| Patents for A61P 43 - Drugs for specific purposes, not provided for in groups (156,317) |
|---|
| 03/29/2011 | US7915254 Photosensitizers for photodynamic therapy; killing tissue, cells; anticancer agents |
| 03/29/2011 | US7915237 Production of pure stereoisomers of tricyclo[5.2.1.02.6]-dec-9-yl-xanthogenate and medicaments therefrom |
| 03/29/2011 | US7915226 Methods of suppressing microglial activation |
| 03/29/2011 | US7915219 treatment of cell damage caused by ischemia or stroke by administering to a cell or a tissue an effective amount of an isozyme specific delta PKC (protein kinase C) antagonist |
| 03/29/2011 | US7914818 Prevent drug abruse; side effect reduction; administering mixture of opioid antagonist, releasable form and sequestering agent |
| 03/29/2011 | US7914768 Stabiliser for radiopharmaceuticals |
| 03/29/2011 | US7914537 Devices and methods for the restoration of a spinal disc |
| 03/29/2011 | CA2489276C Tricyclic steroid hormone nuclear receptor modulators |
| 03/29/2011 | CA2472114C 2-o-(.beta.-d-glucopyranosyl) ascorbic acid, process for its production, and foods and cosmetics containing compositons comprising it |
| 03/29/2011 | CA2469055C Aminotetralin derivatives as muscarinic receptor antagonists |
| 03/29/2011 | CA2462211C Naphthyridine derivatives, their preparation and their use as phosphodiesterase isoenzyme 4 (pde4) inhibitors |
| 03/29/2011 | CA2452845C Dye-sulfenates for dual phototherapy |
| 03/29/2011 | CA2446327C A polypeptide and dna thereof useful as a neovascular marker |
| 03/29/2011 | CA2443672C Aryl and biaryl piperidines used as mch antagonists |
| 03/29/2011 | CA2436980C Amido ether substituted imidazoquinolines |
| 03/29/2011 | CA2435146C Formulation of boronic acid compounds |
| 03/29/2011 | CA2420562C Creatine ester pronutrient compounds and formulations |
| 03/29/2011 | CA2410968C Method of treating chronic ulcers |
| 03/29/2011 | CA2397016C Use of lipid conjugates in the treatment of disease |
| 03/29/2011 | CA2390652C Human circulating virus-inhibiting peptide (virip) and its use |
| 03/29/2011 | CA2390164C Substituted 4h-chromene and analogs as activators of caspases and inducers of apoptosis and the use thereof |
| 03/29/2011 | CA2383779C N-(indolecarbonyl)piperazine derivatives |
| 03/29/2011 | CA2379508C Biphasic skin composition comprising ascorbic acid, ceramides and betaglycane |
| 03/29/2011 | CA2344974C Chimaeric proteins between members of tgf-beta superfamily |
| 03/29/2011 | CA2299139C 4-phenyl-pyridine derivatives |
| 03/29/2011 | CA2279407C Centipeda plant extract |
| 03/24/2011 | WO2011035179A1 Method of slowing the aging process by activating sirtuin enzymes with a combination of fucoxanthin and punicic acid |
| 03/24/2011 | WO2011034951A2 Assisted enzyme replacement therapy |
| 03/24/2011 | WO2011034215A1 COMPOUNDS HAVING TAFIa INHIBITORY ACTIVITY |
| 03/24/2011 | WO2011034207A1 Partial peptide of lacritin |
| 03/24/2011 | WO2011034105A1 Modified erythropoietin to which water-soluble long-chain molecule is added |
| 03/24/2011 | WO2011034078A1 Glycine compound |
| 03/24/2011 | WO2011034051A1 Novel cyclic squaramide derivatives |
| 03/24/2011 | WO2011033717A1 Goya koji composition |
| 03/24/2011 | WO2011033304A1 Improvement of tendon repair |
| 03/24/2011 | WO2010127209A3 Compositions and methods for therapy of macular degeneration |
| 03/24/2011 | US20110071285 Low-molecular serine proteases inhibitors comprising polyhydroxy-alkyl and polyhydroxy-cycloalkyl radicals |
| 03/24/2011 | US20110071144 Quinazoline derivatives and pharmaceutical compositions containing them |
| 03/24/2011 | US20110071098 Flurbiprofen and muscle relaxant gel combinations thereof |
| 03/24/2011 | US20110071090 Method of mitigating adverse drug events using omega-3-fatty acids as a parenteral therapeutic drug vehicle |
| 03/24/2011 | US20110071073 Detection of mutations in a gene associated with resistance to viral infection, OAS1 |
| 03/24/2011 | US20110070303 Novel dosage formulation |
| 03/24/2011 | US20110070302 Coated pharmaceutical or nutraceutical preparation with accelerated controlled active substance release |
| 03/24/2011 | US20110070300 Extended release dosage forms of metoprolol |
| 03/24/2011 | US20110070287 Film-Coated Compressed Chewing Gum |
| 03/24/2011 | US20110070276 Bioactive keratin peptides |
| 03/24/2011 | US20110070209 Combination growth factor therapy and cell therapy for treatment of acute and chronic diseases of the organs |
