 1,3-diaryl cyclopentanes and derivatives thereof as paf antagonists |
| 03/02/1988 | EP0257696A1 Process for dimerizing alpha-olefins |
| 03/02/1988 | EP0257232A2 Oligomerization of ethylene in methanol and water |
| 03/02/1988 | EP0257049A1 Chiral compounds. |
| 03/01/1988 | US4728702 Coupling with coupling agent |
| 03/01/1988 | US4728672 Process for producing hydrocarbons |
| 03/01/1988 | CA1233459A1 Procedure for producing zeolite catalysts, and alkylation process |
| 03/01/1988 | CA1233416A1 Topical treatment of skin inflammatory disorders |
| 02/25/1988 | WO1988001261A1 Olefin oligomerization process and catalyst |
| 02/24/1988 | EP0256945A1 Mordenite-based catalyst for the isomerization of straight chain paraffins |
| 02/24/1988 | EP0256857A1 Oxidative conversion of methane to ethylene and ethane |
| 02/24/1988 | EP0256849A1 Aromatization process |
| 02/24/1988 | EP0256604A2 Process for the isomerization of unbranched hydrocarbons |
| 02/24/1988 | EP0256097A1 Vinyl compounds and liquid crystal phase. |
| 02/24/1988 | EP0256065A1 Layered crystalline aluminosilicate and a method for its preparation. |