| Patents for C07B 47 - Formation or introduction of functional groups not provided for in groups (421) |
|---|
| 10/04/2011 | CA2453303C Method of functionalizing solid supports |
| 09/06/2011 | US8013149 Methods and intermediates for the synthesis of porphyrins |
| 08/24/2011 | EP2359923A1 Method of preparing organometallic compounds |
| 08/24/2011 | EP2359922A1 Method of preparing organometallic compounds |
| 08/24/2011 | CN1946656B Methods, compositions, and apparatuses for forming macrocyclic compounds |
| 08/18/2011 | US20110197969 Methods and intermediates for the synthesis of dipyrrin-substituted porphyrinic macrocycles |
| 08/11/2011 | DE102010001836A1 Verfahren zur Hydrosilylierung mit Platinkatalysator Hydrosilylation process with platinum catalyst |
| 08/10/2011 | CN1980600B Synthesis of porphyrins designed for attachment to electroactive surfaces via one or more carbon tethers |
| 08/09/2011 | US7994311 Fluorescent chemosensors for metals based on dipyrrins |
| 06/28/2011 | US7968706 Method of manufacturing phthalocyanine compound |
| 06/21/2011 | US7964720 Method of making porphyrins |
| 06/14/2011 | US7960725 Aryl-aryl dendrimers |
| 06/14/2011 | US7960371 High-purity large-scale preparation of stannsoporfin |
| 05/31/2011 | US7951939 Methods and intermediates for the synthesis of porphyrins |
| 05/31/2011 | US7951938 Fluorinated dyes or colorants and their uses |
| 05/24/2011 | US7947844 One-pot synthesis of benzisoindolenines used in the preparation of naphthalocyanines |
| 05/24/2011 | US7947829 Method of making porphyrins |
| 05/24/2011 | US7947828 Methods and intermediates for the synthesis of dipyrrin-substituted porphyrinic macrocycles |
| 05/24/2011 | US7947827 Pharmaceutical formulation comprising a metaloporphyrin and method for its purification and use |
| 05/24/2011 | US7947826 Wet film filming |
| 05/24/2011 | US7947825 Process for making titanyl phthalocyanine |
| 05/24/2011 | US7947729 Adduct of fluorescent dye and tumor avid tetrapyrrole |
| 05/24/2011 | US7947672 Water-soluble anionic bacteriochlorophyll derivatives and their uses |
| 05/24/2011 | US7946626 Substrate having IR-absorbing dye with branched axial ligands |
| 05/10/2011 | US7939656 Geometric synthesis of porphyrin rods |
| 05/05/2011 | WO2011050533A1 Method for preparing conjugated diene phosphonate compounds |
| 04/13/2011 | CN102010282A Method for preparing diaryl disulfide and diaryl diselenide under catalysis of aqueous phase |
| 03/09/2011 | EP0907625B1 Method for separating organic compounds using fluorous separation systems |
| 02/15/2011 | US7888501 Process for making organic photosensitive pigment |
| 02/01/2011 | US7879996 2-([60] fullerene [1',9':3,4] cyclohexen-1-y1)-5,10,15,20-(tetra magnesium [(4-(N-(4-carboxy butyl) amino) phenyl 2,3-dicarboxylatel]) porphyrin iron (II); prepared by linking a fullerene to a porphyrin compound, preferably with electromagnetic or sonic waves |
| 12/15/2010 | CN1988848B Carboranylporphyrins and uses thereof |
| 12/02/2010 | WO2010138633A1 Method of providing neuroprotection using substituted porphyrins |
| 12/02/2010 | US20100305083 Substituted porphyrins |
| 11/30/2010 | US7842801 using a photosensitizer,containing phthalocyanine ring with pendant phenylsulfonate moieties linked through a secondary amide and complexed with a copper, zinc, nickel, manganese, cobalt, aluminum or vanadium central metal; and a carrier to detect cancer for photodynamic therapy |
| 11/30/2010 | US7842682 Boronated metal-phthalocyanines, process for their preparation, pharmaceutical compositions comprising them and use thereof |
| 11/23/2010 | US7838670 Naphthalocyanine compound and method for producing the same |
| 11/23/2010 | US7838669 useful for image-forming materials, IR-sensitive thermal recording materials, optical recording devices and optical film materials |
| 11/16/2010 | US7834175 reacting macrocyclic metal-free cyanine compound dissolved in solvent and vanadium acetylacetonate; low cost |
| 11/09/2010 | US7830702 Synthetic molecular spring device |