| 03/24/2011 | US20110070205 Multipotent stem cells and uses thereof |
| 03/24/2011 | US20110070201 Mucosal or enteral administration of biologically active macromolecules |
| 03/24/2011 | US20110070162 Rna interference mediating small rna molecules |
| 03/24/2011 | CA2773596A1 Modified erythropoietin to which water-soluble long-chain molecule is added |
| 03/24/2011 | CA2773125A1 Compounds having tafia inhibitory activity |
| 03/24/2011 | CA2772689A1 Glycine compound |
| 03/23/2011 | EP2298878A2 Compositions and methods for the diagnosis of cancer |
| 03/23/2011 | EP2298816A2 Apoptosis induced by an antibody against Her2 |
| 03/23/2011 | EP2298803A2 Human G-protein coupled receptor and ligands thereof |
| 03/23/2011 | EP2298789A1 Mammalian genes; related reagents and methods |
| 03/23/2011 | EP2298778A1 Imidazothiazole derivative having 4,7-diazaspiroý2.5¨octane ring structure |
| 03/23/2011 | EP2298767A1 Nitrogenated bicyclic heterocyclic compound |
| 03/23/2011 | EP2298757A2 Urea compounds active as vanilloid receptor antagonist for the treatment of pain |
| 03/23/2011 | EP2298755A1 Method of producing bicyclo[3.1.0]hexane derivative using enzyme |
| 03/23/2011 | EP2298750A1 Novel isoxazole derivative |
| 03/23/2011 | EP2298747A1 Triazole derivative or salt thereof |
| 03/23/2011 | EP2298738A1 1-aryl- or 1-alkylsulfonyl-heterocyclylbenzazoles as 5-hydroxytryptamine-6 ligands |
| 03/23/2011 | EP2298731A1 Amide compound |
| 03/23/2011 | EP2298355A2 Albumin fusion proteins |
| 03/23/2011 | EP2298354A2 Remodelling and glycoconjugation of interferon-beta |
| 03/23/2011 | EP2298348A1 Antibody binding alpha4Beta7 integrin and its use to treat inflammatory bowel disease |
| 03/23/2011 | EP2298346A2 Human antibodies specific to kdr and uses thereof |
| 03/23/2011 | EP2298332A1 BAFF, inhibitors thereof and their use in the modulation of the B-cell response |
| 03/23/2011 | EP2298325A1 Combinations comprising anti-adhesive and prebiotic carbohydrates |
| 03/23/2011 | EP2298309A1 Antitumor agent, kit and method of treating cancer |
| 03/23/2011 | EP2298306A1 A method of analgesia |
| 03/23/2011 | EP2298301A2 Medicaments for increasing endogenous Erythropoietin (EPO) |
| 03/23/2011 | EP2298293A1 Lipase inhibitor |
| 03/23/2011 | EP2298292A2 Kinase inhibitors for treating cancers |
| 03/23/2011 | EP2298291A2 Kinase inhibitors for treating cancers |
| 03/23/2011 | EP2298282A1 Combination of drugs having different physical properties into single dosage form |
| 03/23/2011 | EP2298278A1 Prevention and reduction of blood loss |
| 03/23/2011 | EP2298275A1 Composition for external use |
| 03/23/2011 | EP2297138A1 Processes for the preparation of crystalline forms of sunitinib malate |
| 03/23/2011 | EP2296706A2 Photochemical internalisation of kinase inhibitors |
| 03/23/2011 | EP2296633A2 The use of solid carrier particles to improve the processability of a pharmaceutical agent |
| 03/23/2011 | EP1469878B1 Fgfr agonists |
| 03/23/2011 | EP1448205B1 Combinations for the treatment of immunoinflammatory disorders |
| 03/23/2011 | EP1446101B1 Catheter injectable depot compositions and uses thereof |
| 03/23/2011 | EP1330444B1 Nitrogenous heterocyclic compounds and process for making them |
| 03/23/2011 | EP1278748B1 Inhibitors of human phosphatidyl-inositol 3-kinase delta |
| 03/23/2011 | EP1140836B1 Amide compounds |
| 03/23/2011 | CN1745768B Use of medicine containing Milkvetch Root against aspirin |
| 03/23/2011 | CN101987115A Jade screen oral preparation as well as preparation method and detection method thereof |
| 03/23/2011 | CN101987111A Composition of cisplatin in combination with 2,2'-dithio-bis(ethanesulfonate) (dimesna) |
| 03/23/2011 | CN101698088B Traditional Chinese medicine for treating hyperblastosis of human body |
| 03/23/2011 | CN101175751B Crystal of indole derivative having piperidine ring and process for production thereof |
| 03/23/2011 | CN101129467B Traditional Chinese medicine for treating paraplegia |
| 03/22/2011 | US7910741 Nitrogen-containing heterocyclic derivatives and drugs containing the same as the active ingredient |
| 03/22/2011 | US7910721 Nucleic acid-enzyme complex |
| 03/22/2011 | US7910709 Thyroid stimulating hormone for use in diagnosis, prevention and treatment of thyroid gland disorders |
| 03/22/2011 | US7910626 Use of S1P receptor agonists in heart diseases |
| 03/22/2011 | US7910605 Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders |