| Patents for C05B 15 - Organic phosphatic fertilisers (178) | |
|---|---|
| 03/2015 | |
| 03/05/2015 | DE102013217080A1 Düngepellet Fertilizer pellet |
| 01/2015 | |
| 01/15/2015 | WO2015006556A1 Compositions and kits for causing, enhancing, and/or expediting biodegradation of articles and methods of production and use thereof |
| 01/13/2015 | US8932382 Process of producing bio-organo-phosphate (BOP) fertilizer through continuous solubilization of rock phosphate by a composting bioprocess and bioaugmentation with phosphorus solubilizing microorganisms |
| 12/2014 | |
| 12/16/2014 | US8911524 Composition and method to increase phosphorus uptake in plants |
| 12/10/2014 | CN102985393B 用于施肥的基于纤维素的持续释放常量营养素组合物 Macronutrients sustained release compositions for cellulose-based fertilizer |
| 10/2014 | |
| 10/30/2014 | US20140318201 Treatment of organic waste |
| 09/2014 | |
| 09/10/2014 | EP2774907A2 Method and plant for continuous manufacture of granular USP nitrogen and phosphate type fertilizers and products on their basis |
| 07/2014 | |
| 07/22/2014 | US8784530 Organic fertilizer |
| 07/16/2014 | CN103930387A 包含营养素的压实型氯化钾肥料及其制备方法 Compaction type potassium fertilizer containing nutrients and its preparation method |
| 06/2014 | |
| 06/19/2014 | WO2014092770A2 Solvent systems of n-alkyl thiophosphoric triamides and methods of use in agricultural applications |
| 06/19/2014 | US20140171317 Urea Phosphite Fertilizer |
| 06/11/2014 | EP2739589A2 Compacted muriate of potash fertilizers containing nutrients and methods of making same |
| 05/2014 | |
| 05/07/2014 | CN103771908A 一种简易花盆基肥磷肥的制备方法 A simple method for preparing pots basal phosphate |
| 04/2014 | |
| 04/03/2014 | US20140090430 Process of producing bio-organo-phosphate (bop) fertilizer through continuous solubilization of rock phosphate by a composting bioprocess and bioaugmentation with phosphorus solubilizing microorganisms |
| 03/2014 | |
| 03/05/2014 | CN103613412A Preparation method of composition containing nucleotide salt and deoxyribonucleotide salt |
| 03/05/2014 | CN103613411A Nutrient for promoting plant growth |
| 02/2014 | |
| 02/20/2014 | US20140047884 Compositions of Substantially Spherical Particles and Methods of Making Thereof |
| 01/2014 | |
| 01/15/2014 | CN102077841B Application of sodium ribonucleotide in agriculture |
| 01/14/2014 | US8628598 Method and system for agricultural fertigation |
| 11/2013 | |
| 11/28/2013 | WO2013176777A1 Process of producing bio-organo-phosphate (bop) fertilizer |
| 11/21/2013 | US20130305794 Organic Fertilizer |
| 10/2013 | |
| 10/31/2013 | US20130283873 Additive containing n-(n-butyl)thiophosphoric triamide for urea-based fertilizer |
| 10/24/2013 | US20130276495 Additive containing n-(n-butyl)thiophosphoric triamide for urea-based fertilizer |
| 08/2013 | |
| 08/07/2013 | CN1471409B Concept for slurry separation and biogas production |
| 08/01/2013 | US20130192322 Plant Fertilizers Derived from Organic Nitrogen and Phosphorus Sources |
| 07/2013 | |
| 07/10/2013 | CN103193530A Method for producing labile phosphorus organic fertilizer by using pig manure |
| 06/2013 | |
| 06/27/2013 | US20130160361 Container, Soil Blend, and Method of Growing Plants |
| 06/13/2013 | US20130145806 Solvent Systems of N-Alkyl Thiophosphoric Triamides and Methods of Use in Agricultural Applications |
| 05/2013 | |
| 05/23/2013 | US20130125598 Pelletized organic fertilizer |
| 05/16/2013 | US20130123102 Urea phosphite fertilizer |
| 04/2013 | |
| 04/25/2013 | WO2013019935A3 Compacted muriate of potash fertilizers containing nutrients and methods of making same |
| 04/18/2013 | US20130091912 Treatment of organic waste |
| 04/10/2013 | EP2576485A2 A cellulose based sustained release macronutrient composition for fertilizer application |
| 04/09/2013 | CA2573543C N-phenylphosphoric acid triamides, method for the production thereof and their use as agents for regulating or inhibiting enzymatic urea hydrolysis |
| 03/2013 | |
| 03/20/2013 | CN102985393A A cellulose based sustained release macronutrient composition for fertilizer application |
| 03/07/2013 | US20130055635 Plant propagation medium and methods of making and using it |
| 02/2013 | |
| 02/07/2013 | WO2013019935A2 Compacted muriate of potash fertilizers containing nutrients and methods of making same |
| 01/2013 | |
| 01/15/2013 | CA2668519C Methods of generating phosphorus fertilizers through the utilization of microbial fermentation technology |
| 01/10/2013 | US20130012383 Use of aminocarboxylates in agriculture |
| 01/09/2013 | EP2542514A2 Fertilizer composition containing micronutrients and methods of making same |
| 12/2012 | |
| 12/05/2012 | CN102811979A Fertilizer composition containing micronutrients and methods of making same |
| 12/05/2012 | CN102811974A A method of producing functionally effective organically chelated micronutrients |
| 11/2012 | |
| 11/28/2012 | CN202555199U Material mixer for producing organic diammonium phosphate |
| 11/15/2012 | US20120285211 Fertilizer composition incorporating fibrous material for enhanced particle integrity |
| 08/2012 | |
| 08/22/2012 | CN202387402U Material mixer for producing organic diammonium phosphate |
| 03/2012 | |
| 03/21/2012 | EP2429674A1 Phosphate recovery from sludge |
| 03/15/2012 | WO2011154843A3 A cellulose based sustained release macronutrient composition for fertilizer application |
| 01/2012 | |
| 01/18/2012 | CN102320866A Method for preparing organic phosphorus fertilizer by using coenzyme Q10 fermentation liquor |
| 01/10/2012 | USRE43073 Formulation of phosphorus fertilizer for plants |
| 12/2011 | |
| 12/29/2011 | WO2011109202A3 Fertilizer composition containing micronutrients and methods of making same |
| 12/15/2011 | WO2011154843A2 A cellulose based sustained release macronutrient composition for fertilizer application |
| 12/15/2011 | CA2801614A1 A cellulose based sustained release macronutrient composition for fertilizer application |
| 12/13/2011 | US8075659 Preparations with improved urease-inhibiting effect and urea-containing fertilizers containing the latter |
| 08/2011 | |
| 08/04/2011 | WO2011092574A1 A method of producing functionally effective organically chelated micronutrients |
| 07/2011 | |
| 07/13/2011 | CN102124116A Method for extracting phosphorous from solids using active leaching and phosphate-accumulating microorganisms |
| 06/2011 | |
| 06/01/2011 | CN102077841A Application of sodium ribonucleotide in agriculture |
| 04/2011 | |
| 04/26/2011 | US7931728 Fertilizer granules and manufacturing process |
| 02/2011 | |
| 02/08/2011 | US7883884 anaerobic digestion of animal manures, energy crops and similar organic substrates to refine nutrients comprised in the digested biomass to fertilizers of commercial quality; processing the organic waste material of animal origin; increased hygiene and food safety; BSE |
| 12/2010 | |
| 12/21/2010 | US7855189 N-(2-nitrophenyl)phosphoric acid triamide obtained by reacting anilines or hydrochlorides with POCl3 OR PSCl3 for inhibiting urease-catalysed urea hydrolysis and combining with nitrification inhibitors pyrazole derivatives, a 1H-1,2,4-traizoles, dicyandiamide |
| 12/15/2010 | CN101913926A Concept for slurry separation and biogas production |
| 11/2010 | |
| 11/18/2010 | WO2010130589A1 Phosphate recovery from sludge |
| 11/18/2010 | CA2757308A1 Phosphate recovery from sludge |
| 11/10/2010 | CN101362655B Technology for producing carbon-rich organic phosphorus fertilizer by industrial waste |
| 07/2010 | |
| 07/29/2010 | WO2010018228A3 Method for extracting phosphorous from solids using active leaching and phosphate-accumulating microorganisms |
| 02/2010 | |
| 02/18/2010 | CA2734105A1 Method for selectively extracting phosphorus from solids |
| 02/10/2010 | CN100588659C N-phenylphosphoric acid triamides, method for the production thereof and their use as agents for regulating or inhibiting enzymatic urea hydrolysis |
| 01/2010 | |
| 01/12/2010 | CA2420064C Concept for slurry separation and biogas production |
| 10/2009 | |