| 11/02/2010 | US7825108 in the form of coded data, whilst minimizing visible coloration of the substrate; using a light to heat conversion dye comprising a metal-cyanine |
| 10/26/2010 | US7820644 Substituted porphyrins |
| 10/19/2010 | US7816518 Porphyrin derivatives and their use in photon activation therapy |
| 10/05/2010 | US7807825 superoxide dismutase mimetics such as manganese(III) 5,10,15,20-tetrakis[N,N'-diethylimidazolium-2-yl]porphyrin, used for the treatment for oxidative stress injuries, including asthma, neurodegenerative disease, cancer, diabetes, cardiovascular disorders, sickle cell anemia and radiation injury |
| 09/21/2010 | US7799911 halogen-free, has green hue; organic solvent resistance, acid resistance; phthalocyanine metal complex where the phthalocyanine ring has fused imidazolidin-2-one ring(s); printing inks, coloring plastics, ink jets, color filters; environmentally safe to replace polyhalogenated copper phthalocyanine |
| 09/21/2010 | US7799910 Geometric synthesis of porphyrin rods |
| 09/15/2010 | CN101830767A Method for synthesizing difluoromethyl compound |
| 09/08/2010 | CN101824031A 一种手性噁唑啉及其用途 One chiral oxazolines and their use |
| 09/07/2010 | US7790880 1-Vinylimidazoles ligands for iron and cobalt phthalocyanine complexes made by charging a powder phase in a closed vessel with nitrogen; excellent UV (Ultraviolet)-blocking effect together with low surface resistance; antistatic agents |
| 09/07/2010 | US7790879 Easily deformed in accordance with exerted force when the force is externally exerted and is high in its electric conductivity; used as a material of a flexible electronic device |
| 08/17/2010 | US7777028 Preparation of metal mesoporphyrin compounds |
| 08/12/2010 | US20100200066 Methods and intermediates for the synthesis of dipyrrin-substituted porphyrinic macrocycles |
| 08/03/2010 | US7767808 Porphyrin-phthalocyanine dimer and tetramer having directly-bound π electron systems and production method thereof |
| 08/03/2010 | US7767807 Use of phthalocyanines as marking substances for liquids |
| 07/13/2010 | US7754879 Porphyrin compound, albumin inclusion compound thereof and artificial oxygen carrier |
| 07/06/2010 | US7749991 photosensitizers used in the photodynamic therapy of microbial infections, tumors, pre-cancerous and proliferative pathologies and/or in the diagnosis, as well as for blood and blood derivatives sterilization |
| 06/29/2010 | US7745618 Method of making porphyrins |
| 06/29/2010 | US7745617 Metallophthalocyanine mixed crystal and phthalocyanine pigment containing the same |
| 06/15/2010 | US7737271 IR absorbing dyes is compatible with inkjet printers, inks, lightfastness, thermal stability, nontoxic, low-cost manufacture |
| 06/15/2010 | US7737270 reacting phthalonitrile with cuprous chloride or titanium tetrachloride in ethanol to form titanyl or copper phthalocyanine; efficiency; pollution control |
| 05/25/2010 | US7723513 Methods and intermediates for the synthesis of dipyrrin-substituted porphyrinic macrocycles |
| 05/18/2010 | US7718794 Synthesis of porphyrins designed for attachment to electroactive surfaces via one or more carbon tethers |
| 05/04/2010 | US7709632 such as porphyrins, chlorins, texaphyrins via cyclization, oligomerization |
| 03/23/2010 | US7683363 Mixture of compound for absorbing energy , sensitizers capable of emitting energy |
| 03/16/2010 | US7678899 Phthalocyanines and their use in ink-jet printers |
| 03/16/2010 | US7678728 made by precipitating a transition metal N4-chelate precursor made of 50:50 molar percent H2 tetraphenyl porphyrin and cobalt tetraphenyl porphyrin onto plurality of removable template particles to produce dispersed precursor and pyrolyzing dispersed precursor to produce a pyropolymer |
| 03/02/2010 | US7671194 Method of preparing naphthalocyanines |
| 03/02/2010 | US7671046 Target Atp binding sites; ruthenium and platinum are fused to nitrogen heterocyclic ligands; stability and selectivity; anticancer agents |
| 02/16/2010 | US7662807 Sulphonated meso-tetraphenyl chlorins |
| 02/16/2010 | US7662362 Nanoparticulate probe for in vivo monitoring of tissue oxygenation |