| 10/15/2009 | US20090258786 Controlled release agricultural products and processes for making the same |
| 09/2009 | |
| 09/09/2009 | CN101525348A Method for industrialized production of N-alkyl substituted phosphoric triamide |
| 08/2009 | |
| 08/05/2009 | EP1771458B1 N-phenylphosphoric acid triamides, method for the production thereof and their use as agents for regulating or inhibiting enzymatic urea hydrolysis |
| 07/2009 | |
| 07/30/2009 | US20090191325 Surface active ingredient composition |
| 07/28/2009 | US7565765 Pneumatic liquid dispensing assembly for hydroponically cultivated plants |
| 04/2009 | |
| 04/16/2009 | US20090095040 Urea phosphite fertilizer |
| 04/09/2009 | DE102008050179A1 Multivalenter Stickstoff-Phosphat-Dünger (NP-Dünger) auf Basis nachwachsender Rohstoffe tierischen Ursprungs und Verfahren zu seiner Herstellung The multivalent nitrogen-phosphate fertilizer (NP fertilizer) based on renewable raw materials of animal origin and method of production |
| 04/08/2009 | EP2044186A1 Tungstate based corrosion inhibitors |
| 02/2009 | |
| 02/11/2009 | CN101362655A Technology for producing carbon-rich organic phosphorus fertilizer by industrial waste |
| 01/2009 | |
| 01/07/2009 | CN101337976A Method for producing N-alkyl substituted phosphoric triamide |
| 09/2008 | |
| 09/03/2008 | CN201109762Y Slewing steel strip condensing granulation apparatus for producing UAP and UAPK complex fertilizer |
| 07/2008 | |
| 07/22/2008 | US7402263 preventing corrosion by nitrogen fertilizer solutions in contact with ferrous metal storage tanks, pipes or surfaces, by adding a alkali metal tungstate and iron stabilizer agents comprising dispersant polymers |
| 07/09/2008 | EP1940753A2 Stabilized filler and fertilizer containing same |
| 05/2008 | |
| 05/15/2008 | WO2008057448A2 Methods of generating phosphorus fertilizers through the utilization of microbial fermentation technology |
| 05/15/2008 | CA2668519A1 Methods of generating phosphorus fertilizers through the utilization of microbial fermentation technology |
| 05/14/2008 | CN101177364A Biodegradable slow-release fertilizer with three-dimensional grid structure |
| 05/08/2008 | US20080105018 Methods of generating phosphorus fertilizers through the utilization of microbial fermentation technology |
| 03/2008 | |
| 03/20/2008 | US20080070871 N-Phenylphosphoric Acid Triamides, Method for the Production Thereof and Their Use as Agents for Regulating or Inhibiting Enzymatic Urea Hydrolysis |
| 02/2008 | |
| 02/21/2008 | US20080041130 Organo Phosphatic Fertilizer |
| 01/2008 | |
| 01/31/2008 | WO2008013534A1 Tungstate based corrosion inhibitors |
| 01/31/2008 | CA2658812A1 Tungstate based corrosion inhibitors |
| 12/2007 | |
| 12/12/2007 | CN100354237C Nourishing water-loss reducer |
| 08/2007 | |
| 08/07/2007 | US7252697 Granulating a condensed mixture of the ammonium phosphate slurry and release-controlling materials |
| 06/2007 | |
| 06/27/2007 | CN1989144A N-phenylphosphoric acid triamides, method for the production thereof and their use as agents for regulating or inhibiting enzymatic urea hydrolysis |
| 05/2007 | |
| 05/31/2007 | WO2007042173A3 Stabilized filler and fertilizer containing same |
| 04/2007 | |
| 04/19/2007 | WO2007042173A2 Stabilized filler and fertilizer containing same |
| 04/19/2007 | CA2624680A1 Stabilized filler and fertilizer containing same |
| 04/18/2007 | EP1773179A2 Automatic control for dental applications |
| 04/11/2007 | EP1772444A1 Stabilized filler and fertilizer containing same |
| 04/11/2007 | EP1771458A1 N-phenylphosphoric acid triamides, method for the production thereof and their use as agents for regulating or inhibiting enzymatic urea hydrolysis |
| 01/2007 | |
| 01/09/2007 | US7160350 Formulation of phosphorus fertilizer for plants |
| 10/2006 | |
| 10/05/2006 | DE4437313B4 Verwendung von Phospholipiden zur Verbesserung des Pflanzenwachstums Use of phospholipids for improving plant growth |
| 05/2006 | |
| 05/03/2006 | CN1765852A Nourishing water-loss reducer |
1 2