| 02/09/2010 | US7659301 Controlling photoactivation; reducing oxygen concentration of tissue at site; prevention metabolism; cooling |
| 01/19/2010 | US7649091 complex comprising manganese acetate and {[{(Porphine-5,15-diyl)bis[cyclopropyl-diyl]}](2-)-N21,N22,N23, N24 }; reduce damage to cells; preventing or arresting free radical associated diseases or conditions; free radical scavengers |
| 12/22/2009 | CA2462832C Process for preparing 1-olefins using palladium-carbene compounds |
| 12/15/2009 | US7632942 Oxidizing cycloalkane with molecular oxygen in the presence of a mixture of metal oxides and/or a composite metal oxide, each containing ruthenium and cobalt as the metal elements therein; excellent selectivity |
| 11/18/2009 | CN101583595A Composition for alkylation, and method for detoxification of toxic compound using the composition |
| 11/10/2009 | US7615630 Compound and method for synthesizing the same, ink, ink cartridge, recording unit, ink-jet recording apparatus, recording method, liquid composition, pattern generating method, article, environmental history-detecting method |
| 10/15/2009 | WO2009124897A1 Complex compound containing a metal atom and phosphine derivative as the ligand |
| 09/29/2009 | US7595394 Porphyrin compound, albumin inclusion compound thereof and artificial oxygen carrier |
| 09/01/2009 | US7582751 condensing a 1,9-bis(N,N-)dialkylaminomethyl)dipyrromethanes with a dipyrromethanes in ethanol containing metal salt to produce a reaction product; optinoally oxidizing the product with benzoquinone, 2,3-dichloro-5,6-dicyano-, or chloranil, optionally demetallating to produce porphyrins |
| 09/01/2009 | US7582750 Method for conversion of terminal alkenes to aldehydes using ruthenium (IV) porphyrin catalysts |
| 08/18/2009 | US7576199 Near infrared dyes |
| 08/05/2009 | CN100522363C Addition reaction of silicon with hydrogen solid supported bimetallic catalyst and its preparation method |
| 07/30/2009 | DE102008000156A1 Durch Bestrahlung aktivierte Hydrosilylierungsreaktionen Irradiation activated hydrosilylation reactions |
| 07/07/2009 | US7557205 For improving contrast of X-ray, ultrasound, radionuclide and magnetic resonance images |
| 06/30/2009 | US7553961 Method of producing a metal phthalocyanine pigment |
| 06/23/2009 | US7550587 Photosensitizer and method for production thereof |
| 06/23/2009 | US7550586 Phthalocyanines with peripheral siloxane substitution |
| 06/23/2009 | US7550585 Providing a macrocyclic metal-free cyanine compound and inserting a metal therein using a metal reagent, wherein the metal reagent comprises at least one organic ligand, wherein the organic ligand is acetylacetonate (acac), acetate or C1-8 alkoxide; IR absorbing dyes |
| 06/10/2009 | EP2066601A1 Hydrosilylation |
| 05/20/2009 | CN100488921C Process for producing organic compound using nitrite |
| 05/07/2009 | WO2008018063A3 Tetraarylporphine derivatives and uses thereof |
| 05/06/2009 | EP2055695A1 Composition for alkylation, and method for detoxification of toxic compound using the composition |
| 04/21/2009 | US7521551 Chlorins possessing fused ring systems useful as photoselective compounds for photodynamic therapy |
| 03/10/2009 | US7501509 A tetrapyrollic photosensitizer compound having at least one pendant CH2CH2CON(CH2CON(CH2COOH)2)2 or N(CH2COOH)2 group, being a chlorin, bacteriochlorin, porphyrin, pyropheophorbide, purpurinimide, or bacteriopurpurinimide |
| 03/10/2009 | US7501508 Methods and intermediates for the synthesis of porphyrins |
| 02/10/2009 | US7488817 Metal complex protein kinase inhibitors |
| 02/03/2009 | US7485721 Oxidation resistance; antiinflamamtory agents; respiratory system disorders |
| 01/06/2009 | US7473777 Method for production of halogen-containing phthalocyanine compound |
| 12/30/2008 | US7470785 Oxidatively cyclizing a tetrahydrobilene compound in an organic solvent in the presence of a base, an oxidant and a metal salt and optionally displacing metal M to create a free base chlorin |
| 12/30/2008 | US7470677 Oxidant scavengers |
| 12/24/2008 | CN101328143A Fluorine-containing sulphoxide imines compounds, synthetic methods and uses sthereof |